git-workflow/autogits
SHA256
19
0
Fork 8
Code Issues 43 Pull Requests 6 Projects 2 Activity

vendor: move vendored sources in-tree

Browse Source 
This should make it easier to see changes instead of just a blob
This commit is contained in:
Adam Majer
2025-08-25 19:43:16 +02:00
parent 7e055c3169
commit 082db173f3
634 changed files with 148182 additions and 20 deletions
Download Patch File Download Diff File Expand all files Collapse all files

11
vendor/github.com/redis/go-redis/v9/.gitignore generated vendored Normal file
View File

@@ -0,0 +1,11 @@
*.rdb
testdata/*
.idea/
.DS_Store
*.tar.gz
*.dic
redis8tests.sh
coverage.txt
**/coverage.txt
.vscode
tmp/*

34
vendor/github.com/redis/go-redis/v9/.golangci.yml generated vendored Normal file
View File

@@ -0,0 +1,34 @@
version: "2"
run:
timeout: 5m
tests: false
linters:
settings:
staticcheck:
checks:
- all
# Incorrect or missing package comment.
# https://staticcheck.dev/docs/checks/#ST1000
- -ST1000
# Omit embedded fields from selector expression.
# https://staticcheck.dev/docs/checks/#QF1008
- -QF1008
- -ST1003
exclusions:
generated: lax
presets:
- comments
- common-false-positives
- legacy
- std-error-handling
paths:
- third_party$
- builtin$
- examples$
formatters:
exclusions:
generated: lax
paths:
- third_party$
- builtin$
- examples$

4
vendor/github.com/redis/go-redis/v9/.prettierrc.yml generated vendored Normal file
View File

@@ -0,0 +1,4 @@
semi: false
singleQuote: true
proseWrap: always
printWidth: 100

133
vendor/github.com/redis/go-redis/v9/CHANGELOG.md generated vendored Normal file
View File

@@ -0,0 +1,133 @@
## Unreleased
### Changed
* `go-redis` won't skip span creation if the parent spans is not recording. ([#2980](https://github.com/redis/go-redis/issues/2980))
Users can use the OpenTelemetry sampler to control the sampling behavior.
For instance, you can use the `ParentBased(NeverSample())` sampler from `go.opentelemetry.io/otel/sdk/trace` to keep
a similar behavior (drop orphan spans) of `go-redis` as before.
## [9.0.5](https://github.com/redis/go-redis/compare/v9.0.4...v9.0.5) (2023-05-29)
### Features
* Add ACL LOG ([#2536](https://github.com/redis/go-redis/issues/2536)) ([31ba855](https://github.com/redis/go-redis/commit/31ba855ddebc38fbcc69a75d9d4fb769417cf602))
* add field protocol to setupClusterQueryParams ([#2600](https://github.com/redis/go-redis/issues/2600)) ([840c25c](https://github.com/redis/go-redis/commit/840c25cb6f320501886a82a5e75f47b491e46fbe))
* add protocol option ([#2598](https://github.com/redis/go-redis/issues/2598)) ([3917988](https://github.com/redis/go-redis/commit/391798880cfb915c4660f6c3ba63e0c1a459e2af))
## [9.0.4](https://github.com/redis/go-redis/compare/v9.0.3...v9.0.4) (2023-05-01)
### Bug Fixes
* reader float parser ([#2513](https://github.com/redis/go-redis/issues/2513)) ([46f2450](https://github.com/redis/go-redis/commit/46f245075e6e3a8bd8471f9ca67ea95fd675e241))
### Features
* add client info command ([#2483](https://github.com/redis/go-redis/issues/2483)) ([b8c7317](https://github.com/redis/go-redis/commit/b8c7317cc6af444603731f7017c602347c0ba61e))
* no longer verify HELLO error messages ([#2515](https://github.com/redis/go-redis/issues/2515)) ([7b4f217](https://github.com/redis/go-redis/commit/7b4f2179cb5dba3d3c6b0c6f10db52b837c912c8))
* read the structure to increase the judgment of the omitempty op… ([#2529](https://github.com/redis/go-redis/issues/2529)) ([37c057b](https://github.com/redis/go-redis/commit/37c057b8e597c5e8a0e372337f6a8ad27f6030af))
## [9.0.3](https://github.com/redis/go-redis/compare/v9.0.2...v9.0.3) (2023-04-02)
### New Features
- feat(scan): scan time.Time sets the default decoding (#2413)
- Add support for CLUSTER LINKS command (#2504)
- Add support for acl dryrun command (#2502)
- Add support for COMMAND GETKEYS & COMMAND GETKEYSANDFLAGS (#2500)
- Add support for LCS Command (#2480)
- Add support for BZMPOP (#2456)
- Adding support for ZMPOP command (#2408)
- Add support for LMPOP (#2440)
- feat: remove pool unused fields (#2438)
- Expiretime and PExpireTime (#2426)
- Implement `FUNCTION` group of commands (#2475)
- feat(zadd): add ZAddLT and ZAddGT (#2429)
- Add: Support for COMMAND LIST command (#2491)
- Add support for BLMPOP (#2442)
- feat: check pipeline.Do to prevent confusion with Exec (#2517)
- Function stats, function kill, fcall and fcall_ro (#2486)
- feat: Add support for CLUSTER SHARDS command (#2507)
- feat(cmd): support for adding byte,bit parameters to the bitpos command (#2498)
### Fixed
- fix: eval api cmd.SetFirstKeyPos (#2501)
- fix: limit the number of connections created (#2441)
- fixed #2462 v9 continue support dragonfly, it's Hello command return "NOAUTH Authentication required" error (#2479)
- Fix for internal/hscan/structmap.go:89:23: undefined: reflect.Pointer (#2458)
- fix: group lag can be null (#2448)
### Maintenance
- Updating to the latest version of redis (#2508)
- Allowing for running tests on a port other than the fixed 6380 (#2466)
- redis 7.0.8 in tests (#2450)
- docs: Update redisotel example for v9 (#2425)
- chore: update go mod, Upgrade golang.org/x/net version to 0.7.0 (#2476)
- chore: add Chinese translation (#2436)
- chore(deps): bump github.com/bsm/gomega from 1.20.0 to 1.26.0 (#2421)
- chore(deps): bump github.com/bsm/ginkgo/v2 from 2.5.0 to 2.7.0 (#2420)
- chore(deps): bump actions/setup-go from 3 to 4 (#2495)
- docs: add instructions for the HSet api (#2503)
- docs: add reading lag field comment (#2451)
- test: update go mod before testing(go mod tidy) (#2423)
- docs: fix comment typo (#2505)
- test: remove testify (#2463)
- refactor: change ListElementCmd to KeyValuesCmd. (#2443)
- fix(appendArg): appendArg case special type (#2489)
## [9.0.2](https://github.com/redis/go-redis/compare/v9.0.1...v9.0.2) (2023-02-01)
### Features
* upgrade OpenTelemetry, use the new metrics API. ([#2410](https://github.com/redis/go-redis/issues/2410)) ([e29e42c](https://github.com/redis/go-redis/commit/e29e42cde2755ab910d04185025dc43ce6f59c65))
## v9 2023-01-30
### Breaking
- Changed Pipelines to not be thread-safe any more.
### Added
- Added support for [RESP3](https://github.com/antirez/RESP3/blob/master/spec.md) protocol. It was
contributed by @monkey92t who has done the majority of work in this release.
- Added `ContextTimeoutEnabled` option that controls whether the client respects context timeouts
and deadlines. See
[Redis Timeouts](https://redis.uptrace.dev/guide/go-redis-debugging.html#timeouts) for details.
- Added `ParseClusterURL` to parse URLs into `ClusterOptions`, for example,
`redis://user:password@localhost:6789?dial_timeout=3&read_timeout=6s&addr=localhost:6790&addr=localhost:6791`.
- Added metrics instrumentation using `redisotel.IstrumentMetrics`. See
[documentation](https://redis.uptrace.dev/guide/go-redis-monitoring.html)
- Added `redis.HasErrorPrefix` to help working with errors.
### Changed
- Removed asynchronous cancellation based on the context timeout. It was racy in v8 and is
completely gone in v9.
- Reworked hook interface and added `DialHook`.
- Replaced `redisotel.NewTracingHook` with `redisotel.InstrumentTracing`. See
[example](example/otel) and
[documentation](https://redis.uptrace.dev/guide/go-redis-monitoring.html).
- Replaced `*redis.Z` with `redis.Z` since it is small enough to be passed as value without making
an allocation.
- Renamed the option `MaxConnAge` to `ConnMaxLifetime`.
- Renamed the option `IdleTimeout` to `ConnMaxIdleTime`.
- Removed connection reaper in favor of `MaxIdleConns`.
- Removed `WithContext` since `context.Context` can be passed directly as an arg.
- Removed `Pipeline.Close` since there is no real need to explicitly manage pipeline resources and
it can be safely reused via `sync.Pool` etc. `Pipeline.Discard` is still available if you want to
reset commands for some reason.
### Fixed
- Improved and fixed pipeline retries.
- As usually, added support for more commands and fixed some bugs.

118
vendor/github.com/redis/go-redis/v9/CONTRIBUTING.md generated vendored Normal file
View File

@@ -0,0 +1,118 @@
# Contributing
## Introduction
We appreciate your interest in considering contributing to go-redis.
Community contributions mean a lot to us.
## Contributions we need
You may already know how you'd like to contribute, whether it's a fix for a bug you
encountered, or a new feature your team wants to use.
If you don't know where to start, consider improving
documentation, bug triaging, and writing tutorials are all examples of
helpful contributions that mean less work for you.
## Your First Contribution
Unsure where to begin contributing? You can start by looking through
[help-wanted
issues](https://github.com/redis/go-redis/issues?q=is%3Aopen+is%3Aissue+label%3ahelp-wanted).
Never contributed to open source before? Here are a couple of friendly
tutorials:
- <http://makeapullrequest.com/>
- <http://www.firsttimersonly.com/>
## Getting Started
Here's how to get started with your code contribution:
1. Create your own fork of go-redis
2. Do the changes in your fork
3. If you need a development environment, run `make docker.start`.
> Note: this clones and builds the docker containers specified in `docker-compose.yml`, to understand more about
> the infrastructure that will be started you can check the `docker-compose.yml`. You also have the possiblity
> to specify the redis image that will be pulled with the env variable `CLIENT_LIBS_TEST_IMAGE`.
> By default the docker image that will be pulled and started is `redislabs/client-libs-test:rs-7.4.0-v2`.
> If you want to test with newer Redis version, using a newer version of `redislabs/client-libs-test` should work out of the box.
4. While developing, make sure the tests pass by running `make test` (if you have the docker containers running, `make test.ci` may be sufficient).
> Note: `make test` will try to start all containers, run the tests with `make test.ci` and then stop all containers.
5. If you like the change and think the project could use it, send a
pull request
To see what else is part of the automation, run `invoke -l`
## Testing
### Setting up Docker
To run the tests, you need to have Docker installed and running. If you are using a host OS that does not support
docker host networks out of the box (e.g. Windows, OSX), you need to set up a docker desktop and enable docker host networks.
### Running tests
Call `make test` to run all tests.
Continuous Integration uses these same wrappers to run all of these
tests against multiple versions of redis. Feel free to test your
changes against all the go versions supported, as declared by the
[build.yml](./.github/workflows/build.yml) file.
### Troubleshooting
If you get any errors when running `make test`, make sure
that you are using supported versions of Docker and go.
## How to Report a Bug
### Security Vulnerabilities
**NOTE**: If you find a security vulnerability, do NOT open an issue.
Email [Redis Open Source (<oss@redis.com>)](mailto:oss@redis.com) instead.
In order to determine whether you are dealing with a security issue, ask
yourself these two questions:
- Can I access something that's not mine, or something I shouldn't
have access to?
- Can I disable something for other people?
If the answer to either of those two questions are *yes*, then you're
probably dealing with a security issue. Note that even if you answer
*no* to both questions, you may still be dealing with a security
issue, so if you're unsure, just email [us](mailto:oss@redis.com).
### Everything Else
When filing an issue, make sure to answer these five questions:
1. What version of go-redis are you using?
2. What version of redis are you using?
3. What did you do?
4. What did you expect to see?
5. What did you see instead?
## Suggest a feature or enhancement
If you'd like to contribute a new feature, make sure you check our
issue list to see if someone has already proposed it. Work may already
be underway on the feature you want or we may have rejected a
feature like it already.
If you don't see anything, open a new issue that describes the feature
you would like and how it should work.
## Code review process
The core team regularly looks at pull requests. We will provide
feedback as soon as possible. After receiving our feedback, please respond
within two weeks. After that time, we may close your PR if it isn't
showing any activity.
## Support
Maintainers can provide limited support to contributors on discord: https://discord.gg/W4txy5AeKM

25
vendor/github.com/redis/go-redis/v9/LICENSE generated vendored Normal file
View File

@@ -0,0 +1,25 @@
Copyright (c) 2013 The github.com/redis/go-redis Authors.
All rights reserved.
Redistribution and use in source and binary forms, with or without
modification, are permitted provided that the following conditions are
met:
* Redistributions of source code must retain the above copyright
notice, this list of conditions and the following disclaimer.
* Redistributions in binary form must reproduce the above
copyright notice, this list of conditions and the following disclaimer
in the documentation and/or other materials provided with the
distribution.
THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT
OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.

67
vendor/github.com/redis/go-redis/v9/Makefile generated vendored Normal file
View File

@@ -0,0 +1,67 @@
GO_MOD_DIRS := $(shell find . -type f -name 'go.mod' -exec dirname {} \; | sort)
docker.start:
docker compose --profile all up -d --quiet-pull
docker.stop:
docker compose --profile all down
test:
$(MAKE) docker.start
@if [ -z "$(REDIS_VERSION)" ]; then \
echo "REDIS_VERSION not set, running all tests"; \
$(MAKE) test.ci; \
else \
MAJOR_VERSION=$$(echo "$(REDIS_VERSION)" | cut -d. -f1); \
if [ "$$MAJOR_VERSION" -ge 8 ]; then \
echo "REDIS_VERSION $(REDIS_VERSION) >= 8, running all tests"; \
$(MAKE) test.ci; \
else \
echo "REDIS_VERSION $(REDIS_VERSION) < 8, skipping vector_sets tests"; \
$(MAKE) test.ci.skip-vectorsets; \
fi; \
fi
$(MAKE) docker.stop
test.ci:
set -e; for dir in $(GO_MOD_DIRS); do \
echo "go test in $${dir}"; \
(cd "$${dir}" && \
go mod tidy -compat=1.18 && \
go vet && \
go test -v -coverprofile=coverage.txt -covermode=atomic ./... -race -skip Example); \
done
cd internal/customvet && go build .
go vet -vettool ./internal/customvet/customvet
test.ci.skip-vectorsets:
set -e; for dir in $(GO_MOD_DIRS); do \
echo "go test in $${dir} (skipping vector sets)"; \
(cd "$${dir}" && \
go mod tidy -compat=1.18 && \
go vet && \
go test -v -coverprofile=coverage.txt -covermode=atomic ./... -race \
-run '^(?!.*(?:VectorSet|vectorset|ExampleClient_vectorset)).*$$' -skip Example); \
done
cd internal/customvet && go build .
go vet -vettool ./internal/customvet/customvet
bench:
go test ./... -test.run=NONE -test.bench=. -test.benchmem -skip Example
.PHONY: all test test.ci test.ci.skip-vectorsets bench fmt
build:
go build .
fmt:
gofumpt -w ./
goimports -w -local github.com/redis/go-redis ./
go_mod_tidy:
set -e; for dir in $(GO_MOD_DIRS); do \
echo "go mod tidy in $${dir}"; \
(cd "$${dir}" && \
go get -u ./... && \
go mod tidy -compat=1.18); \
done

458
vendor/github.com/redis/go-redis/v9/README.md generated vendored Normal file
View File

@@ -0,0 +1,458 @@
# Redis client for Go
[![build workflow](https://github.com/redis/go-redis/actions/workflows/build.yml/badge.svg)](https://github.com/redis/go-redis/actions)
[![PkgGoDev](https://pkg.go.dev/badge/github.com/redis/go-redis/v9)](https://pkg.go.dev/github.com/redis/go-redis/v9?tab=doc)
[![Documentation](https://img.shields.io/badge/redis-documentation-informational)](https://redis.uptrace.dev/)
[![Go Report Card](https://goreportcard.com/badge/github.com/redis/go-redis/v9)](https://goreportcard.com/report/github.com/redis/go-redis/v9)
[![codecov](https://codecov.io/github/redis/go-redis/graph/badge.svg?token=tsrCZKuSSw)](https://codecov.io/github/redis/go-redis)
[![Discord](https://img.shields.io/discord/697882427875393627.svg?style=social&logo=discord)](https://discord.gg/W4txy5AeKM)
[![Twitch](https://img.shields.io/twitch/status/redisinc?style=social)](https://www.twitch.tv/redisinc)
[![YouTube](https://img.shields.io/youtube/channel/views/UCD78lHSwYqMlyetR0_P4Vig?style=social)](https://www.youtube.com/redisinc)
[![Twitter](https://img.shields.io/twitter/follow/redisinc?style=social)](https://twitter.com/redisinc)
[![Stack Exchange questions](https://img.shields.io/stackexchange/stackoverflow/t/go-redis?style=social&logo=stackoverflow&label=Stackoverflow)](https://stackoverflow.com/questions/tagged/go-redis)
> go-redis is the official Redis client library for the Go programming language. It offers a straightforward interface for interacting with Redis servers.
## Supported versions
In `go-redis` we are aiming to support the last three releases of Redis. Currently, this means we do support:
- [Redis 7.2](https://raw.githubusercontent.com/redis/redis/7.2/00-RELEASENOTES) - using Redis Stack 7.2 for modules support
- [Redis 7.4](https://raw.githubusercontent.com/redis/redis/7.4/00-RELEASENOTES) - using Redis Stack 7.4 for modules support
- [Redis 8.0](https://raw.githubusercontent.com/redis/redis/8.0/00-RELEASENOTES) - using Redis CE 8.0 where modules are included
Although the `go.mod` states it requires at minimum `go 1.18`, our CI is configured to run the tests against all three
versions of Redis and latest two versions of Go ([1.23](https://go.dev/doc/devel/release#go1.23.0),
[1.24](https://go.dev/doc/devel/release#go1.24.0)). We observe that some modules related test may not pass with
Redis Stack 7.2 and some commands are changed with Redis CE 8.0.
Please do refer to the documentation and the tests if you experience any issues. We do plan to update the go version
in the `go.mod` to `go 1.24` in one of the next releases.
## How do I Redis?
[Learn for free at Redis University](https://university.redis.com/)
[Build faster with the Redis Launchpad](https://launchpad.redis.com/)
[Try the Redis Cloud](https://redis.com/try-free/)
[Dive in developer tutorials](https://developer.redis.com/)
[Join the Redis community](https://redis.com/community/)
[Work at Redis](https://redis.com/company/careers/jobs/)
## Documentation
- [English](https://redis.uptrace.dev)
- [简体中文](https://redis.uptrace.dev/zh/)
## Resources
- [Discussions](https://github.com/redis/go-redis/discussions)
- [Chat](https://discord.gg/W4txy5AeKM)
- [Reference](https://pkg.go.dev/github.com/redis/go-redis/v9)
- [Examples](https://pkg.go.dev/github.com/redis/go-redis/v9#pkg-examples)
## Ecosystem
- [Redis Mock](https://github.com/go-redis/redismock)
- [Distributed Locks](https://github.com/bsm/redislock)
- [Redis Cache](https://github.com/go-redis/cache)
- [Rate limiting](https://github.com/go-redis/redis_rate)
This client also works with [Kvrocks](https://github.com/apache/incubator-kvrocks), a distributed
key value NoSQL database that uses RocksDB as storage engine and is compatible with Redis protocol.
## Features
- Redis commands except QUIT and SYNC.
- Automatic connection pooling.
- [StreamingCredentialsProvider (e.g. entra id, oauth)](#1-streaming-credentials-provider-highest-priority) (experimental)
- [Pub/Sub](https://redis.uptrace.dev/guide/go-redis-pubsub.html).
- [Pipelines and transactions](https://redis.uptrace.dev/guide/go-redis-pipelines.html).
- [Scripting](https://redis.uptrace.dev/guide/lua-scripting.html).
- [Redis Sentinel](https://redis.uptrace.dev/guide/go-redis-sentinel.html).
- [Redis Cluster](https://redis.uptrace.dev/guide/go-redis-cluster.html).
- [Redis Ring](https://redis.uptrace.dev/guide/ring.html).
- [Redis Performance Monitoring](https://redis.uptrace.dev/guide/redis-performance-monitoring.html).
- [Redis Probabilistic [RedisStack]](https://redis.io/docs/data-types/probabilistic/)
## Installation
go-redis supports 2 last Go versions and requires a Go version with
[modules](https://github.com/golang/go/wiki/Modules) support. So make sure to initialize a Go
module:
```shell
go mod init github.com/my/repo
```
Then install go-redis/**v9**:
```shell
go get github.com/redis/go-redis/v9
```
## Quickstart
```go
import (
"context"
"fmt"
"github.com/redis/go-redis/v9"
)
var ctx = context.Background()
func ExampleClient() {
rdb := redis.NewClient(&redis.Options{
Addr: "localhost:6379",
Password: "", // no password set
DB: 0, // use default DB
})
err := rdb.Set(ctx, "key", "value", 0).Err()
if err != nil {
panic(err)
}
val, err := rdb.Get(ctx, "key").Result()
if err != nil {
panic(err)
}
fmt.Println("key", val)
val2, err := rdb.Get(ctx, "key2").Result()
if err == redis.Nil {
fmt.Println("key2 does not exist")
} else if err != nil {
panic(err)
} else {
fmt.Println("key2", val2)
}
// Output: key value
// key2 does not exist
}
```
### Authentication
The Redis client supports multiple ways to provide authentication credentials, with a clear priority order. Here are the available options:
#### 1. Streaming Credentials Provider (Highest Priority) - Experimental feature
The streaming credentials provider allows for dynamic credential updates during the connection lifetime. This is particularly useful for managed identity services and token-based authentication.
```go
type StreamingCredentialsProvider interface {
Subscribe(listener CredentialsListener) (Credentials, UnsubscribeFunc, error)
}
type CredentialsListener interface {
OnNext(credentials Credentials) // Called when credentials are updated
OnError(err error) // Called when an error occurs
}
type Credentials interface {
BasicAuth() (username string, password string)
RawCredentials() string
}
```
Example usage:
```go
rdb := redis.NewClient(&redis.Options{
Addr: "localhost:6379",
StreamingCredentialsProvider: &MyCredentialsProvider{},
})
```
**Note:** The streaming credentials provider can be used with [go-redis-entraid](https://github.com/redis/go-redis-entraid) to enable Entra ID (formerly Azure AD) authentication. This allows for seamless integration with Azure's managed identity services and token-based authentication.
Example with Entra ID:
```go
import (
"github.com/redis/go-redis/v9"
"github.com/redis/go-redis-entraid"
)
// Create an Entra ID credentials provider
provider := entraid.NewDefaultAzureIdentityProvider()
// Configure Redis client with Entra ID authentication
rdb := redis.NewClient(&redis.Options{
Addr: "your-redis-server.redis.cache.windows.net:6380",
StreamingCredentialsProvider: provider,
TLSConfig: &tls.Config{
MinVersion: tls.VersionTLS12,
},
})
```
#### 2. Context-based Credentials Provider
The context-based provider allows credentials to be determined at the time of each operation, using the context.
```go
rdb := redis.NewClient(&redis.Options{
Addr: "localhost:6379",
CredentialsProviderContext: func(ctx context.Context) (string, string, error) {
// Return username, password, and any error
return "user", "pass", nil
},
})
```
#### 3. Regular Credentials Provider
A simple function-based provider that returns static credentials.
```go
rdb := redis.NewClient(&redis.Options{
Addr: "localhost:6379",
CredentialsProvider: func() (string, string) {
// Return username and password
return "user", "pass"
},
})
```
#### 4. Username/Password Fields (Lowest Priority)
The most basic way to provide credentials is through the `Username` and `Password` fields in the options.
```go
rdb := redis.NewClient(&redis.Options{
Addr: "localhost:6379",
Username: "user",
Password: "pass",
})
```
#### Priority Order
The client will use credentials in the following priority order:
1. Streaming Credentials Provider (if set)
2. Context-based Credentials Provider (if set)
3. Regular Credentials Provider (if set)
4. Username/Password fields (if set)
If none of these are set, the client will attempt to connect without authentication.
### Protocol Version
The client supports both RESP2 and RESP3 protocols. You can specify the protocol version in the options:
```go
rdb := redis.NewClient(&redis.Options{
Addr: "localhost:6379",
Password: "", // no password set
DB: 0, // use default DB
Protocol: 3, // specify 2 for RESP 2 or 3 for RESP 3
})
```
### Connecting via a redis url
go-redis also supports connecting via the
[redis uri specification](https://github.com/redis/redis-specifications/tree/master/uri/redis.txt).
The example below demonstrates how the connection can easily be configured using a string, adhering
to this specification.
```go
import (
"github.com/redis/go-redis/v9"
)
func ExampleClient() *redis.Client {
url := "redis://user:password@localhost:6379/0?protocol=3"
opts, err := redis.ParseURL(url)
if err != nil {
panic(err)
}
return redis.NewClient(opts)
}
```
### Instrument with OpenTelemetry
```go
import (
"github.com/redis/go-redis/v9"
"github.com/redis/go-redis/extra/redisotel/v9"
"errors"
)
func main() {
...
rdb := redis.NewClient(&redis.Options{...})
if err := errors.Join(redisotel.InstrumentTracing(rdb), redisotel.InstrumentMetrics(rdb)); err != nil {
log.Fatal(err)
}
```
### Advanced Configuration
go-redis supports extending the client identification phase to allow projects to send their own custom client identification.
#### Default Client Identification
By default, go-redis automatically sends the client library name and version during the connection process. This feature is available in redis-server as of version 7.2. As a result, the command is "fire and forget", meaning it should fail silently, in the case that the redis server does not support this feature.
#### Disabling Identity Verification
When connection identity verification is not required or needs to be explicitly disabled, a `DisableIdentity` configuration option exists.
Initially there was a typo and the option was named `DisableIndentity` instead of `DisableIdentity`. The misspelled option is marked as Deprecated and will be removed in V10 of this library.
Although both options will work at the moment, the correct option is `DisableIdentity`. The deprecated option will be removed in V10 of this library, so please use the correct option name to avoid any issues.
To disable verification, set the `DisableIdentity` option to `true` in the Redis client options:
```go
rdb := redis.NewClient(&redis.Options{
Addr: "localhost:6379",
Password: "",
DB: 0,
DisableIdentity: true, // Disable set-info on connect
})
```
#### Unstable RESP3 Structures for RediSearch Commands
When integrating Redis with application functionalities using RESP3, it's important to note that some response structures aren't final yet. This is especially true for more complex structures like search and query results. We recommend using RESP2 when using the search and query capabilities, but we plan to stabilize the RESP3-based API-s in the coming versions. You can find more guidance in the upcoming release notes.
To enable unstable RESP3, set the option in your client configuration:
```go
redis.NewClient(&redis.Options{
UnstableResp3: true,
})
```
**Note:** When UnstableResp3 mode is enabled, it's necessary to use RawResult() and RawVal() to retrieve a raw data.
Since, raw response is the only option for unstable search commands Val() and Result() calls wouldn't have any affect on them:
```go
res1, err := client.FTSearchWithArgs(ctx, "txt", "foo bar", &redis.FTSearchOptions{}).RawResult()
val1 := client.FTSearchWithArgs(ctx, "txt", "foo bar", &redis.FTSearchOptions{}).RawVal()
```
#### Redis-Search Default Dialect
In the Redis-Search module, **the default dialect is 2**. If needed, you can explicitly specify a different dialect using the appropriate configuration in your queries.
**Important**: Be aware that the query dialect may impact the results returned. If needed, you can revert to a different dialect version by passing the desired dialect in the arguments of the command you want to execute.
For example:
```
res2, err := rdb.FTSearchWithArgs(ctx,
"idx:bicycle",
"@pickup_zone:[CONTAINS $bike]",
&redis.FTSearchOptions{
Params: map[string]interface{}{
"bike": "POINT(-0.1278 51.5074)",
},
DialectVersion: 3,
},
).Result()
```
You can find further details in the [query dialect documentation](https://redis.io/docs/latest/develop/interact/search-and-query/advanced-concepts/dialects/).
## Contributing
We welcome contributions to the go-redis library! If you have a bug fix, feature request, or improvement, please open an issue or pull request on GitHub.
We appreciate your help in making go-redis better for everyone.
If you are interested in contributing to the go-redis library, please check out our [contributing guidelines](CONTRIBUTING.md) for more information on how to get started.
## Look and feel
Some corner cases:
```go
// SET key value EX 10 NX
set, err := rdb.SetNX(ctx, "key", "value", 10*time.Second).Result()
// SET key value keepttl NX
set, err := rdb.SetNX(ctx, "key", "value", redis.KeepTTL).Result()
// SORT list LIMIT 0 2 ASC
vals, err := rdb.Sort(ctx, "list", &redis.Sort{Offset: 0, Count: 2, Order: "ASC"}).Result()
// ZRANGEBYSCORE zset -inf +inf WITHSCORES LIMIT 0 2
vals, err := rdb.ZRangeByScoreWithScores(ctx, "zset", &redis.ZRangeBy{
Min: "-inf",
Max: "+inf",
Offset: 0,
Count: 2,
}).Result()
// ZINTERSTORE out 2 zset1 zset2 WEIGHTS 2 3 AGGREGATE SUM
vals, err := rdb.ZInterStore(ctx, "out", &redis.ZStore{
Keys: []string{"zset1", "zset2"},
Weights: []int64{2, 3}
}).Result()
// EVAL "return {KEYS[1],ARGV[1]}" 1 "key" "hello"
vals, err := rdb.Eval(ctx, "return {KEYS[1],ARGV[1]}", []string{"key"}, "hello").Result()
// custom command
res, err := rdb.Do(ctx, "set", "key", "value").Result()
```
## Run the test
go-redis will start a redis-server and run the test cases.
The paths of redis-server bin file and redis config file are defined in `main_test.go`:
```go
var (
redisServerBin, _ = filepath.Abs(filepath.Join("testdata", "redis", "src", "redis-server"))
redisServerConf, _ = filepath.Abs(filepath.Join("testdata", "redis", "redis.conf"))
)
```
For local testing, you can change the variables to refer to your local files, or create a soft link
to the corresponding folder for redis-server and copy the config file to `testdata/redis/`:
```shell
ln -s /usr/bin/redis-server ./go-redis/testdata/redis/src
cp ./go-redis/testdata/redis.conf ./go-redis/testdata/redis/
```
Lastly, run:
```shell
go test
```
Another option is to run your specific tests with an already running redis. The example below, tests
against a redis running on port 9999.:
```shell
REDIS_PORT=9999 go test <your options>
```
## See also
- [Golang ORM](https://bun.uptrace.dev) for PostgreSQL, MySQL, MSSQL, and SQLite
- [Golang PostgreSQL](https://bun.uptrace.dev/postgres/)
- [Golang HTTP router](https://bunrouter.uptrace.dev/)
- [Golang ClickHouse ORM](https://github.com/uptrace/go-clickhouse)
## Contributors
> The go-redis project was originally initiated by :star: [**uptrace/uptrace**](https://github.com/uptrace/uptrace).
> Uptrace is an open-source APM tool that supports distributed tracing, metrics, and logs. You can
> use it to monitor applications and set up automatic alerts to receive notifications via email,
> Slack, Telegram, and others.
>
> See [OpenTelemetry](https://github.com/redis/go-redis/tree/master/example/otel) example which
> demonstrates how you can use Uptrace to monitor go-redis.
Thanks to all the people who already contributed!
<a href="https://github.com/redis/go-redis/graphs/contributors">
<img src="https://contributors-img.web.app/image?repo=redis/go-redis" />
</a>

201
vendor/github.com/redis/go-redis/v9/RELEASE-NOTES.md generated vendored Normal file
View File

@@ -0,0 +1,201 @@
# Release Notes
# 9.11.0 (2025-06-24)
## 🚀 Highlights
Fixes TxPipeline to work correctly in cluster scenarios, allowing execution of commands
only in the same slot.
# Changes
## 🚀 New Features
- Set cluster slot for `scan` commands, rather than random ([#2623](https://github.com/redis/go-redis/pull/2623))
- Add CredentialsProvider field to UniversalOptions ([#2927](https://github.com/redis/go-redis/pull/2927))
- feat(redisotel): add WithCallerEnabled option ([#3415](https://github.com/redis/go-redis/pull/3415))
## 🐛 Bug Fixes
- fix(txpipeline): keyless commands should take the slot of the keyed ([#3411](https://github.com/redis/go-redis/pull/3411))
- fix(loading): cache the loaded flag for slave nodes ([#3410](https://github.com/redis/go-redis/pull/3410))
- fix(txpipeline): should return error on multi/exec on multiple slots ([#3408](https://github.com/redis/go-redis/pull/3408))
- fix: check if the shard exists to avoid returning nil ([#3396](https://github.com/redis/go-redis/pull/3396))
## 🧰 Maintenance
- feat: optimize connection pool waitTurn ([#3412](https://github.com/redis/go-redis/pull/3412))
- chore(ci): update CI redis builds ([#3407](https://github.com/redis/go-redis/pull/3407))
- chore: remove a redundant method from `Ring`, `Client` and `ClusterClient` ([#3401](https://github.com/redis/go-redis/pull/3401))
- test: refactor TestBasicCredentials using table-driven tests ([#3406](https://github.com/redis/go-redis/pull/3406))
- perf: reduce unnecessary memory allocation operations ([#3399](https://github.com/redis/go-redis/pull/3399))
- fix: insert entry during iterating over a map ([#3398](https://github.com/redis/go-redis/pull/3398))
- DOC-5229 probabilistic data type examples ([#3413](https://github.com/redis/go-redis/pull/3413))
- chore(deps): bump rojopolis/spellcheck-github-actions from 0.49.0 to 0.51.0 ([#3414](https://github.com/redis/go-redis/pull/3414))
## Contributors
We'd like to thank all the contributors who worked on this release!
[@andy-stark-redis](https://github.com/andy-stark-redis), [@boekkooi-impossiblecloud](https://github.com/boekkooi-impossiblecloud), [@cxljs](https://github.com/cxljs), [@dcherubini](https://github.com/dcherubini), [@dependabot[bot]](https://github.com/apps/dependabot), [@iamamirsalehi](https://github.com/iamamirsalehi), [@ndyakov](https://github.com/ndyakov), [@pete-woods](https://github.com/pete-woods), [@twz915](https://github.com/twz915) and [dependabot[bot]](https://github.com/apps/dependabot)
# 9.10.0 (2025-06-06)
## 🚀 Highlights
`go-redis` now supports [vector sets](https://redis.io/docs/latest/develop/data-types/vector-sets/). This data type is marked
as "in preview" in Redis and its support in `go-redis` is marked as experimental. You can find examples in the documentation and
in the `doctests` folder.
# Changes
## 🚀 New Features
- feat: support vectorset ([#3375](https://github.com/redis/go-redis/pull/3375))
## 🧰 Maintenance
- Add the missing NewFloatSliceResult for testing ([#3393](https://github.com/redis/go-redis/pull/3393))
- DOC-5078 vector set examples ([#3394](https://github.com/redis/go-redis/pull/3394))
## Contributors
We'd like to thank all the contributors who worked on this release!
[@AndBobsYourUncle](https://github.com/AndBobsYourUncle), [@andy-stark-redis](https://github.com/andy-stark-redis), [@fukua95](https://github.com/fukua95) and [@ndyakov](https://github.com/ndyakov)
# 9.9.0 (2025-05-27)
## 🚀 Highlights
- **Token-based Authentication**: Added `StreamingCredentialsProvider` for dynamic credential updates (experimental)
- Can be used with [go-redis-entraid](https://github.com/redis/go-redis-entraid) for Azure AD authentication
- **Connection Statistics**: Added connection waiting statistics for better monitoring
- **Failover Improvements**: Added `ParseFailoverURL` for easier failover configuration
- **Ring Client Enhancements**: Added shard access methods for better Pub/Sub management
## ✨ New Features
- Added `StreamingCredentialsProvider` for token-based authentication ([#3320](https://github.com/redis/go-redis/pull/3320))
- Supports dynamic credential updates
- Includes connection close hooks
- Note: Currently marked as experimental
- Added `ParseFailoverURL` for parsing failover URLs ([#3362](https://github.com/redis/go-redis/pull/3362))
- Added connection waiting statistics ([#2804](https://github.com/redis/go-redis/pull/2804))
- Added new utility functions:
- `ParseFloat` and `MustParseFloat` in public utils package ([#3371](https://github.com/redis/go-redis/pull/3371))
- Unit tests for `Atoi`, `ParseInt`, `ParseUint`, and `ParseFloat` ([#3377](https://github.com/redis/go-redis/pull/3377))
- Added Ring client shard access methods:
- `GetShardClients()` to retrieve all active shard clients
- `GetShardClientForKey(key string)` to get the shard client for a specific key ([#3388](https://github.com/redis/go-redis/pull/3388))
## 🐛 Bug Fixes
- Fixed routing reads to loading slave nodes ([#3370](https://github.com/redis/go-redis/pull/3370))
- Added support for nil lag in XINFO GROUPS ([#3369](https://github.com/redis/go-redis/pull/3369))
- Fixed pool acquisition timeout issues ([#3381](https://github.com/redis/go-redis/pull/3381))
- Optimized unnecessary copy operations ([#3376](https://github.com/redis/go-redis/pull/3376))
## 📚 Documentation
- Updated documentation for XINFO GROUPS with nil lag support ([#3369](https://github.com/redis/go-redis/pull/3369))
- Added package-level comments for new features
## ⚡ Performance and Reliability
- Optimized `ReplaceSpaces` function ([#3383](https://github.com/redis/go-redis/pull/3383))
- Set default value for `Options.Protocol` in `init()` ([#3387](https://github.com/redis/go-redis/pull/3387))
- Exported pool errors for public consumption ([#3380](https://github.com/redis/go-redis/pull/3380))
## 🔧 Dependencies and Infrastructure
- Updated Redis CI to version 8.0.1 ([#3372](https://github.com/redis/go-redis/pull/3372))
- Updated spellcheck GitHub Actions ([#3389](https://github.com/redis/go-redis/pull/3389))
- Removed unused parameters ([#3382](https://github.com/redis/go-redis/pull/3382), [#3384](https://github.com/redis/go-redis/pull/3384))
## 🧪 Testing
- Added unit tests for pool acquisition timeout ([#3381](https://github.com/redis/go-redis/pull/3381))
- Added unit tests for utility functions ([#3377](https://github.com/redis/go-redis/pull/3377))
## 👥 Contributors
We would like to thank all the contributors who made this release possible:
[@ndyakov](https://github.com/ndyakov), [@ofekshenawa](https://github.com/ofekshenawa), [@LINKIWI](https://github.com/LINKIWI), [@iamamirsalehi](https://github.com/iamamirsalehi), [@fukua95](https://github.com/fukua95), [@lzakharov](https://github.com/lzakharov), [@DengY11](https://github.com/DengY11)
## 📝 Changelog
For a complete list of changes, see the [full changelog](https://github.com/redis/go-redis/compare/v9.8.0...v9.9.0).
# 9.8.0 (2025-04-30)
## 🚀 Highlights
- **Redis 8 Support**: Full compatibility with Redis 8.0, including testing and CI integration
- **Enhanced Hash Operations**: Added support for new hash commands (`HGETDEL`, `HGETEX`, `HSETEX`) and `HSTRLEN` command
- **Search Improvements**: Enabled Search DIALECT 2 by default and added `CountOnly` argument for `FT.Search`
## ✨ New Features
- Added support for new hash commands: `HGETDEL`, `HGETEX`, `HSETEX` ([#3305](https://github.com/redis/go-redis/pull/3305))
- Added `HSTRLEN` command for hash operations ([#2843](https://github.com/redis/go-redis/pull/2843))
- Added `Do` method for raw query by single connection from `pool.Conn()` ([#3182](https://github.com/redis/go-redis/pull/3182))
- Prevent false-positive marshaling by treating zero time.Time as empty in isEmptyValue ([#3273](https://github.com/redis/go-redis/pull/3273))
- Added FailoverClusterClient support for Universal client ([#2794](https://github.com/redis/go-redis/pull/2794))
- Added support for cluster mode with `IsClusterMode` config parameter ([#3255](https://github.com/redis/go-redis/pull/3255))
- Added client name support in `HELLO` RESP handshake ([#3294](https://github.com/redis/go-redis/pull/3294))
- **Enabled Search DIALECT 2 by default** ([#3213](https://github.com/redis/go-redis/pull/3213))
- Added read-only option for failover configurations ([#3281](https://github.com/redis/go-redis/pull/3281))
- Added `CountOnly` argument for `FT.Search` to use `LIMIT 0 0` ([#3338](https://github.com/redis/go-redis/pull/3338))
- Added `DB` option support in `NewFailoverClusterClient` ([#3342](https://github.com/redis/go-redis/pull/3342))
- Added `nil` check for the options when creating a client ([#3363](https://github.com/redis/go-redis/pull/3363))
## 🐛 Bug Fixes
- Fixed `PubSub` concurrency safety issues ([#3360](https://github.com/redis/go-redis/pull/3360))
- Fixed panic caused when argument is `nil` ([#3353](https://github.com/redis/go-redis/pull/3353))
- Improved error handling when fetching master node from sentinels ([#3349](https://github.com/redis/go-redis/pull/3349))
- Fixed connection pool timeout issues and increased retries ([#3298](https://github.com/redis/go-redis/pull/3298))
- Fixed context cancellation error leading to connection spikes on Primary instances ([#3190](https://github.com/redis/go-redis/pull/3190))
- Fixed RedisCluster client to consider `MASTERDOWN` a retriable error ([#3164](https://github.com/redis/go-redis/pull/3164))
- Fixed tracing to show complete commands instead of truncated versions ([#3290](https://github.com/redis/go-redis/pull/3290))
- Fixed OpenTelemetry instrumentation to prevent multiple span reporting ([#3168](https://github.com/redis/go-redis/pull/3168))
- Fixed `FT.Search` Limit argument and added `CountOnly` argument for limit 0 0 ([#3338](https://github.com/redis/go-redis/pull/3338))
- Fixed missing command in interface ([#3344](https://github.com/redis/go-redis/pull/3344))
- Fixed slot calculation for `COUNTKEYSINSLOT` command ([#3327](https://github.com/redis/go-redis/pull/3327))
- Updated PubSub implementation with correct context ([#3329](https://github.com/redis/go-redis/pull/3329))
## 📚 Documentation
- Added hash search examples ([#3357](https://github.com/redis/go-redis/pull/3357))
- Fixed documentation comments ([#3351](https://github.com/redis/go-redis/pull/3351))
- Added `CountOnly` search example ([#3345](https://github.com/redis/go-redis/pull/3345))
- Added examples for list commands: `LLEN`, `LPOP`, `LPUSH`, `LRANGE`, `RPOP`, `RPUSH` ([#3234](https://github.com/redis/go-redis/pull/3234))
- Added `SADD` and `SMEMBERS` command examples ([#3242](https://github.com/redis/go-redis/pull/3242))
- Updated `README.md` to use Redis Discord guild ([#3331](https://github.com/redis/go-redis/pull/3331))
- Updated `HExpire` command documentation ([#3355](https://github.com/redis/go-redis/pull/3355))
- Featured OpenTelemetry instrumentation more prominently ([#3316](https://github.com/redis/go-redis/pull/3316))
- Updated `README.md` with additional information ([#310ce55](https://github.com/redis/go-redis/commit/310ce55))
## ⚡ Performance and Reliability
- Bound connection pool background dials to configured dial timeout ([#3089](https://github.com/redis/go-redis/pull/3089))
- Ensured context isn't exhausted via concurrent query ([#3334](https://github.com/redis/go-redis/pull/3334))
## 🔧 Dependencies and Infrastructure
- Updated testing image to Redis 8.0-RC2 ([#3361](https://github.com/redis/go-redis/pull/3361))
- Enabled CI for Redis CE 8.0 ([#3274](https://github.com/redis/go-redis/pull/3274))
- Updated various dependencies:
- Bumped golangci/golangci-lint-action from 6.5.0 to 7.0.0 ([#3354](https://github.com/redis/go-redis/pull/3354))
- Bumped rojopolis/spellcheck-github-actions ([#3336](https://github.com/redis/go-redis/pull/3336))
- Bumped golang.org/x/net in example/otel ([#3308](https://github.com/redis/go-redis/pull/3308))
- Migrated golangci-lint configuration to v2 format ([#3354](https://github.com/redis/go-redis/pull/3354))
## ⚠️ Breaking Changes
- **Enabled Search DIALECT 2 by default** ([#3213](https://github.com/redis/go-redis/pull/3213))
- Dropped RedisGears (Triggers and Functions) support ([#3321](https://github.com/redis/go-redis/pull/3321))
- Dropped FT.PROFILE command that was never enabled ([#3323](https://github.com/redis/go-redis/pull/3323))
## 🔒 Security
- Fixed network error handling on SETINFO (CVE-2025-29923) ([#3295](https://github.com/redis/go-redis/pull/3295))
## 🧪 Testing
- Added integration tests for Redis 8 behavior changes in Redis Search ([#3337](https://github.com/redis/go-redis/pull/3337))
- Added vector types INT8 and UINT8 tests ([#3299](https://github.com/redis/go-redis/pull/3299))
- Added test codes for search_commands.go ([#3285](https://github.com/redis/go-redis/pull/3285))
- Fixed example test sorting ([#3292](https://github.com/redis/go-redis/pull/3292))
## 👥 Contributors
We would like to thank all the contributors who made this release possible:
[@alexander-menshchikov](https://github.com/alexander-menshchikov), [@EXPEbdodla](https://github.com/EXPEbdodla), [@afti](https://github.com/afti), [@dmaier-redislabs](https://github.com/dmaier-redislabs), [@four_leaf_clover](https://github.com/four_leaf_clover), [@alohaglenn](https://github.com/alohaglenn), [@gh73962](https://github.com/gh73962), [@justinmir](https://github.com/justinmir), [@LINKIWI](https://github.com/LINKIWI), [@liushuangbill](https://github.com/liushuangbill), [@golang88](https://github.com/golang88), [@gnpaone](https://github.com/gnpaone), [@ndyakov](https://github.com/ndyakov), [@nikolaydubina](https://github.com/nikolaydubina), [@oleglacto](https://github.com/oleglacto), [@andy-stark-redis](https://github.com/andy-stark-redis), [@rodneyosodo](https://github.com/rodneyosodo), [@dependabot](https://github.com/dependabot), [@rfyiamcool](https://github.com/rfyiamcool), [@frankxjkuang](https://github.com/frankxjkuang), [@fukua95](https://github.com/fukua95), [@soleymani-milad](https://github.com/soleymani-milad), [@ofekshenawa](https://github.com/ofekshenawa), [@khasanovbi](https://github.com/khasanovbi)

15
vendor/github.com/redis/go-redis/v9/RELEASING.md generated vendored Normal file
View File

@@ -0,0 +1,15 @@
# Releasing
1. Run `release.sh` script which updates versions in go.mod files and pushes a new branch to GitHub:
```shell
TAG=v1.0.0 ./scripts/release.sh
```
2. Open a pull request and wait for the build to finish.
3. Merge the pull request and run `tag.sh` to create tags for packages:
```shell
TAG=v1.0.0 ./scripts/tag.sh
```

89
vendor/github.com/redis/go-redis/v9/acl_commands.go generated vendored Normal file
View File

@@ -0,0 +1,89 @@
package redis
import "context"
type ACLCmdable interface {
ACLDryRun(ctx context.Context, username string, command ...interface{}) *StringCmd
ACLLog(ctx context.Context, count int64) *ACLLogCmd
ACLLogReset(ctx context.Context) *StatusCmd
ACLSetUser(ctx context.Context, username string, rules ...string) *StatusCmd
ACLDelUser(ctx context.Context, username string) *IntCmd
ACLList(ctx context.Context) *StringSliceCmd
ACLCat(ctx context.Context) *StringSliceCmd
ACLCatArgs(ctx context.Context, options *ACLCatArgs) *StringSliceCmd
}
type ACLCatArgs struct {
Category string
}
func (c cmdable) ACLDryRun(ctx context.Context, username string, command ...interface{}) *StringCmd {
args := make([]interface{}, 0, 3+len(command))
args = append(args, "acl", "dryrun", username)
args = append(args, command...)
cmd := NewStringCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ACLLog(ctx context.Context, count int64) *ACLLogCmd {
args := make([]interface{}, 0, 3)
args = append(args, "acl", "log")
if count > 0 {
args = append(args, count)
}
cmd := NewACLLogCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ACLLogReset(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "acl", "log", "reset")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ACLDelUser(ctx context.Context, username string) *IntCmd {
cmd := NewIntCmd(ctx, "acl", "deluser", username)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ACLSetUser(ctx context.Context, username string, rules ...string) *StatusCmd {
args := make([]interface{}, 3+len(rules))
args[0] = "acl"
args[1] = "setuser"
args[2] = username
for i, rule := range rules {
args[i+3] = rule
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ACLList(ctx context.Context) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "acl", "list")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ACLCat(ctx context.Context) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "acl", "cat")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ACLCatArgs(ctx context.Context, options *ACLCatArgs) *StringSliceCmd {
// if there is a category passed, build new cmd, if there isn't - use the ACLCat method
if options != nil && options.Category != "" {
cmd := NewStringSliceCmd(ctx, "acl", "cat", options.Category)
_ = c(ctx, cmd)
return cmd
}
return c.ACLCat(ctx)
}

61
vendor/github.com/redis/go-redis/v9/auth/auth.go generated vendored Normal file
View File

@@ -0,0 +1,61 @@
// Package auth package provides authentication-related interfaces and types.
// It also includes a basic implementation of credentials using username and password.
package auth
// StreamingCredentialsProvider is an interface that defines the methods for a streaming credentials provider.
// It is used to provide credentials for authentication.
// The CredentialsListener is used to receive updates when the credentials change.
type StreamingCredentialsProvider interface {
// Subscribe subscribes to the credentials provider for updates.
// It returns the current credentials, a cancel function to unsubscribe from the provider,
// and an error if any.
// TODO(ndyakov): Should we add context to the Subscribe method?
Subscribe(listener CredentialsListener) (Credentials, UnsubscribeFunc, error)
}
// UnsubscribeFunc is a function that is used to cancel the subscription to the credentials provider.
// It is used to unsubscribe from the provider when the credentials are no longer needed.
type UnsubscribeFunc func() error
// CredentialsListener is an interface that defines the methods for a credentials listener.
// It is used to receive updates when the credentials change.
// The OnNext method is called when the credentials change.
// The OnError method is called when an error occurs while requesting the credentials.
type CredentialsListener interface {
OnNext(credentials Credentials)
OnError(err error)
}
// Credentials is an interface that defines the methods for credentials.
// It is used to provide the credentials for authentication.
type Credentials interface {
// BasicAuth returns the username and password for basic authentication.
BasicAuth() (username string, password string)
// RawCredentials returns the raw credentials as a string.
// This can be used to extract the username and password from the raw credentials or
// additional information if present in the token.
RawCredentials() string
}
type basicAuth struct {
username string
password string
}
// RawCredentials returns the raw credentials as a string.
func (b *basicAuth) RawCredentials() string {
return b.username + ":" + b.password
}
// BasicAuth returns the username and password for basic authentication.
func (b *basicAuth) BasicAuth() (username string, password string) {
return b.username, b.password
}
// NewBasicCredentials creates a new Credentials object from the given username and password.
func NewBasicCredentials(username, password string) Credentials {
return &basicAuth{
username: username,
password: password,
}
}

47
vendor/github.com/redis/go-redis/v9/auth/reauth_credentials_listener.go generated vendored Normal file
View File

@@ -0,0 +1,47 @@
package auth
// ReAuthCredentialsListener is a struct that implements the CredentialsListener interface.
// It is used to re-authenticate the credentials when they are updated.
// It contains:
// - reAuth: a function that takes the new credentials and returns an error if any.
// - onErr: a function that takes an error and handles it.
type ReAuthCredentialsListener struct {
reAuth func(credentials Credentials) error
onErr func(err error)
}
// OnNext is called when the credentials are updated.
// It calls the reAuth function with the new credentials.
// If the reAuth function returns an error, it calls the onErr function with the error.
func (c *ReAuthCredentialsListener) OnNext(credentials Credentials) {
if c.reAuth == nil {
return
}
err := c.reAuth(credentials)
if err != nil {
c.OnError(err)
}
}
// OnError is called when an error occurs.
// It can be called from both the credentials provider and the reAuth function.
func (c *ReAuthCredentialsListener) OnError(err error) {
if c.onErr == nil {
return
}
c.onErr(err)
}
// NewReAuthCredentialsListener creates a new ReAuthCredentialsListener.
// Implements the auth.CredentialsListener interface.
func NewReAuthCredentialsListener(reAuth func(credentials Credentials) error, onErr func(err error)) *ReAuthCredentialsListener {
return &ReAuthCredentialsListener{
reAuth: reAuth,
onErr: onErr,
}
}
// Ensure ReAuthCredentialsListener implements the CredentialsListener interface.
var _ CredentialsListener = (*ReAuthCredentialsListener)(nil)

161
vendor/github.com/redis/go-redis/v9/bitmap_commands.go generated vendored Normal file
View File

@@ -0,0 +1,161 @@
package redis
import (
"context"
"errors"
)
type BitMapCmdable interface {
GetBit(ctx context.Context, key string, offset int64) *IntCmd
SetBit(ctx context.Context, key string, offset int64, value int) *IntCmd
BitCount(ctx context.Context, key string, bitCount *BitCount) *IntCmd
BitOpAnd(ctx context.Context, destKey string, keys ...string) *IntCmd
BitOpOr(ctx context.Context, destKey string, keys ...string) *IntCmd
BitOpXor(ctx context.Context, destKey string, keys ...string) *IntCmd
BitOpNot(ctx context.Context, destKey string, key string) *IntCmd
BitPos(ctx context.Context, key string, bit int64, pos ...int64) *IntCmd
BitPosSpan(ctx context.Context, key string, bit int8, start, end int64, span string) *IntCmd
BitField(ctx context.Context, key string, values ...interface{}) *IntSliceCmd
BitFieldRO(ctx context.Context, key string, values ...interface{}) *IntSliceCmd
}
func (c cmdable) GetBit(ctx context.Context, key string, offset int64) *IntCmd {
cmd := NewIntCmd(ctx, "getbit", key, offset)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SetBit(ctx context.Context, key string, offset int64, value int) *IntCmd {
cmd := NewIntCmd(
ctx,
"setbit",
key,
offset,
value,
)
_ = c(ctx, cmd)
return cmd
}
type BitCount struct {
Start, End int64
Unit string // BYTE(default) | BIT
}
const BitCountIndexByte string = "BYTE"
const BitCountIndexBit string = "BIT"
func (c cmdable) BitCount(ctx context.Context, key string, bitCount *BitCount) *IntCmd {
args := make([]any, 2, 5)
args[0] = "bitcount"
args[1] = key
if bitCount != nil {
args = append(args, bitCount.Start, bitCount.End)
if bitCount.Unit != "" {
if bitCount.Unit != BitCountIndexByte && bitCount.Unit != BitCountIndexBit {
cmd := NewIntCmd(ctx)
cmd.SetErr(errors.New("redis: invalid bitcount index"))
return cmd
}
args = append(args, bitCount.Unit)
}
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) bitOp(ctx context.Context, op, destKey string, keys ...string) *IntCmd {
args := make([]interface{}, 3+len(keys))
args[0] = "bitop"
args[1] = op
args[2] = destKey
for i, key := range keys {
args[3+i] = key
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) BitOpAnd(ctx context.Context, destKey string, keys ...string) *IntCmd {
return c.bitOp(ctx, "and", destKey, keys...)
}
func (c cmdable) BitOpOr(ctx context.Context, destKey string, keys ...string) *IntCmd {
return c.bitOp(ctx, "or", destKey, keys...)
}
func (c cmdable) BitOpXor(ctx context.Context, destKey string, keys ...string) *IntCmd {
return c.bitOp(ctx, "xor", destKey, keys...)
}
func (c cmdable) BitOpNot(ctx context.Context, destKey string, key string) *IntCmd {
return c.bitOp(ctx, "not", destKey, key)
}
// BitPos is an API before Redis version 7.0, cmd: bitpos key bit start end
// if you need the `byte | bit` parameter, please use `BitPosSpan`.
func (c cmdable) BitPos(ctx context.Context, key string, bit int64, pos ...int64) *IntCmd {
args := make([]interface{}, 3+len(pos))
args[0] = "bitpos"
args[1] = key
args[2] = bit
switch len(pos) {
case 0:
case 1:
args[3] = pos[0]
case 2:
args[3] = pos[0]
args[4] = pos[1]
default:
panic("too many arguments")
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// BitPosSpan supports the `byte | bit` parameters in redis version 7.0,
// the bitpos command defaults to using byte type for the `start-end` range,
// which means it counts in bytes from start to end. you can set the value
// of "span" to determine the type of `start-end`.
// span = "bit", cmd: bitpos key bit start end bit
// span = "byte", cmd: bitpos key bit start end byte
func (c cmdable) BitPosSpan(ctx context.Context, key string, bit int8, start, end int64, span string) *IntCmd {
cmd := NewIntCmd(ctx, "bitpos", key, bit, start, end, span)
_ = c(ctx, cmd)
return cmd
}
// BitField accepts multiple values:
// - BitField("set", "i1", "offset1", "value1","cmd2", "type2", "offset2", "value2")
// - BitField([]string{"cmd1", "type1", "offset1", "value1","cmd2", "type2", "offset2", "value2"})
// - BitField([]interface{}{"cmd1", "type1", "offset1", "value1","cmd2", "type2", "offset2", "value2"})
func (c cmdable) BitField(ctx context.Context, key string, values ...interface{}) *IntSliceCmd {
args := make([]interface{}, 2, 2+len(values))
args[0] = "bitfield"
args[1] = key
args = appendArgs(args, values)
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// BitFieldRO - Read-only variant of the BITFIELD command.
// It is like the original BITFIELD but only accepts GET subcommand and can safely be used in read-only replicas.
// - BitFieldRO(ctx, key, "<Encoding0>", "<Offset0>", "<Encoding1>","<Offset1>")
func (c cmdable) BitFieldRO(ctx context.Context, key string, values ...interface{}) *IntSliceCmd {
args := make([]interface{}, 2, 2+len(values))
args[0] = "BITFIELD_RO"
args[1] = key
if len(values)%2 != 0 {
panic("BitFieldRO: invalid number of arguments, must be even")
}
for i := 0; i < len(values); i += 2 {
args = append(args, "GET", values[i], values[i+1])
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}

199
vendor/github.com/redis/go-redis/v9/cluster_commands.go generated vendored Normal file
View File

@@ -0,0 +1,199 @@
package redis
import "context"
type ClusterCmdable interface {
ClusterMyShardID(ctx context.Context) *StringCmd
ClusterMyID(ctx context.Context) *StringCmd
ClusterSlots(ctx context.Context) *ClusterSlotsCmd
ClusterShards(ctx context.Context) *ClusterShardsCmd
ClusterLinks(ctx context.Context) *ClusterLinksCmd
ClusterNodes(ctx context.Context) *StringCmd
ClusterMeet(ctx context.Context, host, port string) *StatusCmd
ClusterForget(ctx context.Context, nodeID string) *StatusCmd
ClusterReplicate(ctx context.Context, nodeID string) *StatusCmd
ClusterResetSoft(ctx context.Context) *StatusCmd
ClusterResetHard(ctx context.Context) *StatusCmd
ClusterInfo(ctx context.Context) *StringCmd
ClusterKeySlot(ctx context.Context, key string) *IntCmd
ClusterGetKeysInSlot(ctx context.Context, slot int, count int) *StringSliceCmd
ClusterCountFailureReports(ctx context.Context, nodeID string) *IntCmd
ClusterCountKeysInSlot(ctx context.Context, slot int) *IntCmd
ClusterDelSlots(ctx context.Context, slots ...int) *StatusCmd
ClusterDelSlotsRange(ctx context.Context, min, max int) *StatusCmd
ClusterSaveConfig(ctx context.Context) *StatusCmd
ClusterSlaves(ctx context.Context, nodeID string) *StringSliceCmd
ClusterFailover(ctx context.Context) *StatusCmd
ClusterAddSlots(ctx context.Context, slots ...int) *StatusCmd
ClusterAddSlotsRange(ctx context.Context, min, max int) *StatusCmd
ReadOnly(ctx context.Context) *StatusCmd
ReadWrite(ctx context.Context) *StatusCmd
}
func (c cmdable) ClusterMyShardID(ctx context.Context) *StringCmd {
cmd := NewStringCmd(ctx, "cluster", "myshardid")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterMyID(ctx context.Context) *StringCmd {
cmd := NewStringCmd(ctx, "cluster", "myid")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterSlots(ctx context.Context) *ClusterSlotsCmd {
cmd := NewClusterSlotsCmd(ctx, "cluster", "slots")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterShards(ctx context.Context) *ClusterShardsCmd {
cmd := NewClusterShardsCmd(ctx, "cluster", "shards")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterLinks(ctx context.Context) *ClusterLinksCmd {
cmd := NewClusterLinksCmd(ctx, "cluster", "links")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterNodes(ctx context.Context) *StringCmd {
cmd := NewStringCmd(ctx, "cluster", "nodes")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterMeet(ctx context.Context, host, port string) *StatusCmd {
cmd := NewStatusCmd(ctx, "cluster", "meet", host, port)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterForget(ctx context.Context, nodeID string) *StatusCmd {
cmd := NewStatusCmd(ctx, "cluster", "forget", nodeID)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterReplicate(ctx context.Context, nodeID string) *StatusCmd {
cmd := NewStatusCmd(ctx, "cluster", "replicate", nodeID)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterResetSoft(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "cluster", "reset", "soft")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterResetHard(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "cluster", "reset", "hard")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterInfo(ctx context.Context) *StringCmd {
cmd := NewStringCmd(ctx, "cluster", "info")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterKeySlot(ctx context.Context, key string) *IntCmd {
cmd := NewIntCmd(ctx, "cluster", "keyslot", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterGetKeysInSlot(ctx context.Context, slot int, count int) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "cluster", "getkeysinslot", slot, count)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterCountFailureReports(ctx context.Context, nodeID string) *IntCmd {
cmd := NewIntCmd(ctx, "cluster", "count-failure-reports", nodeID)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterCountKeysInSlot(ctx context.Context, slot int) *IntCmd {
cmd := NewIntCmd(ctx, "cluster", "countkeysinslot", slot)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterDelSlots(ctx context.Context, slots ...int) *StatusCmd {
args := make([]interface{}, 2+len(slots))
args[0] = "cluster"
args[1] = "delslots"
for i, slot := range slots {
args[2+i] = slot
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterDelSlotsRange(ctx context.Context, min, max int) *StatusCmd {
size := max - min + 1
slots := make([]int, size)
for i := 0; i < size; i++ {
slots[i] = min + i
}
return c.ClusterDelSlots(ctx, slots...)
}
func (c cmdable) ClusterSaveConfig(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "cluster", "saveconfig")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterSlaves(ctx context.Context, nodeID string) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "cluster", "slaves", nodeID)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterFailover(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "cluster", "failover")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterAddSlots(ctx context.Context, slots ...int) *StatusCmd {
args := make([]interface{}, 2+len(slots))
args[0] = "cluster"
args[1] = "addslots"
for i, num := range slots {
args[2+i] = num
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterAddSlotsRange(ctx context.Context, min, max int) *StatusCmd {
size := max - min + 1
slots := make([]int, size)
for i := 0; i < size; i++ {
slots[i] = min + i
}
return c.ClusterAddSlots(ctx, slots...)
}
func (c cmdable) ReadOnly(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "readonly")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ReadWrite(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "readwrite")
_ = c(ctx, cmd)
return cmd
}

5736
vendor/github.com/redis/go-redis/v9/command.go generated vendored Normal file
View File

File diff suppressed because it is too large Load Diff

733
vendor/github.com/redis/go-redis/v9/commands.go generated vendored Normal file
View File

@@ -0,0 +1,733 @@
package redis
import (
"context"
"encoding"
"errors"
"fmt"
"io"
"net"
"reflect"
"runtime"
"strings"
"time"
"github.com/redis/go-redis/v9/internal"
)
// KeepTTL is a Redis KEEPTTL option to keep existing TTL, it requires your redis-server version >= 6.0,
// otherwise you will receive an error: (error) ERR syntax error.
// For example:
//
// rdb.Set(ctx, key, value, redis.KeepTTL)
const KeepTTL = -1
func usePrecise(dur time.Duration) bool {
return dur < time.Second || dur%time.Second != 0
}
func formatMs(ctx context.Context, dur time.Duration) int64 {
if dur > 0 && dur < time.Millisecond {
internal.Logger.Printf(
ctx,
"specified duration is %s, but minimal supported value is %s - truncating to 1ms",
dur, time.Millisecond,
)
return 1
}
return int64(dur / time.Millisecond)
}
func formatSec(ctx context.Context, dur time.Duration) int64 {
if dur > 0 && dur < time.Second {
internal.Logger.Printf(
ctx,
"specified duration is %s, but minimal supported value is %s - truncating to 1s",
dur, time.Second,
)
return 1
}
return int64(dur / time.Second)
}
func appendArgs(dst, src []interface{}) []interface{} {
if len(src) == 1 {
return appendArg(dst, src[0])
}
dst = append(dst, src...)
return dst
}
func appendArg(dst []interface{}, arg interface{}) []interface{} {
switch arg := arg.(type) {
case []string:
for _, s := range arg {
dst = append(dst, s)
}
return dst
case []interface{}:
dst = append(dst, arg...)
return dst
case map[string]interface{}:
for k, v := range arg {
dst = append(dst, k, v)
}
return dst
case map[string]string:
for k, v := range arg {
dst = append(dst, k, v)
}
return dst
case time.Time, time.Duration, encoding.BinaryMarshaler, net.IP:
return append(dst, arg)
case nil:
return dst
default:
// scan struct field
v := reflect.ValueOf(arg)
if v.Type().Kind() == reflect.Ptr {
if v.IsNil() {
// error: arg is not a valid object
return dst
}
v = v.Elem()
}
if v.Type().Kind() == reflect.Struct {
return appendStructField(dst, v)
}
return append(dst, arg)
}
}
// appendStructField appends the field and value held by the structure v to dst, and returns the appended dst.
func appendStructField(dst []interface{}, v reflect.Value) []interface{} {
typ := v.Type()
for i := 0; i < typ.NumField(); i++ {
tag := typ.Field(i).Tag.Get("redis")
if tag == "" || tag == "-" {
continue
}
name, opt, _ := strings.Cut(tag, ",")
if name == "" {
continue
}
field := v.Field(i)
// miss field
if omitEmpty(opt) && isEmptyValue(field) {
continue
}
if field.CanInterface() {
dst = append(dst, name, field.Interface())
}
}
return dst
}
func omitEmpty(opt string) bool {
for opt != "" {
var name string
name, opt, _ = strings.Cut(opt, ",")
if name == "omitempty" {
return true
}
}
return false
}
func isEmptyValue(v reflect.Value) bool {
switch v.Kind() {
case reflect.Array, reflect.Map, reflect.Slice, reflect.String:
return v.Len() == 0
case reflect.Bool:
return !v.Bool()
case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64:
return v.Int() == 0
case reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uintptr:
return v.Uint() == 0
case reflect.Float32, reflect.Float64:
return v.Float() == 0
case reflect.Interface, reflect.Pointer:
return v.IsNil()
case reflect.Struct:
if v.Type() == reflect.TypeOf(time.Time{}) {
return v.IsZero()
}
// Only supports the struct time.Time,
// subsequent iterations will follow the func Scan support decoder.
}
return false
}
type Cmdable interface {
Pipeline() Pipeliner
Pipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error)
TxPipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error)
TxPipeline() Pipeliner
Command(ctx context.Context) *CommandsInfoCmd
CommandList(ctx context.Context, filter *FilterBy) *StringSliceCmd
CommandGetKeys(ctx context.Context, commands ...interface{}) *StringSliceCmd
CommandGetKeysAndFlags(ctx context.Context, commands ...interface{}) *KeyFlagsCmd
ClientGetName(ctx context.Context) *StringCmd
Echo(ctx context.Context, message interface{}) *StringCmd
Ping(ctx context.Context) *StatusCmd
Quit(ctx context.Context) *StatusCmd
Unlink(ctx context.Context, keys ...string) *IntCmd
BgRewriteAOF(ctx context.Context) *StatusCmd
BgSave(ctx context.Context) *StatusCmd
ClientKill(ctx context.Context, ipPort string) *StatusCmd
ClientKillByFilter(ctx context.Context, keys ...string) *IntCmd
ClientList(ctx context.Context) *StringCmd
ClientInfo(ctx context.Context) *ClientInfoCmd
ClientPause(ctx context.Context, dur time.Duration) *BoolCmd
ClientUnpause(ctx context.Context) *BoolCmd
ClientID(ctx context.Context) *IntCmd
ClientUnblock(ctx context.Context, id int64) *IntCmd
ClientUnblockWithError(ctx context.Context, id int64) *IntCmd
ConfigGet(ctx context.Context, parameter string) *MapStringStringCmd
ConfigResetStat(ctx context.Context) *StatusCmd
ConfigSet(ctx context.Context, parameter, value string) *StatusCmd
ConfigRewrite(ctx context.Context) *StatusCmd
DBSize(ctx context.Context) *IntCmd
FlushAll(ctx context.Context) *StatusCmd
FlushAllAsync(ctx context.Context) *StatusCmd
FlushDB(ctx context.Context) *StatusCmd
FlushDBAsync(ctx context.Context) *StatusCmd
Info(ctx context.Context, section ...string) *StringCmd
LastSave(ctx context.Context) *IntCmd
Save(ctx context.Context) *StatusCmd
Shutdown(ctx context.Context) *StatusCmd
ShutdownSave(ctx context.Context) *StatusCmd
ShutdownNoSave(ctx context.Context) *StatusCmd
SlaveOf(ctx context.Context, host, port string) *StatusCmd
SlowLogGet(ctx context.Context, num int64) *SlowLogCmd
Time(ctx context.Context) *TimeCmd
DebugObject(ctx context.Context, key string) *StringCmd
MemoryUsage(ctx context.Context, key string, samples ...int) *IntCmd
ModuleLoadex(ctx context.Context, conf *ModuleLoadexConfig) *StringCmd
ACLCmdable
BitMapCmdable
ClusterCmdable
GenericCmdable
GeoCmdable
HashCmdable
HyperLogLogCmdable
ListCmdable
ProbabilisticCmdable
PubSubCmdable
ScriptingFunctionsCmdable
SearchCmdable
SetCmdable
SortedSetCmdable
StringCmdable
StreamCmdable
TimeseriesCmdable
JSONCmdable
VectorSetCmdable
}
type StatefulCmdable interface {
Cmdable
Auth(ctx context.Context, password string) *StatusCmd
AuthACL(ctx context.Context, username, password string) *StatusCmd
Select(ctx context.Context, index int) *StatusCmd
SwapDB(ctx context.Context, index1, index2 int) *StatusCmd
ClientSetName(ctx context.Context, name string) *BoolCmd
ClientSetInfo(ctx context.Context, info LibraryInfo) *StatusCmd
Hello(ctx context.Context, ver int, username, password, clientName string) *MapStringInterfaceCmd
}
var (
_ Cmdable = (*Client)(nil)
_ Cmdable = (*Tx)(nil)
_ Cmdable = (*Ring)(nil)
_ Cmdable = (*ClusterClient)(nil)
)
type cmdable func(ctx context.Context, cmd Cmder) error
type statefulCmdable func(ctx context.Context, cmd Cmder) error
//------------------------------------------------------------------------------
func (c statefulCmdable) Auth(ctx context.Context, password string) *StatusCmd {
cmd := NewStatusCmd(ctx, "auth", password)
_ = c(ctx, cmd)
return cmd
}
// AuthACL Perform an AUTH command, using the given user and pass.
// Should be used to authenticate the current connection with one of the connections defined in the ACL list
// when connecting to a Redis 6.0 instance, or greater, that is using the Redis ACL system.
func (c statefulCmdable) AuthACL(ctx context.Context, username, password string) *StatusCmd {
cmd := NewStatusCmd(ctx, "auth", username, password)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Wait(ctx context.Context, numSlaves int, timeout time.Duration) *IntCmd {
cmd := NewIntCmd(ctx, "wait", numSlaves, int(timeout/time.Millisecond))
cmd.setReadTimeout(timeout)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) WaitAOF(ctx context.Context, numLocal, numSlaves int, timeout time.Duration) *IntCmd {
cmd := NewIntCmd(ctx, "waitAOF", numLocal, numSlaves, int(timeout/time.Millisecond))
cmd.setReadTimeout(timeout)
_ = c(ctx, cmd)
return cmd
}
func (c statefulCmdable) Select(ctx context.Context, index int) *StatusCmd {
cmd := NewStatusCmd(ctx, "select", index)
_ = c(ctx, cmd)
return cmd
}
func (c statefulCmdable) SwapDB(ctx context.Context, index1, index2 int) *StatusCmd {
cmd := NewStatusCmd(ctx, "swapdb", index1, index2)
_ = c(ctx, cmd)
return cmd
}
// ClientSetName assigns a name to the connection.
func (c statefulCmdable) ClientSetName(ctx context.Context, name string) *BoolCmd {
cmd := NewBoolCmd(ctx, "client", "setname", name)
_ = c(ctx, cmd)
return cmd
}
// ClientSetInfo sends a CLIENT SETINFO command with the provided info.
func (c statefulCmdable) ClientSetInfo(ctx context.Context, info LibraryInfo) *StatusCmd {
err := info.Validate()
if err != nil {
panic(err.Error())
}
var cmd *StatusCmd
if info.LibName != nil {
libName := fmt.Sprintf("go-redis(%s,%s)", *info.LibName, internal.ReplaceSpaces(runtime.Version()))
cmd = NewStatusCmd(ctx, "client", "setinfo", "LIB-NAME", libName)
} else {
cmd = NewStatusCmd(ctx, "client", "setinfo", "LIB-VER", *info.LibVer)
}
_ = c(ctx, cmd)
return cmd
}
// Validate checks if only one field in the struct is non-nil.
func (info LibraryInfo) Validate() error {
if info.LibName != nil && info.LibVer != nil {
return errors.New("both LibName and LibVer cannot be set at the same time")
}
if info.LibName == nil && info.LibVer == nil {
return errors.New("at least one of LibName and LibVer should be set")
}
return nil
}
// Hello sets the resp protocol used.
func (c statefulCmdable) Hello(ctx context.Context,
ver int, username, password, clientName string,
) *MapStringInterfaceCmd {
args := make([]interface{}, 0, 7)
args = append(args, "hello", ver)
if password != "" {
if username != "" {
args = append(args, "auth", username, password)
} else {
args = append(args, "auth", "default", password)
}
}
if clientName != "" {
args = append(args, "setname", clientName)
}
cmd := NewMapStringInterfaceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
//------------------------------------------------------------------------------
func (c cmdable) Command(ctx context.Context) *CommandsInfoCmd {
cmd := NewCommandsInfoCmd(ctx, "command")
_ = c(ctx, cmd)
return cmd
}
// FilterBy is used for the `CommandList` command parameter.
type FilterBy struct {
Module string
ACLCat string
Pattern string
}
func (c cmdable) CommandList(ctx context.Context, filter *FilterBy) *StringSliceCmd {
args := make([]interface{}, 0, 5)
args = append(args, "command", "list")
if filter != nil {
if filter.Module != "" {
args = append(args, "filterby", "module", filter.Module)
} else if filter.ACLCat != "" {
args = append(args, "filterby", "aclcat", filter.ACLCat)
} else if filter.Pattern != "" {
args = append(args, "filterby", "pattern", filter.Pattern)
}
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) CommandGetKeys(ctx context.Context, commands ...interface{}) *StringSliceCmd {
args := make([]interface{}, 2+len(commands))
args[0] = "command"
args[1] = "getkeys"
copy(args[2:], commands)
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) CommandGetKeysAndFlags(ctx context.Context, commands ...interface{}) *KeyFlagsCmd {
args := make([]interface{}, 2+len(commands))
args[0] = "command"
args[1] = "getkeysandflags"
copy(args[2:], commands)
cmd := NewKeyFlagsCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// ClientGetName returns the name of the connection.
func (c cmdable) ClientGetName(ctx context.Context) *StringCmd {
cmd := NewStringCmd(ctx, "client", "getname")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Echo(ctx context.Context, message interface{}) *StringCmd {
cmd := NewStringCmd(ctx, "echo", message)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Ping(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "ping")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Do(ctx context.Context, args ...interface{}) *Cmd {
cmd := NewCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Quit(_ context.Context) *StatusCmd {
panic("not implemented")
}
//------------------------------------------------------------------------------
func (c cmdable) BgRewriteAOF(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "bgrewriteaof")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) BgSave(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "bgsave")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClientKill(ctx context.Context, ipPort string) *StatusCmd {
cmd := NewStatusCmd(ctx, "client", "kill", ipPort)
_ = c(ctx, cmd)
return cmd
}
// ClientKillByFilter is new style syntax, while the ClientKill is old
//
// CLIENT KILL <option> [value] ... <option> [value]
func (c cmdable) ClientKillByFilter(ctx context.Context, keys ...string) *IntCmd {
args := make([]interface{}, 2+len(keys))
args[0] = "client"
args[1] = "kill"
for i, key := range keys {
args[2+i] = key
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClientList(ctx context.Context) *StringCmd {
cmd := NewStringCmd(ctx, "client", "list")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClientPause(ctx context.Context, dur time.Duration) *BoolCmd {
cmd := NewBoolCmd(ctx, "client", "pause", formatMs(ctx, dur))
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClientUnpause(ctx context.Context) *BoolCmd {
cmd := NewBoolCmd(ctx, "client", "unpause")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClientID(ctx context.Context) *IntCmd {
cmd := NewIntCmd(ctx, "client", "id")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClientUnblock(ctx context.Context, id int64) *IntCmd {
cmd := NewIntCmd(ctx, "client", "unblock", id)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClientUnblockWithError(ctx context.Context, id int64) *IntCmd {
cmd := NewIntCmd(ctx, "client", "unblock", id, "error")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClientInfo(ctx context.Context) *ClientInfoCmd {
cmd := NewClientInfoCmd(ctx, "client", "info")
_ = c(ctx, cmd)
return cmd
}
// ------------------------------------------------------------------------------------------------
func (c cmdable) ConfigGet(ctx context.Context, parameter string) *MapStringStringCmd {
cmd := NewMapStringStringCmd(ctx, "config", "get", parameter)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ConfigResetStat(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "config", "resetstat")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ConfigSet(ctx context.Context, parameter, value string) *StatusCmd {
cmd := NewStatusCmd(ctx, "config", "set", parameter, value)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ConfigRewrite(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "config", "rewrite")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) DBSize(ctx context.Context) *IntCmd {
cmd := NewIntCmd(ctx, "dbsize")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FlushAll(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "flushall")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FlushAllAsync(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "flushall", "async")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FlushDB(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "flushdb")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FlushDBAsync(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "flushdb", "async")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Info(ctx context.Context, sections ...string) *StringCmd {
args := make([]interface{}, 1+len(sections))
args[0] = "info"
for i, section := range sections {
args[i+1] = section
}
cmd := NewStringCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) InfoMap(ctx context.Context, sections ...string) *InfoCmd {
args := make([]interface{}, 1+len(sections))
args[0] = "info"
for i, section := range sections {
args[i+1] = section
}
cmd := NewInfoCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LastSave(ctx context.Context) *IntCmd {
cmd := NewIntCmd(ctx, "lastsave")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Save(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "save")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) shutdown(ctx context.Context, modifier string) *StatusCmd {
var args []interface{}
if modifier == "" {
args = []interface{}{"shutdown"}
} else {
args = []interface{}{"shutdown", modifier}
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
if err := cmd.Err(); err != nil {
if err == io.EOF {
// Server quit as expected.
cmd.err = nil
}
} else {
// Server did not quit. String reply contains the reason.
cmd.err = errors.New(cmd.val)
cmd.val = ""
}
return cmd
}
func (c cmdable) Shutdown(ctx context.Context) *StatusCmd {
return c.shutdown(ctx, "")
}
func (c cmdable) ShutdownSave(ctx context.Context) *StatusCmd {
return c.shutdown(ctx, "save")
}
func (c cmdable) ShutdownNoSave(ctx context.Context) *StatusCmd {
return c.shutdown(ctx, "nosave")
}
func (c cmdable) SlaveOf(ctx context.Context, host, port string) *StatusCmd {
cmd := NewStatusCmd(ctx, "slaveof", host, port)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SlowLogGet(ctx context.Context, num int64) *SlowLogCmd {
cmd := NewSlowLogCmd(context.Background(), "slowlog", "get", num)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Sync(_ context.Context) {
panic("not implemented")
}
func (c cmdable) Time(ctx context.Context) *TimeCmd {
cmd := NewTimeCmd(ctx, "time")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) DebugObject(ctx context.Context, key string) *StringCmd {
cmd := NewStringCmd(ctx, "debug", "object", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) MemoryUsage(ctx context.Context, key string, samples ...int) *IntCmd {
args := []interface{}{"memory", "usage", key}
if len(samples) > 0 {
if len(samples) != 1 {
panic("MemoryUsage expects single sample count")
}
args = append(args, "SAMPLES", samples[0])
}
cmd := NewIntCmd(ctx, args...)
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
//------------------------------------------------------------------------------
// ModuleLoadexConfig struct is used to specify the arguments for the MODULE LOADEX command of redis.
// `MODULE LOADEX path [CONFIG name value [CONFIG name value ...]] [ARGS args [args ...]]`
type ModuleLoadexConfig struct {
Path string
Conf map[string]interface{}
Args []interface{}
}
func (c *ModuleLoadexConfig) toArgs() []interface{} {
args := make([]interface{}, 3, 3+len(c.Conf)*3+len(c.Args)*2)
args[0] = "MODULE"
args[1] = "LOADEX"
args[2] = c.Path
for k, v := range c.Conf {
args = append(args, "CONFIG", k, v)
}
for _, arg := range c.Args {
args = append(args, "ARGS", arg)
}
return args
}
// ModuleLoadex Redis `MODULE LOADEX path [CONFIG name value [CONFIG name value ...]] [ARGS args [args ...]]` command.
func (c cmdable) ModuleLoadex(ctx context.Context, conf *ModuleLoadexConfig) *StringCmd {
cmd := NewStringCmd(ctx, conf.toArgs()...)
_ = c(ctx, cmd)
return cmd
}
/*
Monitor - represents a Redis MONITOR command, allowing the user to capture
and process all commands sent to a Redis server. This mimics the behavior of
MONITOR in the redis-cli.
Notes:
- Using MONITOR blocks the connection to the server for itself. It needs a dedicated connection
- The user should create a channel of type string
- This runs concurrently in the background. Trigger via the Start and Stop functions
See further: Redis MONITOR command: https://redis.io/commands/monitor
*/
func (c cmdable) Monitor(ctx context.Context, ch chan string) *MonitorCmd {
cmd := newMonitorCmd(ctx, ch)
_ = c(ctx, cmd)
return cmd
}

4
vendor/github.com/redis/go-redis/v9/doc.go generated vendored Normal file
View File

@@ -0,0 +1,4 @@
/*
Package redis implements a Redis client.
*/
package redis

106
vendor/github.com/redis/go-redis/v9/docker-compose.yml generated vendored Normal file
View File

@@ -0,0 +1,106 @@
---
services:
redis:
image: ${CLIENT_LIBS_TEST_IMAGE:-redislabs/client-libs-test:rs-7.4.0-v2}
platform: linux/amd64
container_name: redis-standalone
environment:
- TLS_ENABLED=yes
- REDIS_CLUSTER=no
- PORT=6379
- TLS_PORT=6666
command: ${REDIS_EXTRA_ARGS:---enable-debug-command yes --enable-module-command yes --tls-auth-clients optional --save ""}
ports:
- 6379:6379
- 6666:6666 # TLS port
volumes:
- "./dockers/standalone:/redis/work"
profiles:
- standalone
- sentinel
- all-stack
- all
osscluster:
image: ${CLIENT_LIBS_TEST_IMAGE:-redislabs/client-libs-test:rs-7.4.0-v2}
platform: linux/amd64
container_name: redis-osscluster
environment:
- NODES=6
- PORT=16600
command: "--cluster-enabled yes"
ports:
- "16600-16605:16600-16605"
volumes:
- "./dockers/osscluster:/redis/work"
profiles:
- cluster
- all-stack
- all
sentinel-cluster:
image: ${CLIENT_LIBS_TEST_IMAGE:-redislabs/client-libs-test:rs-7.4.0-v2}
platform: linux/amd64
container_name: redis-sentinel-cluster
network_mode: "host"
environment:
- NODES=3
- TLS_ENABLED=yes
- REDIS_CLUSTER=no
- PORT=9121
command: ${REDIS_EXTRA_ARGS:---enable-debug-command yes --enable-module-command yes --tls-auth-clients optional --save ""}
#ports:
# - "9121-9123:9121-9123"
volumes:
- "./dockers/sentinel-cluster:/redis/work"
profiles:
- sentinel
- all-stack
- all
sentinel:
image: ${CLIENT_LIBS_TEST_IMAGE:-redislabs/client-libs-test:rs-7.4.0-v2}
platform: linux/amd64
container_name: redis-sentinel
depends_on:
- sentinel-cluster
environment:
- NODES=3
- REDIS_CLUSTER=no
- PORT=26379
command: ${REDIS_EXTRA_ARGS:---sentinel}
network_mode: "host"
#ports:
# - 26379:26379
# - 26380:26380
# - 26381:26381
volumes:
- "./dockers/sentinel.conf:/redis/config-default/redis.conf"
- "./dockers/sentinel:/redis/work"
profiles:
- sentinel
- all-stack
- all
ring-cluster:
image: ${CLIENT_LIBS_TEST_IMAGE:-redislabs/client-libs-test:rs-7.4.0-v2}
platform: linux/amd64
container_name: redis-ring-cluster
environment:
- NODES=3
- TLS_ENABLED=yes
- REDIS_CLUSTER=no
- PORT=6390
command: ${REDIS_EXTRA_ARGS:---enable-debug-command yes --enable-module-command yes --tls-auth-clients optional --save ""}
ports:
- 6390:6390
- 6391:6391
- 6392:6392
volumes:
- "./dockers/ring:/redis/work"
profiles:
- ring
- cluster
- all-stack
- all

187
vendor/github.com/redis/go-redis/v9/error.go generated vendored Normal file
View File

@@ -0,0 +1,187 @@
package redis
import (
"context"
"errors"
"io"
"net"
"strings"
"github.com/redis/go-redis/v9/internal"
"github.com/redis/go-redis/v9/internal/pool"
"github.com/redis/go-redis/v9/internal/proto"
)
// ErrClosed performs any operation on the closed client will return this error.
var ErrClosed = pool.ErrClosed
// ErrPoolExhausted is returned from a pool connection method
// when the maximum number of database connections in the pool has been reached.
var ErrPoolExhausted = pool.ErrPoolExhausted
// ErrPoolTimeout timed out waiting to get a connection from the connection pool.
var ErrPoolTimeout = pool.ErrPoolTimeout
// ErrCrossSlot is returned when keys are used in the same Redis command and
// the keys are not in the same hash slot. This error is returned by Redis
// Cluster and will be returned by the client when TxPipeline or TxPipelined
// is used on a ClusterClient with keys in different slots.
var ErrCrossSlot = proto.RedisError("CROSSSLOT Keys in request don't hash to the same slot")
// HasErrorPrefix checks if the err is a Redis error and the message contains a prefix.
func HasErrorPrefix(err error, prefix string) bool {
var rErr Error
if !errors.As(err, &rErr) {
return false
}
msg := rErr.Error()
msg = strings.TrimPrefix(msg, "ERR ") // KVRocks adds such prefix
return strings.HasPrefix(msg, prefix)
}
type Error interface {
error
// RedisError is a no-op function but
// serves to distinguish types that are Redis
// errors from ordinary errors: a type is a
// Redis error if it has a RedisError method.
RedisError()
}
var _ Error = proto.RedisError("")
func isContextError(err error) bool {
switch err {
case context.Canceled, context.DeadlineExceeded:
return true
default:
return false
}
}
func shouldRetry(err error, retryTimeout bool) bool {
switch err {
case io.EOF, io.ErrUnexpectedEOF:
return true
case nil, context.Canceled, context.DeadlineExceeded:
return false
case pool.ErrPoolTimeout:
// connection pool timeout, increase retries. #3289
return true
}
if v, ok := err.(timeoutError); ok {
if v.Timeout() {
return retryTimeout
}
return true
}
s := err.Error()
if s == "ERR max number of clients reached" {
return true
}
if strings.HasPrefix(s, "LOADING ") {
return true
}
if strings.HasPrefix(s, "READONLY ") {
return true
}
if strings.HasPrefix(s, "MASTERDOWN ") {
return true
}
if strings.HasPrefix(s, "CLUSTERDOWN ") {
return true
}
if strings.HasPrefix(s, "TRYAGAIN ") {
return true
}
return false
}
func isRedisError(err error) bool {
_, ok := err.(proto.RedisError)
return ok
}
func isBadConn(err error, allowTimeout bool, addr string) bool {
switch err {
case nil:
return false
case context.Canceled, context.DeadlineExceeded:
return true
}
if isRedisError(err) {
switch {
case isReadOnlyError(err):
// Close connections in read only state in case domain addr is used
// and domain resolves to a different Redis Server. See #790.
return true
case isMovedSameConnAddr(err, addr):
// Close connections when we are asked to move to the same addr
// of the connection. Force a DNS resolution when all connections
// of the pool are recycled
return true
default:
return false
}
}
if allowTimeout {
if netErr, ok := err.(net.Error); ok && netErr.Timeout() {
return false
}
}
return true
}
func isMovedError(err error) (moved bool, ask bool, addr string) {
if !isRedisError(err) {
return
}
s := err.Error()
switch {
case strings.HasPrefix(s, "MOVED "):
moved = true
case strings.HasPrefix(s, "ASK "):
ask = true
default:
return
}
ind := strings.LastIndex(s, " ")
if ind == -1 {
return false, false, ""
}
addr = s[ind+1:]
addr = internal.GetAddr(addr)
return
}
func isLoadingError(err error) bool {
return strings.HasPrefix(err.Error(), "LOADING ")
}
func isReadOnlyError(err error) bool {
return strings.HasPrefix(err.Error(), "READONLY ")
}
func isMovedSameConnAddr(err error, addr string) bool {
redisError := err.Error()
if !strings.HasPrefix(redisError, "MOVED ") {
return false
}
return strings.HasSuffix(redisError, " "+addr)
}
//------------------------------------------------------------------------------
type timeoutError interface {
Timeout() bool
}

392
vendor/github.com/redis/go-redis/v9/generic_commands.go generated vendored Normal file
View File

@@ -0,0 +1,392 @@
package redis
import (
"context"
"time"
"github.com/redis/go-redis/v9/internal/hashtag"
)
type GenericCmdable interface {
Del(ctx context.Context, keys ...string) *IntCmd
Dump(ctx context.Context, key string) *StringCmd
Exists(ctx context.Context, keys ...string) *IntCmd
Expire(ctx context.Context, key string, expiration time.Duration) *BoolCmd
ExpireAt(ctx context.Context, key string, tm time.Time) *BoolCmd
ExpireTime(ctx context.Context, key string) *DurationCmd
ExpireNX(ctx context.Context, key string, expiration time.Duration) *BoolCmd
ExpireXX(ctx context.Context, key string, expiration time.Duration) *BoolCmd
ExpireGT(ctx context.Context, key string, expiration time.Duration) *BoolCmd
ExpireLT(ctx context.Context, key string, expiration time.Duration) *BoolCmd
Keys(ctx context.Context, pattern string) *StringSliceCmd
Migrate(ctx context.Context, host, port, key string, db int, timeout time.Duration) *StatusCmd
Move(ctx context.Context, key string, db int) *BoolCmd
ObjectFreq(ctx context.Context, key string) *IntCmd
ObjectRefCount(ctx context.Context, key string) *IntCmd
ObjectEncoding(ctx context.Context, key string) *StringCmd
ObjectIdleTime(ctx context.Context, key string) *DurationCmd
Persist(ctx context.Context, key string) *BoolCmd
PExpire(ctx context.Context, key string, expiration time.Duration) *BoolCmd
PExpireAt(ctx context.Context, key string, tm time.Time) *BoolCmd
PExpireTime(ctx context.Context, key string) *DurationCmd
PTTL(ctx context.Context, key string) *DurationCmd
RandomKey(ctx context.Context) *StringCmd
Rename(ctx context.Context, key, newkey string) *StatusCmd
RenameNX(ctx context.Context, key, newkey string) *BoolCmd
Restore(ctx context.Context, key string, ttl time.Duration, value string) *StatusCmd
RestoreReplace(ctx context.Context, key string, ttl time.Duration, value string) *StatusCmd
Sort(ctx context.Context, key string, sort *Sort) *StringSliceCmd
SortRO(ctx context.Context, key string, sort *Sort) *StringSliceCmd
SortStore(ctx context.Context, key, store string, sort *Sort) *IntCmd
SortInterfaces(ctx context.Context, key string, sort *Sort) *SliceCmd
Touch(ctx context.Context, keys ...string) *IntCmd
TTL(ctx context.Context, key string) *DurationCmd
Type(ctx context.Context, key string) *StatusCmd
Copy(ctx context.Context, sourceKey string, destKey string, db int, replace bool) *IntCmd
Scan(ctx context.Context, cursor uint64, match string, count int64) *ScanCmd
ScanType(ctx context.Context, cursor uint64, match string, count int64, keyType string) *ScanCmd
}
func (c cmdable) Del(ctx context.Context, keys ...string) *IntCmd {
args := make([]interface{}, 1+len(keys))
args[0] = "del"
for i, key := range keys {
args[1+i] = key
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Unlink(ctx context.Context, keys ...string) *IntCmd {
args := make([]interface{}, 1+len(keys))
args[0] = "unlink"
for i, key := range keys {
args[1+i] = key
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Dump(ctx context.Context, key string) *StringCmd {
cmd := NewStringCmd(ctx, "dump", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Exists(ctx context.Context, keys ...string) *IntCmd {
args := make([]interface{}, 1+len(keys))
args[0] = "exists"
for i, key := range keys {
args[1+i] = key
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Expire(ctx context.Context, key string, expiration time.Duration) *BoolCmd {
return c.expire(ctx, key, expiration, "")
}
func (c cmdable) ExpireNX(ctx context.Context, key string, expiration time.Duration) *BoolCmd {
return c.expire(ctx, key, expiration, "NX")
}
func (c cmdable) ExpireXX(ctx context.Context, key string, expiration time.Duration) *BoolCmd {
return c.expire(ctx, key, expiration, "XX")
}
func (c cmdable) ExpireGT(ctx context.Context, key string, expiration time.Duration) *BoolCmd {
return c.expire(ctx, key, expiration, "GT")
}
func (c cmdable) ExpireLT(ctx context.Context, key string, expiration time.Duration) *BoolCmd {
return c.expire(ctx, key, expiration, "LT")
}
func (c cmdable) expire(
ctx context.Context, key string, expiration time.Duration, mode string,
) *BoolCmd {
args := make([]interface{}, 3, 4)
args[0] = "expire"
args[1] = key
args[2] = formatSec(ctx, expiration)
if mode != "" {
args = append(args, mode)
}
cmd := NewBoolCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ExpireAt(ctx context.Context, key string, tm time.Time) *BoolCmd {
cmd := NewBoolCmd(ctx, "expireat", key, tm.Unix())
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ExpireTime(ctx context.Context, key string) *DurationCmd {
cmd := NewDurationCmd(ctx, time.Second, "expiretime", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Keys(ctx context.Context, pattern string) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "keys", pattern)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Migrate(ctx context.Context, host, port, key string, db int, timeout time.Duration) *StatusCmd {
cmd := NewStatusCmd(
ctx,
"migrate",
host,
port,
key,
db,
formatMs(ctx, timeout),
)
cmd.setReadTimeout(timeout)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Move(ctx context.Context, key string, db int) *BoolCmd {
cmd := NewBoolCmd(ctx, "move", key, db)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ObjectFreq(ctx context.Context, key string) *IntCmd {
cmd := NewIntCmd(ctx, "object", "freq", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ObjectRefCount(ctx context.Context, key string) *IntCmd {
cmd := NewIntCmd(ctx, "object", "refcount", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ObjectEncoding(ctx context.Context, key string) *StringCmd {
cmd := NewStringCmd(ctx, "object", "encoding", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ObjectIdleTime(ctx context.Context, key string) *DurationCmd {
cmd := NewDurationCmd(ctx, time.Second, "object", "idletime", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Persist(ctx context.Context, key string) *BoolCmd {
cmd := NewBoolCmd(ctx, "persist", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) PExpire(ctx context.Context, key string, expiration time.Duration) *BoolCmd {
cmd := NewBoolCmd(ctx, "pexpire", key, formatMs(ctx, expiration))
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) PExpireAt(ctx context.Context, key string, tm time.Time) *BoolCmd {
cmd := NewBoolCmd(
ctx,
"pexpireat",
key,
tm.UnixNano()/int64(time.Millisecond),
)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) PExpireTime(ctx context.Context, key string) *DurationCmd {
cmd := NewDurationCmd(ctx, time.Millisecond, "pexpiretime", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) PTTL(ctx context.Context, key string) *DurationCmd {
cmd := NewDurationCmd(ctx, time.Millisecond, "pttl", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) RandomKey(ctx context.Context) *StringCmd {
cmd := NewStringCmd(ctx, "randomkey")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Rename(ctx context.Context, key, newkey string) *StatusCmd {
cmd := NewStatusCmd(ctx, "rename", key, newkey)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) RenameNX(ctx context.Context, key, newkey string) *BoolCmd {
cmd := NewBoolCmd(ctx, "renamenx", key, newkey)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Restore(ctx context.Context, key string, ttl time.Duration, value string) *StatusCmd {
cmd := NewStatusCmd(
ctx,
"restore",
key,
formatMs(ctx, ttl),
value,
)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) RestoreReplace(ctx context.Context, key string, ttl time.Duration, value string) *StatusCmd {
cmd := NewStatusCmd(
ctx,
"restore",
key,
formatMs(ctx, ttl),
value,
"replace",
)
_ = c(ctx, cmd)
return cmd
}
type Sort struct {
By string
Offset, Count int64
Get []string
Order string
Alpha bool
}
func (sort *Sort) args(command, key string) []interface{} {
args := []interface{}{command, key}
if sort.By != "" {
args = append(args, "by", sort.By)
}
if sort.Offset != 0 || sort.Count != 0 {
args = append(args, "limit", sort.Offset, sort.Count)
}
for _, get := range sort.Get {
args = append(args, "get", get)
}
if sort.Order != "" {
args = append(args, sort.Order)
}
if sort.Alpha {
args = append(args, "alpha")
}
return args
}
func (c cmdable) SortRO(ctx context.Context, key string, sort *Sort) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, sort.args("sort_ro", key)...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Sort(ctx context.Context, key string, sort *Sort) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, sort.args("sort", key)...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SortStore(ctx context.Context, key, store string, sort *Sort) *IntCmd {
args := sort.args("sort", key)
if store != "" {
args = append(args, "store", store)
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SortInterfaces(ctx context.Context, key string, sort *Sort) *SliceCmd {
cmd := NewSliceCmd(ctx, sort.args("sort", key)...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Touch(ctx context.Context, keys ...string) *IntCmd {
args := make([]interface{}, len(keys)+1)
args[0] = "touch"
for i, key := range keys {
args[i+1] = key
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) TTL(ctx context.Context, key string) *DurationCmd {
cmd := NewDurationCmd(ctx, time.Second, "ttl", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Type(ctx context.Context, key string) *StatusCmd {
cmd := NewStatusCmd(ctx, "type", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Copy(ctx context.Context, sourceKey, destKey string, db int, replace bool) *IntCmd {
args := []interface{}{"copy", sourceKey, destKey, "DB", db}
if replace {
args = append(args, "REPLACE")
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
//------------------------------------------------------------------------------
func (c cmdable) Scan(ctx context.Context, cursor uint64, match string, count int64) *ScanCmd {
args := []interface{}{"scan", cursor}
if match != "" {
args = append(args, "match", match)
}
if count > 0 {
args = append(args, "count", count)
}
cmd := NewScanCmd(ctx, c, args...)
if hashtag.Present(match) {
cmd.SetFirstKeyPos(3)
}
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ScanType(ctx context.Context, cursor uint64, match string, count int64, keyType string) *ScanCmd {
args := []interface{}{"scan", cursor}
if match != "" {
args = append(args, "match", match)
}
if count > 0 {
args = append(args, "count", count)
}
if keyType != "" {
args = append(args, "type", keyType)
}
cmd := NewScanCmd(ctx, c, args...)
if hashtag.Present(match) {
cmd.SetFirstKeyPos(3)
}
_ = c(ctx, cmd)
return cmd
}

155
vendor/github.com/redis/go-redis/v9/geo_commands.go generated vendored Normal file
View File

@@ -0,0 +1,155 @@
package redis
import (
"context"
"errors"
)
type GeoCmdable interface {
GeoAdd(ctx context.Context, key string, geoLocation ...*GeoLocation) *IntCmd
GeoPos(ctx context.Context, key string, members ...string) *GeoPosCmd
GeoRadius(ctx context.Context, key string, longitude, latitude float64, query *GeoRadiusQuery) *GeoLocationCmd
GeoRadiusStore(ctx context.Context, key string, longitude, latitude float64, query *GeoRadiusQuery) *IntCmd
GeoRadiusByMember(ctx context.Context, key, member string, query *GeoRadiusQuery) *GeoLocationCmd
GeoRadiusByMemberStore(ctx context.Context, key, member string, query *GeoRadiusQuery) *IntCmd
GeoSearch(ctx context.Context, key string, q *GeoSearchQuery) *StringSliceCmd
GeoSearchLocation(ctx context.Context, key string, q *GeoSearchLocationQuery) *GeoSearchLocationCmd
GeoSearchStore(ctx context.Context, key, store string, q *GeoSearchStoreQuery) *IntCmd
GeoDist(ctx context.Context, key string, member1, member2, unit string) *FloatCmd
GeoHash(ctx context.Context, key string, members ...string) *StringSliceCmd
}
func (c cmdable) GeoAdd(ctx context.Context, key string, geoLocation ...*GeoLocation) *IntCmd {
args := make([]interface{}, 2+3*len(geoLocation))
args[0] = "geoadd"
args[1] = key
for i, eachLoc := range geoLocation {
args[2+3*i] = eachLoc.Longitude
args[2+3*i+1] = eachLoc.Latitude
args[2+3*i+2] = eachLoc.Name
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// GeoRadius is a read-only GEORADIUS_RO command.
func (c cmdable) GeoRadius(
ctx context.Context, key string, longitude, latitude float64, query *GeoRadiusQuery,
) *GeoLocationCmd {
cmd := NewGeoLocationCmd(ctx, query, "georadius_ro", key, longitude, latitude)
if query.Store != "" || query.StoreDist != "" {
cmd.SetErr(errors.New("GeoRadius does not support Store or StoreDist"))
return cmd
}
_ = c(ctx, cmd)
return cmd
}
// GeoRadiusStore is a writing GEORADIUS command.
func (c cmdable) GeoRadiusStore(
ctx context.Context, key string, longitude, latitude float64, query *GeoRadiusQuery,
) *IntCmd {
args := geoLocationArgs(query, "georadius", key, longitude, latitude)
cmd := NewIntCmd(ctx, args...)
if query.Store == "" && query.StoreDist == "" {
cmd.SetErr(errors.New("GeoRadiusStore requires Store or StoreDist"))
return cmd
}
_ = c(ctx, cmd)
return cmd
}
// GeoRadiusByMember is a read-only GEORADIUSBYMEMBER_RO command.
func (c cmdable) GeoRadiusByMember(
ctx context.Context, key, member string, query *GeoRadiusQuery,
) *GeoLocationCmd {
cmd := NewGeoLocationCmd(ctx, query, "georadiusbymember_ro", key, member)
if query.Store != "" || query.StoreDist != "" {
cmd.SetErr(errors.New("GeoRadiusByMember does not support Store or StoreDist"))
return cmd
}
_ = c(ctx, cmd)
return cmd
}
// GeoRadiusByMemberStore is a writing GEORADIUSBYMEMBER command.
func (c cmdable) GeoRadiusByMemberStore(
ctx context.Context, key, member string, query *GeoRadiusQuery,
) *IntCmd {
args := geoLocationArgs(query, "georadiusbymember", key, member)
cmd := NewIntCmd(ctx, args...)
if query.Store == "" && query.StoreDist == "" {
cmd.SetErr(errors.New("GeoRadiusByMemberStore requires Store or StoreDist"))
return cmd
}
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) GeoSearch(ctx context.Context, key string, q *GeoSearchQuery) *StringSliceCmd {
args := make([]interface{}, 0, 13)
args = append(args, "geosearch", key)
args = geoSearchArgs(q, args)
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) GeoSearchLocation(
ctx context.Context, key string, q *GeoSearchLocationQuery,
) *GeoSearchLocationCmd {
args := make([]interface{}, 0, 16)
args = append(args, "geosearch", key)
args = geoSearchLocationArgs(q, args)
cmd := NewGeoSearchLocationCmd(ctx, q, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) GeoSearchStore(ctx context.Context, key, store string, q *GeoSearchStoreQuery) *IntCmd {
args := make([]interface{}, 0, 15)
args = append(args, "geosearchstore", store, key)
args = geoSearchArgs(&q.GeoSearchQuery, args)
if q.StoreDist {
args = append(args, "storedist")
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) GeoDist(
ctx context.Context, key string, member1, member2, unit string,
) *FloatCmd {
if unit == "" {
unit = "km"
}
cmd := NewFloatCmd(ctx, "geodist", key, member1, member2, unit)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) GeoHash(ctx context.Context, key string, members ...string) *StringSliceCmd {
args := make([]interface{}, 2+len(members))
args[0] = "geohash"
args[1] = key
for i, member := range members {
args[2+i] = member
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) GeoPos(ctx context.Context, key string, members ...string) *GeoPosCmd {
args := make([]interface{}, 2+len(members))
args[0] = "geopos"
args[1] = key
for i, member := range members {
args[2+i] = member
}
cmd := NewGeoPosCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}

619
vendor/github.com/redis/go-redis/v9/hash_commands.go generated vendored Normal file
View File

@@ -0,0 +1,619 @@
package redis
import (
"context"
"time"
"github.com/redis/go-redis/v9/internal/hashtag"
)
type HashCmdable interface {
HDel(ctx context.Context, key string, fields ...string) *IntCmd
HExists(ctx context.Context, key, field string) *BoolCmd
HGet(ctx context.Context, key, field string) *StringCmd
HGetAll(ctx context.Context, key string) *MapStringStringCmd
HGetDel(ctx context.Context, key string, fields ...string) *StringSliceCmd
HGetEX(ctx context.Context, key string, fields ...string) *StringSliceCmd
HGetEXWithArgs(ctx context.Context, key string, options *HGetEXOptions, fields ...string) *StringSliceCmd
HIncrBy(ctx context.Context, key, field string, incr int64) *IntCmd
HIncrByFloat(ctx context.Context, key, field string, incr float64) *FloatCmd
HKeys(ctx context.Context, key string) *StringSliceCmd
HLen(ctx context.Context, key string) *IntCmd
HMGet(ctx context.Context, key string, fields ...string) *SliceCmd
HSet(ctx context.Context, key string, values ...interface{}) *IntCmd
HMSet(ctx context.Context, key string, values ...interface{}) *BoolCmd
HSetEX(ctx context.Context, key string, fieldsAndValues ...string) *IntCmd
HSetEXWithArgs(ctx context.Context, key string, options *HSetEXOptions, fieldsAndValues ...string) *IntCmd
HSetNX(ctx context.Context, key, field string, value interface{}) *BoolCmd
HScan(ctx context.Context, key string, cursor uint64, match string, count int64) *ScanCmd
HScanNoValues(ctx context.Context, key string, cursor uint64, match string, count int64) *ScanCmd
HVals(ctx context.Context, key string) *StringSliceCmd
HRandField(ctx context.Context, key string, count int) *StringSliceCmd
HRandFieldWithValues(ctx context.Context, key string, count int) *KeyValueSliceCmd
HStrLen(ctx context.Context, key, field string) *IntCmd
HExpire(ctx context.Context, key string, expiration time.Duration, fields ...string) *IntSliceCmd
HExpireWithArgs(ctx context.Context, key string, expiration time.Duration, expirationArgs HExpireArgs, fields ...string) *IntSliceCmd
HPExpire(ctx context.Context, key string, expiration time.Duration, fields ...string) *IntSliceCmd
HPExpireWithArgs(ctx context.Context, key string, expiration time.Duration, expirationArgs HExpireArgs, fields ...string) *IntSliceCmd
HExpireAt(ctx context.Context, key string, tm time.Time, fields ...string) *IntSliceCmd
HExpireAtWithArgs(ctx context.Context, key string, tm time.Time, expirationArgs HExpireArgs, fields ...string) *IntSliceCmd
HPExpireAt(ctx context.Context, key string, tm time.Time, fields ...string) *IntSliceCmd
HPExpireAtWithArgs(ctx context.Context, key string, tm time.Time, expirationArgs HExpireArgs, fields ...string) *IntSliceCmd
HPersist(ctx context.Context, key string, fields ...string) *IntSliceCmd
HExpireTime(ctx context.Context, key string, fields ...string) *IntSliceCmd
HPExpireTime(ctx context.Context, key string, fields ...string) *IntSliceCmd
HTTL(ctx context.Context, key string, fields ...string) *IntSliceCmd
HPTTL(ctx context.Context, key string, fields ...string) *IntSliceCmd
}
func (c cmdable) HDel(ctx context.Context, key string, fields ...string) *IntCmd {
args := make([]interface{}, 2+len(fields))
args[0] = "hdel"
args[1] = key
for i, field := range fields {
args[2+i] = field
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HExists(ctx context.Context, key, field string) *BoolCmd {
cmd := NewBoolCmd(ctx, "hexists", key, field)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HGet(ctx context.Context, key, field string) *StringCmd {
cmd := NewStringCmd(ctx, "hget", key, field)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HGetAll(ctx context.Context, key string) *MapStringStringCmd {
cmd := NewMapStringStringCmd(ctx, "hgetall", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HIncrBy(ctx context.Context, key, field string, incr int64) *IntCmd {
cmd := NewIntCmd(ctx, "hincrby", key, field, incr)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HIncrByFloat(ctx context.Context, key, field string, incr float64) *FloatCmd {
cmd := NewFloatCmd(ctx, "hincrbyfloat", key, field, incr)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HKeys(ctx context.Context, key string) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "hkeys", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HLen(ctx context.Context, key string) *IntCmd {
cmd := NewIntCmd(ctx, "hlen", key)
_ = c(ctx, cmd)
return cmd
}
// HMGet returns the values for the specified fields in the hash stored at key.
// It returns an interface{} to distinguish between empty string and nil value.
func (c cmdable) HMGet(ctx context.Context, key string, fields ...string) *SliceCmd {
args := make([]interface{}, 2+len(fields))
args[0] = "hmget"
args[1] = key
for i, field := range fields {
args[2+i] = field
}
cmd := NewSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HSet accepts values in following formats:
//
// - HSet("myhash", "key1", "value1", "key2", "value2")
//
// - HSet("myhash", []string{"key1", "value1", "key2", "value2"})
//
// - HSet("myhash", map[string]interface{}{"key1": "value1", "key2": "value2"})
//
// Playing struct With "redis" tag.
// type MyHash struct { Key1 string `redis:"key1"`; Key2 int `redis:"key2"` }
//
// - HSet("myhash", MyHash{"value1", "value2"}) Warn: redis-server >= 4.0
//
// For struct, can be a structure pointer type, we only parse the field whose tag is redis.
// if you don't want the field to be read, you can use the `redis:"-"` flag to ignore it,
// or you don't need to set the redis tag.
// For the type of structure field, we only support simple data types:
// string, int/uint(8,16,32,64), float(32,64), time.Time(to RFC3339Nano), time.Duration(to Nanoseconds ),
// if you are other more complex or custom data types, please implement the encoding.BinaryMarshaler interface.
//
// Note that in older versions of Redis server(redis-server < 4.0), HSet only supports a single key-value pair.
// redis-docs: https://redis.io/commands/hset (Starting with Redis version 4.0.0: Accepts multiple field and value arguments.)
// If you are using a Struct type and the number of fields is greater than one,
// you will receive an error similar to "ERR wrong number of arguments", you can use HMSet as a substitute.
func (c cmdable) HSet(ctx context.Context, key string, values ...interface{}) *IntCmd {
args := make([]interface{}, 2, 2+len(values))
args[0] = "hset"
args[1] = key
args = appendArgs(args, values)
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HMSet is a deprecated version of HSet left for compatibility with Redis 3.
func (c cmdable) HMSet(ctx context.Context, key string, values ...interface{}) *BoolCmd {
args := make([]interface{}, 2, 2+len(values))
args[0] = "hmset"
args[1] = key
args = appendArgs(args, values)
cmd := NewBoolCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HSetNX(ctx context.Context, key, field string, value interface{}) *BoolCmd {
cmd := NewBoolCmd(ctx, "hsetnx", key, field, value)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HVals(ctx context.Context, key string) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "hvals", key)
_ = c(ctx, cmd)
return cmd
}
// HRandField redis-server version >= 6.2.0.
func (c cmdable) HRandField(ctx context.Context, key string, count int) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "hrandfield", key, count)
_ = c(ctx, cmd)
return cmd
}
// HRandFieldWithValues redis-server version >= 6.2.0.
func (c cmdable) HRandFieldWithValues(ctx context.Context, key string, count int) *KeyValueSliceCmd {
cmd := NewKeyValueSliceCmd(ctx, "hrandfield", key, count, "withvalues")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HScan(ctx context.Context, key string, cursor uint64, match string, count int64) *ScanCmd {
args := []interface{}{"hscan", key, cursor}
if match != "" {
args = append(args, "match", match)
}
if count > 0 {
args = append(args, "count", count)
}
cmd := NewScanCmd(ctx, c, args...)
if hashtag.Present(match) {
cmd.SetFirstKeyPos(4)
}
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HStrLen(ctx context.Context, key, field string) *IntCmd {
cmd := NewIntCmd(ctx, "hstrlen", key, field)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HScanNoValues(ctx context.Context, key string, cursor uint64, match string, count int64) *ScanCmd {
args := []interface{}{"hscan", key, cursor}
if match != "" {
args = append(args, "match", match)
}
if count > 0 {
args = append(args, "count", count)
}
args = append(args, "novalues")
cmd := NewScanCmd(ctx, c, args...)
if hashtag.Present(match) {
cmd.SetFirstKeyPos(4)
}
_ = c(ctx, cmd)
return cmd
}
type HExpireArgs struct {
NX bool
XX bool
GT bool
LT bool
}
// HExpire - Sets the expiration time for specified fields in a hash in seconds.
// The command constructs an argument list starting with "HEXPIRE", followed by the key, duration, any conditional flags, and the specified fields.
// Available since Redis 7.4 CE.
// For more information refer to [HEXPIRE Documentation].
//
// [HEXPIRE Documentation]: https://redis.io/commands/hexpire/
func (c cmdable) HExpire(ctx context.Context, key string, expiration time.Duration, fields ...string) *IntSliceCmd {
args := []interface{}{"HEXPIRE", key, formatSec(ctx, expiration), "FIELDS", len(fields)}
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HExpireWithArgs - Sets the expiration time for specified fields in a hash in seconds.
// It requires a key, an expiration duration, a struct with boolean flags for conditional expiration settings (NX, XX, GT, LT), and a list of fields.
// The command constructs an argument list starting with "HEXPIRE", followed by the key, duration, any conditional flags, and the specified fields.
// Available since Redis 7.4 CE.
// For more information refer to [HEXPIRE Documentation].
//
// [HEXPIRE Documentation]: https://redis.io/commands/hexpire/
func (c cmdable) HExpireWithArgs(ctx context.Context, key string, expiration time.Duration, expirationArgs HExpireArgs, fields ...string) *IntSliceCmd {
args := []interface{}{"HEXPIRE", key, formatSec(ctx, expiration)}
// only if one argument is true, we can add it to the args
// if more than one argument is true, it will cause an error
if expirationArgs.NX {
args = append(args, "NX")
} else if expirationArgs.XX {
args = append(args, "XX")
} else if expirationArgs.GT {
args = append(args, "GT")
} else if expirationArgs.LT {
args = append(args, "LT")
}
args = append(args, "FIELDS", len(fields))
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HPExpire - Sets the expiration time for specified fields in a hash in milliseconds.
// Similar to HExpire, it accepts a key, an expiration duration in milliseconds, a struct with expiration condition flags, and a list of fields.
// The command modifies the standard time.Duration to milliseconds for the Redis command.
// Available since Redis 7.4 CE.
// For more information refer to [HPEXPIRE Documentation].
//
// [HPEXPIRE Documentation]: https://redis.io/commands/hpexpire/
func (c cmdable) HPExpire(ctx context.Context, key string, expiration time.Duration, fields ...string) *IntSliceCmd {
args := []interface{}{"HPEXPIRE", key, formatMs(ctx, expiration), "FIELDS", len(fields)}
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HPExpireWithArgs - Sets the expiration time for specified fields in a hash in milliseconds.
// It requires a key, an expiration duration, a struct with boolean flags for conditional expiration settings (NX, XX, GT, LT), and a list of fields.
// The command constructs an argument list starting with "HPEXPIRE", followed by the key, duration, any conditional flags, and the specified fields.
// Available since Redis 7.4 CE.
// For more information refer to [HPEXPIRE Documentation].
//
// [HPEXPIRE Documentation]: https://redis.io/commands/hpexpire/
func (c cmdable) HPExpireWithArgs(ctx context.Context, key string, expiration time.Duration, expirationArgs HExpireArgs, fields ...string) *IntSliceCmd {
args := []interface{}{"HPEXPIRE", key, formatMs(ctx, expiration)}
// only if one argument is true, we can add it to the args
// if more than one argument is true, it will cause an error
if expirationArgs.NX {
args = append(args, "NX")
} else if expirationArgs.XX {
args = append(args, "XX")
} else if expirationArgs.GT {
args = append(args, "GT")
} else if expirationArgs.LT {
args = append(args, "LT")
}
args = append(args, "FIELDS", len(fields))
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HExpireAt - Sets the expiration time for specified fields in a hash to a UNIX timestamp in seconds.
// Takes a key, a UNIX timestamp, a struct of conditional flags, and a list of fields.
// The command sets absolute expiration times based on the UNIX timestamp provided.
// Available since Redis 7.4 CE.
// For more information refer to [HExpireAt Documentation].
//
// [HExpireAt Documentation]: https://redis.io/commands/hexpireat/
func (c cmdable) HExpireAt(ctx context.Context, key string, tm time.Time, fields ...string) *IntSliceCmd {
args := []interface{}{"HEXPIREAT", key, tm.Unix(), "FIELDS", len(fields)}
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HExpireAtWithArgs(ctx context.Context, key string, tm time.Time, expirationArgs HExpireArgs, fields ...string) *IntSliceCmd {
args := []interface{}{"HEXPIREAT", key, tm.Unix()}
// only if one argument is true, we can add it to the args
// if more than one argument is true, it will cause an error
if expirationArgs.NX {
args = append(args, "NX")
} else if expirationArgs.XX {
args = append(args, "XX")
} else if expirationArgs.GT {
args = append(args, "GT")
} else if expirationArgs.LT {
args = append(args, "LT")
}
args = append(args, "FIELDS", len(fields))
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HPExpireAt - Sets the expiration time for specified fields in a hash to a UNIX timestamp in milliseconds.
// Similar to HExpireAt but for timestamps in milliseconds. It accepts the same parameters and adjusts the UNIX time to milliseconds.
// Available since Redis 7.4 CE.
// For more information refer to [HExpireAt Documentation].
//
// [HExpireAt Documentation]: https://redis.io/commands/hexpireat/
func (c cmdable) HPExpireAt(ctx context.Context, key string, tm time.Time, fields ...string) *IntSliceCmd {
args := []interface{}{"HPEXPIREAT", key, tm.UnixNano() / int64(time.Millisecond), "FIELDS", len(fields)}
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HPExpireAtWithArgs(ctx context.Context, key string, tm time.Time, expirationArgs HExpireArgs, fields ...string) *IntSliceCmd {
args := []interface{}{"HPEXPIREAT", key, tm.UnixNano() / int64(time.Millisecond)}
// only if one argument is true, we can add it to the args
// if more than one argument is true, it will cause an error
if expirationArgs.NX {
args = append(args, "NX")
} else if expirationArgs.XX {
args = append(args, "XX")
} else if expirationArgs.GT {
args = append(args, "GT")
} else if expirationArgs.LT {
args = append(args, "LT")
}
args = append(args, "FIELDS", len(fields))
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HPersist - Removes the expiration time from specified fields in a hash.
// Accepts a key and the fields themselves.
// This command ensures that each field specified will have its expiration removed if present.
// Available since Redis 7.4 CE.
// For more information refer to [HPersist Documentation].
//
// [HPersist Documentation]: https://redis.io/commands/hpersist/
func (c cmdable) HPersist(ctx context.Context, key string, fields ...string) *IntSliceCmd {
args := []interface{}{"HPERSIST", key, "FIELDS", len(fields)}
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HExpireTime - Retrieves the expiration time for specified fields in a hash as a UNIX timestamp in seconds.
// Requires a key and the fields themselves to fetch their expiration timestamps.
// This command returns the expiration times for each field or error/status codes for each field as specified.
// Available since Redis 7.4 CE.
// For more information refer to [HExpireTime Documentation].
//
// [HExpireTime Documentation]: https://redis.io/commands/hexpiretime/
// For more information - https://redis.io/commands/hexpiretime/
func (c cmdable) HExpireTime(ctx context.Context, key string, fields ...string) *IntSliceCmd {
args := []interface{}{"HEXPIRETIME", key, "FIELDS", len(fields)}
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HPExpireTime - Retrieves the expiration time for specified fields in a hash as a UNIX timestamp in milliseconds.
// Similar to HExpireTime, adjusted for timestamps in milliseconds. It requires the same parameters.
// Provides the expiration timestamp for each field in milliseconds.
// Available since Redis 7.4 CE.
// For more information refer to [HExpireTime Documentation].
//
// [HExpireTime Documentation]: https://redis.io/commands/hexpiretime/
// For more information - https://redis.io/commands/hexpiretime/
func (c cmdable) HPExpireTime(ctx context.Context, key string, fields ...string) *IntSliceCmd {
args := []interface{}{"HPEXPIRETIME", key, "FIELDS", len(fields)}
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HTTL - Retrieves the remaining time to live for specified fields in a hash in seconds.
// Requires a key and the fields themselves. It returns the TTL for each specified field.
// This command fetches the TTL in seconds for each field or returns error/status codes as appropriate.
// Available since Redis 7.4 CE.
// For more information refer to [HTTL Documentation].
//
// [HTTL Documentation]: https://redis.io/commands/httl/
func (c cmdable) HTTL(ctx context.Context, key string, fields ...string) *IntSliceCmd {
args := []interface{}{"HTTL", key, "FIELDS", len(fields)}
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HPTTL - Retrieves the remaining time to live for specified fields in a hash in milliseconds.
// Similar to HTTL, but returns the TTL in milliseconds. It requires a key and the specified fields.
// This command provides the TTL in milliseconds for each field or returns error/status codes as needed.
// Available since Redis 7.4 CE.
// For more information refer to [HPTTL Documentation].
//
// [HPTTL Documentation]: https://redis.io/commands/hpttl/
// For more information - https://redis.io/commands/hpttl/
func (c cmdable) HPTTL(ctx context.Context, key string, fields ...string) *IntSliceCmd {
args := []interface{}{"HPTTL", key, "FIELDS", len(fields)}
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HGetDel(ctx context.Context, key string, fields ...string) *StringSliceCmd {
args := []interface{}{"HGETDEL", key, "FIELDS", len(fields)}
for _, field := range fields {
args = append(args, field)
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HGetEX(ctx context.Context, key string, fields ...string) *StringSliceCmd {
args := []interface{}{"HGETEX", key, "FIELDS", len(fields)}
for _, field := range fields {
args = append(args, field)
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HGetEXExpirationType represents an expiration option for the HGETEX command.
type HGetEXExpirationType string
const (
HGetEXExpirationEX HGetEXExpirationType = "EX"
HGetEXExpirationPX HGetEXExpirationType = "PX"
HGetEXExpirationEXAT HGetEXExpirationType = "EXAT"
HGetEXExpirationPXAT HGetEXExpirationType = "PXAT"
HGetEXExpirationPERSIST HGetEXExpirationType = "PERSIST"
)
type HGetEXOptions struct {
ExpirationType HGetEXExpirationType
ExpirationVal int64
}
func (c cmdable) HGetEXWithArgs(ctx context.Context, key string, options *HGetEXOptions, fields ...string) *StringSliceCmd {
args := []interface{}{"HGETEX", key}
if options.ExpirationType != "" {
args = append(args, string(options.ExpirationType))
if options.ExpirationType != HGetEXExpirationPERSIST {
args = append(args, options.ExpirationVal)
}
}
args = append(args, "FIELDS", len(fields))
for _, field := range fields {
args = append(args, field)
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
type HSetEXCondition string
const (
HSetEXFNX HSetEXCondition = "FNX" // Only set the fields if none of them already exist.
HSetEXFXX HSetEXCondition = "FXX" // Only set the fields if all already exist.
)
type HSetEXExpirationType string
const (
HSetEXExpirationEX HSetEXExpirationType = "EX"
HSetEXExpirationPX HSetEXExpirationType = "PX"
HSetEXExpirationEXAT HSetEXExpirationType = "EXAT"
HSetEXExpirationPXAT HSetEXExpirationType = "PXAT"
HSetEXExpirationKEEPTTL HSetEXExpirationType = "KEEPTTL"
)
type HSetEXOptions struct {
Condition HSetEXCondition
ExpirationType HSetEXExpirationType
ExpirationVal int64
}
func (c cmdable) HSetEX(ctx context.Context, key string, fieldsAndValues ...string) *IntCmd {
args := []interface{}{"HSETEX", key, "FIELDS", len(fieldsAndValues) / 2}
for _, field := range fieldsAndValues {
args = append(args, field)
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HSetEXWithArgs(ctx context.Context, key string, options *HSetEXOptions, fieldsAndValues ...string) *IntCmd {
args := []interface{}{"HSETEX", key}
if options.Condition != "" {
args = append(args, string(options.Condition))
}
if options.ExpirationType != "" {
args = append(args, string(options.ExpirationType))
if options.ExpirationType != HSetEXExpirationKEEPTTL {
args = append(args, options.ExpirationVal)
}
}
args = append(args, "FIELDS", len(fieldsAndValues)/2)
for _, field := range fieldsAndValues {
args = append(args, field)
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}

42
vendor/github.com/redis/go-redis/v9/hyperloglog_commands.go generated vendored Normal file
View File

@@ -0,0 +1,42 @@
package redis
import "context"
type HyperLogLogCmdable interface {
PFAdd(ctx context.Context, key string, els ...interface{}) *IntCmd
PFCount(ctx context.Context, keys ...string) *IntCmd
PFMerge(ctx context.Context, dest string, keys ...string) *StatusCmd
}
func (c cmdable) PFAdd(ctx context.Context, key string, els ...interface{}) *IntCmd {
args := make([]interface{}, 2, 2+len(els))
args[0] = "pfadd"
args[1] = key
args = appendArgs(args, els)
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) PFCount(ctx context.Context, keys ...string) *IntCmd {
args := make([]interface{}, 1+len(keys))
args[0] = "pfcount"
for i, key := range keys {
args[1+i] = key
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) PFMerge(ctx context.Context, dest string, keys ...string) *StatusCmd {
args := make([]interface{}, 2+len(keys))
args[0] = "pfmerge"
args[1] = dest
for i, key := range keys {
args[2+i] = key
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}

58
vendor/github.com/redis/go-redis/v9/internal/arg.go generated vendored Normal file
View File

@@ -0,0 +1,58 @@
package internal
import (
"fmt"
"strconv"
"time"
"github.com/redis/go-redis/v9/internal/util"
)
func AppendArg(b []byte, v interface{}) []byte {
switch v := v.(type) {
case nil:
return append(b, "<nil>"...)
case string:
return appendUTF8String(b, util.StringToBytes(v))
case []byte:
return appendUTF8String(b, v)
case int:
return strconv.AppendInt(b, int64(v), 10)
case int8:
return strconv.AppendInt(b, int64(v), 10)
case int16:
return strconv.AppendInt(b, int64(v), 10)
case int32:
return strconv.AppendInt(b, int64(v), 10)
case int64:
return strconv.AppendInt(b, v, 10)
case uint:
return strconv.AppendUint(b, uint64(v), 10)
case uint8:
return strconv.AppendUint(b, uint64(v), 10)
case uint16:
return strconv.AppendUint(b, uint64(v), 10)
case uint32:
return strconv.AppendUint(b, uint64(v), 10)
case uint64:
return strconv.AppendUint(b, v, 10)
case float32:
return strconv.AppendFloat(b, float64(v), 'f', -1, 64)
case float64:
return strconv.AppendFloat(b, v, 'f', -1, 64)
case bool:
if v {
return append(b, "true"...)
}
return append(b, "false"...)
case time.Time:
return v.AppendFormat(b, time.RFC3339Nano)
default:
return append(b, fmt.Sprint(v)...)
}
}
func appendUTF8String(dst []byte, src []byte) []byte {
dst = append(dst, src...)
return dst
}

90
vendor/github.com/redis/go-redis/v9/internal/hashtag/hashtag.go generated vendored Normal file
View File

@@ -0,0 +1,90 @@
package hashtag
import (
"strings"
"github.com/redis/go-redis/v9/internal/rand"
)
const slotNumber = 16384
// CRC16 implementation according to CCITT standards.
// Copyright 2001-2010 Georges Menie (www.menie.org)
// Copyright 2013 The Go Authors. All rights reserved.
// http://redis.io/topics/cluster-spec#appendix-a-crc16-reference-implementation-in-ansi-c
var crc16tab = [256]uint16{
0x0000, 0x1021, 0x2042, 0x3063, 0x4084, 0x50a5, 0x60c6, 0x70e7,
0x8108, 0x9129, 0xa14a, 0xb16b, 0xc18c, 0xd1ad, 0xe1ce, 0xf1ef,
0x1231, 0x0210, 0x3273, 0x2252, 0x52b5, 0x4294, 0x72f7, 0x62d6,
0x9339, 0x8318, 0xb37b, 0xa35a, 0xd3bd, 0xc39c, 0xf3ff, 0xe3de,
0x2462, 0x3443, 0x0420, 0x1401, 0x64e6, 0x74c7, 0x44a4, 0x5485,
0xa56a, 0xb54b, 0x8528, 0x9509, 0xe5ee, 0xf5cf, 0xc5ac, 0xd58d,
0x3653, 0x2672, 0x1611, 0x0630, 0x76d7, 0x66f6, 0x5695, 0x46b4,
0xb75b, 0xa77a, 0x9719, 0x8738, 0xf7df, 0xe7fe, 0xd79d, 0xc7bc,
0x48c4, 0x58e5, 0x6886, 0x78a7, 0x0840, 0x1861, 0x2802, 0x3823,
0xc9cc, 0xd9ed, 0xe98e, 0xf9af, 0x8948, 0x9969, 0xa90a, 0xb92b,
0x5af5, 0x4ad4, 0x7ab7, 0x6a96, 0x1a71, 0x0a50, 0x3a33, 0x2a12,
0xdbfd, 0xcbdc, 0xfbbf, 0xeb9e, 0x9b79, 0x8b58, 0xbb3b, 0xab1a,
0x6ca6, 0x7c87, 0x4ce4, 0x5cc5, 0x2c22, 0x3c03, 0x0c60, 0x1c41,
0xedae, 0xfd8f, 0xcdec, 0xddcd, 0xad2a, 0xbd0b, 0x8d68, 0x9d49,
0x7e97, 0x6eb6, 0x5ed5, 0x4ef4, 0x3e13, 0x2e32, 0x1e51, 0x0e70,
0xff9f, 0xefbe, 0xdfdd, 0xcffc, 0xbf1b, 0xaf3a, 0x9f59, 0x8f78,
0x9188, 0x81a9, 0xb1ca, 0xa1eb, 0xd10c, 0xc12d, 0xf14e, 0xe16f,
0x1080, 0x00a1, 0x30c2, 0x20e3, 0x5004, 0x4025, 0x7046, 0x6067,
0x83b9, 0x9398, 0xa3fb, 0xb3da, 0xc33d, 0xd31c, 0xe37f, 0xf35e,
0x02b1, 0x1290, 0x22f3, 0x32d2, 0x4235, 0x5214, 0x6277, 0x7256,
0xb5ea, 0xa5cb, 0x95a8, 0x8589, 0xf56e, 0xe54f, 0xd52c, 0xc50d,
0x34e2, 0x24c3, 0x14a0, 0x0481, 0x7466, 0x6447, 0x5424, 0x4405,
0xa7db, 0xb7fa, 0x8799, 0x97b8, 0xe75f, 0xf77e, 0xc71d, 0xd73c,
0x26d3, 0x36f2, 0x0691, 0x16b0, 0x6657, 0x7676, 0x4615, 0x5634,
0xd94c, 0xc96d, 0xf90e, 0xe92f, 0x99c8, 0x89e9, 0xb98a, 0xa9ab,
0x5844, 0x4865, 0x7806, 0x6827, 0x18c0, 0x08e1, 0x3882, 0x28a3,
0xcb7d, 0xdb5c, 0xeb3f, 0xfb1e, 0x8bf9, 0x9bd8, 0xabbb, 0xbb9a,
0x4a75, 0x5a54, 0x6a37, 0x7a16, 0x0af1, 0x1ad0, 0x2ab3, 0x3a92,
0xfd2e, 0xed0f, 0xdd6c, 0xcd4d, 0xbdaa, 0xad8b, 0x9de8, 0x8dc9,
0x7c26, 0x6c07, 0x5c64, 0x4c45, 0x3ca2, 0x2c83, 0x1ce0, 0x0cc1,
0xef1f, 0xff3e, 0xcf5d, 0xdf7c, 0xaf9b, 0xbfba, 0x8fd9, 0x9ff8,
0x6e17, 0x7e36, 0x4e55, 0x5e74, 0x2e93, 0x3eb2, 0x0ed1, 0x1ef0,
}
func Key(key string) string {
if s := strings.IndexByte(key, '{'); s > -1 {
if e := strings.IndexByte(key[s+1:], '}'); e > 0 {
return key[s+1 : s+e+1]
}
}
return key
}
func Present(key string) bool {
if key == "" {
return false
}
if s := strings.IndexByte(key, '{'); s > -1 {
if e := strings.IndexByte(key[s+1:], '}'); e > 0 {
return true
}
}
return false
}
func RandomSlot() int {
return rand.Intn(slotNumber)
}
// Slot returns a consistent slot number between 0 and 16383
// for any given string key.
func Slot(key string) int {
if key == "" {
return RandomSlot()
}
key = Key(key)
return int(crc16sum(key)) % slotNumber
}
func crc16sum(key string) (crc uint16) {
for i := 0; i < len(key); i++ {
crc = (crc << 8) ^ crc16tab[(byte(crc>>8)^key[i])&0x00ff]
}
return
}

207
vendor/github.com/redis/go-redis/v9/internal/hscan/hscan.go generated vendored Normal file
View File

@@ -0,0 +1,207 @@
package hscan
import (
"errors"
"fmt"
"reflect"
"strconv"
)
// decoderFunc represents decoding functions for default built-in types.
type decoderFunc func(reflect.Value, string) error
// Scanner is the interface implemented by themselves,
// which will override the decoding behavior of decoderFunc.
type Scanner interface {
ScanRedis(s string) error
}
var (
// List of built-in decoders indexed by their numeric constant values (eg: reflect.Bool = 1).
decoders = []decoderFunc{
reflect.Bool: decodeBool,
reflect.Int: decodeInt,
reflect.Int8: decodeInt8,
reflect.Int16: decodeInt16,
reflect.Int32: decodeInt32,
reflect.Int64: decodeInt64,
reflect.Uint: decodeUint,
reflect.Uint8: decodeUint8,
reflect.Uint16: decodeUint16,
reflect.Uint32: decodeUint32,
reflect.Uint64: decodeUint64,
reflect.Float32: decodeFloat32,
reflect.Float64: decodeFloat64,
reflect.Complex64: decodeUnsupported,
reflect.Complex128: decodeUnsupported,
reflect.Array: decodeUnsupported,
reflect.Chan: decodeUnsupported,
reflect.Func: decodeUnsupported,
reflect.Interface: decodeUnsupported,
reflect.Map: decodeUnsupported,
reflect.Ptr: decodeUnsupported,
reflect.Slice: decodeSlice,
reflect.String: decodeString,
reflect.Struct: decodeUnsupported,
reflect.UnsafePointer: decodeUnsupported,
}
// Global map of struct field specs that is populated once for every new
// struct type that is scanned. This caches the field types and the corresponding
// decoder functions to avoid iterating through struct fields on subsequent scans.
globalStructMap = newStructMap()
)
func Struct(dst interface{}) (StructValue, error) {
v := reflect.ValueOf(dst)
// The destination to scan into should be a struct pointer.
if v.Kind() != reflect.Ptr || v.IsNil() {
return StructValue{}, fmt.Errorf("redis.Scan(non-pointer %T)", dst)
}
v = v.Elem()
if v.Kind() != reflect.Struct {
return StructValue{}, fmt.Errorf("redis.Scan(non-struct %T)", dst)
}
return StructValue{
spec: globalStructMap.get(v.Type()),
value: v,
}, nil
}
// Scan scans the results from a key-value Redis map result set to a destination struct.
// The Redis keys are matched to the struct's field with the `redis` tag.
func Scan(dst interface{}, keys []interface{}, vals []interface{}) error {
if len(keys) != len(vals) {
return errors.New("args should have the same number of keys and vals")
}
strct, err := Struct(dst)
if err != nil {
return err
}
// Iterate through the (key, value) sequence.
for i := 0; i < len(vals); i++ {
key, ok := keys[i].(string)
if !ok {
continue
}
val, ok := vals[i].(string)
if !ok {
continue
}
if err := strct.Scan(key, val); err != nil {
return err
}
}
return nil
}
func decodeBool(f reflect.Value, s string) error {
b, err := strconv.ParseBool(s)
if err != nil {
return err
}
f.SetBool(b)
return nil
}
func decodeInt8(f reflect.Value, s string) error {
return decodeNumber(f, s, 8)
}
func decodeInt16(f reflect.Value, s string) error {
return decodeNumber(f, s, 16)
}
func decodeInt32(f reflect.Value, s string) error {
return decodeNumber(f, s, 32)
}
func decodeInt64(f reflect.Value, s string) error {
return decodeNumber(f, s, 64)
}
func decodeInt(f reflect.Value, s string) error {
return decodeNumber(f, s, 0)
}
func decodeNumber(f reflect.Value, s string, bitSize int) error {
v, err := strconv.ParseInt(s, 10, bitSize)
if err != nil {
return err
}
f.SetInt(v)
return nil
}
func decodeUint8(f reflect.Value, s string) error {
return decodeUnsignedNumber(f, s, 8)
}
func decodeUint16(f reflect.Value, s string) error {
return decodeUnsignedNumber(f, s, 16)
}
func decodeUint32(f reflect.Value, s string) error {
return decodeUnsignedNumber(f, s, 32)
}
func decodeUint64(f reflect.Value, s string) error {
return decodeUnsignedNumber(f, s, 64)
}
func decodeUint(f reflect.Value, s string) error {
return decodeUnsignedNumber(f, s, 0)
}
func decodeUnsignedNumber(f reflect.Value, s string, bitSize int) error {
v, err := strconv.ParseUint(s, 10, bitSize)
if err != nil {
return err
}
f.SetUint(v)
return nil
}
func decodeFloat32(f reflect.Value, s string) error {
v, err := strconv.ParseFloat(s, 32)
if err != nil {
return err
}
f.SetFloat(v)
return nil
}
// although the default is float64, but we better define it.
func decodeFloat64(f reflect.Value, s string) error {
v, err := strconv.ParseFloat(s, 64)
if err != nil {
return err
}
f.SetFloat(v)
return nil
}
func decodeString(f reflect.Value, s string) error {
f.SetString(s)
return nil
}
func decodeSlice(f reflect.Value, s string) error {
// []byte slice ([]uint8).
if f.Type().Elem().Kind() == reflect.Uint8 {
f.SetBytes([]byte(s))
}
return nil
}
func decodeUnsupported(v reflect.Value, s string) error {
return fmt.Errorf("redis.Scan(unsupported %s)", v.Type())
}

125
vendor/github.com/redis/go-redis/v9/internal/hscan/structmap.go generated vendored Normal file
View File

@@ -0,0 +1,125 @@
package hscan
import (
"encoding"
"fmt"
"reflect"
"strings"
"sync"
"github.com/redis/go-redis/v9/internal/util"
)
// structMap contains the map of struct fields for target structs
// indexed by the struct type.
type structMap struct {
m sync.Map
}
func newStructMap() *structMap {
return new(structMap)
}
func (s *structMap) get(t reflect.Type) *structSpec {
if v, ok := s.m.Load(t); ok {
return v.(*structSpec)
}
spec := newStructSpec(t, "redis")
s.m.Store(t, spec)
return spec
}
//------------------------------------------------------------------------------
// structSpec contains the list of all fields in a target struct.
type structSpec struct {
m map[string]*structField
}
func (s *structSpec) set(tag string, sf *structField) {
s.m[tag] = sf
}
func newStructSpec(t reflect.Type, fieldTag string) *structSpec {
numField := t.NumField()
out := &structSpec{
m: make(map[string]*structField, numField),
}
for i := 0; i < numField; i++ {
f := t.Field(i)
tag := f.Tag.Get(fieldTag)
if tag == "" || tag == "-" {
continue
}
tag = strings.Split(tag, ",")[0]
if tag == "" {
continue
}
// Use the built-in decoder.
kind := f.Type.Kind()
if kind == reflect.Pointer {
kind = f.Type.Elem().Kind()
}
out.set(tag, &structField{index: i, fn: decoders[kind]})
}
return out
}
//------------------------------------------------------------------------------
// structField represents a single field in a target struct.
type structField struct {
index int
fn decoderFunc
}
//------------------------------------------------------------------------------
type StructValue struct {
spec *structSpec
value reflect.Value
}
func (s StructValue) Scan(key string, value string) error {
field, ok := s.spec.m[key]
if !ok {
return nil
}
v := s.value.Field(field.index)
isPtr := v.Kind() == reflect.Ptr
if isPtr && v.IsNil() {
v.Set(reflect.New(v.Type().Elem()))
}
if !isPtr && v.Type().Name() != "" && v.CanAddr() {
v = v.Addr()
isPtr = true
}
if isPtr && v.Type().NumMethod() > 0 && v.CanInterface() {
switch scan := v.Interface().(type) {
case Scanner:
return scan.ScanRedis(value)
case encoding.TextUnmarshaler:
return scan.UnmarshalText(util.StringToBytes(value))
}
}
if isPtr {
v = v.Elem()
}
if err := field.fn(v, value); err != nil {
t := s.value.Type()
return fmt.Errorf("cannot scan redis.result %s into struct field %s.%s of type %s, error-%s",
value, t.Name(), t.Field(field.index).Name, t.Field(field.index).Type, err.Error())
}
return nil
}

29
vendor/github.com/redis/go-redis/v9/internal/internal.go generated vendored Normal file
View File

@@ -0,0 +1,29 @@
package internal
import (
"time"
"github.com/redis/go-redis/v9/internal/rand"
)
func RetryBackoff(retry int, minBackoff, maxBackoff time.Duration) time.Duration {
if retry < 0 {
panic("not reached")
}
if minBackoff == 0 {
return 0
}
d := minBackoff << uint(retry)
if d < minBackoff {
return maxBackoff
}
d = minBackoff + time.Duration(rand.Int63n(int64(d)))
if d > maxBackoff || d < minBackoff {
d = maxBackoff
}
return d
}

26
vendor/github.com/redis/go-redis/v9/internal/log.go generated vendored Normal file
View File

@@ -0,0 +1,26 @@
package internal
import (
"context"
"fmt"
"log"
"os"
)
type Logging interface {
Printf(ctx context.Context, format string, v ...interface{})
}
type logger struct {
log *log.Logger
}
func (l *logger) Printf(ctx context.Context, format string, v ...interface{}) {
_ = l.log.Output(2, fmt.Sprintf(format, v...))
}
// Logger calls Output to print to the stderr.
// Arguments are handled in the manner of fmt.Print.
var Logger Logging = &logger{
log: log.New(os.Stderr, "redis: ", log.LstdFlags|log.Lshortfile),
}

63
vendor/github.com/redis/go-redis/v9/internal/once.go generated vendored Normal file
View File

@@ -0,0 +1,63 @@
/*
Copyright 2014 The Camlistore Authors
Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at
http://www.apache.org/licenses/LICENSE-2.0
Unless required by applicable law or agreed to in writing, software
distributed under the License is distributed on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
See the License for the specific language governing permissions and
limitations under the License.
*/
package internal
import (
"sync"
"sync/atomic"
)
// A Once will perform a successful action exactly once.
//
// Unlike a sync.Once, this Once's func returns an error
// and is re-armed on failure.
type Once struct {
m sync.Mutex
done uint32
}
// Do calls the function f if and only if Do has not been invoked
// without error for this instance of Once. In other words, given
//
// var once Once
//
// if once.Do(f) is called multiple times, only the first call will
// invoke f, even if f has a different value in each invocation unless
// f returns an error. A new instance of Once is required for each
// function to execute.
//
// Do is intended for initialization that must be run exactly once. Since f
// is niladic, it may be necessary to use a function literal to capture the
// arguments to a function to be invoked by Do:
//
// err := config.once.Do(func() error { return config.init(filename) })
func (o *Once) Do(f func() error) error {
if atomic.LoadUint32(&o.done) == 1 {
return nil
}
// Slow-path.
o.m.Lock()
defer o.m.Unlock()
var err error
if o.done == 0 {
err = f()
if err == nil {
atomic.StoreUint32(&o.done, 1)
}
}
return err
}

137
vendor/github.com/redis/go-redis/v9/internal/pool/conn.go generated vendored Normal file
View File

@@ -0,0 +1,137 @@
package pool
import (
"bufio"
"context"
"net"
"sync/atomic"
"time"
"github.com/redis/go-redis/v9/internal/proto"
)
var noDeadline = time.Time{}
type Conn struct {
usedAt int64 // atomic
netConn net.Conn
rd *proto.Reader
bw *bufio.Writer
wr *proto.Writer
Inited bool
pooled bool
createdAt time.Time
onClose func() error
}
func NewConn(netConn net.Conn) *Conn {
cn := &Conn{
netConn: netConn,
createdAt: time.Now(),
}
cn.rd = proto.NewReader(netConn)
cn.bw = bufio.NewWriter(netConn)
cn.wr = proto.NewWriter(cn.bw)
cn.SetUsedAt(time.Now())
return cn
}
func (cn *Conn) UsedAt() time.Time {
unix := atomic.LoadInt64(&cn.usedAt)
return time.Unix(unix, 0)
}
func (cn *Conn) SetUsedAt(tm time.Time) {
atomic.StoreInt64(&cn.usedAt, tm.Unix())
}
func (cn *Conn) SetOnClose(fn func() error) {
cn.onClose = fn
}
func (cn *Conn) SetNetConn(netConn net.Conn) {
cn.netConn = netConn
cn.rd.Reset(netConn)
cn.bw.Reset(netConn)
}
func (cn *Conn) Write(b []byte) (int, error) {
return cn.netConn.Write(b)
}
func (cn *Conn) RemoteAddr() net.Addr {
if cn.netConn != nil {
return cn.netConn.RemoteAddr()
}
return nil
}
func (cn *Conn) WithReader(
ctx context.Context, timeout time.Duration, fn func(rd *proto.Reader) error,
) error {
if timeout >= 0 {
if err := cn.netConn.SetReadDeadline(cn.deadline(ctx, timeout)); err != nil {
return err
}
}
return fn(cn.rd)
}
func (cn *Conn) WithWriter(
ctx context.Context, timeout time.Duration, fn func(wr *proto.Writer) error,
) error {
if timeout >= 0 {
if err := cn.netConn.SetWriteDeadline(cn.deadline(ctx, timeout)); err != nil {
return err
}
}
if cn.bw.Buffered() > 0 {
cn.bw.Reset(cn.netConn)
}
if err := fn(cn.wr); err != nil {
return err
}
return cn.bw.Flush()
}
func (cn *Conn) Close() error {
if cn.onClose != nil {
// ignore error
_ = cn.onClose()
}
return cn.netConn.Close()
}
func (cn *Conn) deadline(ctx context.Context, timeout time.Duration) time.Time {
tm := time.Now()
cn.SetUsedAt(tm)
if timeout > 0 {
tm = tm.Add(timeout)
}
if ctx != nil {
deadline, ok := ctx.Deadline()
if ok {
if timeout == 0 {
return deadline
}
if deadline.Before(tm) {
return deadline
}
return tm
}
}
if timeout > 0 {
return tm
}
return noDeadline
}

49
vendor/github.com/redis/go-redis/v9/internal/pool/conn_check.go generated vendored Normal file
View File

@@ -0,0 +1,49 @@
//go:build linux || darwin || dragonfly || freebsd || netbsd || openbsd || solaris || illumos
package pool
import (
"errors"
"io"
"net"
"syscall"
"time"
)
var errUnexpectedRead = errors.New("unexpected read from socket")
func connCheck(conn net.Conn) error {
// Reset previous timeout.
_ = conn.SetDeadline(time.Time{})
sysConn, ok := conn.(syscall.Conn)
if !ok {
return nil
}
rawConn, err := sysConn.SyscallConn()
if err != nil {
return err
}
var sysErr error
if err := rawConn.Read(func(fd uintptr) bool {
var buf [1]byte
n, err := syscall.Read(int(fd), buf[:])
switch {
case n == 0 && err == nil:
sysErr = io.EOF
case n > 0:
sysErr = errUnexpectedRead
case err == syscall.EAGAIN || err == syscall.EWOULDBLOCK:
sysErr = nil
default:
sysErr = err
}
return true
}); err != nil {
return err
}
return sysErr
}

9
vendor/github.com/redis/go-redis/v9/internal/pool/conn_check_dummy.go generated vendored Normal file
View File

@@ -0,0 +1,9 @@
//go:build !linux && !darwin && !dragonfly && !freebsd && !netbsd && !openbsd && !solaris && !illumos
package pool
import "net"
func connCheck(conn net.Conn) error {
return nil
}

532
vendor/github.com/redis/go-redis/v9/internal/pool/pool.go generated vendored Normal file
View File

@@ -0,0 +1,532 @@
package pool
import (
"context"
"errors"
"net"
"sync"
"sync/atomic"
"time"
"github.com/redis/go-redis/v9/internal"
)
var (
// ErrClosed performs any operation on the closed client will return this error.
ErrClosed = errors.New("redis: client is closed")
// ErrPoolExhausted is returned from a pool connection method
// when the maximum number of database connections in the pool has been reached.
ErrPoolExhausted = errors.New("redis: connection pool exhausted")
// ErrPoolTimeout timed out waiting to get a connection from the connection pool.
ErrPoolTimeout = errors.New("redis: connection pool timeout")
)
var timers = sync.Pool{
New: func() interface{} {
t := time.NewTimer(time.Hour)
t.Stop()
return t
},
}
// Stats contains pool state information and accumulated stats.
type Stats struct {
Hits uint32 // number of times free connection was found in the pool
Misses uint32 // number of times free connection was NOT found in the pool
Timeouts uint32 // number of times a wait timeout occurred
WaitCount uint32 // number of times a connection was waited
WaitDurationNs int64 // total time spent for waiting a connection in nanoseconds
TotalConns uint32 // number of total connections in the pool
IdleConns uint32 // number of idle connections in the pool
StaleConns uint32 // number of stale connections removed from the pool
}
type Pooler interface {
NewConn(context.Context) (*Conn, error)
CloseConn(*Conn) error
Get(context.Context) (*Conn, error)
Put(context.Context, *Conn)
Remove(context.Context, *Conn, error)
Len() int
IdleLen() int
Stats() *Stats
Close() error
}
type Options struct {
Dialer func(context.Context) (net.Conn, error)
PoolFIFO bool
PoolSize int
DialTimeout time.Duration
PoolTimeout time.Duration
MinIdleConns int
MaxIdleConns int
MaxActiveConns int
ConnMaxIdleTime time.Duration
ConnMaxLifetime time.Duration
}
type lastDialErrorWrap struct {
err error
}
type ConnPool struct {
cfg *Options
dialErrorsNum uint32 // atomic
lastDialError atomic.Value
queue chan struct{}
connsMu sync.Mutex
conns []*Conn
idleConns []*Conn
poolSize int
idleConnsLen int
stats Stats
waitDurationNs atomic.Int64
_closed uint32 // atomic
}
var _ Pooler = (*ConnPool)(nil)
func NewConnPool(opt *Options) *ConnPool {
p := &ConnPool{
cfg: opt,
queue: make(chan struct{}, opt.PoolSize),
conns: make([]*Conn, 0, opt.PoolSize),
idleConns: make([]*Conn, 0, opt.PoolSize),
}
p.connsMu.Lock()
p.checkMinIdleConns()
p.connsMu.Unlock()
return p
}
func (p *ConnPool) checkMinIdleConns() {
if p.cfg.MinIdleConns == 0 {
return
}
for p.poolSize < p.cfg.PoolSize && p.idleConnsLen < p.cfg.MinIdleConns {
select {
case p.queue <- struct{}{}:
p.poolSize++
p.idleConnsLen++
go func() {
err := p.addIdleConn()
if err != nil && err != ErrClosed {
p.connsMu.Lock()
p.poolSize--
p.idleConnsLen--
p.connsMu.Unlock()
}
p.freeTurn()
}()
default:
return
}
}
}
func (p *ConnPool) addIdleConn() error {
ctx, cancel := context.WithTimeout(context.Background(), p.cfg.DialTimeout)
defer cancel()
cn, err := p.dialConn(ctx, true)
if err != nil {
return err
}
p.connsMu.Lock()
defer p.connsMu.Unlock()
// It is not allowed to add new connections to the closed connection pool.
if p.closed() {
_ = cn.Close()
return ErrClosed
}
p.conns = append(p.conns, cn)
p.idleConns = append(p.idleConns, cn)
return nil
}
func (p *ConnPool) NewConn(ctx context.Context) (*Conn, error) {
return p.newConn(ctx, false)
}
func (p *ConnPool) newConn(ctx context.Context, pooled bool) (*Conn, error) {
if p.closed() {
return nil, ErrClosed
}
p.connsMu.Lock()
if p.cfg.MaxActiveConns > 0 && p.poolSize >= p.cfg.MaxActiveConns {
p.connsMu.Unlock()
return nil, ErrPoolExhausted
}
p.connsMu.Unlock()
cn, err := p.dialConn(ctx, pooled)
if err != nil {
return nil, err
}
p.connsMu.Lock()
defer p.connsMu.Unlock()
if p.cfg.MaxActiveConns > 0 && p.poolSize >= p.cfg.MaxActiveConns {
_ = cn.Close()
return nil, ErrPoolExhausted
}
p.conns = append(p.conns, cn)
if pooled {
// If pool is full remove the cn on next Put.
if p.poolSize >= p.cfg.PoolSize {
cn.pooled = false
} else {
p.poolSize++
}
}
return cn, nil
}
func (p *ConnPool) dialConn(ctx context.Context, pooled bool) (*Conn, error) {
if p.closed() {
return nil, ErrClosed
}
if atomic.LoadUint32(&p.dialErrorsNum) >= uint32(p.cfg.PoolSize) {
return nil, p.getLastDialError()
}
netConn, err := p.cfg.Dialer(ctx)
if err != nil {
p.setLastDialError(err)
if atomic.AddUint32(&p.dialErrorsNum, 1) == uint32(p.cfg.PoolSize) {
go p.tryDial()
}
return nil, err
}
cn := NewConn(netConn)
cn.pooled = pooled
return cn, nil
}
func (p *ConnPool) tryDial() {
for {
if p.closed() {
return
}
ctx, cancel := context.WithTimeout(context.Background(), p.cfg.DialTimeout)
conn, err := p.cfg.Dialer(ctx)
if err != nil {
p.setLastDialError(err)
time.Sleep(time.Second)
cancel()
continue
}
atomic.StoreUint32(&p.dialErrorsNum, 0)
_ = conn.Close()
cancel()
return
}
}
func (p *ConnPool) setLastDialError(err error) {
p.lastDialError.Store(&lastDialErrorWrap{err: err})
}
func (p *ConnPool) getLastDialError() error {
err, _ := p.lastDialError.Load().(*lastDialErrorWrap)
if err != nil {
return err.err
}
return nil
}
// Get returns existed connection from the pool or creates a new one.
func (p *ConnPool) Get(ctx context.Context) (*Conn, error) {
if p.closed() {
return nil, ErrClosed
}
if err := p.waitTurn(ctx); err != nil {
return nil, err
}
for {
p.connsMu.Lock()
cn, err := p.popIdle()
p.connsMu.Unlock()
if err != nil {
p.freeTurn()
return nil, err
}
if cn == nil {
break
}
if !p.isHealthyConn(cn) {
_ = p.CloseConn(cn)
continue
}
atomic.AddUint32(&p.stats.Hits, 1)
return cn, nil
}
atomic.AddUint32(&p.stats.Misses, 1)
newcn, err := p.newConn(ctx, true)
if err != nil {
p.freeTurn()
return nil, err
}
return newcn, nil
}
func (p *ConnPool) waitTurn(ctx context.Context) error {
select {
case <-ctx.Done():
return ctx.Err()
default:
}
select {
case p.queue <- struct{}{}:
return nil
default:
}
start := time.Now()
timer := timers.Get().(*time.Timer)
defer timers.Put(timer)
timer.Reset(p.cfg.PoolTimeout)
select {
case <-ctx.Done():
if !timer.Stop() {
<-timer.C
}
return ctx.Err()
case p.queue <- struct{}{}:
p.waitDurationNs.Add(time.Since(start).Nanoseconds())
atomic.AddUint32(&p.stats.WaitCount, 1)
if !timer.Stop() {
<-timer.C
}
return nil
case <-timer.C:
atomic.AddUint32(&p.stats.Timeouts, 1)
return ErrPoolTimeout
}
}
func (p *ConnPool) freeTurn() {
<-p.queue
}
func (p *ConnPool) popIdle() (*Conn, error) {
if p.closed() {
return nil, ErrClosed
}
n := len(p.idleConns)
if n == 0 {
return nil, nil
}
var cn *Conn
if p.cfg.PoolFIFO {
cn = p.idleConns[0]
copy(p.idleConns, p.idleConns[1:])
p.idleConns = p.idleConns[:n-1]
} else {
idx := n - 1
cn = p.idleConns[idx]
p.idleConns = p.idleConns[:idx]
}
p.idleConnsLen--
p.checkMinIdleConns()
return cn, nil
}
func (p *ConnPool) Put(ctx context.Context, cn *Conn) {
if cn.rd.Buffered() > 0 {
internal.Logger.Printf(ctx, "Conn has unread data")
p.Remove(ctx, cn, BadConnError{})
return
}
if !cn.pooled {
p.Remove(ctx, cn, nil)
return
}
var shouldCloseConn bool
p.connsMu.Lock()
if p.cfg.MaxIdleConns == 0 || p.idleConnsLen < p.cfg.MaxIdleConns {
p.idleConns = append(p.idleConns, cn)
p.idleConnsLen++
} else {
p.removeConn(cn)
shouldCloseConn = true
}
p.connsMu.Unlock()
p.freeTurn()
if shouldCloseConn {
_ = p.closeConn(cn)
}
}
func (p *ConnPool) Remove(_ context.Context, cn *Conn, reason error) {
p.removeConnWithLock(cn)
p.freeTurn()
_ = p.closeConn(cn)
}
func (p *ConnPool) CloseConn(cn *Conn) error {
p.removeConnWithLock(cn)
return p.closeConn(cn)
}
func (p *ConnPool) removeConnWithLock(cn *Conn) {
p.connsMu.Lock()
defer p.connsMu.Unlock()
p.removeConn(cn)
}
func (p *ConnPool) removeConn(cn *Conn) {
for i, c := range p.conns {
if c == cn {
p.conns = append(p.conns[:i], p.conns[i+1:]...)
if cn.pooled {
p.poolSize--
p.checkMinIdleConns()
}
break
}
}
atomic.AddUint32(&p.stats.StaleConns, 1)
}
func (p *ConnPool) closeConn(cn *Conn) error {
return cn.Close()
}
// Len returns total number of connections.
func (p *ConnPool) Len() int {
p.connsMu.Lock()
n := len(p.conns)
p.connsMu.Unlock()
return n
}
// IdleLen returns number of idle connections.
func (p *ConnPool) IdleLen() int {
p.connsMu.Lock()
n := p.idleConnsLen
p.connsMu.Unlock()
return n
}
func (p *ConnPool) Stats() *Stats {
return &Stats{
Hits: atomic.LoadUint32(&p.stats.Hits),
Misses: atomic.LoadUint32(&p.stats.Misses),
Timeouts: atomic.LoadUint32(&p.stats.Timeouts),
WaitCount: atomic.LoadUint32(&p.stats.WaitCount),
WaitDurationNs: p.waitDurationNs.Load(),
TotalConns: uint32(p.Len()),
IdleConns: uint32(p.IdleLen()),
StaleConns: atomic.LoadUint32(&p.stats.StaleConns),
}
}
func (p *ConnPool) closed() bool {
return atomic.LoadUint32(&p._closed) == 1
}
func (p *ConnPool) Filter(fn func(*Conn) bool) error {
p.connsMu.Lock()
defer p.connsMu.Unlock()
var firstErr error
for _, cn := range p.conns {
if fn(cn) {
if err := p.closeConn(cn); err != nil && firstErr == nil {
firstErr = err
}
}
}
return firstErr
}
func (p *ConnPool) Close() error {
if !atomic.CompareAndSwapUint32(&p._closed, 0, 1) {
return ErrClosed
}
var firstErr error
p.connsMu.Lock()
for _, cn := range p.conns {
if err := p.closeConn(cn); err != nil && firstErr == nil {
firstErr = err
}
}
p.conns = nil
p.poolSize = 0
p.idleConns = nil
p.idleConnsLen = 0
p.connsMu.Unlock()
return firstErr
}
func (p *ConnPool) isHealthyConn(cn *Conn) bool {
now := time.Now()
if p.cfg.ConnMaxLifetime > 0 && now.Sub(cn.createdAt) >= p.cfg.ConnMaxLifetime {
return false
}
if p.cfg.ConnMaxIdleTime > 0 && now.Sub(cn.UsedAt()) >= p.cfg.ConnMaxIdleTime {
return false
}
if connCheck(cn.netConn) != nil {
return false
}
cn.SetUsedAt(now)
return true
}

58
vendor/github.com/redis/go-redis/v9/internal/pool/pool_single.go generated vendored Normal file
View File

@@ -0,0 +1,58 @@
package pool
import "context"
type SingleConnPool struct {
pool Pooler
cn *Conn
stickyErr error
}
var _ Pooler = (*SingleConnPool)(nil)
func NewSingleConnPool(pool Pooler, cn *Conn) *SingleConnPool {
return &SingleConnPool{
pool: pool,
cn: cn,
}
}
func (p *SingleConnPool) NewConn(ctx context.Context) (*Conn, error) {
return p.pool.NewConn(ctx)
}
func (p *SingleConnPool) CloseConn(cn *Conn) error {
return p.pool.CloseConn(cn)
}
func (p *SingleConnPool) Get(ctx context.Context) (*Conn, error) {
if p.stickyErr != nil {
return nil, p.stickyErr
}
return p.cn, nil
}
func (p *SingleConnPool) Put(ctx context.Context, cn *Conn) {}
func (p *SingleConnPool) Remove(ctx context.Context, cn *Conn, reason error) {
p.cn = nil
p.stickyErr = reason
}
func (p *SingleConnPool) Close() error {
p.cn = nil
p.stickyErr = ErrClosed
return nil
}
func (p *SingleConnPool) Len() int {
return 0
}
func (p *SingleConnPool) IdleLen() int {
return 0
}
func (p *SingleConnPool) Stats() *Stats {
return &Stats{}
}

201
vendor/github.com/redis/go-redis/v9/internal/pool/pool_sticky.go generated vendored Normal file
View File

@@ -0,0 +1,201 @@
package pool
import (
"context"
"errors"
"fmt"
"sync/atomic"
)
const (
stateDefault = 0
stateInited = 1
stateClosed = 2
)
type BadConnError struct {
wrapped error
}
var _ error = (*BadConnError)(nil)
func (e BadConnError) Error() string {
s := "redis: Conn is in a bad state"
if e.wrapped != nil {
s += ": " + e.wrapped.Error()
}
return s
}
func (e BadConnError) Unwrap() error {
return e.wrapped
}
//------------------------------------------------------------------------------
type StickyConnPool struct {
pool Pooler
shared int32 // atomic
state uint32 // atomic
ch chan *Conn
_badConnError atomic.Value
}
var _ Pooler = (*StickyConnPool)(nil)
func NewStickyConnPool(pool Pooler) *StickyConnPool {
p, ok := pool.(*StickyConnPool)
if !ok {
p = &StickyConnPool{
pool: pool,
ch: make(chan *Conn, 1),
}
}
atomic.AddInt32(&p.shared, 1)
return p
}
func (p *StickyConnPool) NewConn(ctx context.Context) (*Conn, error) {
return p.pool.NewConn(ctx)
}
func (p *StickyConnPool) CloseConn(cn *Conn) error {
return p.pool.CloseConn(cn)
}
func (p *StickyConnPool) Get(ctx context.Context) (*Conn, error) {
// In worst case this races with Close which is not a very common operation.
for i := 0; i < 1000; i++ {
switch atomic.LoadUint32(&p.state) {
case stateDefault:
cn, err := p.pool.Get(ctx)
if err != nil {
return nil, err
}
if atomic.CompareAndSwapUint32(&p.state, stateDefault, stateInited) {
return cn, nil
}
p.pool.Remove(ctx, cn, ErrClosed)
case stateInited:
if err := p.badConnError(); err != nil {
return nil, err
}
cn, ok := <-p.ch
if !ok {
return nil, ErrClosed
}
return cn, nil
case stateClosed:
return nil, ErrClosed
default:
panic("not reached")
}
}
return nil, fmt.Errorf("redis: StickyConnPool.Get: infinite loop")
}
func (p *StickyConnPool) Put(ctx context.Context, cn *Conn) {
defer func() {
if recover() != nil {
p.freeConn(ctx, cn)
}
}()
p.ch <- cn
}
func (p *StickyConnPool) freeConn(ctx context.Context, cn *Conn) {
if err := p.badConnError(); err != nil {
p.pool.Remove(ctx, cn, err)
} else {
p.pool.Put(ctx, cn)
}
}
func (p *StickyConnPool) Remove(ctx context.Context, cn *Conn, reason error) {
defer func() {
if recover() != nil {
p.pool.Remove(ctx, cn, ErrClosed)
}
}()
p._badConnError.Store(BadConnError{wrapped: reason})
p.ch <- cn
}
func (p *StickyConnPool) Close() error {
if shared := atomic.AddInt32(&p.shared, -1); shared > 0 {
return nil
}
for i := 0; i < 1000; i++ {
state := atomic.LoadUint32(&p.state)
if state == stateClosed {
return ErrClosed
}
if atomic.CompareAndSwapUint32(&p.state, state, stateClosed) {
close(p.ch)
cn, ok := <-p.ch
if ok {
p.freeConn(context.TODO(), cn)
}
return nil
}
}
return errors.New("redis: StickyConnPool.Close: infinite loop")
}
func (p *StickyConnPool) Reset(ctx context.Context) error {
if p.badConnError() == nil {
return nil
}
select {
case cn, ok := <-p.ch:
if !ok {
return ErrClosed
}
p.pool.Remove(ctx, cn, ErrClosed)
p._badConnError.Store(BadConnError{wrapped: nil})
default:
return errors.New("redis: StickyConnPool does not have a Conn")
}
if !atomic.CompareAndSwapUint32(&p.state, stateInited, stateDefault) {
state := atomic.LoadUint32(&p.state)
return fmt.Errorf("redis: invalid StickyConnPool state: %d", state)
}
return nil
}
func (p *StickyConnPool) badConnError() error {
if v := p._badConnError.Load(); v != nil {
if err := v.(BadConnError); err.wrapped != nil {
return err
}
}
return nil
}
func (p *StickyConnPool) Len() int {
switch atomic.LoadUint32(&p.state) {
case stateDefault:
return 0
case stateInited:
return 1
case stateClosed:
return 0
default:
panic("not reached")
}
}
func (p *StickyConnPool) IdleLen() int {
return len(p.ch)
}
func (p *StickyConnPool) Stats() *Stats {
return &Stats{}
}

552
vendor/github.com/redis/go-redis/v9/internal/proto/reader.go generated vendored Normal file
View File

@@ -0,0 +1,552 @@
package proto
import (
"bufio"
"errors"
"fmt"
"io"
"math"
"math/big"
"strconv"
"github.com/redis/go-redis/v9/internal/util"
)
// redis resp protocol data type.
const (
RespStatus = '+' // +<string>\r\n
RespError = '-' // -<string>\r\n
RespString = '$' // $<length>\r\n<bytes>\r\n
RespInt = ':' // :<number>\r\n
RespNil = '_' // _\r\n
RespFloat = ',' // ,<floating-point-number>\r\n (golang float)
RespBool = '#' // true: #t\r\n false: #f\r\n
RespBlobError = '!' // !<length>\r\n<bytes>\r\n
RespVerbatim = '=' // =<length>\r\nFORMAT:<bytes>\r\n
RespBigInt = '(' // (<big number>\r\n
RespArray = '*' // *<len>\r\n... (same as resp2)
RespMap = '%' // %<len>\r\n(key)\r\n(value)\r\n... (golang map)
RespSet = '~' // ~<len>\r\n... (same as Array)
RespAttr = '|' // |<len>\r\n(key)\r\n(value)\r\n... + command reply
RespPush = '>' // ><len>\r\n... (same as Array)
)
// Not used temporarily.
// Redis has not used these two data types for the time being, and will implement them later.
// Streamed = "EOF:"
// StreamedAggregated = '?'
//------------------------------------------------------------------------------
const Nil = RedisError("redis: nil") // nolint:errname
type RedisError string
func (e RedisError) Error() string { return string(e) }
func (RedisError) RedisError() {}
func ParseErrorReply(line []byte) error {
return RedisError(line[1:])
}
//------------------------------------------------------------------------------
type Reader struct {
rd *bufio.Reader
}
func NewReader(rd io.Reader) *Reader {
return &Reader{
rd: bufio.NewReader(rd),
}
}
func (r *Reader) Buffered() int {
return r.rd.Buffered()
}
func (r *Reader) Peek(n int) ([]byte, error) {
return r.rd.Peek(n)
}
func (r *Reader) Reset(rd io.Reader) {
r.rd.Reset(rd)
}
// PeekReplyType returns the data type of the next response without advancing the Reader,
// and discard the attribute type.
func (r *Reader) PeekReplyType() (byte, error) {
b, err := r.rd.Peek(1)
if err != nil {
return 0, err
}
if b[0] == RespAttr {
if err = r.DiscardNext(); err != nil {
return 0, err
}
return r.PeekReplyType()
}
return b[0], nil
}
// ReadLine Return a valid reply, it will check the protocol or redis error,
// and discard the attribute type.
func (r *Reader) ReadLine() ([]byte, error) {
line, err := r.readLine()
if err != nil {
return nil, err
}
switch line[0] {
case RespError:
return nil, ParseErrorReply(line)
case RespNil:
return nil, Nil
case RespBlobError:
var blobErr string
blobErr, err = r.readStringReply(line)
if err == nil {
err = RedisError(blobErr)
}
return nil, err
case RespAttr:
if err = r.Discard(line); err != nil {
return nil, err
}
return r.ReadLine()
}
// Compatible with RESP2
if IsNilReply(line) {
return nil, Nil
}
return line, nil
}
// readLine returns an error if:
// - there is a pending read error;
// - or line does not end with \r\n.
func (r *Reader) readLine() ([]byte, error) {
b, err := r.rd.ReadSlice('\n')
if err != nil {
if err != bufio.ErrBufferFull {
return nil, err
}
full := make([]byte, len(b))
copy(full, b)
b, err = r.rd.ReadBytes('\n')
if err != nil {
return nil, err
}
full = append(full, b...) //nolint:makezero
b = full
}
if len(b) <= 2 || b[len(b)-1] != '\n' || b[len(b)-2] != '\r' {
return nil, fmt.Errorf("redis: invalid reply: %q", b)
}
return b[:len(b)-2], nil
}
func (r *Reader) ReadReply() (interface{}, error) {
line, err := r.ReadLine()
if err != nil {
return nil, err
}
switch line[0] {
case RespStatus:
return string(line[1:]), nil
case RespInt:
return util.ParseInt(line[1:], 10, 64)
case RespFloat:
return r.readFloat(line)
case RespBool:
return r.readBool(line)
case RespBigInt:
return r.readBigInt(line)
case RespString:
return r.readStringReply(line)
case RespVerbatim:
return r.readVerb(line)
case RespArray, RespSet, RespPush:
return r.readSlice(line)
case RespMap:
return r.readMap(line)
}
return nil, fmt.Errorf("redis: can't parse %.100q", line)
}
func (r *Reader) readFloat(line []byte) (float64, error) {
v := string(line[1:])
switch string(line[1:]) {
case "inf":
return math.Inf(1), nil
case "-inf":
return math.Inf(-1), nil
case "nan", "-nan":
return math.NaN(), nil
}
return strconv.ParseFloat(v, 64)
}
func (r *Reader) readBool(line []byte) (bool, error) {
switch string(line[1:]) {
case "t":
return true, nil
case "f":
return false, nil
}
return false, fmt.Errorf("redis: can't parse bool reply: %q", line)
}
func (r *Reader) readBigInt(line []byte) (*big.Int, error) {
i := new(big.Int)
if i, ok := i.SetString(string(line[1:]), 10); ok {
return i, nil
}
return nil, fmt.Errorf("redis: can't parse bigInt reply: %q", line)
}
func (r *Reader) readStringReply(line []byte) (string, error) {
n, err := replyLen(line)
if err != nil {
return "", err
}
b := make([]byte, n+2)
_, err = io.ReadFull(r.rd, b)
if err != nil {
return "", err
}
return util.BytesToString(b[:n]), nil
}
func (r *Reader) readVerb(line []byte) (string, error) {
s, err := r.readStringReply(line)
if err != nil {
return "", err
}
if len(s) < 4 || s[3] != ':' {
return "", fmt.Errorf("redis: can't parse verbatim string reply: %q", line)
}
return s[4:], nil
}
func (r *Reader) readSlice(line []byte) ([]interface{}, error) {
n, err := replyLen(line)
if err != nil {
return nil, err
}
val := make([]interface{}, n)
for i := 0; i < len(val); i++ {
v, err := r.ReadReply()
if err != nil {
if err == Nil {
val[i] = nil
continue
}
if err, ok := err.(RedisError); ok {
val[i] = err
continue
}
return nil, err
}
val[i] = v
}
return val, nil
}
func (r *Reader) readMap(line []byte) (map[interface{}]interface{}, error) {
n, err := replyLen(line)
if err != nil {
return nil, err
}
m := make(map[interface{}]interface{}, n)
for i := 0; i < n; i++ {
k, err := r.ReadReply()
if err != nil {
return nil, err
}
v, err := r.ReadReply()
if err != nil {
if err == Nil {
m[k] = nil
continue
}
if err, ok := err.(RedisError); ok {
m[k] = err
continue
}
return nil, err
}
m[k] = v
}
return m, nil
}
// -------------------------------
func (r *Reader) ReadInt() (int64, error) {
line, err := r.ReadLine()
if err != nil {
return 0, err
}
switch line[0] {
case RespInt, RespStatus:
return util.ParseInt(line[1:], 10, 64)
case RespString:
s, err := r.readStringReply(line)
if err != nil {
return 0, err
}
return util.ParseInt([]byte(s), 10, 64)
case RespBigInt:
b, err := r.readBigInt(line)
if err != nil {
return 0, err
}
if !b.IsInt64() {
return 0, fmt.Errorf("bigInt(%s) value out of range", b.String())
}
return b.Int64(), nil
}
return 0, fmt.Errorf("redis: can't parse int reply: %.100q", line)
}
func (r *Reader) ReadUint() (uint64, error) {
line, err := r.ReadLine()
if err != nil {
return 0, err
}
switch line[0] {
case RespInt, RespStatus:
return util.ParseUint(line[1:], 10, 64)
case RespString:
s, err := r.readStringReply(line)
if err != nil {
return 0, err
}
return util.ParseUint([]byte(s), 10, 64)
case RespBigInt:
b, err := r.readBigInt(line)
if err != nil {
return 0, err
}
if !b.IsUint64() {
return 0, fmt.Errorf("bigInt(%s) value out of range", b.String())
}
return b.Uint64(), nil
}
return 0, fmt.Errorf("redis: can't parse uint reply: %.100q", line)
}
func (r *Reader) ReadFloat() (float64, error) {
line, err := r.ReadLine()
if err != nil {
return 0, err
}
switch line[0] {
case RespFloat:
return r.readFloat(line)
case RespStatus:
return strconv.ParseFloat(string(line[1:]), 64)
case RespString:
s, err := r.readStringReply(line)
if err != nil {
return 0, err
}
return strconv.ParseFloat(s, 64)
}
return 0, fmt.Errorf("redis: can't parse float reply: %.100q", line)
}
func (r *Reader) ReadString() (string, error) {
line, err := r.ReadLine()
if err != nil {
return "", err
}
switch line[0] {
case RespStatus, RespInt, RespFloat:
return string(line[1:]), nil
case RespString:
return r.readStringReply(line)
case RespBool:
b, err := r.readBool(line)
return strconv.FormatBool(b), err
case RespVerbatim:
return r.readVerb(line)
case RespBigInt:
b, err := r.readBigInt(line)
if err != nil {
return "", err
}
return b.String(), nil
}
return "", fmt.Errorf("redis: can't parse reply=%.100q reading string", line)
}
func (r *Reader) ReadBool() (bool, error) {
s, err := r.ReadString()
if err != nil {
return false, err
}
return s == "OK" || s == "1" || s == "true", nil
}
func (r *Reader) ReadSlice() ([]interface{}, error) {
line, err := r.ReadLine()
if err != nil {
return nil, err
}
return r.readSlice(line)
}
// ReadFixedArrayLen read fixed array length.
func (r *Reader) ReadFixedArrayLen(fixedLen int) error {
n, err := r.ReadArrayLen()
if err != nil {
return err
}
if n != fixedLen {
return fmt.Errorf("redis: got %d elements in the array, wanted %d", n, fixedLen)
}
return nil
}
// ReadArrayLen Read and return the length of the array.
func (r *Reader) ReadArrayLen() (int, error) {
line, err := r.ReadLine()
if err != nil {
return 0, err
}
switch line[0] {
case RespArray, RespSet, RespPush:
return replyLen(line)
default:
return 0, fmt.Errorf("redis: can't parse array/set/push reply: %.100q", line)
}
}
// ReadFixedMapLen reads fixed map length.
func (r *Reader) ReadFixedMapLen(fixedLen int) error {
n, err := r.ReadMapLen()
if err != nil {
return err
}
if n != fixedLen {
return fmt.Errorf("redis: got %d elements in the map, wanted %d", n, fixedLen)
}
return nil
}
// ReadMapLen reads the length of the map type.
// If responding to the array type (RespArray/RespSet/RespPush),
// it must be a multiple of 2 and return n/2.
// Other types will return an error.
func (r *Reader) ReadMapLen() (int, error) {
line, err := r.ReadLine()
if err != nil {
return 0, err
}
switch line[0] {
case RespMap:
return replyLen(line)
case RespArray, RespSet, RespPush:
// Some commands and RESP2 protocol may respond to array types.
n, err := replyLen(line)
if err != nil {
return 0, err
}
if n%2 != 0 {
return 0, fmt.Errorf("redis: the length of the array must be a multiple of 2, got: %d", n)
}
return n / 2, nil
default:
return 0, fmt.Errorf("redis: can't parse map reply: %.100q", line)
}
}
// DiscardNext read and discard the data represented by the next line.
func (r *Reader) DiscardNext() error {
line, err := r.readLine()
if err != nil {
return err
}
return r.Discard(line)
}
// Discard the data represented by line.
func (r *Reader) Discard(line []byte) (err error) {
if len(line) == 0 {
return errors.New("redis: invalid line")
}
switch line[0] {
case RespStatus, RespError, RespInt, RespNil, RespFloat, RespBool, RespBigInt:
return nil
}
n, err := replyLen(line)
if err != nil && err != Nil {
return err
}
switch line[0] {
case RespBlobError, RespString, RespVerbatim:
// +\r\n
_, err = r.rd.Discard(n + 2)
return err
case RespArray, RespSet, RespPush:
for i := 0; i < n; i++ {
if err = r.DiscardNext(); err != nil {
return err
}
}
return nil
case RespMap, RespAttr:
// Read key & value.
for i := 0; i < n*2; i++ {
if err = r.DiscardNext(); err != nil {
return err
}
}
return nil
}
return fmt.Errorf("redis: can't parse %.100q", line)
}
func replyLen(line []byte) (n int, err error) {
n, err = util.Atoi(line[1:])
if err != nil {
return 0, err
}
if n < -1 {
return 0, fmt.Errorf("redis: invalid reply: %q", line)
}
switch line[0] {
case RespString, RespVerbatim, RespBlobError,
RespArray, RespSet, RespPush, RespMap, RespAttr:
if n == -1 {
return 0, Nil
}
}
return n, nil
}
// IsNilReply detects redis.Nil of RESP2.
func IsNilReply(line []byte) bool {
return len(line) == 3 &&
(line[0] == RespString || line[0] == RespArray) &&
line[1] == '-' && line[2] == '1'
}

185
vendor/github.com/redis/go-redis/v9/internal/proto/scan.go generated vendored Normal file
View File

@@ -0,0 +1,185 @@
package proto
import (
"encoding"
"fmt"
"net"
"reflect"
"time"
"github.com/redis/go-redis/v9/internal/util"
)
// Scan parses bytes `b` to `v` with appropriate type.
//
//nolint:gocyclo
func Scan(b []byte, v interface{}) error {
switch v := v.(type) {
case nil:
return fmt.Errorf("redis: Scan(nil)")
case *string:
*v = util.BytesToString(b)
return nil
case *[]byte:
*v = b
return nil
case *int:
var err error
*v, err = util.Atoi(b)
return err
case *int8:
n, err := util.ParseInt(b, 10, 8)
if err != nil {
return err
}
*v = int8(n)
return nil
case *int16:
n, err := util.ParseInt(b, 10, 16)
if err != nil {
return err
}
*v = int16(n)
return nil
case *int32:
n, err := util.ParseInt(b, 10, 32)
if err != nil {
return err
}
*v = int32(n)
return nil
case *int64:
n, err := util.ParseInt(b, 10, 64)
if err != nil {
return err
}
*v = n
return nil
case *uint:
n, err := util.ParseUint(b, 10, 64)
if err != nil {
return err
}
*v = uint(n)
return nil
case *uint8:
n, err := util.ParseUint(b, 10, 8)
if err != nil {
return err
}
*v = uint8(n)
return nil
case *uint16:
n, err := util.ParseUint(b, 10, 16)
if err != nil {
return err
}
*v = uint16(n)
return nil
case *uint32:
n, err := util.ParseUint(b, 10, 32)
if err != nil {
return err
}
*v = uint32(n)
return nil
case *uint64:
n, err := util.ParseUint(b, 10, 64)
if err != nil {
return err
}
*v = n
return nil
case *float32:
n, err := util.ParseFloat(b, 32)
if err != nil {
return err
}
*v = float32(n)
return err
case *float64:
var err error
*v, err = util.ParseFloat(b, 64)
return err
case *bool:
*v = len(b) == 1 && b[0] == '1'
return nil
case *time.Time:
var err error
*v, err = time.Parse(time.RFC3339Nano, util.BytesToString(b))
return err
case *time.Duration:
n, err := util.ParseInt(b, 10, 64)
if err != nil {
return err
}
*v = time.Duration(n)
return nil
case encoding.BinaryUnmarshaler:
return v.UnmarshalBinary(b)
case *net.IP:
*v = b
return nil
default:
return fmt.Errorf(
"redis: can't unmarshal %T (consider implementing BinaryUnmarshaler)", v)
}
}
func ScanSlice(data []string, slice interface{}) error {
v := reflect.ValueOf(slice)
if !v.IsValid() {
return fmt.Errorf("redis: ScanSlice(nil)")
}
if v.Kind() != reflect.Ptr {
return fmt.Errorf("redis: ScanSlice(non-pointer %T)", slice)
}
v = v.Elem()
if v.Kind() != reflect.Slice {
return fmt.Errorf("redis: ScanSlice(non-slice %T)", slice)
}
next := makeSliceNextElemFunc(v)
for i, s := range data {
elem := next()
if err := Scan([]byte(s), elem.Addr().Interface()); err != nil {
err = fmt.Errorf("redis: ScanSlice index=%d value=%q failed: %w", i, s, err)
return err
}
}
return nil
}
func makeSliceNextElemFunc(v reflect.Value) func() reflect.Value {
elemType := v.Type().Elem()
if elemType.Kind() == reflect.Ptr {
elemType = elemType.Elem()
return func() reflect.Value {
if v.Len() < v.Cap() {
v.Set(v.Slice(0, v.Len()+1))
elem := v.Index(v.Len() - 1)
if elem.IsNil() {
elem.Set(reflect.New(elemType))
}
return elem.Elem()
}
elem := reflect.New(elemType)
v.Set(reflect.Append(v, elem))
return elem.Elem()
}
}
zero := reflect.Zero(elemType)
return func() reflect.Value {
if v.Len() < v.Cap() {
v.Set(v.Slice(0, v.Len()+1))
return v.Index(v.Len() - 1)
}
v.Set(reflect.Append(v, zero))
return v.Index(v.Len() - 1)
}
}

242
vendor/github.com/redis/go-redis/v9/internal/proto/writer.go generated vendored Normal file
View File

@@ -0,0 +1,242 @@
package proto
import (
"encoding"
"fmt"
"io"
"net"
"strconv"
"time"
"github.com/redis/go-redis/v9/internal/util"
)
type writer interface {
io.Writer
io.ByteWriter
// WriteString implement io.StringWriter.
WriteString(s string) (n int, err error)
}
type Writer struct {
writer
lenBuf []byte
numBuf []byte
}
func NewWriter(wr writer) *Writer {
return &Writer{
writer: wr,
lenBuf: make([]byte, 64),
numBuf: make([]byte, 64),
}
}
func (w *Writer) WriteArgs(args []interface{}) error {
if err := w.WriteByte(RespArray); err != nil {
return err
}
if err := w.writeLen(len(args)); err != nil {
return err
}
for _, arg := range args {
if err := w.WriteArg(arg); err != nil {
return err
}
}
return nil
}
func (w *Writer) writeLen(n int) error {
w.lenBuf = strconv.AppendUint(w.lenBuf[:0], uint64(n), 10)
w.lenBuf = append(w.lenBuf, '\r', '\n')
_, err := w.Write(w.lenBuf)
return err
}
func (w *Writer) WriteArg(v interface{}) error {
switch v := v.(type) {
case nil:
return w.string("")
case string:
return w.string(v)
case *string:
if v == nil {
return w.string("")
}
return w.string(*v)
case []byte:
return w.bytes(v)
case int:
return w.int(int64(v))
case *int:
if v == nil {
return w.int(0)
}
return w.int(int64(*v))
case int8:
return w.int(int64(v))
case *int8:
if v == nil {
return w.int(0)
}
return w.int(int64(*v))
case int16:
return w.int(int64(v))
case *int16:
if v == nil {
return w.int(0)
}
return w.int(int64(*v))
case int32:
return w.int(int64(v))
case *int32:
if v == nil {
return w.int(0)
}
return w.int(int64(*v))
case int64:
return w.int(v)
case *int64:
if v == nil {
return w.int(0)
}
return w.int(*v)
case uint:
return w.uint(uint64(v))
case *uint:
if v == nil {
return w.uint(0)
}
return w.uint(uint64(*v))
case uint8:
return w.uint(uint64(v))
case *uint8:
if v == nil {
return w.string("")
}
return w.uint(uint64(*v))
case uint16:
return w.uint(uint64(v))
case *uint16:
if v == nil {
return w.uint(0)
}
return w.uint(uint64(*v))
case uint32:
return w.uint(uint64(v))
case *uint32:
if v == nil {
return w.uint(0)
}
return w.uint(uint64(*v))
case uint64:
return w.uint(v)
case *uint64:
if v == nil {
return w.uint(0)
}
return w.uint(*v)
case float32:
return w.float(float64(v))
case *float32:
if v == nil {
return w.float(0)
}
return w.float(float64(*v))
case float64:
return w.float(v)
case *float64:
if v == nil {
return w.float(0)
}
return w.float(*v)
case bool:
if v {
return w.int(1)
}
return w.int(0)
case *bool:
if v == nil {
return w.int(0)
}
if *v {
return w.int(1)
}
return w.int(0)
case time.Time:
w.numBuf = v.AppendFormat(w.numBuf[:0], time.RFC3339Nano)
return w.bytes(w.numBuf)
case *time.Time:
if v == nil {
v = &time.Time{}
}
w.numBuf = v.AppendFormat(w.numBuf[:0], time.RFC3339Nano)
return w.bytes(w.numBuf)
case time.Duration:
return w.int(v.Nanoseconds())
case *time.Duration:
if v == nil {
return w.int(0)
}
return w.int(v.Nanoseconds())
case encoding.BinaryMarshaler:
b, err := v.MarshalBinary()
if err != nil {
return err
}
return w.bytes(b)
case net.IP:
return w.bytes(v)
default:
return fmt.Errorf(
"redis: can't marshal %T (implement encoding.BinaryMarshaler)", v)
}
}
func (w *Writer) bytes(b []byte) error {
if err := w.WriteByte(RespString); err != nil {
return err
}
if err := w.writeLen(len(b)); err != nil {
return err
}
if _, err := w.Write(b); err != nil {
return err
}
return w.crlf()
}
func (w *Writer) string(s string) error {
return w.bytes(util.StringToBytes(s))
}
func (w *Writer) uint(n uint64) error {
w.numBuf = strconv.AppendUint(w.numBuf[:0], n, 10)
return w.bytes(w.numBuf)
}
func (w *Writer) int(n int64) error {
w.numBuf = strconv.AppendInt(w.numBuf[:0], n, 10)
return w.bytes(w.numBuf)
}
func (w *Writer) float(f float64) error {
w.numBuf = strconv.AppendFloat(w.numBuf[:0], f, 'f', -1, 64)
return w.bytes(w.numBuf)
}
func (w *Writer) crlf() error {
if err := w.WriteByte('\r'); err != nil {
return err
}
return w.WriteByte('\n')
}

50
vendor/github.com/redis/go-redis/v9/internal/rand/rand.go generated vendored Normal file
View File

@@ -0,0 +1,50 @@
package rand
import (
"math/rand"
"sync"
)
// Int returns a non-negative pseudo-random int.
func Int() int { return pseudo.Int() }
// Intn returns, as an int, a non-negative pseudo-random number in [0,n).
// It panics if n <= 0.
func Intn(n int) int { return pseudo.Intn(n) }
// Int63n returns, as an int64, a non-negative pseudo-random number in [0,n).
// It panics if n <= 0.
func Int63n(n int64) int64 { return pseudo.Int63n(n) }
// Perm returns, as a slice of n ints, a pseudo-random permutation of the integers [0,n).
func Perm(n int) []int { return pseudo.Perm(n) }
// Seed uses the provided seed value to initialize the default Source to a
// deterministic state. If Seed is not called, the generator behaves as if
// seeded by Seed(1).
func Seed(n int64) { pseudo.Seed(n) }
var pseudo = rand.New(&source{src: rand.NewSource(1)})
type source struct {
src rand.Source
mu sync.Mutex
}
func (s *source) Int63() int64 {
s.mu.Lock()
n := s.src.Int63()
s.mu.Unlock()
return n
}
func (s *source) Seed(seed int64) {
s.mu.Lock()
s.src.Seed(seed)
s.mu.Unlock()
}
// Shuffle pseudo-randomizes the order of elements.
// n is the number of elements.
// swap swaps the elements with indexes i and j.
func Shuffle(n int, swap func(i, j int)) { pseudo.Shuffle(n, swap) }

113
vendor/github.com/redis/go-redis/v9/internal/util.go generated vendored Normal file
View File

@@ -0,0 +1,113 @@
package internal
import (
"context"
"net"
"strconv"
"strings"
"time"
"github.com/redis/go-redis/v9/internal/util"
)
func Sleep(ctx context.Context, dur time.Duration) error {
t := time.NewTimer(dur)
defer t.Stop()
select {
case <-t.C:
return nil
case <-ctx.Done():
return ctx.Err()
}
}
func ToLower(s string) string {
if isLower(s) {
return s
}
b := make([]byte, len(s))
for i := range b {
c := s[i]
if c >= 'A' && c <= 'Z' {
c += 'a' - 'A'
}
b[i] = c
}
return util.BytesToString(b)
}
func isLower(s string) bool {
for i := 0; i < len(s); i++ {
c := s[i]
if c >= 'A' && c <= 'Z' {
return false
}
}
return true
}
func ReplaceSpaces(s string) string {
return strings.ReplaceAll(s, " ", "-")
}
func GetAddr(addr string) string {
ind := strings.LastIndexByte(addr, ':')
if ind == -1 {
return ""
}
if strings.IndexByte(addr, '.') != -1 {
return addr
}
if addr[0] == '[' {
return addr
}
return net.JoinHostPort(addr[:ind], addr[ind+1:])
}
func ToInteger(val interface{}) int {
switch v := val.(type) {
case int:
return v
case int64:
return int(v)
case string:
i, _ := strconv.Atoi(v)
return i
default:
return 0
}
}
func ToFloat(val interface{}) float64 {
switch v := val.(type) {
case float64:
return v
case string:
f, _ := strconv.ParseFloat(v, 64)
return f
default:
return 0.0
}
}
func ToString(val interface{}) string {
if str, ok := val.(string); ok {
return str
}
return ""
}
func ToStringSlice(val interface{}) []string {
if arr, ok := val.([]interface{}); ok {
result := make([]string, len(arr))
for i, v := range arr {
result[i] = ToString(v)
}
return result
}
return nil
}

30
vendor/github.com/redis/go-redis/v9/internal/util/convert.go generated vendored Normal file
View File

@@ -0,0 +1,30 @@
package util
import (
"fmt"
"math"
"strconv"
)
// ParseFloat parses a Redis RESP3 float reply into a Go float64,
// handling "inf", "-inf", "nan" per Redis conventions.
func ParseStringToFloat(s string) (float64, error) {
switch s {
case "inf":
return math.Inf(1), nil
case "-inf":
return math.Inf(-1), nil
case "nan", "-nan":
return math.NaN(), nil
}
return strconv.ParseFloat(s, 64)
}
// MustParseFloat is like ParseFloat but panics on parse errors.
func MustParseFloat(s string) float64 {
f, err := ParseStringToFloat(s)
if err != nil {
panic(fmt.Sprintf("redis: failed to parse float %q: %v", s, err))
}
return f
}

11
vendor/github.com/redis/go-redis/v9/internal/util/safe.go generated vendored Normal file
View File

@@ -0,0 +1,11 @@
//go:build appengine
package util
func BytesToString(b []byte) string {
return string(b)
}
func StringToBytes(s string) []byte {
return []byte(s)
}

19
vendor/github.com/redis/go-redis/v9/internal/util/strconv.go generated vendored Normal file
View File

@@ -0,0 +1,19 @@
package util
import "strconv"
func Atoi(b []byte) (int, error) {
return strconv.Atoi(BytesToString(b))
}
func ParseInt(b []byte, base int, bitSize int) (int64, error) {
return strconv.ParseInt(BytesToString(b), base, bitSize)
}
func ParseUint(b []byte, base int, bitSize int) (uint64, error) {
return strconv.ParseUint(BytesToString(b), base, bitSize)
}
func ParseFloat(b []byte, bitSize int) (float64, error) {
return strconv.ParseFloat(BytesToString(b), bitSize)
}

5
vendor/github.com/redis/go-redis/v9/internal/util/type.go generated vendored Normal file
View File

@@ -0,0 +1,5 @@
package util
func ToPtr[T any](v T) *T {
return &v
}

22
vendor/github.com/redis/go-redis/v9/internal/util/unsafe.go generated vendored Normal file
View File

@@ -0,0 +1,22 @@
//go:build !appengine
package util
import (
"unsafe"
)
// BytesToString converts byte slice to string.
func BytesToString(b []byte) string {
return *(*string)(unsafe.Pointer(&b))
}
// StringToBytes converts string to byte slice.
func StringToBytes(s string) []byte {
return *(*[]byte)(unsafe.Pointer(
&struct {
string
Cap int
}{s, len(s)},
))
}

66
vendor/github.com/redis/go-redis/v9/iterator.go generated vendored Normal file
View File

@@ -0,0 +1,66 @@
package redis
import (
"context"
)
// ScanIterator is used to incrementally iterate over a collection of elements.
type ScanIterator struct {
cmd *ScanCmd
pos int
}
// Err returns the last iterator error, if any.
func (it *ScanIterator) Err() error {
return it.cmd.Err()
}
// Next advances the cursor and returns true if more values can be read.
func (it *ScanIterator) Next(ctx context.Context) bool {
// Instantly return on errors.
if it.cmd.Err() != nil {
return false
}
// Advance cursor, check if we are still within range.
if it.pos < len(it.cmd.page) {
it.pos++
return true
}
for {
// Return if there is no more data to fetch.
if it.cmd.cursor == 0 {
return false
}
// Fetch next page.
switch it.cmd.args[0] {
case "scan", "qscan":
it.cmd.args[1] = it.cmd.cursor
default:
it.cmd.args[2] = it.cmd.cursor
}
err := it.cmd.process(ctx, it.cmd)
if err != nil {
return false
}
it.pos = 1
// Redis can occasionally return empty page.
if len(it.cmd.page) > 0 {
return true
}
}
}
// Val returns the key/field at the current cursor position.
func (it *ScanIterator) Val() string {
var v string
if it.cmd.Err() == nil && it.pos > 0 && it.pos <= len(it.cmd.page) {
v = it.cmd.page[it.pos-1]
}
return v
}

599
vendor/github.com/redis/go-redis/v9/json.go generated vendored Normal file
View File

@@ -0,0 +1,599 @@
package redis
import (
"context"
"encoding/json"
"strings"
"github.com/redis/go-redis/v9/internal/proto"
"github.com/redis/go-redis/v9/internal/util"
)
// -------------------------------------------
type JSONCmdable interface {
JSONArrAppend(ctx context.Context, key, path string, values ...interface{}) *IntSliceCmd
JSONArrIndex(ctx context.Context, key, path string, value ...interface{}) *IntSliceCmd
JSONArrIndexWithArgs(ctx context.Context, key, path string, options *JSONArrIndexArgs, value ...interface{}) *IntSliceCmd
JSONArrInsert(ctx context.Context, key, path string, index int64, values ...interface{}) *IntSliceCmd
JSONArrLen(ctx context.Context, key, path string) *IntSliceCmd
JSONArrPop(ctx context.Context, key, path string, index int) *StringSliceCmd
JSONArrTrim(ctx context.Context, key, path string) *IntSliceCmd
JSONArrTrimWithArgs(ctx context.Context, key, path string, options *JSONArrTrimArgs) *IntSliceCmd
JSONClear(ctx context.Context, key, path string) *IntCmd
JSONDebugMemory(ctx context.Context, key, path string) *IntCmd
JSONDel(ctx context.Context, key, path string) *IntCmd
JSONForget(ctx context.Context, key, path string) *IntCmd
JSONGet(ctx context.Context, key string, paths ...string) *JSONCmd
JSONGetWithArgs(ctx context.Context, key string, options *JSONGetArgs, paths ...string) *JSONCmd
JSONMerge(ctx context.Context, key, path string, value string) *StatusCmd
JSONMSetArgs(ctx context.Context, docs []JSONSetArgs) *StatusCmd
JSONMSet(ctx context.Context, params ...interface{}) *StatusCmd
JSONMGet(ctx context.Context, path string, keys ...string) *JSONSliceCmd
JSONNumIncrBy(ctx context.Context, key, path string, value float64) *JSONCmd
JSONObjKeys(ctx context.Context, key, path string) *SliceCmd
JSONObjLen(ctx context.Context, key, path string) *IntPointerSliceCmd
JSONSet(ctx context.Context, key, path string, value interface{}) *StatusCmd
JSONSetMode(ctx context.Context, key, path string, value interface{}, mode string) *StatusCmd
JSONStrAppend(ctx context.Context, key, path, value string) *IntPointerSliceCmd
JSONStrLen(ctx context.Context, key, path string) *IntPointerSliceCmd
JSONToggle(ctx context.Context, key, path string) *IntPointerSliceCmd
JSONType(ctx context.Context, key, path string) *JSONSliceCmd
}
type JSONSetArgs struct {
Key string
Path string
Value interface{}
}
type JSONArrIndexArgs struct {
Start int
Stop *int
}
type JSONArrTrimArgs struct {
Start int
Stop *int
}
type JSONCmd struct {
baseCmd
val string
expanded interface{}
}
var _ Cmder = (*JSONCmd)(nil)
func newJSONCmd(ctx context.Context, args ...interface{}) *JSONCmd {
return &JSONCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
},
}
}
func (cmd *JSONCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *JSONCmd) SetVal(val string) {
cmd.val = val
}
func (cmd *JSONCmd) Val() string {
if len(cmd.val) == 0 && cmd.expanded != nil {
val, err := json.Marshal(cmd.expanded)
if err != nil {
cmd.SetErr(err)
return ""
}
return string(val)
} else {
return cmd.val
}
}
func (cmd *JSONCmd) Result() (string, error) {
return cmd.Val(), cmd.Err()
}
func (cmd *JSONCmd) Expanded() (interface{}, error) {
if len(cmd.val) != 0 && cmd.expanded == nil {
err := json.Unmarshal([]byte(cmd.val), &cmd.expanded)
if err != nil {
return nil, err
}
}
return cmd.expanded, nil
}
func (cmd *JSONCmd) readReply(rd *proto.Reader) error {
// nil response from JSON.(M)GET (cmd.baseCmd.err will be "redis: nil")
if cmd.baseCmd.Err() == Nil {
cmd.val = ""
return Nil
}
if readType, err := rd.PeekReplyType(); err != nil {
return err
} else if readType == proto.RespArray {
size, err := rd.ReadArrayLen()
if err != nil {
return err
}
expanded := make([]interface{}, size)
for i := 0; i < size; i++ {
if expanded[i], err = rd.ReadReply(); err != nil {
return err
}
}
cmd.expanded = expanded
} else {
if str, err := rd.ReadString(); err != nil && err != Nil {
return err
} else if str == "" || err == Nil {
cmd.val = ""
} else {
cmd.val = str
}
}
return nil
}
// -------------------------------------------
type JSONSliceCmd struct {
baseCmd
val []interface{}
}
func NewJSONSliceCmd(ctx context.Context, args ...interface{}) *JSONSliceCmd {
return &JSONSliceCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
},
}
}
func (cmd *JSONSliceCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *JSONSliceCmd) SetVal(val []interface{}) {
cmd.val = val
}
func (cmd *JSONSliceCmd) Val() []interface{} {
return cmd.val
}
func (cmd *JSONSliceCmd) Result() ([]interface{}, error) {
return cmd.val, cmd.err
}
func (cmd *JSONSliceCmd) readReply(rd *proto.Reader) error {
if cmd.baseCmd.Err() == Nil {
cmd.val = nil
return Nil
}
if readType, err := rd.PeekReplyType(); err != nil {
return err
} else if readType == proto.RespArray {
response, err := rd.ReadReply()
if err != nil {
return nil
} else {
cmd.val = response.([]interface{})
}
} else {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]interface{}, n)
for i := 0; i < len(cmd.val); i++ {
switch s, err := rd.ReadString(); {
case err == Nil:
cmd.val[i] = ""
case err != nil:
return err
default:
cmd.val[i] = s
}
}
}
return nil
}
/*******************************************************************************
*
* IntPointerSliceCmd
* used to represent a RedisJSON response where the result is either an integer or nil
*
*******************************************************************************/
type IntPointerSliceCmd struct {
baseCmd
val []*int64
}
// NewIntPointerSliceCmd initialises an IntPointerSliceCmd
func NewIntPointerSliceCmd(ctx context.Context, args ...interface{}) *IntPointerSliceCmd {
return &IntPointerSliceCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
},
}
}
func (cmd *IntPointerSliceCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *IntPointerSliceCmd) SetVal(val []*int64) {
cmd.val = val
}
func (cmd *IntPointerSliceCmd) Val() []*int64 {
return cmd.val
}
func (cmd *IntPointerSliceCmd) Result() ([]*int64, error) {
return cmd.val, cmd.err
}
func (cmd *IntPointerSliceCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]*int64, n)
for i := 0; i < len(cmd.val); i++ {
val, err := rd.ReadInt()
if err != nil && err != Nil {
return err
} else if err != Nil {
cmd.val[i] = &val
}
}
return nil
}
//------------------------------------------------------------------------------
// JSONArrAppend adds the provided JSON values to the end of the array at the given path.
// For more information, see https://redis.io/commands/json.arrappend
func (c cmdable) JSONArrAppend(ctx context.Context, key, path string, values ...interface{}) *IntSliceCmd {
args := []interface{}{"JSON.ARRAPPEND", key, path}
args = append(args, values...)
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONArrIndex searches for the first occurrence of the provided JSON value in the array at the given path.
// For more information, see https://redis.io/commands/json.arrindex
func (c cmdable) JSONArrIndex(ctx context.Context, key, path string, value ...interface{}) *IntSliceCmd {
args := []interface{}{"JSON.ARRINDEX", key, path}
args = append(args, value...)
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONArrIndexWithArgs searches for the first occurrence of a JSON value in an array while allowing the start and
// stop options to be provided.
// For more information, see https://redis.io/commands/json.arrindex
func (c cmdable) JSONArrIndexWithArgs(ctx context.Context, key, path string, options *JSONArrIndexArgs, value ...interface{}) *IntSliceCmd {
args := []interface{}{"JSON.ARRINDEX", key, path}
args = append(args, value...)
if options != nil {
args = append(args, options.Start)
if options.Stop != nil {
args = append(args, *options.Stop)
}
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONArrInsert inserts the JSON values into the array at the specified path before the index (shifts to the right).
// For more information, see https://redis.io/commands/json.arrinsert
func (c cmdable) JSONArrInsert(ctx context.Context, key, path string, index int64, values ...interface{}) *IntSliceCmd {
args := []interface{}{"JSON.ARRINSERT", key, path, index}
args = append(args, values...)
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONArrLen reports the length of the JSON array at the specified path in the given key.
// For more information, see https://redis.io/commands/json.arrlen
func (c cmdable) JSONArrLen(ctx context.Context, key, path string) *IntSliceCmd {
args := []interface{}{"JSON.ARRLEN", key, path}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONArrPop removes and returns an element from the specified index in the array.
// For more information, see https://redis.io/commands/json.arrpop
func (c cmdable) JSONArrPop(ctx context.Context, key, path string, index int) *StringSliceCmd {
args := []interface{}{"JSON.ARRPOP", key, path, index}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONArrTrim trims an array to contain only the specified inclusive range of elements.
// For more information, see https://redis.io/commands/json.arrtrim
func (c cmdable) JSONArrTrim(ctx context.Context, key, path string) *IntSliceCmd {
args := []interface{}{"JSON.ARRTRIM", key, path}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONArrTrimWithArgs trims an array to contain only the specified inclusive range of elements.
// For more information, see https://redis.io/commands/json.arrtrim
func (c cmdable) JSONArrTrimWithArgs(ctx context.Context, key, path string, options *JSONArrTrimArgs) *IntSliceCmd {
args := []interface{}{"JSON.ARRTRIM", key, path}
if options != nil {
args = append(args, options.Start)
if options.Stop != nil {
args = append(args, *options.Stop)
}
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONClear clears container values (arrays/objects) and sets numeric values to 0.
// For more information, see https://redis.io/commands/json.clear
func (c cmdable) JSONClear(ctx context.Context, key, path string) *IntCmd {
args := []interface{}{"JSON.CLEAR", key, path}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONDebugMemory reports a value's memory usage in bytes (unimplemented)
// For more information, see https://redis.io/commands/json.debug-memory
func (c cmdable) JSONDebugMemory(ctx context.Context, key, path string) *IntCmd {
panic("not implemented")
}
// JSONDel deletes a value.
// For more information, see https://redis.io/commands/json.del
func (c cmdable) JSONDel(ctx context.Context, key, path string) *IntCmd {
args := []interface{}{"JSON.DEL", key, path}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONForget deletes a value.
// For more information, see https://redis.io/commands/json.forget
func (c cmdable) JSONForget(ctx context.Context, key, path string) *IntCmd {
args := []interface{}{"JSON.FORGET", key, path}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONGet returns the value at path in JSON serialized form. JSON.GET returns an
// array of strings. This function parses out the wrapping array but leaves the
// internal strings unprocessed by default (see Val())
// For more information - https://redis.io/commands/json.get/
func (c cmdable) JSONGet(ctx context.Context, key string, paths ...string) *JSONCmd {
args := make([]interface{}, len(paths)+2)
args[0] = "JSON.GET"
args[1] = key
for n, path := range paths {
args[n+2] = path
}
cmd := newJSONCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
type JSONGetArgs struct {
Indent string
Newline string
Space string
}
// JSONGetWithArgs - Retrieves the value of a key from a JSON document.
// This function also allows for specifying additional options such as:
// Indention, NewLine and Space
// For more information - https://redis.io/commands/json.get/
func (c cmdable) JSONGetWithArgs(ctx context.Context, key string, options *JSONGetArgs, paths ...string) *JSONCmd {
args := []interface{}{"JSON.GET", key}
if options != nil {
if options.Indent != "" {
args = append(args, "INDENT", options.Indent)
}
if options.Newline != "" {
args = append(args, "NEWLINE", options.Newline)
}
if options.Space != "" {
args = append(args, "SPACE", options.Space)
}
for _, path := range paths {
args = append(args, path)
}
}
cmd := newJSONCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONMerge merges a given JSON value into matching paths.
// For more information, see https://redis.io/commands/json.merge
func (c cmdable) JSONMerge(ctx context.Context, key, path string, value string) *StatusCmd {
args := []interface{}{"JSON.MERGE", key, path, value}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONMGet returns the values at the specified path from multiple key arguments.
// Note - the arguments are reversed when compared with `JSON.MGET` as we want
// to follow the pattern of having the last argument be variable.
// For more information, see https://redis.io/commands/json.mget
func (c cmdable) JSONMGet(ctx context.Context, path string, keys ...string) *JSONSliceCmd {
args := make([]interface{}, len(keys)+1)
args[0] = "JSON.MGET"
for n, key := range keys {
args[n+1] = key
}
args = append(args, path)
cmd := NewJSONSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONMSetArgs sets or updates one or more JSON values according to the specified key-path-value triplets.
// For more information, see https://redis.io/commands/json.mset
func (c cmdable) JSONMSetArgs(ctx context.Context, docs []JSONSetArgs) *StatusCmd {
args := []interface{}{"JSON.MSET"}
for _, doc := range docs {
args = append(args, doc.Key, doc.Path, doc.Value)
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) JSONMSet(ctx context.Context, params ...interface{}) *StatusCmd {
args := []interface{}{"JSON.MSET"}
args = append(args, params...)
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONNumIncrBy increments the number value stored at the specified path by the provided number.
// For more information, see https://redis.io/docs/latest/commands/json.numincrby/
func (c cmdable) JSONNumIncrBy(ctx context.Context, key, path string, value float64) *JSONCmd {
args := []interface{}{"JSON.NUMINCRBY", key, path, value}
cmd := newJSONCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONObjKeys returns the keys in the object that's referenced by the specified path.
// For more information, see https://redis.io/commands/json.objkeys
func (c cmdable) JSONObjKeys(ctx context.Context, key, path string) *SliceCmd {
args := []interface{}{"JSON.OBJKEYS", key, path}
cmd := NewSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONObjLen reports the number of keys in the JSON object at the specified path in the given key.
// For more information, see https://redis.io/commands/json.objlen
func (c cmdable) JSONObjLen(ctx context.Context, key, path string) *IntPointerSliceCmd {
args := []interface{}{"JSON.OBJLEN", key, path}
cmd := NewIntPointerSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONSet sets the JSON value at the given path in the given key. The value must be something that
// can be marshaled to JSON (using encoding/JSON) unless the argument is a string or a []byte when we assume that
// it can be passed directly as JSON.
// For more information, see https://redis.io/commands/json.set
func (c cmdable) JSONSet(ctx context.Context, key, path string, value interface{}) *StatusCmd {
return c.JSONSetMode(ctx, key, path, value, "")
}
// JSONSetMode sets the JSON value at the given path in the given key and allows the mode to be set
// (the mode value must be "XX" or "NX"). The value must be something that can be marshaled to JSON (using encoding/JSON) unless
// the argument is a string or []byte when we assume that it can be passed directly as JSON.
// For more information, see https://redis.io/commands/json.set
func (c cmdable) JSONSetMode(ctx context.Context, key, path string, value interface{}, mode string) *StatusCmd {
var bytes []byte
var err error
switch v := value.(type) {
case string:
bytes = []byte(v)
case []byte:
bytes = v
default:
bytes, err = json.Marshal(v)
}
args := []interface{}{"JSON.SET", key, path, util.BytesToString(bytes)}
if mode != "" {
switch strings.ToUpper(mode) {
case "XX", "NX":
args = append(args, strings.ToUpper(mode))
default:
panic("redis: JSON.SET mode must be NX or XX")
}
}
cmd := NewStatusCmd(ctx, args...)
if err != nil {
cmd.SetErr(err)
} else {
_ = c(ctx, cmd)
}
return cmd
}
// JSONStrAppend appends the JSON-string values to the string at the specified path.
// For more information, see https://redis.io/commands/json.strappend
func (c cmdable) JSONStrAppend(ctx context.Context, key, path, value string) *IntPointerSliceCmd {
args := []interface{}{"JSON.STRAPPEND", key, path, value}
cmd := NewIntPointerSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONStrLen reports the length of the JSON String at the specified path in the given key.
// For more information, see https://redis.io/commands/json.strlen
func (c cmdable) JSONStrLen(ctx context.Context, key, path string) *IntPointerSliceCmd {
args := []interface{}{"JSON.STRLEN", key, path}
cmd := NewIntPointerSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONToggle toggles a Boolean value stored at the specified path.
// For more information, see https://redis.io/commands/json.toggle
func (c cmdable) JSONToggle(ctx context.Context, key, path string) *IntPointerSliceCmd {
args := []interface{}{"JSON.TOGGLE", key, path}
cmd := NewIntPointerSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONType reports the type of JSON value at the specified path.
// For more information, see https://redis.io/commands/json.type
func (c cmdable) JSONType(ctx context.Context, key, path string) *JSONSliceCmd {
args := []interface{}{"JSON.TYPE", key, path}
cmd := NewJSONSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}

289
vendor/github.com/redis/go-redis/v9/list_commands.go generated vendored Normal file
View File

@@ -0,0 +1,289 @@
package redis
import (
"context"
"strings"
"time"
)
type ListCmdable interface {
BLPop(ctx context.Context, timeout time.Duration, keys ...string) *StringSliceCmd
BLMPop(ctx context.Context, timeout time.Duration, direction string, count int64, keys ...string) *KeyValuesCmd
BRPop(ctx context.Context, timeout time.Duration, keys ...string) *StringSliceCmd
BRPopLPush(ctx context.Context, source, destination string, timeout time.Duration) *StringCmd
LIndex(ctx context.Context, key string, index int64) *StringCmd
LInsert(ctx context.Context, key, op string, pivot, value interface{}) *IntCmd
LInsertBefore(ctx context.Context, key string, pivot, value interface{}) *IntCmd
LInsertAfter(ctx context.Context, key string, pivot, value interface{}) *IntCmd
LLen(ctx context.Context, key string) *IntCmd
LMPop(ctx context.Context, direction string, count int64, keys ...string) *KeyValuesCmd
LPop(ctx context.Context, key string) *StringCmd
LPopCount(ctx context.Context, key string, count int) *StringSliceCmd
LPos(ctx context.Context, key string, value string, args LPosArgs) *IntCmd
LPosCount(ctx context.Context, key string, value string, count int64, args LPosArgs) *IntSliceCmd
LPush(ctx context.Context, key string, values ...interface{}) *IntCmd
LPushX(ctx context.Context, key string, values ...interface{}) *IntCmd
LRange(ctx context.Context, key string, start, stop int64) *StringSliceCmd
LRem(ctx context.Context, key string, count int64, value interface{}) *IntCmd
LSet(ctx context.Context, key string, index int64, value interface{}) *StatusCmd
LTrim(ctx context.Context, key string, start, stop int64) *StatusCmd
RPop(ctx context.Context, key string) *StringCmd
RPopCount(ctx context.Context, key string, count int) *StringSliceCmd
RPopLPush(ctx context.Context, source, destination string) *StringCmd
RPush(ctx context.Context, key string, values ...interface{}) *IntCmd
RPushX(ctx context.Context, key string, values ...interface{}) *IntCmd
LMove(ctx context.Context, source, destination, srcpos, destpos string) *StringCmd
BLMove(ctx context.Context, source, destination, srcpos, destpos string, timeout time.Duration) *StringCmd
}
func (c cmdable) BLPop(ctx context.Context, timeout time.Duration, keys ...string) *StringSliceCmd {
args := make([]interface{}, 1+len(keys)+1)
args[0] = "blpop"
for i, key := range keys {
args[1+i] = key
}
args[len(args)-1] = formatSec(ctx, timeout)
cmd := NewStringSliceCmd(ctx, args...)
cmd.setReadTimeout(timeout)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) BLMPop(ctx context.Context, timeout time.Duration, direction string, count int64, keys ...string) *KeyValuesCmd {
args := make([]interface{}, 3+len(keys), 6+len(keys))
args[0] = "blmpop"
args[1] = formatSec(ctx, timeout)
args[2] = len(keys)
for i, key := range keys {
args[3+i] = key
}
args = append(args, strings.ToLower(direction), "count", count)
cmd := NewKeyValuesCmd(ctx, args...)
cmd.setReadTimeout(timeout)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) BRPop(ctx context.Context, timeout time.Duration, keys ...string) *StringSliceCmd {
args := make([]interface{}, 1+len(keys)+1)
args[0] = "brpop"
for i, key := range keys {
args[1+i] = key
}
args[len(keys)+1] = formatSec(ctx, timeout)
cmd := NewStringSliceCmd(ctx, args...)
cmd.setReadTimeout(timeout)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) BRPopLPush(ctx context.Context, source, destination string, timeout time.Duration) *StringCmd {
cmd := NewStringCmd(
ctx,
"brpoplpush",
source,
destination,
formatSec(ctx, timeout),
)
cmd.setReadTimeout(timeout)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LIndex(ctx context.Context, key string, index int64) *StringCmd {
cmd := NewStringCmd(ctx, "lindex", key, index)
_ = c(ctx, cmd)
return cmd
}
// LMPop Pops one or more elements from the first non-empty list key from the list of provided key names.
// direction: left or right, count: > 0
// example: client.LMPop(ctx, "left", 3, "key1", "key2")
func (c cmdable) LMPop(ctx context.Context, direction string, count int64, keys ...string) *KeyValuesCmd {
args := make([]interface{}, 2+len(keys), 5+len(keys))
args[0] = "lmpop"
args[1] = len(keys)
for i, key := range keys {
args[2+i] = key
}
args = append(args, strings.ToLower(direction), "count", count)
cmd := NewKeyValuesCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LInsert(ctx context.Context, key, op string, pivot, value interface{}) *IntCmd {
cmd := NewIntCmd(ctx, "linsert", key, op, pivot, value)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LInsertBefore(ctx context.Context, key string, pivot, value interface{}) *IntCmd {
cmd := NewIntCmd(ctx, "linsert", key, "before", pivot, value)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LInsertAfter(ctx context.Context, key string, pivot, value interface{}) *IntCmd {
cmd := NewIntCmd(ctx, "linsert", key, "after", pivot, value)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LLen(ctx context.Context, key string) *IntCmd {
cmd := NewIntCmd(ctx, "llen", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LPop(ctx context.Context, key string) *StringCmd {
cmd := NewStringCmd(ctx, "lpop", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LPopCount(ctx context.Context, key string, count int) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "lpop", key, count)
_ = c(ctx, cmd)
return cmd
}
type LPosArgs struct {
Rank, MaxLen int64
}
func (c cmdable) LPos(ctx context.Context, key string, value string, a LPosArgs) *IntCmd {
args := []interface{}{"lpos", key, value}
if a.Rank != 0 {
args = append(args, "rank", a.Rank)
}
if a.MaxLen != 0 {
args = append(args, "maxlen", a.MaxLen)
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LPosCount(ctx context.Context, key string, value string, count int64, a LPosArgs) *IntSliceCmd {
args := []interface{}{"lpos", key, value, "count", count}
if a.Rank != 0 {
args = append(args, "rank", a.Rank)
}
if a.MaxLen != 0 {
args = append(args, "maxlen", a.MaxLen)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LPush(ctx context.Context, key string, values ...interface{}) *IntCmd {
args := make([]interface{}, 2, 2+len(values))
args[0] = "lpush"
args[1] = key
args = appendArgs(args, values)
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LPushX(ctx context.Context, key string, values ...interface{}) *IntCmd {
args := make([]interface{}, 2, 2+len(values))
args[0] = "lpushx"
args[1] = key
args = appendArgs(args, values)
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LRange(ctx context.Context, key string, start, stop int64) *StringSliceCmd {
cmd := NewStringSliceCmd(
ctx,
"lrange",
key,
start,
stop,
)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LRem(ctx context.Context, key string, count int64, value interface{}) *IntCmd {
cmd := NewIntCmd(ctx, "lrem", key, count, value)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LSet(ctx context.Context, key string, index int64, value interface{}) *StatusCmd {
cmd := NewStatusCmd(ctx, "lset", key, index, value)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LTrim(ctx context.Context, key string, start, stop int64) *StatusCmd {
cmd := NewStatusCmd(
ctx,
"ltrim",
key,
start,
stop,
)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) RPop(ctx context.Context, key string) *StringCmd {
cmd := NewStringCmd(ctx, "rpop", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) RPopCount(ctx context.Context, key string, count int) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "rpop", key, count)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) RPopLPush(ctx context.Context, source, destination string) *StringCmd {
cmd := NewStringCmd(ctx, "rpoplpush", source, destination)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) RPush(ctx context.Context, key string, values ...interface{}) *IntCmd {
args := make([]interface{}, 2, 2+len(values))
args[0] = "rpush"
args[1] = key
args = appendArgs(args, values)
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) RPushX(ctx context.Context, key string, values ...interface{}) *IntCmd {
args := make([]interface{}, 2, 2+len(values))
args[0] = "rpushx"
args[1] = key
args = appendArgs(args, values)
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LMove(ctx context.Context, source, destination, srcpos, destpos string) *StringCmd {
cmd := NewStringCmd(ctx, "lmove", source, destination, srcpos, destpos)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) BLMove(
ctx context.Context, source, destination, srcpos, destpos string, timeout time.Duration,
) *StringCmd {
cmd := NewStringCmd(ctx, "blmove", source, destination, srcpos, destpos, formatSec(ctx, timeout))
cmd.setReadTimeout(timeout)
_ = c(ctx, cmd)
return cmd
}

596
vendor/github.com/redis/go-redis/v9/options.go generated vendored Normal file
View File

@@ -0,0 +1,596 @@
package redis
import (
"context"
"crypto/tls"
"errors"
"fmt"
"net"
"net/url"
"runtime"
"sort"
"strconv"
"strings"
"time"
"github.com/redis/go-redis/v9/auth"
"github.com/redis/go-redis/v9/internal/pool"
)
// Limiter is the interface of a rate limiter or a circuit breaker.
type Limiter interface {
// Allow returns nil if operation is allowed or an error otherwise.
// If operation is allowed client must ReportResult of the operation
// whether it is a success or a failure.
Allow() error
// ReportResult reports the result of the previously allowed operation.
// nil indicates a success, non-nil error usually indicates a failure.
ReportResult(result error)
}
// Options keeps the settings to set up redis connection.
type Options struct {
// Network type, either tcp or unix.
//
// default: is tcp.
Network string
// Addr is the address formated as host:port
Addr string
// ClientName will execute the `CLIENT SETNAME ClientName` command for each conn.
ClientName string
// Dialer creates new network connection and has priority over
// Network and Addr options.
Dialer func(ctx context.Context, network, addr string) (net.Conn, error)
// Hook that is called when new connection is established.
OnConnect func(ctx context.Context, cn *Conn) error
// Protocol 2 or 3. Use the version to negotiate RESP version with redis-server.
//
// default: 3.
Protocol int
// Username is used to authenticate the current connection
// with one of the connections defined in the ACL list when connecting
// to a Redis 6.0 instance, or greater, that is using the Redis ACL system.
Username string
// Password is an optional password. Must match the password specified in the
// `requirepass` server configuration option (if connecting to a Redis 5.0 instance, or lower),
// or the User Password when connecting to a Redis 6.0 instance, or greater,
// that is using the Redis ACL system.
Password string
// CredentialsProvider allows the username and password to be updated
// before reconnecting. It should return the current username and password.
CredentialsProvider func() (username string, password string)
// CredentialsProviderContext is an enhanced parameter of CredentialsProvider,
// done to maintain API compatibility. In the future,
// there might be a merge between CredentialsProviderContext and CredentialsProvider.
// There will be a conflict between them; if CredentialsProviderContext exists, we will ignore CredentialsProvider.
CredentialsProviderContext func(ctx context.Context) (username string, password string, err error)
// StreamingCredentialsProvider is used to retrieve the credentials
// for the connection from an external source. Those credentials may change
// during the connection lifetime. This is useful for managed identity
// scenarios where the credentials are retrieved from an external source.
//
// Currently, this is a placeholder for the future implementation.
StreamingCredentialsProvider auth.StreamingCredentialsProvider
// DB is the database to be selected after connecting to the server.
DB int
// MaxRetries is the maximum number of retries before giving up.
// -1 (not 0) disables retries.
//
// default: 3 retries
MaxRetries int
// MinRetryBackoff is the minimum backoff between each retry.
// -1 disables backoff.
//
// default: 8 milliseconds
MinRetryBackoff time.Duration
// MaxRetryBackoff is the maximum backoff between each retry.
// -1 disables backoff.
// default: 512 milliseconds;
MaxRetryBackoff time.Duration
// DialTimeout for establishing new connections.
//
// default: 5 seconds
DialTimeout time.Duration
// ReadTimeout for socket reads. If reached, commands will fail
// with a timeout instead of blocking. Supported values:
//
// - `-1` - no timeout (block indefinitely).
// - `-2` - disables SetReadDeadline calls completely.
//
// default: 3 seconds
ReadTimeout time.Duration
// WriteTimeout for socket writes. If reached, commands will fail
// with a timeout instead of blocking. Supported values:
//
// - `-1` - no timeout (block indefinitely).
// - `-2` - disables SetWriteDeadline calls completely.
//
// default: 3 seconds
WriteTimeout time.Duration
// ContextTimeoutEnabled controls whether the client respects context timeouts and deadlines.
// See https://redis.uptrace.dev/guide/go-redis-debugging.html#timeouts
ContextTimeoutEnabled bool
// PoolFIFO type of connection pool.
//
// - true for FIFO pool
// - false for LIFO pool.
//
// Note that FIFO has slightly higher overhead compared to LIFO,
// but it helps closing idle connections faster reducing the pool size.
PoolFIFO bool
// PoolSize is the base number of socket connections.
// Default is 10 connections per every available CPU as reported by runtime.GOMAXPROCS.
// If there is not enough connections in the pool, new connections will be allocated in excess of PoolSize,
// you can limit it through MaxActiveConns
//
// default: 10 * runtime.GOMAXPROCS(0)
PoolSize int
// PoolTimeout is the amount of time client waits for connection if all connections
// are busy before returning an error.
//
// default: ReadTimeout + 1 second
PoolTimeout time.Duration
// MinIdleConns is the minimum number of idle connections which is useful when establishing
// new connection is slow. The idle connections are not closed by default.
//
// default: 0
MinIdleConns int
// MaxIdleConns is the maximum number of idle connections.
// The idle connections are not closed by default.
//
// default: 0
MaxIdleConns int
// MaxActiveConns is the maximum number of connections allocated by the pool at a given time.
// When zero, there is no limit on the number of connections in the pool.
// If the pool is full, the next call to Get() will block until a connection is released.
MaxActiveConns int
// ConnMaxIdleTime is the maximum amount of time a connection may be idle.
// Should be less than server's timeout.
//
// Expired connections may be closed lazily before reuse.
// If d <= 0, connections are not closed due to a connection's idle time.
// -1 disables idle timeout check.
//
// default: 30 minutes
ConnMaxIdleTime time.Duration
// ConnMaxLifetime is the maximum amount of time a connection may be reused.
//
// Expired connections may be closed lazily before reuse.
// If <= 0, connections are not closed due to a connection's age.
//
// default: 0
ConnMaxLifetime time.Duration
// TLSConfig to use. When set, TLS will be negotiated.
TLSConfig *tls.Config
// Limiter interface used to implement circuit breaker or rate limiter.
Limiter Limiter
// readOnly enables read only queries on slave/follower nodes.
readOnly bool
// DisableIndentity - Disable set-lib on connect.
//
// default: false
//
// Deprecated: Use DisableIdentity instead.
DisableIndentity bool
// DisableIdentity is used to disable CLIENT SETINFO command on connect.
//
// default: false
DisableIdentity bool
// Add suffix to client name. Default is empty.
// IdentitySuffix - add suffix to client name.
IdentitySuffix string
// UnstableResp3 enables Unstable mode for Redis Search module with RESP3.
// When unstable mode is enabled, the client will use RESP3 protocol and only be able to use RawResult
UnstableResp3 bool
}
func (opt *Options) init() {
if opt.Addr == "" {
opt.Addr = "localhost:6379"
}
if opt.Network == "" {
if strings.HasPrefix(opt.Addr, "/") {
opt.Network = "unix"
} else {
opt.Network = "tcp"
}
}
if opt.Protocol < 2 {
opt.Protocol = 3
}
if opt.DialTimeout == 0 {
opt.DialTimeout = 5 * time.Second
}
if opt.Dialer == nil {
opt.Dialer = NewDialer(opt)
}
if opt.PoolSize == 0 {
opt.PoolSize = 10 * runtime.GOMAXPROCS(0)
}
switch opt.ReadTimeout {
case -2:
opt.ReadTimeout = -1
case -1:
opt.ReadTimeout = 0
case 0:
opt.ReadTimeout = 3 * time.Second
}
switch opt.WriteTimeout {
case -2:
opt.WriteTimeout = -1
case -1:
opt.WriteTimeout = 0
case 0:
opt.WriteTimeout = opt.ReadTimeout
}
if opt.PoolTimeout == 0 {
if opt.ReadTimeout > 0 {
opt.PoolTimeout = opt.ReadTimeout + time.Second
} else {
opt.PoolTimeout = 30 * time.Second
}
}
if opt.ConnMaxIdleTime == 0 {
opt.ConnMaxIdleTime = 30 * time.Minute
}
switch opt.MaxRetries {
case -1:
opt.MaxRetries = 0
case 0:
opt.MaxRetries = 3
}
switch opt.MinRetryBackoff {
case -1:
opt.MinRetryBackoff = 0
case 0:
opt.MinRetryBackoff = 8 * time.Millisecond
}
switch opt.MaxRetryBackoff {
case -1:
opt.MaxRetryBackoff = 0
case 0:
opt.MaxRetryBackoff = 512 * time.Millisecond
}
}
func (opt *Options) clone() *Options {
clone := *opt
return &clone
}
// NewDialer returns a function that will be used as the default dialer
// when none is specified in Options.Dialer.
func NewDialer(opt *Options) func(context.Context, string, string) (net.Conn, error) {
return func(ctx context.Context, network, addr string) (net.Conn, error) {
netDialer := &net.Dialer{
Timeout: opt.DialTimeout,
KeepAlive: 5 * time.Minute,
}
if opt.TLSConfig == nil {
return netDialer.DialContext(ctx, network, addr)
}
return tls.DialWithDialer(netDialer, network, addr, opt.TLSConfig)
}
}
// ParseURL parses a URL into Options that can be used to connect to Redis.
// Scheme is required.
// There are two connection types: by tcp socket and by unix socket.
// Tcp connection:
//
// redis://<user>:<password>@<host>:<port>/<db_number>
//
// Unix connection:
//
// unix://<user>:<password>@</path/to/redis.sock>?db=<db_number>
//
// Most Option fields can be set using query parameters, with the following restrictions:
// - field names are mapped using snake-case conversion: to set MaxRetries, use max_retries
// - only scalar type fields are supported (bool, int, time.Duration)
// - for time.Duration fields, values must be a valid input for time.ParseDuration();
// additionally a plain integer as value (i.e. without unit) is interpreted as seconds
// - to disable a duration field, use value less than or equal to 0; to use the default
// value, leave the value blank or remove the parameter
// - only the last value is interpreted if a parameter is given multiple times
// - fields "network", "addr", "username" and "password" can only be set using other
// URL attributes (scheme, host, userinfo, resp.), query parameters using these
// names will be treated as unknown parameters
// - unknown parameter names will result in an error
// - use "skip_verify=true" to ignore TLS certificate validation
//
// Examples:
//
// redis://user:password@localhost:6789/3?dial_timeout=3&db=1&read_timeout=6s&max_retries=2
// is equivalent to:
// &Options{
// Network: "tcp",
// Addr: "localhost:6789",
// DB: 1, // path "/3" was overridden by "&db=1"
// DialTimeout: 3 * time.Second, // no time unit = seconds
// ReadTimeout: 6 * time.Second,
// MaxRetries: 2,
// }
func ParseURL(redisURL string) (*Options, error) {
u, err := url.Parse(redisURL)
if err != nil {
return nil, err
}
switch u.Scheme {
case "redis", "rediss":
return setupTCPConn(u)
case "unix":
return setupUnixConn(u)
default:
return nil, fmt.Errorf("redis: invalid URL scheme: %s", u.Scheme)
}
}
func setupTCPConn(u *url.URL) (*Options, error) {
o := &Options{Network: "tcp"}
o.Username, o.Password = getUserPassword(u)
h, p := getHostPortWithDefaults(u)
o.Addr = net.JoinHostPort(h, p)
f := strings.FieldsFunc(u.Path, func(r rune) bool {
return r == '/'
})
switch len(f) {
case 0:
o.DB = 0
case 1:
var err error
if o.DB, err = strconv.Atoi(f[0]); err != nil {
return nil, fmt.Errorf("redis: invalid database number: %q", f[0])
}
default:
return nil, fmt.Errorf("redis: invalid URL path: %s", u.Path)
}
if u.Scheme == "rediss" {
o.TLSConfig = &tls.Config{
ServerName: h,
MinVersion: tls.VersionTLS12,
}
}
return setupConnParams(u, o)
}
// getHostPortWithDefaults is a helper function that splits the url into
// a host and a port. If the host is missing, it defaults to localhost
// and if the port is missing, it defaults to 6379.
func getHostPortWithDefaults(u *url.URL) (string, string) {
host, port, err := net.SplitHostPort(u.Host)
if err != nil {
host = u.Host
}
if host == "" {
host = "localhost"
}
if port == "" {
port = "6379"
}
return host, port
}
func setupUnixConn(u *url.URL) (*Options, error) {
o := &Options{
Network: "unix",
}
if strings.TrimSpace(u.Path) == "" { // path is required with unix connection
return nil, errors.New("redis: empty unix socket path")
}
o.Addr = u.Path
o.Username, o.Password = getUserPassword(u)
return setupConnParams(u, o)
}
type queryOptions struct {
q url.Values
err error
}
func (o *queryOptions) has(name string) bool {
return len(o.q[name]) > 0
}
func (o *queryOptions) string(name string) string {
vs := o.q[name]
if len(vs) == 0 {
return ""
}
delete(o.q, name) // enable detection of unknown parameters
return vs[len(vs)-1]
}
func (o *queryOptions) strings(name string) []string {
vs := o.q[name]
delete(o.q, name)
return vs
}
func (o *queryOptions) int(name string) int {
s := o.string(name)
if s == "" {
return 0
}
i, err := strconv.Atoi(s)
if err == nil {
return i
}
if o.err == nil {
o.err = fmt.Errorf("redis: invalid %s number: %s", name, err)
}
return 0
}
func (o *queryOptions) duration(name string) time.Duration {
s := o.string(name)
if s == "" {
return 0
}
// try plain number first
if i, err := strconv.Atoi(s); err == nil {
if i <= 0 {
// disable timeouts
return -1
}
return time.Duration(i) * time.Second
}
dur, err := time.ParseDuration(s)
if err == nil {
return dur
}
if o.err == nil {
o.err = fmt.Errorf("redis: invalid %s duration: %w", name, err)
}
return 0
}
func (o *queryOptions) bool(name string) bool {
switch s := o.string(name); s {
case "true", "1":
return true
case "false", "0", "":
return false
default:
if o.err == nil {
o.err = fmt.Errorf("redis: invalid %s boolean: expected true/false/1/0 or an empty string, got %q", name, s)
}
return false
}
}
func (o *queryOptions) remaining() []string {
if len(o.q) == 0 {
return nil
}
keys := make([]string, 0, len(o.q))
for k := range o.q {
keys = append(keys, k)
}
sort.Strings(keys)
return keys
}
// setupConnParams converts query parameters in u to option value in o.
func setupConnParams(u *url.URL, o *Options) (*Options, error) {
q := queryOptions{q: u.Query()}
// compat: a future major release may use q.int("db")
if tmp := q.string("db"); tmp != "" {
db, err := strconv.Atoi(tmp)
if err != nil {
return nil, fmt.Errorf("redis: invalid database number: %w", err)
}
o.DB = db
}
o.Protocol = q.int("protocol")
o.ClientName = q.string("client_name")
o.MaxRetries = q.int("max_retries")
o.MinRetryBackoff = q.duration("min_retry_backoff")
o.MaxRetryBackoff = q.duration("max_retry_backoff")
o.DialTimeout = q.duration("dial_timeout")
o.ReadTimeout = q.duration("read_timeout")
o.WriteTimeout = q.duration("write_timeout")
o.PoolFIFO = q.bool("pool_fifo")
o.PoolSize = q.int("pool_size")
o.PoolTimeout = q.duration("pool_timeout")
o.MinIdleConns = q.int("min_idle_conns")
o.MaxIdleConns = q.int("max_idle_conns")
o.MaxActiveConns = q.int("max_active_conns")
if q.has("conn_max_idle_time") {
o.ConnMaxIdleTime = q.duration("conn_max_idle_time")
} else {
o.ConnMaxIdleTime = q.duration("idle_timeout")
}
if q.has("conn_max_lifetime") {
o.ConnMaxLifetime = q.duration("conn_max_lifetime")
} else {
o.ConnMaxLifetime = q.duration("max_conn_age")
}
if q.err != nil {
return nil, q.err
}
if o.TLSConfig != nil && q.has("skip_verify") {
o.TLSConfig.InsecureSkipVerify = q.bool("skip_verify")
}
// any parameters left?
if r := q.remaining(); len(r) > 0 {
return nil, fmt.Errorf("redis: unexpected option: %s", strings.Join(r, ", "))
}
return o, nil
}
func getUserPassword(u *url.URL) (string, string) {
var user, password string
if u.User != nil {
user = u.User.Username()
if p, ok := u.User.Password(); ok {
password = p
}
}
return user, password
}
func newConnPool(
opt *Options,
dialer func(ctx context.Context, network, addr string) (net.Conn, error),
) *pool.ConnPool {
return pool.NewConnPool(&pool.Options{
Dialer: func(ctx context.Context) (net.Conn, error) {
return dialer(ctx, opt.Network, opt.Addr)
},
PoolFIFO: opt.PoolFIFO,
PoolSize: opt.PoolSize,
PoolTimeout: opt.PoolTimeout,
DialTimeout: opt.DialTimeout,
MinIdleConns: opt.MinIdleConns,
MaxIdleConns: opt.MaxIdleConns,
MaxActiveConns: opt.MaxActiveConns,
ConnMaxIdleTime: opt.ConnMaxIdleTime,
ConnMaxLifetime: opt.ConnMaxLifetime,
})
}

2047
vendor/github.com/redis/go-redis/v9/osscluster.go generated vendored Normal file
View File

File diff suppressed because it is too large Load Diff

109
vendor/github.com/redis/go-redis/v9/osscluster_commands.go generated vendored Normal file
View File

@@ -0,0 +1,109 @@
package redis
import (
"context"
"sync"
"sync/atomic"
)
func (c *ClusterClient) DBSize(ctx context.Context) *IntCmd {
cmd := NewIntCmd(ctx, "dbsize")
_ = c.withProcessHook(ctx, cmd, func(ctx context.Context, _ Cmder) error {
var size int64
err := c.ForEachMaster(ctx, func(ctx context.Context, master *Client) error {
n, err := master.DBSize(ctx).Result()
if err != nil {
return err
}
atomic.AddInt64(&size, n)
return nil
})
if err != nil {
cmd.SetErr(err)
} else {
cmd.val = size
}
return nil
})
return cmd
}
func (c *ClusterClient) ScriptLoad(ctx context.Context, script string) *StringCmd {
cmd := NewStringCmd(ctx, "script", "load", script)
_ = c.withProcessHook(ctx, cmd, func(ctx context.Context, _ Cmder) error {
var mu sync.Mutex
err := c.ForEachShard(ctx, func(ctx context.Context, shard *Client) error {
val, err := shard.ScriptLoad(ctx, script).Result()
if err != nil {
return err
}
mu.Lock()
if cmd.Val() == "" {
cmd.val = val
}
mu.Unlock()
return nil
})
if err != nil {
cmd.SetErr(err)
}
return nil
})
return cmd
}
func (c *ClusterClient) ScriptFlush(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "script", "flush")
_ = c.withProcessHook(ctx, cmd, func(ctx context.Context, _ Cmder) error {
err := c.ForEachShard(ctx, func(ctx context.Context, shard *Client) error {
return shard.ScriptFlush(ctx).Err()
})
if err != nil {
cmd.SetErr(err)
}
return nil
})
return cmd
}
func (c *ClusterClient) ScriptExists(ctx context.Context, hashes ...string) *BoolSliceCmd {
args := make([]interface{}, 2+len(hashes))
args[0] = "script"
args[1] = "exists"
for i, hash := range hashes {
args[2+i] = hash
}
cmd := NewBoolSliceCmd(ctx, args...)
result := make([]bool, len(hashes))
for i := range result {
result[i] = true
}
_ = c.withProcessHook(ctx, cmd, func(ctx context.Context, _ Cmder) error {
var mu sync.Mutex
err := c.ForEachShard(ctx, func(ctx context.Context, shard *Client) error {
val, err := shard.ScriptExists(ctx, hashes...).Result()
if err != nil {
return err
}
mu.Lock()
for i, v := range val {
result[i] = result[i] && v
}
mu.Unlock()
return nil
})
if err != nil {
cmd.SetErr(err)
} else {
cmd.val = result
}
return nil
})
return cmd
}

121
vendor/github.com/redis/go-redis/v9/pipeline.go generated vendored Normal file
View File

@@ -0,0 +1,121 @@
package redis
import (
"context"
"errors"
)
type pipelineExecer func(context.Context, []Cmder) error
// Pipeliner is an mechanism to realise Redis Pipeline technique.
//
// Pipelining is a technique to extremely speed up processing by packing
// operations to batches, send them at once to Redis and read a replies in a
// single step.
// See https://redis.io/topics/pipelining
//
// Pay attention, that Pipeline is not a transaction, so you can get unexpected
// results in case of big pipelines and small read/write timeouts.
// Redis client has retransmission logic in case of timeouts, pipeline
// can be retransmitted and commands can be executed more then once.
// To avoid this: it is good idea to use reasonable bigger read/write timeouts
// depends of your batch size and/or use TxPipeline.
type Pipeliner interface {
StatefulCmdable
// Len is to obtain the number of commands in the pipeline that have not yet been executed.
Len() int
// Do is an API for executing any command.
// If a certain Redis command is not yet supported, you can use Do to execute it.
Do(ctx context.Context, args ...interface{}) *Cmd
// Process is to put the commands to be executed into the pipeline buffer.
Process(ctx context.Context, cmd Cmder) error
// Discard is to discard all commands in the cache that have not yet been executed.
Discard()
// Exec is to send all the commands buffered in the pipeline to the redis-server.
Exec(ctx context.Context) ([]Cmder, error)
}
var _ Pipeliner = (*Pipeline)(nil)
// Pipeline implements pipelining as described in
// http://redis.io/topics/pipelining.
// Please note: it is not safe for concurrent use by multiple goroutines.
type Pipeline struct {
cmdable
statefulCmdable
exec pipelineExecer
cmds []Cmder
}
func (c *Pipeline) init() {
c.cmdable = c.Process
c.statefulCmdable = c.Process
}
// Len returns the number of queued commands.
func (c *Pipeline) Len() int {
return len(c.cmds)
}
// Do queues the custom command for later execution.
func (c *Pipeline) Do(ctx context.Context, args ...interface{}) *Cmd {
cmd := NewCmd(ctx, args...)
if len(args) == 0 {
cmd.SetErr(errors.New("redis: please enter the command to be executed"))
return cmd
}
_ = c.Process(ctx, cmd)
return cmd
}
// Process queues the cmd for later execution.
func (c *Pipeline) Process(ctx context.Context, cmd Cmder) error {
c.cmds = append(c.cmds, cmd)
return nil
}
// Discard resets the pipeline and discards queued commands.
func (c *Pipeline) Discard() {
c.cmds = c.cmds[:0]
}
// Exec executes all previously queued commands using one
// client-server roundtrip.
//
// Exec always returns list of commands and error of the first failed
// command if any.
func (c *Pipeline) Exec(ctx context.Context) ([]Cmder, error) {
if len(c.cmds) == 0 {
return nil, nil
}
cmds := c.cmds
c.cmds = nil
return cmds, c.exec(ctx, cmds)
}
func (c *Pipeline) Pipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error) {
if err := fn(c); err != nil {
return nil, err
}
return c.Exec(ctx)
}
func (c *Pipeline) Pipeline() Pipeliner {
return c
}
func (c *Pipeline) TxPipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error) {
return c.Pipelined(ctx, fn)
}
func (c *Pipeline) TxPipeline() Pipeliner {
return c
}

1433
vendor/github.com/redis/go-redis/v9/probabilistic.go generated vendored Normal file
View File

File diff suppressed because it is too large Load Diff

732
vendor/github.com/redis/go-redis/v9/pubsub.go generated vendored Normal file
View File

@@ -0,0 +1,732 @@
package redis
import (
"context"
"fmt"
"strings"
"sync"
"time"
"github.com/redis/go-redis/v9/internal"
"github.com/redis/go-redis/v9/internal/pool"
"github.com/redis/go-redis/v9/internal/proto"
)
// PubSub implements Pub/Sub commands as described in
// http://redis.io/topics/pubsub. Message receiving is NOT safe
// for concurrent use by multiple goroutines.
//
// PubSub automatically reconnects to Redis Server and resubscribes
// to the channels in case of network errors.
type PubSub struct {
opt *Options
newConn func(ctx context.Context, channels []string) (*pool.Conn, error)
closeConn func(*pool.Conn) error
mu sync.Mutex
cn *pool.Conn
channels map[string]struct{}
patterns map[string]struct{}
schannels map[string]struct{}
closed bool
exit chan struct{}
cmd *Cmd
chOnce sync.Once
msgCh *channel
allCh *channel
}
func (c *PubSub) init() {
c.exit = make(chan struct{})
}
func (c *PubSub) String() string {
c.mu.Lock()
defer c.mu.Unlock()
channels := mapKeys(c.channels)
channels = append(channels, mapKeys(c.patterns)...)
channels = append(channels, mapKeys(c.schannels)...)
return fmt.Sprintf("PubSub(%s)", strings.Join(channels, ", "))
}
func (c *PubSub) connWithLock(ctx context.Context) (*pool.Conn, error) {
c.mu.Lock()
cn, err := c.conn(ctx, nil)
c.mu.Unlock()
return cn, err
}
func (c *PubSub) conn(ctx context.Context, newChannels []string) (*pool.Conn, error) {
if c.closed {
return nil, pool.ErrClosed
}
if c.cn != nil {
return c.cn, nil
}
channels := mapKeys(c.channels)
channels = append(channels, newChannels...)
cn, err := c.newConn(ctx, channels)
if err != nil {
return nil, err
}
if err := c.resubscribe(ctx, cn); err != nil {
_ = c.closeConn(cn)
return nil, err
}
c.cn = cn
return cn, nil
}
func (c *PubSub) writeCmd(ctx context.Context, cn *pool.Conn, cmd Cmder) error {
return cn.WithWriter(ctx, c.opt.WriteTimeout, func(wr *proto.Writer) error {
return writeCmd(wr, cmd)
})
}
func (c *PubSub) resubscribe(ctx context.Context, cn *pool.Conn) error {
var firstErr error
if len(c.channels) > 0 {
firstErr = c._subscribe(ctx, cn, "subscribe", mapKeys(c.channels))
}
if len(c.patterns) > 0 {
err := c._subscribe(ctx, cn, "psubscribe", mapKeys(c.patterns))
if err != nil && firstErr == nil {
firstErr = err
}
}
if len(c.schannels) > 0 {
err := c._subscribe(ctx, cn, "ssubscribe", mapKeys(c.schannels))
if err != nil && firstErr == nil {
firstErr = err
}
}
return firstErr
}
func mapKeys(m map[string]struct{}) []string {
s := make([]string, len(m))
i := 0
for k := range m {
s[i] = k
i++
}
return s
}
func (c *PubSub) _subscribe(
ctx context.Context, cn *pool.Conn, redisCmd string, channels []string,
) error {
args := make([]interface{}, 0, 1+len(channels))
args = append(args, redisCmd)
for _, channel := range channels {
args = append(args, channel)
}
cmd := NewSliceCmd(ctx, args...)
return c.writeCmd(ctx, cn, cmd)
}
func (c *PubSub) releaseConnWithLock(
ctx context.Context,
cn *pool.Conn,
err error,
allowTimeout bool,
) {
c.mu.Lock()
c.releaseConn(ctx, cn, err, allowTimeout)
c.mu.Unlock()
}
func (c *PubSub) releaseConn(ctx context.Context, cn *pool.Conn, err error, allowTimeout bool) {
if c.cn != cn {
return
}
if isBadConn(err, allowTimeout, c.opt.Addr) {
c.reconnect(ctx, err)
}
}
func (c *PubSub) reconnect(ctx context.Context, reason error) {
_ = c.closeTheCn(reason)
_, _ = c.conn(ctx, nil)
}
func (c *PubSub) closeTheCn(reason error) error {
if c.cn == nil {
return nil
}
if !c.closed {
internal.Logger.Printf(c.getContext(), "redis: discarding bad PubSub connection: %s", reason)
}
err := c.closeConn(c.cn)
c.cn = nil
return err
}
func (c *PubSub) Close() error {
c.mu.Lock()
defer c.mu.Unlock()
if c.closed {
return pool.ErrClosed
}
c.closed = true
close(c.exit)
return c.closeTheCn(pool.ErrClosed)
}
// Subscribe the client to the specified channels. It returns
// empty subscription if there are no channels.
func (c *PubSub) Subscribe(ctx context.Context, channels ...string) error {
c.mu.Lock()
defer c.mu.Unlock()
err := c.subscribe(ctx, "subscribe", channels...)
if c.channels == nil {
c.channels = make(map[string]struct{})
}
for _, s := range channels {
c.channels[s] = struct{}{}
}
return err
}
// PSubscribe the client to the given patterns. It returns
// empty subscription if there are no patterns.
func (c *PubSub) PSubscribe(ctx context.Context, patterns ...string) error {
c.mu.Lock()
defer c.mu.Unlock()
err := c.subscribe(ctx, "psubscribe", patterns...)
if c.patterns == nil {
c.patterns = make(map[string]struct{})
}
for _, s := range patterns {
c.patterns[s] = struct{}{}
}
return err
}
// SSubscribe Subscribes the client to the specified shard channels.
func (c *PubSub) SSubscribe(ctx context.Context, channels ...string) error {
c.mu.Lock()
defer c.mu.Unlock()
err := c.subscribe(ctx, "ssubscribe", channels...)
if c.schannels == nil {
c.schannels = make(map[string]struct{})
}
for _, s := range channels {
c.schannels[s] = struct{}{}
}
return err
}
// Unsubscribe the client from the given channels, or from all of
// them if none is given.
func (c *PubSub) Unsubscribe(ctx context.Context, channels ...string) error {
c.mu.Lock()
defer c.mu.Unlock()
if len(channels) > 0 {
for _, channel := range channels {
delete(c.channels, channel)
}
} else {
// Unsubscribe from all channels.
for channel := range c.channels {
delete(c.channels, channel)
}
}
err := c.subscribe(ctx, "unsubscribe", channels...)
return err
}
// PUnsubscribe the client from the given patterns, or from all of
// them if none is given.
func (c *PubSub) PUnsubscribe(ctx context.Context, patterns ...string) error {
c.mu.Lock()
defer c.mu.Unlock()
if len(patterns) > 0 {
for _, pattern := range patterns {
delete(c.patterns, pattern)
}
} else {
// Unsubscribe from all patterns.
for pattern := range c.patterns {
delete(c.patterns, pattern)
}
}
err := c.subscribe(ctx, "punsubscribe", patterns...)
return err
}
// SUnsubscribe unsubscribes the client from the given shard channels,
// or from all of them if none is given.
func (c *PubSub) SUnsubscribe(ctx context.Context, channels ...string) error {
c.mu.Lock()
defer c.mu.Unlock()
if len(channels) > 0 {
for _, channel := range channels {
delete(c.schannels, channel)
}
} else {
// Unsubscribe from all channels.
for channel := range c.schannels {
delete(c.schannels, channel)
}
}
err := c.subscribe(ctx, "sunsubscribe", channels...)
return err
}
func (c *PubSub) subscribe(ctx context.Context, redisCmd string, channels ...string) error {
cn, err := c.conn(ctx, channels)
if err != nil {
return err
}
err = c._subscribe(ctx, cn, redisCmd, channels)
c.releaseConn(ctx, cn, err, false)
return err
}
func (c *PubSub) Ping(ctx context.Context, payload ...string) error {
args := []interface{}{"ping"}
if len(payload) == 1 {
args = append(args, payload[0])
}
cmd := NewCmd(ctx, args...)
c.mu.Lock()
defer c.mu.Unlock()
cn, err := c.conn(ctx, nil)
if err != nil {
return err
}
err = c.writeCmd(ctx, cn, cmd)
c.releaseConn(ctx, cn, err, false)
return err
}
// Subscription received after a successful subscription to channel.
type Subscription struct {
// Can be "subscribe", "unsubscribe", "psubscribe" or "punsubscribe".
Kind string
// Channel name we have subscribed to.
Channel string
// Number of channels we are currently subscribed to.
Count int
}
func (m *Subscription) String() string {
return fmt.Sprintf("%s: %s", m.Kind, m.Channel)
}
// Message received as result of a PUBLISH command issued by another client.
type Message struct {
Channel string
Pattern string
Payload string
PayloadSlice []string
}
func (m *Message) String() string {
return fmt.Sprintf("Message<%s: %s>", m.Channel, m.Payload)
}
// Pong received as result of a PING command issued by another client.
type Pong struct {
Payload string
}
func (p *Pong) String() string {
if p.Payload != "" {
return fmt.Sprintf("Pong<%s>", p.Payload)
}
return "Pong"
}
func (c *PubSub) newMessage(reply interface{}) (interface{}, error) {
switch reply := reply.(type) {
case string:
return &Pong{
Payload: reply,
}, nil
case []interface{}:
switch kind := reply[0].(string); kind {
case "subscribe", "unsubscribe", "psubscribe", "punsubscribe", "ssubscribe", "sunsubscribe":
// Can be nil in case of "unsubscribe".
channel, _ := reply[1].(string)
return &Subscription{
Kind: kind,
Channel: channel,
Count: int(reply[2].(int64)),
}, nil
case "message", "smessage":
switch payload := reply[2].(type) {
case string:
return &Message{
Channel: reply[1].(string),
Payload: payload,
}, nil
case []interface{}:
ss := make([]string, len(payload))
for i, s := range payload {
ss[i] = s.(string)
}
return &Message{
Channel: reply[1].(string),
PayloadSlice: ss,
}, nil
default:
return nil, fmt.Errorf("redis: unsupported pubsub message payload: %T", payload)
}
case "pmessage":
return &Message{
Pattern: reply[1].(string),
Channel: reply[2].(string),
Payload: reply[3].(string),
}, nil
case "pong":
return &Pong{
Payload: reply[1].(string),
}, nil
default:
return nil, fmt.Errorf("redis: unsupported pubsub message: %q", kind)
}
default:
return nil, fmt.Errorf("redis: unsupported pubsub message: %#v", reply)
}
}
// ReceiveTimeout acts like Receive but returns an error if message
// is not received in time. This is low-level API and in most cases
// Channel should be used instead.
func (c *PubSub) ReceiveTimeout(ctx context.Context, timeout time.Duration) (interface{}, error) {
if c.cmd == nil {
c.cmd = NewCmd(ctx)
}
// Don't hold the lock to allow subscriptions and pings.
cn, err := c.connWithLock(ctx)
if err != nil {
return nil, err
}
err = cn.WithReader(ctx, timeout, func(rd *proto.Reader) error {
return c.cmd.readReply(rd)
})
c.releaseConnWithLock(ctx, cn, err, timeout > 0)
if err != nil {
return nil, err
}
return c.newMessage(c.cmd.Val())
}
// Receive returns a message as a Subscription, Message, Pong or error.
// See PubSub example for details. This is low-level API and in most cases
// Channel should be used instead.
func (c *PubSub) Receive(ctx context.Context) (interface{}, error) {
return c.ReceiveTimeout(ctx, 0)
}
// ReceiveMessage returns a Message or error ignoring Subscription and Pong
// messages. This is low-level API and in most cases Channel should be used
// instead.
func (c *PubSub) ReceiveMessage(ctx context.Context) (*Message, error) {
for {
msg, err := c.Receive(ctx)
if err != nil {
return nil, err
}
switch msg := msg.(type) {
case *Subscription:
// Ignore.
case *Pong:
// Ignore.
case *Message:
return msg, nil
default:
err := fmt.Errorf("redis: unknown message: %T", msg)
return nil, err
}
}
}
func (c *PubSub) getContext() context.Context {
if c.cmd != nil {
return c.cmd.ctx
}
return context.Background()
}
//------------------------------------------------------------------------------
// Channel returns a Go channel for concurrently receiving messages.
// The channel is closed together with the PubSub. If the Go channel
// is blocked full for 1 minute the message is dropped.
// Receive* APIs can not be used after channel is created.
//
// go-redis periodically sends ping messages to test connection health
// and re-subscribes if ping can not received for 1 minute.
func (c *PubSub) Channel(opts ...ChannelOption) <-chan *Message {
c.chOnce.Do(func() {
c.msgCh = newChannel(c, opts...)
c.msgCh.initMsgChan()
})
if c.msgCh == nil {
err := fmt.Errorf("redis: Channel can't be called after ChannelWithSubscriptions")
panic(err)
}
return c.msgCh.msgCh
}
// ChannelSize is like Channel, but creates a Go channel
// with specified buffer size.
//
// Deprecated: use Channel(WithChannelSize(size)), remove in v9.
func (c *PubSub) ChannelSize(size int) <-chan *Message {
return c.Channel(WithChannelSize(size))
}
// ChannelWithSubscriptions is like Channel, but message type can be either
// *Subscription or *Message. Subscription messages can be used to detect
// reconnections.
//
// ChannelWithSubscriptions can not be used together with Channel or ChannelSize.
func (c *PubSub) ChannelWithSubscriptions(opts ...ChannelOption) <-chan interface{} {
c.chOnce.Do(func() {
c.allCh = newChannel(c, opts...)
c.allCh.initAllChan()
})
if c.allCh == nil {
err := fmt.Errorf("redis: ChannelWithSubscriptions can't be called after Channel")
panic(err)
}
return c.allCh.allCh
}
type ChannelOption func(c *channel)
// WithChannelSize specifies the Go chan size that is used to buffer incoming messages.
//
// The default is 100 messages.
func WithChannelSize(size int) ChannelOption {
return func(c *channel) {
c.chanSize = size
}
}
// WithChannelHealthCheckInterval specifies the health check interval.
// PubSub will ping Redis Server if it does not receive any messages within the interval.
// To disable health check, use zero interval.
//
// The default is 3 seconds.
func WithChannelHealthCheckInterval(d time.Duration) ChannelOption {
return func(c *channel) {
c.checkInterval = d
}
}
// WithChannelSendTimeout specifies the channel send timeout after which
// the message is dropped.
//
// The default is 60 seconds.
func WithChannelSendTimeout(d time.Duration) ChannelOption {
return func(c *channel) {
c.chanSendTimeout = d
}
}
type channel struct {
pubSub *PubSub
msgCh chan *Message
allCh chan interface{}
ping chan struct{}
chanSize int
chanSendTimeout time.Duration
checkInterval time.Duration
}
func newChannel(pubSub *PubSub, opts ...ChannelOption) *channel {
c := &channel{
pubSub: pubSub,
chanSize: 100,
chanSendTimeout: time.Minute,
checkInterval: 3 * time.Second,
}
for _, opt := range opts {
opt(c)
}
if c.checkInterval > 0 {
c.initHealthCheck()
}
return c
}
func (c *channel) initHealthCheck() {
ctx := context.TODO()
c.ping = make(chan struct{}, 1)
go func() {
timer := time.NewTimer(time.Minute)
timer.Stop()
for {
timer.Reset(c.checkInterval)
select {
case <-c.ping:
if !timer.Stop() {
<-timer.C
}
case <-timer.C:
if pingErr := c.pubSub.Ping(ctx); pingErr != nil {
c.pubSub.mu.Lock()
c.pubSub.reconnect(ctx, pingErr)
c.pubSub.mu.Unlock()
}
case <-c.pubSub.exit:
return
}
}
}()
}
// initMsgChan must be in sync with initAllChan.
func (c *channel) initMsgChan() {
ctx := context.TODO()
c.msgCh = make(chan *Message, c.chanSize)
go func() {
timer := time.NewTimer(time.Minute)
timer.Stop()
var errCount int
for {
msg, err := c.pubSub.Receive(ctx)
if err != nil {
if err == pool.ErrClosed {
close(c.msgCh)
return
}
if errCount > 0 {
time.Sleep(100 * time.Millisecond)
}
errCount++
continue
}
errCount = 0
// Any message is as good as a ping.
select {
case c.ping <- struct{}{}:
default:
}
switch msg := msg.(type) {
case *Subscription:
// Ignore.
case *Pong:
// Ignore.
case *Message:
timer.Reset(c.chanSendTimeout)
select {
case c.msgCh <- msg:
if !timer.Stop() {
<-timer.C
}
case <-timer.C:
internal.Logger.Printf(
ctx, "redis: %s channel is full for %s (message is dropped)",
c, c.chanSendTimeout)
}
default:
internal.Logger.Printf(ctx, "redis: unknown message type: %T", msg)
}
}
}()
}
// initAllChan must be in sync with initMsgChan.
func (c *channel) initAllChan() {
ctx := context.TODO()
c.allCh = make(chan interface{}, c.chanSize)
go func() {
timer := time.NewTimer(time.Minute)
timer.Stop()
var errCount int
for {
msg, err := c.pubSub.Receive(ctx)
if err != nil {
if err == pool.ErrClosed {
close(c.allCh)
return
}
if errCount > 0 {
time.Sleep(100 * time.Millisecond)
}
errCount++
continue
}
errCount = 0
// Any message is as good as a ping.
select {
case c.ping <- struct{}{}:
default:
}
switch msg := msg.(type) {
case *Pong:
// Ignore.
case *Subscription, *Message:
timer.Reset(c.chanSendTimeout)
select {
case c.allCh <- msg:
if !timer.Stop() {
<-timer.C
}
case <-timer.C:
internal.Logger.Printf(
ctx, "redis: %s channel is full for %s (message is dropped)",
c, c.chanSendTimeout)
}
default:
internal.Logger.Printf(ctx, "redis: unknown message type: %T", msg)
}
}
}()
}

76
vendor/github.com/redis/go-redis/v9/pubsub_commands.go generated vendored Normal file
View File

@@ -0,0 +1,76 @@
package redis
import "context"
type PubSubCmdable interface {
Publish(ctx context.Context, channel string, message interface{}) *IntCmd
SPublish(ctx context.Context, channel string, message interface{}) *IntCmd
PubSubChannels(ctx context.Context, pattern string) *StringSliceCmd
PubSubNumSub(ctx context.Context, channels ...string) *MapStringIntCmd
PubSubNumPat(ctx context.Context) *IntCmd
PubSubShardChannels(ctx context.Context, pattern string) *StringSliceCmd
PubSubShardNumSub(ctx context.Context, channels ...string) *MapStringIntCmd
}
// Publish posts the message to the channel.
func (c cmdable) Publish(ctx context.Context, channel string, message interface{}) *IntCmd {
cmd := NewIntCmd(ctx, "publish", channel, message)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SPublish(ctx context.Context, channel string, message interface{}) *IntCmd {
cmd := NewIntCmd(ctx, "spublish", channel, message)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) PubSubChannels(ctx context.Context, pattern string) *StringSliceCmd {
args := []interface{}{"pubsub", "channels"}
if pattern != "*" {
args = append(args, pattern)
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) PubSubNumSub(ctx context.Context, channels ...string) *MapStringIntCmd {
args := make([]interface{}, 2+len(channels))
args[0] = "pubsub"
args[1] = "numsub"
for i, channel := range channels {
args[2+i] = channel
}
cmd := NewMapStringIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) PubSubShardChannels(ctx context.Context, pattern string) *StringSliceCmd {
args := []interface{}{"pubsub", "shardchannels"}
if pattern != "*" {
args = append(args, pattern)
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) PubSubShardNumSub(ctx context.Context, channels ...string) *MapStringIntCmd {
args := make([]interface{}, 2+len(channels))
args[0] = "pubsub"
args[1] = "shardnumsub"
for i, channel := range channels {
args[2+i] = channel
}
cmd := NewMapStringIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) PubSubNumPat(ctx context.Context) *IntCmd {
cmd := NewIntCmd(ctx, "pubsub", "numpat")
_ = c(ctx, cmd)
return cmd
}

963
vendor/github.com/redis/go-redis/v9/redis.go generated vendored Normal file
View File

@@ -0,0 +1,963 @@
package redis
import (
"context"
"errors"
"fmt"
"net"
"sync"
"sync/atomic"
"time"
"github.com/redis/go-redis/v9/auth"
"github.com/redis/go-redis/v9/internal"
"github.com/redis/go-redis/v9/internal/hscan"
"github.com/redis/go-redis/v9/internal/pool"
"github.com/redis/go-redis/v9/internal/proto"
)
// Scanner internal/hscan.Scanner exposed interface.
type Scanner = hscan.Scanner
// Nil reply returned by Redis when key does not exist.
const Nil = proto.Nil
// SetLogger set custom log
func SetLogger(logger internal.Logging) {
internal.Logger = logger
}
//------------------------------------------------------------------------------
type Hook interface {
DialHook(next DialHook) DialHook
ProcessHook(next ProcessHook) ProcessHook
ProcessPipelineHook(next ProcessPipelineHook) ProcessPipelineHook
}
type (
DialHook func(ctx context.Context, network, addr string) (net.Conn, error)
ProcessHook func(ctx context.Context, cmd Cmder) error
ProcessPipelineHook func(ctx context.Context, cmds []Cmder) error
)
type hooksMixin struct {
hooksMu *sync.RWMutex
slice []Hook
initial hooks
current hooks
}
func (hs *hooksMixin) initHooks(hooks hooks) {
hs.hooksMu = new(sync.RWMutex)
hs.initial = hooks
hs.chain()
}
type hooks struct {
dial DialHook
process ProcessHook
pipeline ProcessPipelineHook
txPipeline ProcessPipelineHook
}
func (h *hooks) setDefaults() {
if h.dial == nil {
h.dial = func(ctx context.Context, network, addr string) (net.Conn, error) { return nil, nil }
}
if h.process == nil {
h.process = func(ctx context.Context, cmd Cmder) error { return nil }
}
if h.pipeline == nil {
h.pipeline = func(ctx context.Context, cmds []Cmder) error { return nil }
}
if h.txPipeline == nil {
h.txPipeline = func(ctx context.Context, cmds []Cmder) error { return nil }
}
}
// AddHook is to add a hook to the queue.
// Hook is a function executed during network connection, command execution, and pipeline,
// it is a first-in-first-out stack queue (FIFO).
// You need to execute the next hook in each hook, unless you want to terminate the execution of the command.
// For example, you added hook-1, hook-2:
//
// client.AddHook(hook-1, hook-2)
//
// hook-1:
//
// func (Hook1) ProcessHook(next redis.ProcessHook) redis.ProcessHook {
// return func(ctx context.Context, cmd Cmder) error {
// print("hook-1 start")
// next(ctx, cmd)
// print("hook-1 end")
// return nil
// }
// }
//
// hook-2:
//
// func (Hook2) ProcessHook(next redis.ProcessHook) redis.ProcessHook {
// return func(ctx context.Context, cmd redis.Cmder) error {
// print("hook-2 start")
// next(ctx, cmd)
// print("hook-2 end")
// return nil
// }
// }
//
// The execution sequence is:
//
// hook-1 start -> hook-2 start -> exec redis cmd -> hook-2 end -> hook-1 end
//
// Please note: "next(ctx, cmd)" is very important, it will call the next hook,
// if "next(ctx, cmd)" is not executed, the redis command will not be executed.
func (hs *hooksMixin) AddHook(hook Hook) {
hs.slice = append(hs.slice, hook)
hs.chain()
}
func (hs *hooksMixin) chain() {
hs.initial.setDefaults()
hs.hooksMu.Lock()
defer hs.hooksMu.Unlock()
hs.current.dial = hs.initial.dial
hs.current.process = hs.initial.process
hs.current.pipeline = hs.initial.pipeline
hs.current.txPipeline = hs.initial.txPipeline
for i := len(hs.slice) - 1; i >= 0; i-- {
if wrapped := hs.slice[i].DialHook(hs.current.dial); wrapped != nil {
hs.current.dial = wrapped
}
if wrapped := hs.slice[i].ProcessHook(hs.current.process); wrapped != nil {
hs.current.process = wrapped
}
if wrapped := hs.slice[i].ProcessPipelineHook(hs.current.pipeline); wrapped != nil {
hs.current.pipeline = wrapped
}
if wrapped := hs.slice[i].ProcessPipelineHook(hs.current.txPipeline); wrapped != nil {
hs.current.txPipeline = wrapped
}
}
}
func (hs *hooksMixin) clone() hooksMixin {
hs.hooksMu.Lock()
defer hs.hooksMu.Unlock()
clone := *hs
l := len(clone.slice)
clone.slice = clone.slice[:l:l]
clone.hooksMu = new(sync.RWMutex)
return clone
}
func (hs *hooksMixin) withProcessHook(ctx context.Context, cmd Cmder, hook ProcessHook) error {
for i := len(hs.slice) - 1; i >= 0; i-- {
if wrapped := hs.slice[i].ProcessHook(hook); wrapped != nil {
hook = wrapped
}
}
return hook(ctx, cmd)
}
func (hs *hooksMixin) withProcessPipelineHook(
ctx context.Context, cmds []Cmder, hook ProcessPipelineHook,
) error {
for i := len(hs.slice) - 1; i >= 0; i-- {
if wrapped := hs.slice[i].ProcessPipelineHook(hook); wrapped != nil {
hook = wrapped
}
}
return hook(ctx, cmds)
}
func (hs *hooksMixin) dialHook(ctx context.Context, network, addr string) (net.Conn, error) {
// Access to hs.current is guarded by a read-only lock since it may be mutated by AddHook(...)
// while this dialer is concurrently accessed by the background connection pool population
// routine when MinIdleConns > 0.
hs.hooksMu.RLock()
current := hs.current
hs.hooksMu.RUnlock()
return current.dial(ctx, network, addr)
}
func (hs *hooksMixin) processHook(ctx context.Context, cmd Cmder) error {
return hs.current.process(ctx, cmd)
}
func (hs *hooksMixin) processPipelineHook(ctx context.Context, cmds []Cmder) error {
return hs.current.pipeline(ctx, cmds)
}
func (hs *hooksMixin) processTxPipelineHook(ctx context.Context, cmds []Cmder) error {
return hs.current.txPipeline(ctx, cmds)
}
//------------------------------------------------------------------------------
type baseClient struct {
opt *Options
connPool pool.Pooler
hooksMixin
onClose func() error // hook called when client is closed
}
func (c *baseClient) clone() *baseClient {
clone := *c
return &clone
}
func (c *baseClient) withTimeout(timeout time.Duration) *baseClient {
opt := c.opt.clone()
opt.ReadTimeout = timeout
opt.WriteTimeout = timeout
clone := c.clone()
clone.opt = opt
return clone
}
func (c *baseClient) String() string {
return fmt.Sprintf("Redis<%s db:%d>", c.getAddr(), c.opt.DB)
}
func (c *baseClient) newConn(ctx context.Context) (*pool.Conn, error) {
cn, err := c.connPool.NewConn(ctx)
if err != nil {
return nil, err
}
err = c.initConn(ctx, cn)
if err != nil {
_ = c.connPool.CloseConn(cn)
return nil, err
}
return cn, nil
}
func (c *baseClient) getConn(ctx context.Context) (*pool.Conn, error) {
if c.opt.Limiter != nil {
err := c.opt.Limiter.Allow()
if err != nil {
return nil, err
}
}
cn, err := c._getConn(ctx)
if err != nil {
if c.opt.Limiter != nil {
c.opt.Limiter.ReportResult(err)
}
return nil, err
}
return cn, nil
}
func (c *baseClient) _getConn(ctx context.Context) (*pool.Conn, error) {
cn, err := c.connPool.Get(ctx)
if err != nil {
return nil, err
}
if cn.Inited {
return cn, nil
}
if err := c.initConn(ctx, cn); err != nil {
c.connPool.Remove(ctx, cn, err)
if err := errors.Unwrap(err); err != nil {
return nil, err
}
return nil, err
}
return cn, nil
}
func (c *baseClient) newReAuthCredentialsListener(poolCn *pool.Conn) auth.CredentialsListener {
return auth.NewReAuthCredentialsListener(
c.reAuthConnection(poolCn),
c.onAuthenticationErr(poolCn),
)
}
func (c *baseClient) reAuthConnection(poolCn *pool.Conn) func(credentials auth.Credentials) error {
return func(credentials auth.Credentials) error {
var err error
username, password := credentials.BasicAuth()
ctx := context.Background()
connPool := pool.NewSingleConnPool(c.connPool, poolCn)
// hooksMixin are intentionally empty here
cn := newConn(c.opt, connPool, nil)
if username != "" {
err = cn.AuthACL(ctx, username, password).Err()
} else {
err = cn.Auth(ctx, password).Err()
}
return err
}
}
func (c *baseClient) onAuthenticationErr(poolCn *pool.Conn) func(err error) {
return func(err error) {
if err != nil {
if isBadConn(err, false, c.opt.Addr) {
// Close the connection to force a reconnection.
err := c.connPool.CloseConn(poolCn)
if err != nil {
internal.Logger.Printf(context.Background(), "redis: failed to close connection: %v", err)
// try to close the network connection directly
// so that no resource is leaked
err := poolCn.Close()
if err != nil {
internal.Logger.Printf(context.Background(), "redis: failed to close network connection: %v", err)
}
}
}
internal.Logger.Printf(context.Background(), "redis: re-authentication failed: %v", err)
}
}
}
func (c *baseClient) wrappedOnClose(newOnClose func() error) func() error {
onClose := c.onClose
return func() error {
var firstErr error
err := newOnClose()
// Even if we have an error we would like to execute the onClose hook
// if it exists. We will return the first error that occurred.
// This is to keep error handling consistent with the rest of the code.
if err != nil {
firstErr = err
}
if onClose != nil {
err = onClose()
if err != nil && firstErr == nil {
firstErr = err
}
}
return firstErr
}
}
func (c *baseClient) initConn(ctx context.Context, cn *pool.Conn) error {
if cn.Inited {
return nil
}
var err error
cn.Inited = true
connPool := pool.NewSingleConnPool(c.connPool, cn)
conn := newConn(c.opt, connPool, &c.hooksMixin)
username, password := "", ""
if c.opt.StreamingCredentialsProvider != nil {
credentials, unsubscribeFromCredentialsProvider, err := c.opt.StreamingCredentialsProvider.
Subscribe(c.newReAuthCredentialsListener(cn))
if err != nil {
return fmt.Errorf("failed to subscribe to streaming credentials: %w", err)
}
c.onClose = c.wrappedOnClose(unsubscribeFromCredentialsProvider)
cn.SetOnClose(unsubscribeFromCredentialsProvider)
username, password = credentials.BasicAuth()
} else if c.opt.CredentialsProviderContext != nil {
username, password, err = c.opt.CredentialsProviderContext(ctx)
if err != nil {
return fmt.Errorf("failed to get credentials from context provider: %w", err)
}
} else if c.opt.CredentialsProvider != nil {
username, password = c.opt.CredentialsProvider()
} else if c.opt.Username != "" || c.opt.Password != "" {
username, password = c.opt.Username, c.opt.Password
}
// for redis-server versions that do not support the HELLO command,
// RESP2 will continue to be used.
if err = conn.Hello(ctx, c.opt.Protocol, username, password, c.opt.ClientName).Err(); err == nil {
// Authentication successful with HELLO command
} else if !isRedisError(err) {
// When the server responds with the RESP protocol and the result is not a normal
// execution result of the HELLO command, we consider it to be an indication that
// the server does not support the HELLO command.
// The server may be a redis-server that does not support the HELLO command,
// or it could be DragonflyDB or a third-party redis-proxy. They all respond
// with different error string results for unsupported commands, making it
// difficult to rely on error strings to determine all results.
return err
} else if password != "" {
// Try legacy AUTH command if HELLO failed
if username != "" {
err = conn.AuthACL(ctx, username, password).Err()
} else {
err = conn.Auth(ctx, password).Err()
}
if err != nil {
return fmt.Errorf("failed to authenticate: %w", err)
}
}
_, err = conn.Pipelined(ctx, func(pipe Pipeliner) error {
if c.opt.DB > 0 {
pipe.Select(ctx, c.opt.DB)
}
if c.opt.readOnly {
pipe.ReadOnly(ctx)
}
if c.opt.ClientName != "" {
pipe.ClientSetName(ctx, c.opt.ClientName)
}
return nil
})
if err != nil {
return fmt.Errorf("failed to initialize connection options: %w", err)
}
if !c.opt.DisableIdentity && !c.opt.DisableIndentity {
libName := ""
libVer := Version()
if c.opt.IdentitySuffix != "" {
libName = c.opt.IdentitySuffix
}
p := conn.Pipeline()
p.ClientSetInfo(ctx, WithLibraryName(libName))
p.ClientSetInfo(ctx, WithLibraryVersion(libVer))
// Handle network errors (e.g. timeouts) in CLIENT SETINFO to avoid
// out of order responses later on.
if _, err = p.Exec(ctx); err != nil && !isRedisError(err) {
return err
}
}
if c.opt.OnConnect != nil {
return c.opt.OnConnect(ctx, conn)
}
return nil
}
func (c *baseClient) releaseConn(ctx context.Context, cn *pool.Conn, err error) {
if c.opt.Limiter != nil {
c.opt.Limiter.ReportResult(err)
}
if isBadConn(err, false, c.opt.Addr) {
c.connPool.Remove(ctx, cn, err)
} else {
c.connPool.Put(ctx, cn)
}
}
func (c *baseClient) withConn(
ctx context.Context, fn func(context.Context, *pool.Conn) error,
) error {
cn, err := c.getConn(ctx)
if err != nil {
return err
}
var fnErr error
defer func() {
c.releaseConn(ctx, cn, fnErr)
}()
fnErr = fn(ctx, cn)
return fnErr
}
func (c *baseClient) dial(ctx context.Context, network, addr string) (net.Conn, error) {
return c.opt.Dialer(ctx, network, addr)
}
func (c *baseClient) process(ctx context.Context, cmd Cmder) error {
var lastErr error
for attempt := 0; attempt <= c.opt.MaxRetries; attempt++ {
attempt := attempt
retry, err := c._process(ctx, cmd, attempt)
if err == nil || !retry {
return err
}
lastErr = err
}
return lastErr
}
func (c *baseClient) assertUnstableCommand(cmd Cmder) bool {
switch cmd.(type) {
case *AggregateCmd, *FTInfoCmd, *FTSpellCheckCmd, *FTSearchCmd, *FTSynDumpCmd:
if c.opt.UnstableResp3 {
return true
} else {
panic("RESP3 responses for this command are disabled because they may still change. Please set the flag UnstableResp3 . See the [README](https://github.com/redis/go-redis/blob/master/README.md) and the release notes for guidance.")
}
default:
return false
}
}
func (c *baseClient) _process(ctx context.Context, cmd Cmder, attempt int) (bool, error) {
if attempt > 0 {
if err := internal.Sleep(ctx, c.retryBackoff(attempt)); err != nil {
return false, err
}
}
retryTimeout := uint32(0)
if err := c.withConn(ctx, func(ctx context.Context, cn *pool.Conn) error {
if err := cn.WithWriter(c.context(ctx), c.opt.WriteTimeout, func(wr *proto.Writer) error {
return writeCmd(wr, cmd)
}); err != nil {
atomic.StoreUint32(&retryTimeout, 1)
return err
}
readReplyFunc := cmd.readReply
// Apply unstable RESP3 search module.
if c.opt.Protocol != 2 && c.assertUnstableCommand(cmd) {
readReplyFunc = cmd.readRawReply
}
if err := cn.WithReader(c.context(ctx), c.cmdTimeout(cmd), readReplyFunc); err != nil {
if cmd.readTimeout() == nil {
atomic.StoreUint32(&retryTimeout, 1)
} else {
atomic.StoreUint32(&retryTimeout, 0)
}
return err
}
return nil
}); err != nil {
retry := shouldRetry(err, atomic.LoadUint32(&retryTimeout) == 1)
return retry, err
}
return false, nil
}
func (c *baseClient) retryBackoff(attempt int) time.Duration {
return internal.RetryBackoff(attempt, c.opt.MinRetryBackoff, c.opt.MaxRetryBackoff)
}
func (c *baseClient) cmdTimeout(cmd Cmder) time.Duration {
if timeout := cmd.readTimeout(); timeout != nil {
t := *timeout
if t == 0 {
return 0
}
return t + 10*time.Second
}
return c.opt.ReadTimeout
}
// context returns the context for the current connection.
// If the context timeout is enabled, it returns the original context.
// Otherwise, it returns a new background context.
func (c *baseClient) context(ctx context.Context) context.Context {
if c.opt.ContextTimeoutEnabled {
return ctx
}
return context.Background()
}
// Close closes the client, releasing any open resources.
//
// It is rare to Close a Client, as the Client is meant to be
// long-lived and shared between many goroutines.
func (c *baseClient) Close() error {
var firstErr error
if c.onClose != nil {
if err := c.onClose(); err != nil {
firstErr = err
}
}
if err := c.connPool.Close(); err != nil && firstErr == nil {
firstErr = err
}
return firstErr
}
func (c *baseClient) getAddr() string {
return c.opt.Addr
}
func (c *baseClient) processPipeline(ctx context.Context, cmds []Cmder) error {
if err := c.generalProcessPipeline(ctx, cmds, c.pipelineProcessCmds); err != nil {
return err
}
return cmdsFirstErr(cmds)
}
func (c *baseClient) processTxPipeline(ctx context.Context, cmds []Cmder) error {
if err := c.generalProcessPipeline(ctx, cmds, c.txPipelineProcessCmds); err != nil {
return err
}
return cmdsFirstErr(cmds)
}
type pipelineProcessor func(context.Context, *pool.Conn, []Cmder) (bool, error)
func (c *baseClient) generalProcessPipeline(
ctx context.Context, cmds []Cmder, p pipelineProcessor,
) error {
var lastErr error
for attempt := 0; attempt <= c.opt.MaxRetries; attempt++ {
if attempt > 0 {
if err := internal.Sleep(ctx, c.retryBackoff(attempt)); err != nil {
setCmdsErr(cmds, err)
return err
}
}
// Enable retries by default to retry dial errors returned by withConn.
canRetry := true
lastErr = c.withConn(ctx, func(ctx context.Context, cn *pool.Conn) error {
var err error
canRetry, err = p(ctx, cn, cmds)
return err
})
if lastErr == nil || !canRetry || !shouldRetry(lastErr, true) {
return lastErr
}
}
return lastErr
}
func (c *baseClient) pipelineProcessCmds(
ctx context.Context, cn *pool.Conn, cmds []Cmder,
) (bool, error) {
if err := cn.WithWriter(c.context(ctx), c.opt.WriteTimeout, func(wr *proto.Writer) error {
return writeCmds(wr, cmds)
}); err != nil {
setCmdsErr(cmds, err)
return true, err
}
if err := cn.WithReader(c.context(ctx), c.opt.ReadTimeout, func(rd *proto.Reader) error {
return pipelineReadCmds(rd, cmds)
}); err != nil {
return true, err
}
return false, nil
}
func pipelineReadCmds(rd *proto.Reader, cmds []Cmder) error {
for i, cmd := range cmds {
err := cmd.readReply(rd)
cmd.SetErr(err)
if err != nil && !isRedisError(err) {
setCmdsErr(cmds[i+1:], err)
return err
}
}
// Retry errors like "LOADING redis is loading the dataset in memory".
return cmds[0].Err()
}
func (c *baseClient) txPipelineProcessCmds(
ctx context.Context, cn *pool.Conn, cmds []Cmder,
) (bool, error) {
if err := cn.WithWriter(c.context(ctx), c.opt.WriteTimeout, func(wr *proto.Writer) error {
return writeCmds(wr, cmds)
}); err != nil {
setCmdsErr(cmds, err)
return true, err
}
if err := cn.WithReader(c.context(ctx), c.opt.ReadTimeout, func(rd *proto.Reader) error {
statusCmd := cmds[0].(*StatusCmd)
// Trim multi and exec.
trimmedCmds := cmds[1 : len(cmds)-1]
if err := txPipelineReadQueued(rd, statusCmd, trimmedCmds); err != nil {
setCmdsErr(cmds, err)
return err
}
return pipelineReadCmds(rd, trimmedCmds)
}); err != nil {
return false, err
}
return false, nil
}
func txPipelineReadQueued(rd *proto.Reader, statusCmd *StatusCmd, cmds []Cmder) error {
// Parse +OK.
if err := statusCmd.readReply(rd); err != nil {
return err
}
// Parse +QUEUED.
for range cmds {
if err := statusCmd.readReply(rd); err != nil && !isRedisError(err) {
return err
}
}
// Parse number of replies.
line, err := rd.ReadLine()
if err != nil {
if err == Nil {
err = TxFailedErr
}
return err
}
if line[0] != proto.RespArray {
return fmt.Errorf("redis: expected '*', but got line %q", line)
}
return nil
}
//------------------------------------------------------------------------------
// Client is a Redis client representing a pool of zero or more underlying connections.
// It's safe for concurrent use by multiple goroutines.
//
// Client creates and frees connections automatically; it also maintains a free pool
// of idle connections. You can control the pool size with Config.PoolSize option.
type Client struct {
*baseClient
cmdable
}
// NewClient returns a client to the Redis Server specified by Options.
func NewClient(opt *Options) *Client {
if opt == nil {
panic("redis: NewClient nil options")
}
opt.init()
c := Client{
baseClient: &baseClient{
opt: opt,
},
}
c.init()
c.connPool = newConnPool(opt, c.dialHook)
return &c
}
func (c *Client) init() {
c.cmdable = c.Process
c.initHooks(hooks{
dial: c.baseClient.dial,
process: c.baseClient.process,
pipeline: c.baseClient.processPipeline,
txPipeline: c.baseClient.processTxPipeline,
})
}
func (c *Client) WithTimeout(timeout time.Duration) *Client {
clone := *c
clone.baseClient = c.baseClient.withTimeout(timeout)
clone.init()
return &clone
}
func (c *Client) Conn() *Conn {
return newConn(c.opt, pool.NewStickyConnPool(c.connPool), &c.hooksMixin)
}
func (c *Client) Process(ctx context.Context, cmd Cmder) error {
err := c.processHook(ctx, cmd)
cmd.SetErr(err)
return err
}
// Options returns read-only Options that were used to create the client.
func (c *Client) Options() *Options {
return c.opt
}
type PoolStats pool.Stats
// PoolStats returns connection pool stats.
func (c *Client) PoolStats() *PoolStats {
stats := c.connPool.Stats()
return (*PoolStats)(stats)
}
func (c *Client) Pipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error) {
return c.Pipeline().Pipelined(ctx, fn)
}
func (c *Client) Pipeline() Pipeliner {
pipe := Pipeline{
exec: pipelineExecer(c.processPipelineHook),
}
pipe.init()
return &pipe
}
func (c *Client) TxPipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error) {
return c.TxPipeline().Pipelined(ctx, fn)
}
// TxPipeline acts like Pipeline, but wraps queued commands with MULTI/EXEC.
func (c *Client) TxPipeline() Pipeliner {
pipe := Pipeline{
exec: func(ctx context.Context, cmds []Cmder) error {
cmds = wrapMultiExec(ctx, cmds)
return c.processTxPipelineHook(ctx, cmds)
},
}
pipe.init()
return &pipe
}
func (c *Client) pubSub() *PubSub {
pubsub := &PubSub{
opt: c.opt,
newConn: func(ctx context.Context, channels []string) (*pool.Conn, error) {
return c.newConn(ctx)
},
closeConn: c.connPool.CloseConn,
}
pubsub.init()
return pubsub
}
// Subscribe subscribes the client to the specified channels.
// Channels can be omitted to create empty subscription.
// Note that this method does not wait on a response from Redis, so the
// subscription may not be active immediately. To force the connection to wait,
// you may call the Receive() method on the returned *PubSub like so:
//
// sub := client.Subscribe(queryResp)
// iface, err := sub.Receive()
// if err != nil {
// // handle error
// }
//
// // Should be *Subscription, but others are possible if other actions have been
// // taken on sub since it was created.
// switch iface.(type) {
// case *Subscription:
// // subscribe succeeded
// case *Message:
// // received first message
// case *Pong:
// // pong received
// default:
// // handle error
// }
//
// ch := sub.Channel()
func (c *Client) Subscribe(ctx context.Context, channels ...string) *PubSub {
pubsub := c.pubSub()
if len(channels) > 0 {
_ = pubsub.Subscribe(ctx, channels...)
}
return pubsub
}
// PSubscribe subscribes the client to the given patterns.
// Patterns can be omitted to create empty subscription.
func (c *Client) PSubscribe(ctx context.Context, channels ...string) *PubSub {
pubsub := c.pubSub()
if len(channels) > 0 {
_ = pubsub.PSubscribe(ctx, channels...)
}
return pubsub
}
// SSubscribe Subscribes the client to the specified shard channels.
// Channels can be omitted to create empty subscription.
func (c *Client) SSubscribe(ctx context.Context, channels ...string) *PubSub {
pubsub := c.pubSub()
if len(channels) > 0 {
_ = pubsub.SSubscribe(ctx, channels...)
}
return pubsub
}
//------------------------------------------------------------------------------
// Conn represents a single Redis connection rather than a pool of connections.
// Prefer running commands from Client unless there is a specific need
// for a continuous single Redis connection.
type Conn struct {
baseClient
cmdable
statefulCmdable
}
// newConn is a helper func to create a new Conn instance.
// the Conn instance is not thread-safe and should not be shared between goroutines.
// the parentHooks will be cloned, no need to clone before passing it.
func newConn(opt *Options, connPool pool.Pooler, parentHooks *hooksMixin) *Conn {
c := Conn{
baseClient: baseClient{
opt: opt,
connPool: connPool,
},
}
if parentHooks != nil {
c.hooksMixin = parentHooks.clone()
}
c.cmdable = c.Process
c.statefulCmdable = c.Process
c.initHooks(hooks{
dial: c.baseClient.dial,
process: c.baseClient.process,
pipeline: c.baseClient.processPipeline,
txPipeline: c.baseClient.processTxPipeline,
})
return &c
}
func (c *Conn) Process(ctx context.Context, cmd Cmder) error {
err := c.processHook(ctx, cmd)
cmd.SetErr(err)
return err
}
func (c *Conn) Pipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error) {
return c.Pipeline().Pipelined(ctx, fn)
}
func (c *Conn) Pipeline() Pipeliner {
pipe := Pipeline{
exec: c.processPipelineHook,
}
pipe.init()
return &pipe
}
func (c *Conn) TxPipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error) {
return c.TxPipeline().Pipelined(ctx, fn)
}
// TxPipeline acts like Pipeline, but wraps queued commands with MULTI/EXEC.
func (c *Conn) TxPipeline() Pipeliner {
pipe := Pipeline{
exec: func(ctx context.Context, cmds []Cmder) error {
cmds = wrapMultiExec(ctx, cmds)
return c.processTxPipelineHook(ctx, cmds)
},
}
pipe.init()
return &pipe
}

196
vendor/github.com/redis/go-redis/v9/result.go generated vendored Normal file
View File

@@ -0,0 +1,196 @@
package redis
import "time"
// NewCmdResult returns a Cmd initialised with val and err for testing.
func NewCmdResult(val interface{}, err error) *Cmd {
var cmd Cmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewSliceResult returns a SliceCmd initialised with val and err for testing.
func NewSliceResult(val []interface{}, err error) *SliceCmd {
var cmd SliceCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewStatusResult returns a StatusCmd initialised with val and err for testing.
func NewStatusResult(val string, err error) *StatusCmd {
var cmd StatusCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewIntResult returns an IntCmd initialised with val and err for testing.
func NewIntResult(val int64, err error) *IntCmd {
var cmd IntCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewDurationResult returns a DurationCmd initialised with val and err for testing.
func NewDurationResult(val time.Duration, err error) *DurationCmd {
var cmd DurationCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewBoolResult returns a BoolCmd initialised with val and err for testing.
func NewBoolResult(val bool, err error) *BoolCmd {
var cmd BoolCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewStringResult returns a StringCmd initialised with val and err for testing.
func NewStringResult(val string, err error) *StringCmd {
var cmd StringCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewFloatResult returns a FloatCmd initialised with val and err for testing.
func NewFloatResult(val float64, err error) *FloatCmd {
var cmd FloatCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewStringSliceResult returns a StringSliceCmd initialised with val and err for testing.
func NewStringSliceResult(val []string, err error) *StringSliceCmd {
var cmd StringSliceCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewBoolSliceResult returns a BoolSliceCmd initialised with val and err for testing.
func NewBoolSliceResult(val []bool, err error) *BoolSliceCmd {
var cmd BoolSliceCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewFloatSliceResult returns a FloatSliceCmd initialised with val and err for testing.
func NewFloatSliceResult(val []float64, err error) *FloatSliceCmd {
var cmd FloatSliceCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewMapStringStringResult returns a MapStringStringCmd initialised with val and err for testing.
func NewMapStringStringResult(val map[string]string, err error) *MapStringStringCmd {
var cmd MapStringStringCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewMapStringIntCmdResult returns a MapStringIntCmd initialised with val and err for testing.
func NewMapStringIntCmdResult(val map[string]int64, err error) *MapStringIntCmd {
var cmd MapStringIntCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewTimeCmdResult returns a TimeCmd initialised with val and err for testing.
func NewTimeCmdResult(val time.Time, err error) *TimeCmd {
var cmd TimeCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewZSliceCmdResult returns a ZSliceCmd initialised with val and err for testing.
func NewZSliceCmdResult(val []Z, err error) *ZSliceCmd {
var cmd ZSliceCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewZWithKeyCmdResult returns a ZWithKeyCmd initialised with val and err for testing.
func NewZWithKeyCmdResult(val *ZWithKey, err error) *ZWithKeyCmd {
var cmd ZWithKeyCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewScanCmdResult returns a ScanCmd initialised with val and err for testing.
func NewScanCmdResult(keys []string, cursor uint64, err error) *ScanCmd {
var cmd ScanCmd
cmd.page = keys
cmd.cursor = cursor
cmd.SetErr(err)
return &cmd
}
// NewClusterSlotsCmdResult returns a ClusterSlotsCmd initialised with val and err for testing.
func NewClusterSlotsCmdResult(val []ClusterSlot, err error) *ClusterSlotsCmd {
var cmd ClusterSlotsCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewGeoLocationCmdResult returns a GeoLocationCmd initialised with val and err for testing.
func NewGeoLocationCmdResult(val []GeoLocation, err error) *GeoLocationCmd {
var cmd GeoLocationCmd
cmd.locations = val
cmd.SetErr(err)
return &cmd
}
// NewGeoPosCmdResult returns a GeoPosCmd initialised with val and err for testing.
func NewGeoPosCmdResult(val []*GeoPos, err error) *GeoPosCmd {
var cmd GeoPosCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewCommandsInfoCmdResult returns a CommandsInfoCmd initialised with val and err for testing.
func NewCommandsInfoCmdResult(val map[string]*CommandInfo, err error) *CommandsInfoCmd {
var cmd CommandsInfoCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewXMessageSliceCmdResult returns a XMessageSliceCmd initialised with val and err for testing.
func NewXMessageSliceCmdResult(val []XMessage, err error) *XMessageSliceCmd {
var cmd XMessageSliceCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewXStreamSliceCmdResult returns a XStreamSliceCmd initialised with val and err for testing.
func NewXStreamSliceCmdResult(val []XStream, err error) *XStreamSliceCmd {
var cmd XStreamSliceCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewXPendingResult returns a XPendingCmd initialised with val and err for testing.
func NewXPendingResult(val *XPending, err error) *XPendingCmd {
var cmd XPendingCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}

891
vendor/github.com/redis/go-redis/v9/ring.go generated vendored Normal file
View File

@@ -0,0 +1,891 @@
package redis
import (
"context"
"crypto/tls"
"errors"
"fmt"
"net"
"strconv"
"sync"
"sync/atomic"
"time"
"github.com/cespare/xxhash/v2"
"github.com/dgryski/go-rendezvous" //nolint
"github.com/redis/go-redis/v9/auth"
"github.com/redis/go-redis/v9/internal"
"github.com/redis/go-redis/v9/internal/hashtag"
"github.com/redis/go-redis/v9/internal/pool"
"github.com/redis/go-redis/v9/internal/rand"
)
var errRingShardsDown = errors.New("redis: all ring shards are down")
//------------------------------------------------------------------------------
type ConsistentHash interface {
Get(string) string
}
type rendezvousWrapper struct {
*rendezvous.Rendezvous
}
func (w rendezvousWrapper) Get(key string) string {
return w.Lookup(key)
}
func newRendezvous(shards []string) ConsistentHash {
return rendezvousWrapper{rendezvous.New(shards, xxhash.Sum64String)}
}
//------------------------------------------------------------------------------
// RingOptions are used to configure a ring client and should be
// passed to NewRing.
type RingOptions struct {
// Map of name => host:port addresses of ring shards.
Addrs map[string]string
// NewClient creates a shard client with provided options.
NewClient func(opt *Options) *Client
// ClientName will execute the `CLIENT SETNAME ClientName` command for each conn.
ClientName string
// Frequency of PING commands sent to check shards availability.
// Shard is considered down after 3 subsequent failed checks.
HeartbeatFrequency time.Duration
// NewConsistentHash returns a consistent hash that is used
// to distribute keys across the shards.
//
// See https://medium.com/@dgryski/consistent-hashing-algorithmic-tradeoffs-ef6b8e2fcae8
// for consistent hashing algorithmic tradeoffs.
NewConsistentHash func(shards []string) ConsistentHash
// Following options are copied from Options struct.
Dialer func(ctx context.Context, network, addr string) (net.Conn, error)
OnConnect func(ctx context.Context, cn *Conn) error
Protocol int
Username string
Password string
// CredentialsProvider allows the username and password to be updated
// before reconnecting. It should return the current username and password.
CredentialsProvider func() (username string, password string)
// CredentialsProviderContext is an enhanced parameter of CredentialsProvider,
// done to maintain API compatibility. In the future,
// there might be a merge between CredentialsProviderContext and CredentialsProvider.
// There will be a conflict between them; if CredentialsProviderContext exists, we will ignore CredentialsProvider.
CredentialsProviderContext func(ctx context.Context) (username string, password string, err error)
// StreamingCredentialsProvider is used to retrieve the credentials
// for the connection from an external source. Those credentials may change
// during the connection lifetime. This is useful for managed identity
// scenarios where the credentials are retrieved from an external source.
//
// Currently, this is a placeholder for the future implementation.
StreamingCredentialsProvider auth.StreamingCredentialsProvider
DB int
MaxRetries int
MinRetryBackoff time.Duration
MaxRetryBackoff time.Duration
DialTimeout time.Duration
ReadTimeout time.Duration
WriteTimeout time.Duration
ContextTimeoutEnabled bool
// PoolFIFO uses FIFO mode for each node connection pool GET/PUT (default LIFO).
PoolFIFO bool
PoolSize int
PoolTimeout time.Duration
MinIdleConns int
MaxIdleConns int
MaxActiveConns int
ConnMaxIdleTime time.Duration
ConnMaxLifetime time.Duration
TLSConfig *tls.Config
Limiter Limiter
// DisableIndentity - Disable set-lib on connect.
//
// default: false
//
// Deprecated: Use DisableIdentity instead.
DisableIndentity bool
// DisableIdentity is used to disable CLIENT SETINFO command on connect.
//
// default: false
DisableIdentity bool
IdentitySuffix string
UnstableResp3 bool
}
func (opt *RingOptions) init() {
if opt.NewClient == nil {
opt.NewClient = func(opt *Options) *Client {
return NewClient(opt)
}
}
if opt.HeartbeatFrequency == 0 {
opt.HeartbeatFrequency = 500 * time.Millisecond
}
if opt.NewConsistentHash == nil {
opt.NewConsistentHash = newRendezvous
}
switch opt.MaxRetries {
case -1:
opt.MaxRetries = 0
case 0:
opt.MaxRetries = 3
}
switch opt.MinRetryBackoff {
case -1:
opt.MinRetryBackoff = 0
case 0:
opt.MinRetryBackoff = 8 * time.Millisecond
}
switch opt.MaxRetryBackoff {
case -1:
opt.MaxRetryBackoff = 0
case 0:
opt.MaxRetryBackoff = 512 * time.Millisecond
}
}
func (opt *RingOptions) clientOptions() *Options {
return &Options{
ClientName: opt.ClientName,
Dialer: opt.Dialer,
OnConnect: opt.OnConnect,
Protocol: opt.Protocol,
Username: opt.Username,
Password: opt.Password,
CredentialsProvider: opt.CredentialsProvider,
CredentialsProviderContext: opt.CredentialsProviderContext,
StreamingCredentialsProvider: opt.StreamingCredentialsProvider,
DB: opt.DB,
MaxRetries: -1,
DialTimeout: opt.DialTimeout,
ReadTimeout: opt.ReadTimeout,
WriteTimeout: opt.WriteTimeout,
ContextTimeoutEnabled: opt.ContextTimeoutEnabled,
PoolFIFO: opt.PoolFIFO,
PoolSize: opt.PoolSize,
PoolTimeout: opt.PoolTimeout,
MinIdleConns: opt.MinIdleConns,
MaxIdleConns: opt.MaxIdleConns,
MaxActiveConns: opt.MaxActiveConns,
ConnMaxIdleTime: opt.ConnMaxIdleTime,
ConnMaxLifetime: opt.ConnMaxLifetime,
TLSConfig: opt.TLSConfig,
Limiter: opt.Limiter,
DisableIdentity: opt.DisableIdentity,
DisableIndentity: opt.DisableIndentity,
IdentitySuffix: opt.IdentitySuffix,
UnstableResp3: opt.UnstableResp3,
}
}
//------------------------------------------------------------------------------
type ringShard struct {
Client *Client
down int32
addr string
}
func newRingShard(opt *RingOptions, addr string) *ringShard {
clopt := opt.clientOptions()
clopt.Addr = addr
return &ringShard{
Client: opt.NewClient(clopt),
addr: addr,
}
}
func (shard *ringShard) String() string {
var state string
if shard.IsUp() {
state = "up"
} else {
state = "down"
}
return fmt.Sprintf("%s is %s", shard.Client, state)
}
func (shard *ringShard) IsDown() bool {
const threshold = 3
return atomic.LoadInt32(&shard.down) >= threshold
}
func (shard *ringShard) IsUp() bool {
return !shard.IsDown()
}
// Vote votes to set shard state and returns true if state was changed.
func (shard *ringShard) Vote(up bool) bool {
if up {
changed := shard.IsDown()
atomic.StoreInt32(&shard.down, 0)
return changed
}
if shard.IsDown() {
return false
}
atomic.AddInt32(&shard.down, 1)
return shard.IsDown()
}
//------------------------------------------------------------------------------
type ringSharding struct {
opt *RingOptions
mu sync.RWMutex
shards *ringShards
closed bool
hash ConsistentHash
numShard int
onNewNode []func(rdb *Client)
// ensures exclusive access to SetAddrs so there is no need
// to hold mu for the duration of potentially long shard creation
setAddrsMu sync.Mutex
}
type ringShards struct {
m map[string]*ringShard
list []*ringShard
}
func newRingSharding(opt *RingOptions) *ringSharding {
c := &ringSharding{
opt: opt,
}
c.SetAddrs(opt.Addrs)
return c
}
func (c *ringSharding) OnNewNode(fn func(rdb *Client)) {
c.mu.Lock()
c.onNewNode = append(c.onNewNode, fn)
c.mu.Unlock()
}
// SetAddrs replaces the shards in use, such that you can increase and
// decrease number of shards, that you use. It will reuse shards that
// existed before and close the ones that will not be used anymore.
func (c *ringSharding) SetAddrs(addrs map[string]string) {
c.setAddrsMu.Lock()
defer c.setAddrsMu.Unlock()
cleanup := func(shards map[string]*ringShard) {
for addr, shard := range shards {
if err := shard.Client.Close(); err != nil {
internal.Logger.Printf(context.Background(), "shard.Close %s failed: %s", addr, err)
}
}
}
c.mu.RLock()
if c.closed {
c.mu.RUnlock()
return
}
existing := c.shards
c.mu.RUnlock()
shards, created, unused := c.newRingShards(addrs, existing)
c.mu.Lock()
if c.closed {
cleanup(created)
c.mu.Unlock()
return
}
c.shards = shards
c.rebalanceLocked()
c.mu.Unlock()
cleanup(unused)
}
func (c *ringSharding) newRingShards(
addrs map[string]string, existing *ringShards,
) (shards *ringShards, created, unused map[string]*ringShard) {
shards = &ringShards{m: make(map[string]*ringShard, len(addrs))}
created = make(map[string]*ringShard) // indexed by addr
unused = make(map[string]*ringShard) // indexed by addr
if existing != nil {
for _, shard := range existing.list {
unused[shard.addr] = shard
}
}
for name, addr := range addrs {
if shard, ok := unused[addr]; ok {
shards.m[name] = shard
delete(unused, addr)
} else {
shard := newRingShard(c.opt, addr)
shards.m[name] = shard
created[addr] = shard
for _, fn := range c.onNewNode {
fn(shard.Client)
}
}
}
for _, shard := range shards.m {
shards.list = append(shards.list, shard)
}
return
}
// Warning: External exposure of `c.shards.list` may cause data races.
// So keep internal or implement deep copy if exposed.
func (c *ringSharding) List() []*ringShard {
c.mu.RLock()
defer c.mu.RUnlock()
if c.closed {
return nil
}
return c.shards.list
}
func (c *ringSharding) Hash(key string) string {
key = hashtag.Key(key)
var hash string
c.mu.RLock()
defer c.mu.RUnlock()
if c.numShard > 0 {
hash = c.hash.Get(key)
}
return hash
}
func (c *ringSharding) GetByKey(key string) (*ringShard, error) {
key = hashtag.Key(key)
c.mu.RLock()
defer c.mu.RUnlock()
if c.closed {
return nil, pool.ErrClosed
}
if c.numShard == 0 {
return nil, errRingShardsDown
}
shardName := c.hash.Get(key)
if shardName == "" {
return nil, errRingShardsDown
}
return c.shards.m[shardName], nil
}
func (c *ringSharding) GetByName(shardName string) (*ringShard, error) {
if shardName == "" {
return c.Random()
}
c.mu.RLock()
defer c.mu.RUnlock()
shard, ok := c.shards.m[shardName]
if !ok {
return nil, errors.New("redis: the shard is not in the ring")
}
return shard, nil
}
func (c *ringSharding) Random() (*ringShard, error) {
return c.GetByKey(strconv.Itoa(rand.Int()))
}
// Heartbeat monitors state of each shard in the ring.
func (c *ringSharding) Heartbeat(ctx context.Context, frequency time.Duration) {
ticker := time.NewTicker(frequency)
defer ticker.Stop()
for {
select {
case <-ticker.C:
var rebalance bool
// note: `c.List()` return a shadow copy of `[]*ringShard`.
for _, shard := range c.List() {
err := shard.Client.Ping(ctx).Err()
isUp := err == nil || err == pool.ErrPoolTimeout
if shard.Vote(isUp) {
internal.Logger.Printf(ctx, "ring shard state changed: %s", shard)
rebalance = true
}
}
if rebalance {
c.mu.Lock()
c.rebalanceLocked()
c.mu.Unlock()
}
case <-ctx.Done():
return
}
}
}
// rebalanceLocked removes dead shards from the Ring.
// Requires c.mu locked.
func (c *ringSharding) rebalanceLocked() {
if c.closed {
return
}
if c.shards == nil {
return
}
liveShards := make([]string, 0, len(c.shards.m))
for name, shard := range c.shards.m {
if shard.IsUp() {
liveShards = append(liveShards, name)
}
}
c.hash = c.opt.NewConsistentHash(liveShards)
c.numShard = len(liveShards)
}
func (c *ringSharding) Len() int {
c.mu.RLock()
defer c.mu.RUnlock()
return c.numShard
}
func (c *ringSharding) Close() error {
c.mu.Lock()
defer c.mu.Unlock()
if c.closed {
return nil
}
c.closed = true
var firstErr error
for _, shard := range c.shards.list {
if err := shard.Client.Close(); err != nil && firstErr == nil {
firstErr = err
}
}
c.hash = nil
c.shards = nil
c.numShard = 0
return firstErr
}
//------------------------------------------------------------------------------
// Ring is a Redis client that uses consistent hashing to distribute
// keys across multiple Redis servers (shards). It's safe for
// concurrent use by multiple goroutines.
//
// Ring monitors the state of each shard and removes dead shards from
// the ring. When a shard comes online it is added back to the ring. This
// gives you maximum availability and partition tolerance, but no
// consistency between different shards or even clients. Each client
// uses shards that are available to the client and does not do any
// coordination when shard state is changed.
//
// Ring should be used when you need multiple Redis servers for caching
// and can tolerate losing data when one of the servers dies.
// Otherwise you should use Redis Cluster.
type Ring struct {
cmdable
hooksMixin
opt *RingOptions
sharding *ringSharding
cmdsInfoCache *cmdsInfoCache
heartbeatCancelFn context.CancelFunc
}
func NewRing(opt *RingOptions) *Ring {
if opt == nil {
panic("redis: NewRing nil options")
}
opt.init()
hbCtx, hbCancel := context.WithCancel(context.Background())
ring := Ring{
opt: opt,
sharding: newRingSharding(opt),
heartbeatCancelFn: hbCancel,
}
ring.cmdsInfoCache = newCmdsInfoCache(ring.cmdsInfo)
ring.cmdable = ring.Process
ring.initHooks(hooks{
process: ring.process,
pipeline: func(ctx context.Context, cmds []Cmder) error {
return ring.generalProcessPipeline(ctx, cmds, false)
},
txPipeline: func(ctx context.Context, cmds []Cmder) error {
return ring.generalProcessPipeline(ctx, cmds, true)
},
})
go ring.sharding.Heartbeat(hbCtx, opt.HeartbeatFrequency)
return &ring
}
func (c *Ring) SetAddrs(addrs map[string]string) {
c.sharding.SetAddrs(addrs)
}
func (c *Ring) Process(ctx context.Context, cmd Cmder) error {
err := c.processHook(ctx, cmd)
cmd.SetErr(err)
return err
}
// Options returns read-only Options that were used to create the client.
func (c *Ring) Options() *RingOptions {
return c.opt
}
func (c *Ring) retryBackoff(attempt int) time.Duration {
return internal.RetryBackoff(attempt, c.opt.MinRetryBackoff, c.opt.MaxRetryBackoff)
}
// PoolStats returns accumulated connection pool stats.
func (c *Ring) PoolStats() *PoolStats {
// note: `c.List()` return a shadow copy of `[]*ringShard`.
shards := c.sharding.List()
var acc PoolStats
for _, shard := range shards {
s := shard.Client.connPool.Stats()
acc.Hits += s.Hits
acc.Misses += s.Misses
acc.Timeouts += s.Timeouts
acc.TotalConns += s.TotalConns
acc.IdleConns += s.IdleConns
}
return &acc
}
// Len returns the current number of shards in the ring.
func (c *Ring) Len() int {
return c.sharding.Len()
}
// Subscribe subscribes the client to the specified channels.
func (c *Ring) Subscribe(ctx context.Context, channels ...string) *PubSub {
if len(channels) == 0 {
panic("at least one channel is required")
}
shard, err := c.sharding.GetByKey(channels[0])
if err != nil {
// TODO: return PubSub with sticky error
panic(err)
}
return shard.Client.Subscribe(ctx, channels...)
}
// PSubscribe subscribes the client to the given patterns.
func (c *Ring) PSubscribe(ctx context.Context, channels ...string) *PubSub {
if len(channels) == 0 {
panic("at least one channel is required")
}
shard, err := c.sharding.GetByKey(channels[0])
if err != nil {
// TODO: return PubSub with sticky error
panic(err)
}
return shard.Client.PSubscribe(ctx, channels...)
}
// SSubscribe Subscribes the client to the specified shard channels.
func (c *Ring) SSubscribe(ctx context.Context, channels ...string) *PubSub {
if len(channels) == 0 {
panic("at least one channel is required")
}
shard, err := c.sharding.GetByKey(channels[0])
if err != nil {
// TODO: return PubSub with sticky error
panic(err)
}
return shard.Client.SSubscribe(ctx, channels...)
}
func (c *Ring) OnNewNode(fn func(rdb *Client)) {
c.sharding.OnNewNode(fn)
}
// ForEachShard concurrently calls the fn on each live shard in the ring.
// It returns the first error if any.
func (c *Ring) ForEachShard(
ctx context.Context,
fn func(ctx context.Context, client *Client) error,
) error {
// note: `c.List()` return a shadow copy of `[]*ringShard`.
shards := c.sharding.List()
var wg sync.WaitGroup
errCh := make(chan error, 1)
for _, shard := range shards {
if shard.IsDown() {
continue
}
wg.Add(1)
go func(shard *ringShard) {
defer wg.Done()
err := fn(ctx, shard.Client)
if err != nil {
select {
case errCh <- err:
default:
}
}
}(shard)
}
wg.Wait()
select {
case err := <-errCh:
return err
default:
return nil
}
}
func (c *Ring) cmdsInfo(ctx context.Context) (map[string]*CommandInfo, error) {
// note: `c.List()` return a shadow copy of `[]*ringShard`.
shards := c.sharding.List()
var firstErr error
for _, shard := range shards {
cmdsInfo, err := shard.Client.Command(ctx).Result()
if err == nil {
return cmdsInfo, nil
}
if firstErr == nil {
firstErr = err
}
}
if firstErr == nil {
return nil, errRingShardsDown
}
return nil, firstErr
}
func (c *Ring) cmdShard(cmd Cmder) (*ringShard, error) {
pos := cmdFirstKeyPos(cmd)
if pos == 0 {
return c.sharding.Random()
}
firstKey := cmd.stringArg(pos)
return c.sharding.GetByKey(firstKey)
}
func (c *Ring) process(ctx context.Context, cmd Cmder) error {
var lastErr error
for attempt := 0; attempt <= c.opt.MaxRetries; attempt++ {
if attempt > 0 {
if err := internal.Sleep(ctx, c.retryBackoff(attempt)); err != nil {
return err
}
}
shard, err := c.cmdShard(cmd)
if err != nil {
return err
}
lastErr = shard.Client.Process(ctx, cmd)
if lastErr == nil || !shouldRetry(lastErr, cmd.readTimeout() == nil) {
return lastErr
}
}
return lastErr
}
func (c *Ring) Pipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error) {
return c.Pipeline().Pipelined(ctx, fn)
}
func (c *Ring) Pipeline() Pipeliner {
pipe := Pipeline{
exec: pipelineExecer(c.processPipelineHook),
}
pipe.init()
return &pipe
}
func (c *Ring) TxPipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error) {
return c.TxPipeline().Pipelined(ctx, fn)
}
func (c *Ring) TxPipeline() Pipeliner {
pipe := Pipeline{
exec: func(ctx context.Context, cmds []Cmder) error {
cmds = wrapMultiExec(ctx, cmds)
return c.processTxPipelineHook(ctx, cmds)
},
}
pipe.init()
return &pipe
}
func (c *Ring) generalProcessPipeline(
ctx context.Context, cmds []Cmder, tx bool,
) error {
if tx {
// Trim multi .. exec.
cmds = cmds[1 : len(cmds)-1]
}
cmdsMap := make(map[string][]Cmder)
for _, cmd := range cmds {
hash := cmd.stringArg(cmdFirstKeyPos(cmd))
if hash != "" {
hash = c.sharding.Hash(hash)
}
cmdsMap[hash] = append(cmdsMap[hash], cmd)
}
var wg sync.WaitGroup
for hash, cmds := range cmdsMap {
wg.Add(1)
go func(hash string, cmds []Cmder) {
defer wg.Done()
// TODO: retry?
shard, err := c.sharding.GetByName(hash)
if err != nil {
setCmdsErr(cmds, err)
return
}
if tx {
cmds = wrapMultiExec(ctx, cmds)
_ = shard.Client.processTxPipelineHook(ctx, cmds)
} else {
_ = shard.Client.processPipelineHook(ctx, cmds)
}
}(hash, cmds)
}
wg.Wait()
return cmdsFirstErr(cmds)
}
func (c *Ring) Watch(ctx context.Context, fn func(*Tx) error, keys ...string) error {
if len(keys) == 0 {
return fmt.Errorf("redis: Watch requires at least one key")
}
var shards []*ringShard
for _, key := range keys {
if key != "" {
shard, err := c.sharding.GetByKey(key)
if err != nil {
return err
}
shards = append(shards, shard)
}
}
if len(shards) == 0 {
return fmt.Errorf("redis: Watch requires at least one shard")
}
if len(shards) > 1 {
for _, shard := range shards[1:] {
if shard.Client != shards[0].Client {
err := fmt.Errorf("redis: Watch requires all keys to be in the same shard")
return err
}
}
}
return shards[0].Client.Watch(ctx, fn, keys...)
}
// Close closes the ring client, releasing any open resources.
//
// It is rare to Close a Ring, as the Ring is meant to be long-lived
// and shared between many goroutines.
func (c *Ring) Close() error {
c.heartbeatCancelFn()
return c.sharding.Close()
}
// GetShardClients returns a list of all shard clients in the ring.
// This can be used to create dedicated connections (e.g., PubSub) for each shard.
func (c *Ring) GetShardClients() []*Client {
shards := c.sharding.List()
clients := make([]*Client, 0, len(shards))
for _, shard := range shards {
if shard.IsUp() {
clients = append(clients, shard.Client)
}
}
return clients
}
// GetShardClientForKey returns the shard client that would handle the given key.
// This can be used to determine which shard a particular key/channel would be routed to.
func (c *Ring) GetShardClientForKey(key string) (*Client, error) {
shard, err := c.sharding.GetByKey(key)
if err != nil {
return nil, err
}
return shard.Client, nil
}

84
vendor/github.com/redis/go-redis/v9/script.go generated vendored Normal file
View File

@@ -0,0 +1,84 @@
package redis
import (
"context"
"crypto/sha1"
"encoding/hex"
"io"
)
type Scripter interface {
Eval(ctx context.Context, script string, keys []string, args ...interface{}) *Cmd
EvalSha(ctx context.Context, sha1 string, keys []string, args ...interface{}) *Cmd
EvalRO(ctx context.Context, script string, keys []string, args ...interface{}) *Cmd
EvalShaRO(ctx context.Context, sha1 string, keys []string, args ...interface{}) *Cmd
ScriptExists(ctx context.Context, hashes ...string) *BoolSliceCmd
ScriptLoad(ctx context.Context, script string) *StringCmd
}
var (
_ Scripter = (*Client)(nil)
_ Scripter = (*Ring)(nil)
_ Scripter = (*ClusterClient)(nil)
)
type Script struct {
src, hash string
}
func NewScript(src string) *Script {
h := sha1.New()
_, _ = io.WriteString(h, src)
return &Script{
src: src,
hash: hex.EncodeToString(h.Sum(nil)),
}
}
func (s *Script) Hash() string {
return s.hash
}
func (s *Script) Load(ctx context.Context, c Scripter) *StringCmd {
return c.ScriptLoad(ctx, s.src)
}
func (s *Script) Exists(ctx context.Context, c Scripter) *BoolSliceCmd {
return c.ScriptExists(ctx, s.hash)
}
func (s *Script) Eval(ctx context.Context, c Scripter, keys []string, args ...interface{}) *Cmd {
return c.Eval(ctx, s.src, keys, args...)
}
func (s *Script) EvalRO(ctx context.Context, c Scripter, keys []string, args ...interface{}) *Cmd {
return c.EvalRO(ctx, s.src, keys, args...)
}
func (s *Script) EvalSha(ctx context.Context, c Scripter, keys []string, args ...interface{}) *Cmd {
return c.EvalSha(ctx, s.hash, keys, args...)
}
func (s *Script) EvalShaRO(ctx context.Context, c Scripter, keys []string, args ...interface{}) *Cmd {
return c.EvalShaRO(ctx, s.hash, keys, args...)
}
// Run optimistically uses EVALSHA to run the script. If script does not exist
// it is retried using EVAL.
func (s *Script) Run(ctx context.Context, c Scripter, keys []string, args ...interface{}) *Cmd {
r := s.EvalSha(ctx, c, keys, args...)
if HasErrorPrefix(r.Err(), "NOSCRIPT") {
return s.Eval(ctx, c, keys, args...)
}
return r
}
// RunRO optimistically uses EVALSHA_RO to run the script. If script does not exist
// it is retried using EVAL_RO.
func (s *Script) RunRO(ctx context.Context, c Scripter, keys []string, args ...interface{}) *Cmd {
r := s.EvalShaRO(ctx, c, keys, args...)
if HasErrorPrefix(r.Err(), "NOSCRIPT") {
return s.EvalRO(ctx, c, keys, args...)
}
return r
}

215
vendor/github.com/redis/go-redis/v9/scripting_commands.go generated vendored Normal file
View File

@@ -0,0 +1,215 @@
package redis
import "context"
type ScriptingFunctionsCmdable interface {
Eval(ctx context.Context, script string, keys []string, args ...interface{}) *Cmd
EvalSha(ctx context.Context, sha1 string, keys []string, args ...interface{}) *Cmd
EvalRO(ctx context.Context, script string, keys []string, args ...interface{}) *Cmd
EvalShaRO(ctx context.Context, sha1 string, keys []string, args ...interface{}) *Cmd
ScriptExists(ctx context.Context, hashes ...string) *BoolSliceCmd
ScriptFlush(ctx context.Context) *StatusCmd
ScriptKill(ctx context.Context) *StatusCmd
ScriptLoad(ctx context.Context, script string) *StringCmd
FunctionLoad(ctx context.Context, code string) *StringCmd
FunctionLoadReplace(ctx context.Context, code string) *StringCmd
FunctionDelete(ctx context.Context, libName string) *StringCmd
FunctionFlush(ctx context.Context) *StringCmd
FunctionKill(ctx context.Context) *StringCmd
FunctionFlushAsync(ctx context.Context) *StringCmd
FunctionList(ctx context.Context, q FunctionListQuery) *FunctionListCmd
FunctionDump(ctx context.Context) *StringCmd
FunctionRestore(ctx context.Context, libDump string) *StringCmd
FunctionStats(ctx context.Context) *FunctionStatsCmd
FCall(ctx context.Context, function string, keys []string, args ...interface{}) *Cmd
FCallRo(ctx context.Context, function string, keys []string, args ...interface{}) *Cmd
FCallRO(ctx context.Context, function string, keys []string, args ...interface{}) *Cmd
}
func (c cmdable) Eval(ctx context.Context, script string, keys []string, args ...interface{}) *Cmd {
return c.eval(ctx, "eval", script, keys, args...)
}
func (c cmdable) EvalRO(ctx context.Context, script string, keys []string, args ...interface{}) *Cmd {
return c.eval(ctx, "eval_ro", script, keys, args...)
}
func (c cmdable) EvalSha(ctx context.Context, sha1 string, keys []string, args ...interface{}) *Cmd {
return c.eval(ctx, "evalsha", sha1, keys, args...)
}
func (c cmdable) EvalShaRO(ctx context.Context, sha1 string, keys []string, args ...interface{}) *Cmd {
return c.eval(ctx, "evalsha_ro", sha1, keys, args...)
}
func (c cmdable) eval(ctx context.Context, name, payload string, keys []string, args ...interface{}) *Cmd {
cmdArgs := make([]interface{}, 3+len(keys), 3+len(keys)+len(args))
cmdArgs[0] = name
cmdArgs[1] = payload
cmdArgs[2] = len(keys)
for i, key := range keys {
cmdArgs[3+i] = key
}
cmdArgs = appendArgs(cmdArgs, args)
cmd := NewCmd(ctx, cmdArgs...)
// it is possible that only args exist without a key.
// rdb.eval(ctx, eval, script, nil, arg1, arg2)
if len(keys) > 0 {
cmd.SetFirstKeyPos(3)
}
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ScriptExists(ctx context.Context, hashes ...string) *BoolSliceCmd {
args := make([]interface{}, 2+len(hashes))
args[0] = "script"
args[1] = "exists"
for i, hash := range hashes {
args[2+i] = hash
}
cmd := NewBoolSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ScriptFlush(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "script", "flush")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ScriptKill(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "script", "kill")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ScriptLoad(ctx context.Context, script string) *StringCmd {
cmd := NewStringCmd(ctx, "script", "load", script)
_ = c(ctx, cmd)
return cmd
}
// ------------------------------------------------------------------------------
// FunctionListQuery is used with FunctionList to query for Redis libraries
//
// LibraryNamePattern - Use an empty string to get all libraries.
// - Use a glob-style pattern to match multiple libraries with a matching name
// - Use a library's full name to match a single library
// WithCode - If true, it will return the code of the library
type FunctionListQuery struct {
LibraryNamePattern string
WithCode bool
}
func (c cmdable) FunctionLoad(ctx context.Context, code string) *StringCmd {
cmd := NewStringCmd(ctx, "function", "load", code)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FunctionLoadReplace(ctx context.Context, code string) *StringCmd {
cmd := NewStringCmd(ctx, "function", "load", "replace", code)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FunctionDelete(ctx context.Context, libName string) *StringCmd {
cmd := NewStringCmd(ctx, "function", "delete", libName)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FunctionFlush(ctx context.Context) *StringCmd {
cmd := NewStringCmd(ctx, "function", "flush")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FunctionKill(ctx context.Context) *StringCmd {
cmd := NewStringCmd(ctx, "function", "kill")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FunctionFlushAsync(ctx context.Context) *StringCmd {
cmd := NewStringCmd(ctx, "function", "flush", "async")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FunctionList(ctx context.Context, q FunctionListQuery) *FunctionListCmd {
args := make([]interface{}, 2, 5)
args[0] = "function"
args[1] = "list"
if q.LibraryNamePattern != "" {
args = append(args, "libraryname", q.LibraryNamePattern)
}
if q.WithCode {
args = append(args, "withcode")
}
cmd := NewFunctionListCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FunctionDump(ctx context.Context) *StringCmd {
cmd := NewStringCmd(ctx, "function", "dump")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FunctionRestore(ctx context.Context, libDump string) *StringCmd {
cmd := NewStringCmd(ctx, "function", "restore", libDump)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FunctionStats(ctx context.Context) *FunctionStatsCmd {
cmd := NewFunctionStatsCmd(ctx, "function", "stats")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FCall(ctx context.Context, function string, keys []string, args ...interface{}) *Cmd {
cmdArgs := fcallArgs("fcall", function, keys, args...)
cmd := NewCmd(ctx, cmdArgs...)
if len(keys) > 0 {
cmd.SetFirstKeyPos(3)
}
_ = c(ctx, cmd)
return cmd
}
// FCallRo this function simply calls FCallRO,
// Deprecated: to maintain convention FCallRO.
func (c cmdable) FCallRo(ctx context.Context, function string, keys []string, args ...interface{}) *Cmd {
return c.FCallRO(ctx, function, keys, args...)
}
func (c cmdable) FCallRO(ctx context.Context, function string, keys []string, args ...interface{}) *Cmd {
cmdArgs := fcallArgs("fcall_ro", function, keys, args...)
cmd := NewCmd(ctx, cmdArgs...)
if len(keys) > 0 {
cmd.SetFirstKeyPos(3)
}
_ = c(ctx, cmd)
return cmd
}
func fcallArgs(command string, function string, keys []string, args ...interface{}) []interface{} {
cmdArgs := make([]interface{}, 3+len(keys), 3+len(keys)+len(args))
cmdArgs[0] = command
cmdArgs[1] = function
cmdArgs[2] = len(keys)
for i, key := range keys {
cmdArgs[3+i] = key
}
cmdArgs = append(cmdArgs, args...)
return cmdArgs
}

2103
vendor/github.com/redis/go-redis/v9/search_commands.go generated vendored Normal file
View File

File diff suppressed because it is too large Load Diff

1072
vendor/github.com/redis/go-redis/v9/sentinel.go generated vendored Normal file
View File

File diff suppressed because it is too large Load Diff

223
vendor/github.com/redis/go-redis/v9/set_commands.go generated vendored Normal file
View File

@@ -0,0 +1,223 @@
package redis
import (
"context"
"github.com/redis/go-redis/v9/internal/hashtag"
)
type SetCmdable interface {
SAdd(ctx context.Context, key string, members ...interface{}) *IntCmd
SCard(ctx context.Context, key string) *IntCmd
SDiff(ctx context.Context, keys ...string) *StringSliceCmd
SDiffStore(ctx context.Context, destination string, keys ...string) *IntCmd
SInter(ctx context.Context, keys ...string) *StringSliceCmd
SInterCard(ctx context.Context, limit int64, keys ...string) *IntCmd
SInterStore(ctx context.Context, destination string, keys ...string) *IntCmd
SIsMember(ctx context.Context, key string, member interface{}) *BoolCmd
SMIsMember(ctx context.Context, key string, members ...interface{}) *BoolSliceCmd
SMembers(ctx context.Context, key string) *StringSliceCmd
SMembersMap(ctx context.Context, key string) *StringStructMapCmd
SMove(ctx context.Context, source, destination string, member interface{}) *BoolCmd
SPop(ctx context.Context, key string) *StringCmd
SPopN(ctx context.Context, key string, count int64) *StringSliceCmd
SRandMember(ctx context.Context, key string) *StringCmd
SRandMemberN(ctx context.Context, key string, count int64) *StringSliceCmd
SRem(ctx context.Context, key string, members ...interface{}) *IntCmd
SScan(ctx context.Context, key string, cursor uint64, match string, count int64) *ScanCmd
SUnion(ctx context.Context, keys ...string) *StringSliceCmd
SUnionStore(ctx context.Context, destination string, keys ...string) *IntCmd
}
//------------------------------------------------------------------------------
func (c cmdable) SAdd(ctx context.Context, key string, members ...interface{}) *IntCmd {
args := make([]interface{}, 2, 2+len(members))
args[0] = "sadd"
args[1] = key
args = appendArgs(args, members)
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SCard(ctx context.Context, key string) *IntCmd {
cmd := NewIntCmd(ctx, "scard", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SDiff(ctx context.Context, keys ...string) *StringSliceCmd {
args := make([]interface{}, 1+len(keys))
args[0] = "sdiff"
for i, key := range keys {
args[1+i] = key
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SDiffStore(ctx context.Context, destination string, keys ...string) *IntCmd {
args := make([]interface{}, 2+len(keys))
args[0] = "sdiffstore"
args[1] = destination
for i, key := range keys {
args[2+i] = key
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SInter(ctx context.Context, keys ...string) *StringSliceCmd {
args := make([]interface{}, 1+len(keys))
args[0] = "sinter"
for i, key := range keys {
args[1+i] = key
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SInterCard(ctx context.Context, limit int64, keys ...string) *IntCmd {
numKeys := len(keys)
args := make([]interface{}, 4+numKeys)
args[0] = "sintercard"
args[1] = numKeys
for i, key := range keys {
args[2+i] = key
}
args[2+numKeys] = "limit"
args[3+numKeys] = limit
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SInterStore(ctx context.Context, destination string, keys ...string) *IntCmd {
args := make([]interface{}, 2+len(keys))
args[0] = "sinterstore"
args[1] = destination
for i, key := range keys {
args[2+i] = key
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SIsMember(ctx context.Context, key string, member interface{}) *BoolCmd {
cmd := NewBoolCmd(ctx, "sismember", key, member)
_ = c(ctx, cmd)
return cmd
}
// SMIsMember Redis `SMISMEMBER key member [member ...]` command.
func (c cmdable) SMIsMember(ctx context.Context, key string, members ...interface{}) *BoolSliceCmd {
args := make([]interface{}, 2, 2+len(members))
args[0] = "smismember"
args[1] = key
args = appendArgs(args, members)
cmd := NewBoolSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// SMembers Redis `SMEMBERS key` command output as a slice.
func (c cmdable) SMembers(ctx context.Context, key string) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "smembers", key)
_ = c(ctx, cmd)
return cmd
}
// SMembersMap Redis `SMEMBERS key` command output as a map.
func (c cmdable) SMembersMap(ctx context.Context, key string) *StringStructMapCmd {
cmd := NewStringStructMapCmd(ctx, "smembers", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SMove(ctx context.Context, source, destination string, member interface{}) *BoolCmd {
cmd := NewBoolCmd(ctx, "smove", source, destination, member)
_ = c(ctx, cmd)
return cmd
}
// SPop Redis `SPOP key` command.
func (c cmdable) SPop(ctx context.Context, key string) *StringCmd {
cmd := NewStringCmd(ctx, "spop", key)
_ = c(ctx, cmd)
return cmd
}
// SPopN Redis `SPOP key count` command.
func (c cmdable) SPopN(ctx context.Context, key string, count int64) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "spop", key, count)
_ = c(ctx, cmd)
return cmd
}
// SRandMember Redis `SRANDMEMBER key` command.
func (c cmdable) SRandMember(ctx context.Context, key string) *StringCmd {
cmd := NewStringCmd(ctx, "srandmember", key)
_ = c(ctx, cmd)
return cmd
}
// SRandMemberN Redis `SRANDMEMBER key count` command.
func (c cmdable) SRandMemberN(ctx context.Context, key string, count int64) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "srandmember", key, count)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SRem(ctx context.Context, key string, members ...interface{}) *IntCmd {
args := make([]interface{}, 2, 2+len(members))
args[0] = "srem"
args[1] = key
args = appendArgs(args, members)
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SUnion(ctx context.Context, keys ...string) *StringSliceCmd {
args := make([]interface{}, 1+len(keys))
args[0] = "sunion"
for i, key := range keys {
args[1+i] = key
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SUnionStore(ctx context.Context, destination string, keys ...string) *IntCmd {
args := make([]interface{}, 2+len(keys))
args[0] = "sunionstore"
args[1] = destination
for i, key := range keys {
args[2+i] = key
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SScan(ctx context.Context, key string, cursor uint64, match string, count int64) *ScanCmd {
args := []interface{}{"sscan", key, cursor}
if match != "" {
args = append(args, "match", match)
}
if count > 0 {
args = append(args, "count", count)
}
cmd := NewScanCmd(ctx, c, args...)
if hashtag.Present(match) {
cmd.SetFirstKeyPos(4)
}
_ = c(ctx, cmd)
return cmd
}

776
vendor/github.com/redis/go-redis/v9/sortedset_commands.go generated vendored Normal file
View File

@@ -0,0 +1,776 @@
package redis
import (
"context"
"strings"
"time"
"github.com/redis/go-redis/v9/internal/hashtag"
)
type SortedSetCmdable interface {
BZPopMax(ctx context.Context, timeout time.Duration, keys ...string) *ZWithKeyCmd
BZPopMin(ctx context.Context, timeout time.Duration, keys ...string) *ZWithKeyCmd
BZMPop(ctx context.Context, timeout time.Duration, order string, count int64, keys ...string) *ZSliceWithKeyCmd
ZAdd(ctx context.Context, key string, members ...Z) *IntCmd
ZAddLT(ctx context.Context, key string, members ...Z) *IntCmd
ZAddGT(ctx context.Context, key string, members ...Z) *IntCmd
ZAddNX(ctx context.Context, key string, members ...Z) *IntCmd
ZAddXX(ctx context.Context, key string, members ...Z) *IntCmd
ZAddArgs(ctx context.Context, key string, args ZAddArgs) *IntCmd
ZAddArgsIncr(ctx context.Context, key string, args ZAddArgs) *FloatCmd
ZCard(ctx context.Context, key string) *IntCmd
ZCount(ctx context.Context, key, min, max string) *IntCmd
ZLexCount(ctx context.Context, key, min, max string) *IntCmd
ZIncrBy(ctx context.Context, key string, increment float64, member string) *FloatCmd
ZInter(ctx context.Context, store *ZStore) *StringSliceCmd
ZInterWithScores(ctx context.Context, store *ZStore) *ZSliceCmd
ZInterCard(ctx context.Context, limit int64, keys ...string) *IntCmd
ZInterStore(ctx context.Context, destination string, store *ZStore) *IntCmd
ZMPop(ctx context.Context, order string, count int64, keys ...string) *ZSliceWithKeyCmd
ZMScore(ctx context.Context, key string, members ...string) *FloatSliceCmd
ZPopMax(ctx context.Context, key string, count ...int64) *ZSliceCmd
ZPopMin(ctx context.Context, key string, count ...int64) *ZSliceCmd
ZRange(ctx context.Context, key string, start, stop int64) *StringSliceCmd
ZRangeWithScores(ctx context.Context, key string, start, stop int64) *ZSliceCmd
ZRangeByScore(ctx context.Context, key string, opt *ZRangeBy) *StringSliceCmd
ZRangeByLex(ctx context.Context, key string, opt *ZRangeBy) *StringSliceCmd
ZRangeByScoreWithScores(ctx context.Context, key string, opt *ZRangeBy) *ZSliceCmd
ZRangeArgs(ctx context.Context, z ZRangeArgs) *StringSliceCmd
ZRangeArgsWithScores(ctx context.Context, z ZRangeArgs) *ZSliceCmd
ZRangeStore(ctx context.Context, dst string, z ZRangeArgs) *IntCmd
ZRank(ctx context.Context, key, member string) *IntCmd
ZRankWithScore(ctx context.Context, key, member string) *RankWithScoreCmd
ZRem(ctx context.Context, key string, members ...interface{}) *IntCmd
ZRemRangeByRank(ctx context.Context, key string, start, stop int64) *IntCmd
ZRemRangeByScore(ctx context.Context, key, min, max string) *IntCmd
ZRemRangeByLex(ctx context.Context, key, min, max string) *IntCmd
ZRevRange(ctx context.Context, key string, start, stop int64) *StringSliceCmd
ZRevRangeWithScores(ctx context.Context, key string, start, stop int64) *ZSliceCmd
ZRevRangeByScore(ctx context.Context, key string, opt *ZRangeBy) *StringSliceCmd
ZRevRangeByLex(ctx context.Context, key string, opt *ZRangeBy) *StringSliceCmd
ZRevRangeByScoreWithScores(ctx context.Context, key string, opt *ZRangeBy) *ZSliceCmd
ZRevRank(ctx context.Context, key, member string) *IntCmd
ZRevRankWithScore(ctx context.Context, key, member string) *RankWithScoreCmd
ZScore(ctx context.Context, key, member string) *FloatCmd
ZUnionStore(ctx context.Context, dest string, store *ZStore) *IntCmd
ZRandMember(ctx context.Context, key string, count int) *StringSliceCmd
ZRandMemberWithScores(ctx context.Context, key string, count int) *ZSliceCmd
ZUnion(ctx context.Context, store ZStore) *StringSliceCmd
ZUnionWithScores(ctx context.Context, store ZStore) *ZSliceCmd
ZDiff(ctx context.Context, keys ...string) *StringSliceCmd
ZDiffWithScores(ctx context.Context, keys ...string) *ZSliceCmd
ZDiffStore(ctx context.Context, destination string, keys ...string) *IntCmd
ZScan(ctx context.Context, key string, cursor uint64, match string, count int64) *ScanCmd
}
// BZPopMax Redis `BZPOPMAX key [key ...] timeout` command.
func (c cmdable) BZPopMax(ctx context.Context, timeout time.Duration, keys ...string) *ZWithKeyCmd {
args := make([]interface{}, 1+len(keys)+1)
args[0] = "bzpopmax"
for i, key := range keys {
args[1+i] = key
}
args[len(args)-1] = formatSec(ctx, timeout)
cmd := NewZWithKeyCmd(ctx, args...)
cmd.setReadTimeout(timeout)
_ = c(ctx, cmd)
return cmd
}
// BZPopMin Redis `BZPOPMIN key [key ...] timeout` command.
func (c cmdable) BZPopMin(ctx context.Context, timeout time.Duration, keys ...string) *ZWithKeyCmd {
args := make([]interface{}, 1+len(keys)+1)
args[0] = "bzpopmin"
for i, key := range keys {
args[1+i] = key
}
args[len(args)-1] = formatSec(ctx, timeout)
cmd := NewZWithKeyCmd(ctx, args...)
cmd.setReadTimeout(timeout)
_ = c(ctx, cmd)
return cmd
}
// BZMPop is the blocking variant of ZMPOP.
// When any of the sorted sets contains elements, this command behaves exactly like ZMPOP.
// When all sorted sets are empty, Redis will block the connection until another client adds members to one of the keys or until the timeout elapses.
// A timeout of zero can be used to block indefinitely.
// example: client.BZMPop(ctx, 0,"max", 1, "set")
func (c cmdable) BZMPop(ctx context.Context, timeout time.Duration, order string, count int64, keys ...string) *ZSliceWithKeyCmd {
args := make([]interface{}, 3+len(keys), 6+len(keys))
args[0] = "bzmpop"
args[1] = formatSec(ctx, timeout)
args[2] = len(keys)
for i, key := range keys {
args[3+i] = key
}
args = append(args, strings.ToLower(order), "count", count)
cmd := NewZSliceWithKeyCmd(ctx, args...)
cmd.setReadTimeout(timeout)
_ = c(ctx, cmd)
return cmd
}
// ZAddArgs WARN: The GT, LT and NX options are mutually exclusive.
type ZAddArgs struct {
NX bool
XX bool
LT bool
GT bool
Ch bool
Members []Z
}
func (c cmdable) zAddArgs(key string, args ZAddArgs, incr bool) []interface{} {
a := make([]interface{}, 0, 6+2*len(args.Members))
a = append(a, "zadd", key)
// The GT, LT and NX options are mutually exclusive.
if args.NX {
a = append(a, "nx")
} else {
if args.XX {
a = append(a, "xx")
}
if args.GT {
a = append(a, "gt")
} else if args.LT {
a = append(a, "lt")
}
}
if args.Ch {
a = append(a, "ch")
}
if incr {
a = append(a, "incr")
}
for _, m := range args.Members {
a = append(a, m.Score)
a = append(a, m.Member)
}
return a
}
func (c cmdable) ZAddArgs(ctx context.Context, key string, args ZAddArgs) *IntCmd {
cmd := NewIntCmd(ctx, c.zAddArgs(key, args, false)...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZAddArgsIncr(ctx context.Context, key string, args ZAddArgs) *FloatCmd {
cmd := NewFloatCmd(ctx, c.zAddArgs(key, args, true)...)
_ = c(ctx, cmd)
return cmd
}
// ZAdd Redis `ZADD key score member [score member ...]` command.
func (c cmdable) ZAdd(ctx context.Context, key string, members ...Z) *IntCmd {
return c.ZAddArgs(ctx, key, ZAddArgs{
Members: members,
})
}
// ZAddLT Redis `ZADD key LT score member [score member ...]` command.
func (c cmdable) ZAddLT(ctx context.Context, key string, members ...Z) *IntCmd {
return c.ZAddArgs(ctx, key, ZAddArgs{
LT: true,
Members: members,
})
}
// ZAddGT Redis `ZADD key GT score member [score member ...]` command.
func (c cmdable) ZAddGT(ctx context.Context, key string, members ...Z) *IntCmd {
return c.ZAddArgs(ctx, key, ZAddArgs{
GT: true,
Members: members,
})
}
// ZAddNX Redis `ZADD key NX score member [score member ...]` command.
func (c cmdable) ZAddNX(ctx context.Context, key string, members ...Z) *IntCmd {
return c.ZAddArgs(ctx, key, ZAddArgs{
NX: true,
Members: members,
})
}
// ZAddXX Redis `ZADD key XX score member [score member ...]` command.
func (c cmdable) ZAddXX(ctx context.Context, key string, members ...Z) *IntCmd {
return c.ZAddArgs(ctx, key, ZAddArgs{
XX: true,
Members: members,
})
}
func (c cmdable) ZCard(ctx context.Context, key string) *IntCmd {
cmd := NewIntCmd(ctx, "zcard", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZCount(ctx context.Context, key, min, max string) *IntCmd {
cmd := NewIntCmd(ctx, "zcount", key, min, max)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZLexCount(ctx context.Context, key, min, max string) *IntCmd {
cmd := NewIntCmd(ctx, "zlexcount", key, min, max)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZIncrBy(ctx context.Context, key string, increment float64, member string) *FloatCmd {
cmd := NewFloatCmd(ctx, "zincrby", key, increment, member)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZInterStore(ctx context.Context, destination string, store *ZStore) *IntCmd {
args := make([]interface{}, 0, 3+store.len())
args = append(args, "zinterstore", destination, len(store.Keys))
args = store.appendArgs(args)
cmd := NewIntCmd(ctx, args...)
cmd.SetFirstKeyPos(3)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZInter(ctx context.Context, store *ZStore) *StringSliceCmd {
args := make([]interface{}, 0, 2+store.len())
args = append(args, "zinter", len(store.Keys))
args = store.appendArgs(args)
cmd := NewStringSliceCmd(ctx, args...)
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZInterWithScores(ctx context.Context, store *ZStore) *ZSliceCmd {
args := make([]interface{}, 0, 3+store.len())
args = append(args, "zinter", len(store.Keys))
args = store.appendArgs(args)
args = append(args, "withscores")
cmd := NewZSliceCmd(ctx, args...)
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZInterCard(ctx context.Context, limit int64, keys ...string) *IntCmd {
numKeys := len(keys)
args := make([]interface{}, 4+numKeys)
args[0] = "zintercard"
args[1] = numKeys
for i, key := range keys {
args[2+i] = key
}
args[2+numKeys] = "limit"
args[3+numKeys] = limit
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// ZMPop Pops one or more elements with the highest or lowest score from the first non-empty sorted set key from the list of provided key names.
// direction: "max" (highest score) or "min" (lowest score), count: > 0
// example: client.ZMPop(ctx, "max", 5, "set1", "set2")
func (c cmdable) ZMPop(ctx context.Context, order string, count int64, keys ...string) *ZSliceWithKeyCmd {
args := make([]interface{}, 2+len(keys), 5+len(keys))
args[0] = "zmpop"
args[1] = len(keys)
for i, key := range keys {
args[2+i] = key
}
args = append(args, strings.ToLower(order), "count", count)
cmd := NewZSliceWithKeyCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZMScore(ctx context.Context, key string, members ...string) *FloatSliceCmd {
args := make([]interface{}, 2+len(members))
args[0] = "zmscore"
args[1] = key
for i, member := range members {
args[2+i] = member
}
cmd := NewFloatSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZPopMax(ctx context.Context, key string, count ...int64) *ZSliceCmd {
args := []interface{}{
"zpopmax",
key,
}
switch len(count) {
case 0:
break
case 1:
args = append(args, count[0])
default:
panic("too many arguments")
}
cmd := NewZSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZPopMin(ctx context.Context, key string, count ...int64) *ZSliceCmd {
args := []interface{}{
"zpopmin",
key,
}
switch len(count) {
case 0:
break
case 1:
args = append(args, count[0])
default:
panic("too many arguments")
}
cmd := NewZSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// ZRangeArgs is all the options of the ZRange command.
// In version> 6.2.0, you can replace the(cmd):
//
// ZREVRANGE,
// ZRANGEBYSCORE,
// ZREVRANGEBYSCORE,
// ZRANGEBYLEX,
// ZREVRANGEBYLEX.
//
// Please pay attention to your redis-server version.
//
// Rev, ByScore, ByLex and Offset+Count options require redis-server 6.2.0 and higher.
type ZRangeArgs struct {
Key string
// When the ByScore option is provided, the open interval(exclusive) can be set.
// By default, the score intervals specified by <Start> and <Stop> are closed (inclusive).
// It is similar to the deprecated(6.2.0+) ZRangeByScore command.
// For example:
// ZRangeArgs{
// Key: "example-key",
// Start: "(3",
// Stop: 8,
// ByScore: true,
// }
// cmd: "ZRange example-key (3 8 ByScore" (3 < score <= 8).
//
// For the ByLex option, it is similar to the deprecated(6.2.0+) ZRangeByLex command.
// You can set the <Start> and <Stop> options as follows:
// ZRangeArgs{
// Key: "example-key",
// Start: "[abc",
// Stop: "(def",
// ByLex: true,
// }
// cmd: "ZRange example-key [abc (def ByLex"
//
// For normal cases (ByScore==false && ByLex==false), <Start> and <Stop> should be set to the index range (int).
// You can read the documentation for more information: https://redis.io/commands/zrange
Start interface{}
Stop interface{}
// The ByScore and ByLex options are mutually exclusive.
ByScore bool
ByLex bool
Rev bool
// limit offset count.
Offset int64
Count int64
}
func (z ZRangeArgs) appendArgs(args []interface{}) []interface{} {
// For Rev+ByScore/ByLex, we need to adjust the position of <Start> and <Stop>.
if z.Rev && (z.ByScore || z.ByLex) {
args = append(args, z.Key, z.Stop, z.Start)
} else {
args = append(args, z.Key, z.Start, z.Stop)
}
if z.ByScore {
args = append(args, "byscore")
} else if z.ByLex {
args = append(args, "bylex")
}
if z.Rev {
args = append(args, "rev")
}
if z.Offset != 0 || z.Count != 0 {
args = append(args, "limit", z.Offset, z.Count)
}
return args
}
func (c cmdable) ZRangeArgs(ctx context.Context, z ZRangeArgs) *StringSliceCmd {
args := make([]interface{}, 0, 9)
args = append(args, "zrange")
args = z.appendArgs(args)
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZRangeArgsWithScores(ctx context.Context, z ZRangeArgs) *ZSliceCmd {
args := make([]interface{}, 0, 10)
args = append(args, "zrange")
args = z.appendArgs(args)
args = append(args, "withscores")
cmd := NewZSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZRange(ctx context.Context, key string, start, stop int64) *StringSliceCmd {
return c.ZRangeArgs(ctx, ZRangeArgs{
Key: key,
Start: start,
Stop: stop,
})
}
func (c cmdable) ZRangeWithScores(ctx context.Context, key string, start, stop int64) *ZSliceCmd {
return c.ZRangeArgsWithScores(ctx, ZRangeArgs{
Key: key,
Start: start,
Stop: stop,
})
}
type ZRangeBy struct {
Min, Max string
Offset, Count int64
}
func (c cmdable) zRangeBy(ctx context.Context, zcmd, key string, opt *ZRangeBy, withScores bool) *StringSliceCmd {
args := []interface{}{zcmd, key, opt.Min, opt.Max}
if withScores {
args = append(args, "withscores")
}
if opt.Offset != 0 || opt.Count != 0 {
args = append(
args,
"limit",
opt.Offset,
opt.Count,
)
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZRangeByScore(ctx context.Context, key string, opt *ZRangeBy) *StringSliceCmd {
return c.zRangeBy(ctx, "zrangebyscore", key, opt, false)
}
func (c cmdable) ZRangeByLex(ctx context.Context, key string, opt *ZRangeBy) *StringSliceCmd {
return c.zRangeBy(ctx, "zrangebylex", key, opt, false)
}
func (c cmdable) ZRangeByScoreWithScores(ctx context.Context, key string, opt *ZRangeBy) *ZSliceCmd {
args := []interface{}{"zrangebyscore", key, opt.Min, opt.Max, "withscores"}
if opt.Offset != 0 || opt.Count != 0 {
args = append(
args,
"limit",
opt.Offset,
opt.Count,
)
}
cmd := NewZSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZRangeStore(ctx context.Context, dst string, z ZRangeArgs) *IntCmd {
args := make([]interface{}, 0, 10)
args = append(args, "zrangestore", dst)
args = z.appendArgs(args)
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZRank(ctx context.Context, key, member string) *IntCmd {
cmd := NewIntCmd(ctx, "zrank", key, member)
_ = c(ctx, cmd)
return cmd
}
// ZRankWithScore according to the Redis documentation, if member does not exist
// in the sorted set or key does not exist, it will return a redis.Nil error.
func (c cmdable) ZRankWithScore(ctx context.Context, key, member string) *RankWithScoreCmd {
cmd := NewRankWithScoreCmd(ctx, "zrank", key, member, "withscore")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZRem(ctx context.Context, key string, members ...interface{}) *IntCmd {
args := make([]interface{}, 2, 2+len(members))
args[0] = "zrem"
args[1] = key
args = appendArgs(args, members)
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZRemRangeByRank(ctx context.Context, key string, start, stop int64) *IntCmd {
cmd := NewIntCmd(
ctx,
"zremrangebyrank",
key,
start,
stop,
)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZRemRangeByScore(ctx context.Context, key, min, max string) *IntCmd {
cmd := NewIntCmd(ctx, "zremrangebyscore", key, min, max)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZRemRangeByLex(ctx context.Context, key, min, max string) *IntCmd {
cmd := NewIntCmd(ctx, "zremrangebylex", key, min, max)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZRevRange(ctx context.Context, key string, start, stop int64) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "zrevrange", key, start, stop)
_ = c(ctx, cmd)
return cmd
}
// ZRevRangeWithScores according to the Redis documentation, if member does not exist
// in the sorted set or key does not exist, it will return a redis.Nil error.
func (c cmdable) ZRevRangeWithScores(ctx context.Context, key string, start, stop int64) *ZSliceCmd {
cmd := NewZSliceCmd(ctx, "zrevrange", key, start, stop, "withscores")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) zRevRangeBy(ctx context.Context, zcmd, key string, opt *ZRangeBy) *StringSliceCmd {
args := []interface{}{zcmd, key, opt.Max, opt.Min}
if opt.Offset != 0 || opt.Count != 0 {
args = append(
args,
"limit",
opt.Offset,
opt.Count,
)
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZRevRangeByScore(ctx context.Context, key string, opt *ZRangeBy) *StringSliceCmd {
return c.zRevRangeBy(ctx, "zrevrangebyscore", key, opt)
}
func (c cmdable) ZRevRangeByLex(ctx context.Context, key string, opt *ZRangeBy) *StringSliceCmd {
return c.zRevRangeBy(ctx, "zrevrangebylex", key, opt)
}
func (c cmdable) ZRevRangeByScoreWithScores(ctx context.Context, key string, opt *ZRangeBy) *ZSliceCmd {
args := []interface{}{"zrevrangebyscore", key, opt.Max, opt.Min, "withscores"}
if opt.Offset != 0 || opt.Count != 0 {
args = append(
args,
"limit",
opt.Offset,
opt.Count,
)
}
cmd := NewZSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZRevRank(ctx context.Context, key, member string) *IntCmd {
cmd := NewIntCmd(ctx, "zrevrank", key, member)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZRevRankWithScore(ctx context.Context, key, member string) *RankWithScoreCmd {
cmd := NewRankWithScoreCmd(ctx, "zrevrank", key, member, "withscore")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZScore(ctx context.Context, key, member string) *FloatCmd {
cmd := NewFloatCmd(ctx, "zscore", key, member)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZUnion(ctx context.Context, store ZStore) *StringSliceCmd {
args := make([]interface{}, 0, 2+store.len())
args = append(args, "zunion", len(store.Keys))
args = store.appendArgs(args)
cmd := NewStringSliceCmd(ctx, args...)
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZUnionWithScores(ctx context.Context, store ZStore) *ZSliceCmd {
args := make([]interface{}, 0, 3+store.len())
args = append(args, "zunion", len(store.Keys))
args = store.appendArgs(args)
args = append(args, "withscores")
cmd := NewZSliceCmd(ctx, args...)
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZUnionStore(ctx context.Context, dest string, store *ZStore) *IntCmd {
args := make([]interface{}, 0, 3+store.len())
args = append(args, "zunionstore", dest, len(store.Keys))
args = store.appendArgs(args)
cmd := NewIntCmd(ctx, args...)
cmd.SetFirstKeyPos(3)
_ = c(ctx, cmd)
return cmd
}
// ZRandMember redis-server version >= 6.2.0.
func (c cmdable) ZRandMember(ctx context.Context, key string, count int) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "zrandmember", key, count)
_ = c(ctx, cmd)
return cmd
}
// ZRandMemberWithScores redis-server version >= 6.2.0.
func (c cmdable) ZRandMemberWithScores(ctx context.Context, key string, count int) *ZSliceCmd {
cmd := NewZSliceCmd(ctx, "zrandmember", key, count, "withscores")
_ = c(ctx, cmd)
return cmd
}
// ZDiff redis-server version >= 6.2.0.
func (c cmdable) ZDiff(ctx context.Context, keys ...string) *StringSliceCmd {
args := make([]interface{}, 2+len(keys))
args[0] = "zdiff"
args[1] = len(keys)
for i, key := range keys {
args[i+2] = key
}
cmd := NewStringSliceCmd(ctx, args...)
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
// ZDiffWithScores redis-server version >= 6.2.0.
func (c cmdable) ZDiffWithScores(ctx context.Context, keys ...string) *ZSliceCmd {
args := make([]interface{}, 3+len(keys))
args[0] = "zdiff"
args[1] = len(keys)
for i, key := range keys {
args[i+2] = key
}
args[len(keys)+2] = "withscores"
cmd := NewZSliceCmd(ctx, args...)
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
// ZDiffStore redis-server version >=6.2.0.
func (c cmdable) ZDiffStore(ctx context.Context, destination string, keys ...string) *IntCmd {
args := make([]interface{}, 0, 3+len(keys))
args = append(args, "zdiffstore", destination, len(keys))
for _, key := range keys {
args = append(args, key)
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZScan(ctx context.Context, key string, cursor uint64, match string, count int64) *ScanCmd {
args := []interface{}{"zscan", key, cursor}
if match != "" {
args = append(args, "match", match)
}
if count > 0 {
args = append(args, "count", count)
}
cmd := NewScanCmd(ctx, c, args...)
if hashtag.Present(match) {
cmd.SetFirstKeyPos(4)
}
_ = c(ctx, cmd)
return cmd
}
// Z represents sorted set member.
type Z struct {
Score float64
Member interface{}
}
// ZWithKey represents sorted set member including the name of the key where it was popped.
type ZWithKey struct {
Z
Key string
}
// ZStore is used as an arg to ZInter/ZInterStore and ZUnion/ZUnionStore.
type ZStore struct {
Keys []string
Weights []float64
// Can be SUM, MIN or MAX.
Aggregate string
}
func (z ZStore) len() (n int) {
n = len(z.Keys)
if len(z.Weights) > 0 {
n += 1 + len(z.Weights)
}
if z.Aggregate != "" {
n += 2
}
return n
}
func (z ZStore) appendArgs(args []interface{}) []interface{} {
for _, key := range z.Keys {
args = append(args, key)
}
if len(z.Weights) > 0 {
args = append(args, "weights")
for _, weights := range z.Weights {
args = append(args, weights)
}
}
if z.Aggregate != "" {
args = append(args, "aggregate", z.Aggregate)
}
return args
}

450
vendor/github.com/redis/go-redis/v9/stream_commands.go generated vendored Normal file
View File

@@ -0,0 +1,450 @@
package redis
import (
"context"
"time"
)
type StreamCmdable interface {
XAdd(ctx context.Context, a *XAddArgs) *StringCmd
XDel(ctx context.Context, stream string, ids ...string) *IntCmd
XLen(ctx context.Context, stream string) *IntCmd
XRange(ctx context.Context, stream, start, stop string) *XMessageSliceCmd
XRangeN(ctx context.Context, stream, start, stop string, count int64) *XMessageSliceCmd
XRevRange(ctx context.Context, stream string, start, stop string) *XMessageSliceCmd
XRevRangeN(ctx context.Context, stream string, start, stop string, count int64) *XMessageSliceCmd
XRead(ctx context.Context, a *XReadArgs) *XStreamSliceCmd
XReadStreams(ctx context.Context, streams ...string) *XStreamSliceCmd
XGroupCreate(ctx context.Context, stream, group, start string) *StatusCmd
XGroupCreateMkStream(ctx context.Context, stream, group, start string) *StatusCmd
XGroupSetID(ctx context.Context, stream, group, start string) *StatusCmd
XGroupDestroy(ctx context.Context, stream, group string) *IntCmd
XGroupCreateConsumer(ctx context.Context, stream, group, consumer string) *IntCmd
XGroupDelConsumer(ctx context.Context, stream, group, consumer string) *IntCmd
XReadGroup(ctx context.Context, a *XReadGroupArgs) *XStreamSliceCmd
XAck(ctx context.Context, stream, group string, ids ...string) *IntCmd
XPending(ctx context.Context, stream, group string) *XPendingCmd
XPendingExt(ctx context.Context, a *XPendingExtArgs) *XPendingExtCmd
XClaim(ctx context.Context, a *XClaimArgs) *XMessageSliceCmd
XClaimJustID(ctx context.Context, a *XClaimArgs) *StringSliceCmd
XAutoClaim(ctx context.Context, a *XAutoClaimArgs) *XAutoClaimCmd
XAutoClaimJustID(ctx context.Context, a *XAutoClaimArgs) *XAutoClaimJustIDCmd
XTrimMaxLen(ctx context.Context, key string, maxLen int64) *IntCmd
XTrimMaxLenApprox(ctx context.Context, key string, maxLen, limit int64) *IntCmd
XTrimMinID(ctx context.Context, key string, minID string) *IntCmd
XTrimMinIDApprox(ctx context.Context, key string, minID string, limit int64) *IntCmd
XInfoGroups(ctx context.Context, key string) *XInfoGroupsCmd
XInfoStream(ctx context.Context, key string) *XInfoStreamCmd
XInfoStreamFull(ctx context.Context, key string, count int) *XInfoStreamFullCmd
XInfoConsumers(ctx context.Context, key string, group string) *XInfoConsumersCmd
}
// XAddArgs accepts values in the following formats:
// - XAddArgs.Values = []interface{}{"key1", "value1", "key2", "value2"}
// - XAddArgs.Values = []string("key1", "value1", "key2", "value2")
// - XAddArgs.Values = map[string]interface{}{"key1": "value1", "key2": "value2"}
//
// Note that map will not preserve the order of key-value pairs.
// MaxLen/MaxLenApprox and MinID are in conflict, only one of them can be used.
type XAddArgs struct {
Stream string
NoMkStream bool
MaxLen int64 // MAXLEN N
MinID string
// Approx causes MaxLen and MinID to use "~" matcher (instead of "=").
Approx bool
Limit int64
ID string
Values interface{}
}
func (c cmdable) XAdd(ctx context.Context, a *XAddArgs) *StringCmd {
args := make([]interface{}, 0, 11)
args = append(args, "xadd", a.Stream)
if a.NoMkStream {
args = append(args, "nomkstream")
}
switch {
case a.MaxLen > 0:
if a.Approx {
args = append(args, "maxlen", "~", a.MaxLen)
} else {
args = append(args, "maxlen", a.MaxLen)
}
case a.MinID != "":
if a.Approx {
args = append(args, "minid", "~", a.MinID)
} else {
args = append(args, "minid", a.MinID)
}
}
if a.Limit > 0 {
args = append(args, "limit", a.Limit)
}
if a.ID != "" {
args = append(args, a.ID)
} else {
args = append(args, "*")
}
args = appendArg(args, a.Values)
cmd := NewStringCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XDel(ctx context.Context, stream string, ids ...string) *IntCmd {
args := []interface{}{"xdel", stream}
for _, id := range ids {
args = append(args, id)
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XLen(ctx context.Context, stream string) *IntCmd {
cmd := NewIntCmd(ctx, "xlen", stream)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XRange(ctx context.Context, stream, start, stop string) *XMessageSliceCmd {
cmd := NewXMessageSliceCmd(ctx, "xrange", stream, start, stop)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XRangeN(ctx context.Context, stream, start, stop string, count int64) *XMessageSliceCmd {
cmd := NewXMessageSliceCmd(ctx, "xrange", stream, start, stop, "count", count)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XRevRange(ctx context.Context, stream, start, stop string) *XMessageSliceCmd {
cmd := NewXMessageSliceCmd(ctx, "xrevrange", stream, start, stop)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XRevRangeN(ctx context.Context, stream, start, stop string, count int64) *XMessageSliceCmd {
cmd := NewXMessageSliceCmd(ctx, "xrevrange", stream, start, stop, "count", count)
_ = c(ctx, cmd)
return cmd
}
type XReadArgs struct {
Streams []string // list of streams and ids, e.g. stream1 stream2 id1 id2
Count int64
Block time.Duration
ID string
}
func (c cmdable) XRead(ctx context.Context, a *XReadArgs) *XStreamSliceCmd {
args := make([]interface{}, 0, 2*len(a.Streams)+6)
args = append(args, "xread")
keyPos := int8(1)
if a.Count > 0 {
args = append(args, "count")
args = append(args, a.Count)
keyPos += 2
}
if a.Block >= 0 {
args = append(args, "block")
args = append(args, int64(a.Block/time.Millisecond))
keyPos += 2
}
args = append(args, "streams")
keyPos++
for _, s := range a.Streams {
args = append(args, s)
}
if a.ID != "" {
for range a.Streams {
args = append(args, a.ID)
}
}
cmd := NewXStreamSliceCmd(ctx, args...)
if a.Block >= 0 {
cmd.setReadTimeout(a.Block)
}
cmd.SetFirstKeyPos(keyPos)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XReadStreams(ctx context.Context, streams ...string) *XStreamSliceCmd {
return c.XRead(ctx, &XReadArgs{
Streams: streams,
Block: -1,
})
}
func (c cmdable) XGroupCreate(ctx context.Context, stream, group, start string) *StatusCmd {
cmd := NewStatusCmd(ctx, "xgroup", "create", stream, group, start)
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XGroupCreateMkStream(ctx context.Context, stream, group, start string) *StatusCmd {
cmd := NewStatusCmd(ctx, "xgroup", "create", stream, group, start, "mkstream")
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XGroupSetID(ctx context.Context, stream, group, start string) *StatusCmd {
cmd := NewStatusCmd(ctx, "xgroup", "setid", stream, group, start)
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XGroupDestroy(ctx context.Context, stream, group string) *IntCmd {
cmd := NewIntCmd(ctx, "xgroup", "destroy", stream, group)
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XGroupCreateConsumer(ctx context.Context, stream, group, consumer string) *IntCmd {
cmd := NewIntCmd(ctx, "xgroup", "createconsumer", stream, group, consumer)
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XGroupDelConsumer(ctx context.Context, stream, group, consumer string) *IntCmd {
cmd := NewIntCmd(ctx, "xgroup", "delconsumer", stream, group, consumer)
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
type XReadGroupArgs struct {
Group string
Consumer string
Streams []string // list of streams and ids, e.g. stream1 stream2 id1 id2
Count int64
Block time.Duration
NoAck bool
}
func (c cmdable) XReadGroup(ctx context.Context, a *XReadGroupArgs) *XStreamSliceCmd {
args := make([]interface{}, 0, 10+len(a.Streams))
args = append(args, "xreadgroup", "group", a.Group, a.Consumer)
keyPos := int8(4)
if a.Count > 0 {
args = append(args, "count", a.Count)
keyPos += 2
}
if a.Block >= 0 {
args = append(args, "block", int64(a.Block/time.Millisecond))
keyPos += 2
}
if a.NoAck {
args = append(args, "noack")
keyPos++
}
args = append(args, "streams")
keyPos++
for _, s := range a.Streams {
args = append(args, s)
}
cmd := NewXStreamSliceCmd(ctx, args...)
if a.Block >= 0 {
cmd.setReadTimeout(a.Block)
}
cmd.SetFirstKeyPos(keyPos)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XAck(ctx context.Context, stream, group string, ids ...string) *IntCmd {
args := []interface{}{"xack", stream, group}
for _, id := range ids {
args = append(args, id)
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XPending(ctx context.Context, stream, group string) *XPendingCmd {
cmd := NewXPendingCmd(ctx, "xpending", stream, group)
_ = c(ctx, cmd)
return cmd
}
type XPendingExtArgs struct {
Stream string
Group string
Idle time.Duration
Start string
End string
Count int64
Consumer string
}
func (c cmdable) XPendingExt(ctx context.Context, a *XPendingExtArgs) *XPendingExtCmd {
args := make([]interface{}, 0, 9)
args = append(args, "xpending", a.Stream, a.Group)
if a.Idle != 0 {
args = append(args, "idle", formatMs(ctx, a.Idle))
}
args = append(args, a.Start, a.End, a.Count)
if a.Consumer != "" {
args = append(args, a.Consumer)
}
cmd := NewXPendingExtCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
type XAutoClaimArgs struct {
Stream string
Group string
MinIdle time.Duration
Start string
Count int64
Consumer string
}
func (c cmdable) XAutoClaim(ctx context.Context, a *XAutoClaimArgs) *XAutoClaimCmd {
args := xAutoClaimArgs(ctx, a)
cmd := NewXAutoClaimCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XAutoClaimJustID(ctx context.Context, a *XAutoClaimArgs) *XAutoClaimJustIDCmd {
args := xAutoClaimArgs(ctx, a)
args = append(args, "justid")
cmd := NewXAutoClaimJustIDCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func xAutoClaimArgs(ctx context.Context, a *XAutoClaimArgs) []interface{} {
args := make([]interface{}, 0, 8)
args = append(args, "xautoclaim", a.Stream, a.Group, a.Consumer, formatMs(ctx, a.MinIdle), a.Start)
if a.Count > 0 {
args = append(args, "count", a.Count)
}
return args
}
type XClaimArgs struct {
Stream string
Group string
Consumer string
MinIdle time.Duration
Messages []string
}
func (c cmdable) XClaim(ctx context.Context, a *XClaimArgs) *XMessageSliceCmd {
args := xClaimArgs(a)
cmd := NewXMessageSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XClaimJustID(ctx context.Context, a *XClaimArgs) *StringSliceCmd {
args := xClaimArgs(a)
args = append(args, "justid")
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func xClaimArgs(a *XClaimArgs) []interface{} {
args := make([]interface{}, 0, 5+len(a.Messages))
args = append(args,
"xclaim",
a.Stream,
a.Group, a.Consumer,
int64(a.MinIdle/time.Millisecond))
for _, id := range a.Messages {
args = append(args, id)
}
return args
}
// xTrim If approx is true, add the "~" parameter, otherwise it is the default "=" (redis default).
// example:
//
// XTRIM key MAXLEN/MINID threshold LIMIT limit.
// XTRIM key MAXLEN/MINID ~ threshold LIMIT limit.
//
// The redis-server version is lower than 6.2, please set limit to 0.
func (c cmdable) xTrim(
ctx context.Context, key, strategy string,
approx bool, threshold interface{}, limit int64,
) *IntCmd {
args := make([]interface{}, 0, 7)
args = append(args, "xtrim", key, strategy)
if approx {
args = append(args, "~")
}
args = append(args, threshold)
if limit > 0 {
args = append(args, "limit", limit)
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// XTrimMaxLen No `~` rules are used, `limit` cannot be used.
// cmd: XTRIM key MAXLEN maxLen
func (c cmdable) XTrimMaxLen(ctx context.Context, key string, maxLen int64) *IntCmd {
return c.xTrim(ctx, key, "maxlen", false, maxLen, 0)
}
func (c cmdable) XTrimMaxLenApprox(ctx context.Context, key string, maxLen, limit int64) *IntCmd {
return c.xTrim(ctx, key, "maxlen", true, maxLen, limit)
}
func (c cmdable) XTrimMinID(ctx context.Context, key string, minID string) *IntCmd {
return c.xTrim(ctx, key, "minid", false, minID, 0)
}
func (c cmdable) XTrimMinIDApprox(ctx context.Context, key string, minID string, limit int64) *IntCmd {
return c.xTrim(ctx, key, "minid", true, minID, limit)
}
func (c cmdable) XInfoConsumers(ctx context.Context, key string, group string) *XInfoConsumersCmd {
cmd := NewXInfoConsumersCmd(ctx, key, group)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XInfoGroups(ctx context.Context, key string) *XInfoGroupsCmd {
cmd := NewXInfoGroupsCmd(ctx, key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XInfoStream(ctx context.Context, key string) *XInfoStreamCmd {
cmd := NewXInfoStreamCmd(ctx, key)
_ = c(ctx, cmd)
return cmd
}
// XInfoStreamFull XINFO STREAM FULL [COUNT count]
// redis-server >= 6.0.
func (c cmdable) XInfoStreamFull(ctx context.Context, key string, count int) *XInfoStreamFullCmd {
args := make([]interface{}, 0, 6)
args = append(args, "xinfo", "stream", key, "full")
if count > 0 {
args = append(args, "count", count)
}
cmd := NewXInfoStreamFullCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}

303
vendor/github.com/redis/go-redis/v9/string_commands.go generated vendored Normal file
View File

@@ -0,0 +1,303 @@
package redis
import (
"context"
"time"
)
type StringCmdable interface {
Append(ctx context.Context, key, value string) *IntCmd
Decr(ctx context.Context, key string) *IntCmd
DecrBy(ctx context.Context, key string, decrement int64) *IntCmd
Get(ctx context.Context, key string) *StringCmd
GetRange(ctx context.Context, key string, start, end int64) *StringCmd
GetSet(ctx context.Context, key string, value interface{}) *StringCmd
GetEx(ctx context.Context, key string, expiration time.Duration) *StringCmd
GetDel(ctx context.Context, key string) *StringCmd
Incr(ctx context.Context, key string) *IntCmd
IncrBy(ctx context.Context, key string, value int64) *IntCmd
IncrByFloat(ctx context.Context, key string, value float64) *FloatCmd
LCS(ctx context.Context, q *LCSQuery) *LCSCmd
MGet(ctx context.Context, keys ...string) *SliceCmd
MSet(ctx context.Context, values ...interface{}) *StatusCmd
MSetNX(ctx context.Context, values ...interface{}) *BoolCmd
Set(ctx context.Context, key string, value interface{}, expiration time.Duration) *StatusCmd
SetArgs(ctx context.Context, key string, value interface{}, a SetArgs) *StatusCmd
SetEx(ctx context.Context, key string, value interface{}, expiration time.Duration) *StatusCmd
SetNX(ctx context.Context, key string, value interface{}, expiration time.Duration) *BoolCmd
SetXX(ctx context.Context, key string, value interface{}, expiration time.Duration) *BoolCmd
SetRange(ctx context.Context, key string, offset int64, value string) *IntCmd
StrLen(ctx context.Context, key string) *IntCmd
}
func (c cmdable) Append(ctx context.Context, key, value string) *IntCmd {
cmd := NewIntCmd(ctx, "append", key, value)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Decr(ctx context.Context, key string) *IntCmd {
cmd := NewIntCmd(ctx, "decr", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) DecrBy(ctx context.Context, key string, decrement int64) *IntCmd {
cmd := NewIntCmd(ctx, "decrby", key, decrement)
_ = c(ctx, cmd)
return cmd
}
// Get Redis `GET key` command. It returns redis.Nil error when key does not exist.
func (c cmdable) Get(ctx context.Context, key string) *StringCmd {
cmd := NewStringCmd(ctx, "get", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) GetRange(ctx context.Context, key string, start, end int64) *StringCmd {
cmd := NewStringCmd(ctx, "getrange", key, start, end)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) GetSet(ctx context.Context, key string, value interface{}) *StringCmd {
cmd := NewStringCmd(ctx, "getset", key, value)
_ = c(ctx, cmd)
return cmd
}
// GetEx An expiration of zero removes the TTL associated with the key (i.e. GETEX key persist).
// Requires Redis >= 6.2.0.
func (c cmdable) GetEx(ctx context.Context, key string, expiration time.Duration) *StringCmd {
args := make([]interface{}, 0, 4)
args = append(args, "getex", key)
if expiration > 0 {
if usePrecise(expiration) {
args = append(args, "px", formatMs(ctx, expiration))
} else {
args = append(args, "ex", formatSec(ctx, expiration))
}
} else if expiration == 0 {
args = append(args, "persist")
}
cmd := NewStringCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// GetDel redis-server version >= 6.2.0.
func (c cmdable) GetDel(ctx context.Context, key string) *StringCmd {
cmd := NewStringCmd(ctx, "getdel", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Incr(ctx context.Context, key string) *IntCmd {
cmd := NewIntCmd(ctx, "incr", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) IncrBy(ctx context.Context, key string, value int64) *IntCmd {
cmd := NewIntCmd(ctx, "incrby", key, value)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) IncrByFloat(ctx context.Context, key string, value float64) *FloatCmd {
cmd := NewFloatCmd(ctx, "incrbyfloat", key, value)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LCS(ctx context.Context, q *LCSQuery) *LCSCmd {
cmd := NewLCSCmd(ctx, q)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) MGet(ctx context.Context, keys ...string) *SliceCmd {
args := make([]interface{}, 1+len(keys))
args[0] = "mget"
for i, key := range keys {
args[1+i] = key
}
cmd := NewSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// MSet is like Set but accepts multiple values:
// - MSet("key1", "value1", "key2", "value2")
// - MSet([]string{"key1", "value1", "key2", "value2"})
// - MSet(map[string]interface{}{"key1": "value1", "key2": "value2"})
// - MSet(struct), For struct types, see HSet description.
func (c cmdable) MSet(ctx context.Context, values ...interface{}) *StatusCmd {
args := make([]interface{}, 1, 1+len(values))
args[0] = "mset"
args = appendArgs(args, values)
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// MSetNX is like SetNX but accepts multiple values:
// - MSetNX("key1", "value1", "key2", "value2")
// - MSetNX([]string{"key1", "value1", "key2", "value2"})
// - MSetNX(map[string]interface{}{"key1": "value1", "key2": "value2"})
// - MSetNX(struct), For struct types, see HSet description.
func (c cmdable) MSetNX(ctx context.Context, values ...interface{}) *BoolCmd {
args := make([]interface{}, 1, 1+len(values))
args[0] = "msetnx"
args = appendArgs(args, values)
cmd := NewBoolCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// Set Redis `SET key value [expiration]` command.
// Use expiration for `SETEx`-like behavior.
//
// Zero expiration means the key has no expiration time.
// KeepTTL is a Redis KEEPTTL option to keep existing TTL, it requires your redis-server version >= 6.0,
// otherwise you will receive an error: (error) ERR syntax error.
func (c cmdable) Set(ctx context.Context, key string, value interface{}, expiration time.Duration) *StatusCmd {
args := make([]interface{}, 3, 5)
args[0] = "set"
args[1] = key
args[2] = value
if expiration > 0 {
if usePrecise(expiration) {
args = append(args, "px", formatMs(ctx, expiration))
} else {
args = append(args, "ex", formatSec(ctx, expiration))
}
} else if expiration == KeepTTL {
args = append(args, "keepttl")
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// SetArgs provides arguments for the SetArgs function.
type SetArgs struct {
// Mode can be `NX` or `XX` or empty.
Mode string
// Zero `TTL` or `Expiration` means that the key has no expiration time.
TTL time.Duration
ExpireAt time.Time
// When Get is true, the command returns the old value stored at key, or nil when key did not exist.
Get bool
// KeepTTL is a Redis KEEPTTL option to keep existing TTL, it requires your redis-server version >= 6.0,
// otherwise you will receive an error: (error) ERR syntax error.
KeepTTL bool
}
// SetArgs supports all the options that the SET command supports.
// It is the alternative to the Set function when you want
// to have more control over the options.
func (c cmdable) SetArgs(ctx context.Context, key string, value interface{}, a SetArgs) *StatusCmd {
args := []interface{}{"set", key, value}
if a.KeepTTL {
args = append(args, "keepttl")
}
if !a.ExpireAt.IsZero() {
args = append(args, "exat", a.ExpireAt.Unix())
}
if a.TTL > 0 {
if usePrecise(a.TTL) {
args = append(args, "px", formatMs(ctx, a.TTL))
} else {
args = append(args, "ex", formatSec(ctx, a.TTL))
}
}
if a.Mode != "" {
args = append(args, a.Mode)
}
if a.Get {
args = append(args, "get")
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// SetEx Redis `SETEx key expiration value` command.
func (c cmdable) SetEx(ctx context.Context, key string, value interface{}, expiration time.Duration) *StatusCmd {
cmd := NewStatusCmd(ctx, "setex", key, formatSec(ctx, expiration), value)
_ = c(ctx, cmd)
return cmd
}
// SetNX Redis `SET key value [expiration] NX` command.
//
// Zero expiration means the key has no expiration time.
// KeepTTL is a Redis KEEPTTL option to keep existing TTL, it requires your redis-server version >= 6.0,
// otherwise you will receive an error: (error) ERR syntax error.
func (c cmdable) SetNX(ctx context.Context, key string, value interface{}, expiration time.Duration) *BoolCmd {
var cmd *BoolCmd
switch expiration {
case 0:
// Use old `SETNX` to support old Redis versions.
cmd = NewBoolCmd(ctx, "setnx", key, value)
case KeepTTL:
cmd = NewBoolCmd(ctx, "set", key, value, "keepttl", "nx")
default:
if usePrecise(expiration) {
cmd = NewBoolCmd(ctx, "set", key, value, "px", formatMs(ctx, expiration), "nx")
} else {
cmd = NewBoolCmd(ctx, "set", key, value, "ex", formatSec(ctx, expiration), "nx")
}
}
_ = c(ctx, cmd)
return cmd
}
// SetXX Redis `SET key value [expiration] XX` command.
//
// Zero expiration means the key has no expiration time.
// KeepTTL is a Redis KEEPTTL option to keep existing TTL, it requires your redis-server version >= 6.0,
// otherwise you will receive an error: (error) ERR syntax error.
func (c cmdable) SetXX(ctx context.Context, key string, value interface{}, expiration time.Duration) *BoolCmd {
var cmd *BoolCmd
switch expiration {
case 0:
cmd = NewBoolCmd(ctx, "set", key, value, "xx")
case KeepTTL:
cmd = NewBoolCmd(ctx, "set", key, value, "keepttl", "xx")
default:
if usePrecise(expiration) {
cmd = NewBoolCmd(ctx, "set", key, value, "px", formatMs(ctx, expiration), "xx")
} else {
cmd = NewBoolCmd(ctx, "set", key, value, "ex", formatSec(ctx, expiration), "xx")
}
}
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SetRange(ctx context.Context, key string, offset int64, value string) *IntCmd {
cmd := NewIntCmd(ctx, "setrange", key, offset, value)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) StrLen(ctx context.Context, key string) *IntCmd {
cmd := NewIntCmd(ctx, "strlen", key)
_ = c(ctx, cmd)
return cmd
}

950
vendor/github.com/redis/go-redis/v9/timeseries_commands.go generated vendored Normal file
View File

@@ -0,0 +1,950 @@
package redis
import (
"context"
"strconv"
"github.com/redis/go-redis/v9/internal/proto"
)
type TimeseriesCmdable interface {
TSAdd(ctx context.Context, key string, timestamp interface{}, value float64) *IntCmd
TSAddWithArgs(ctx context.Context, key string, timestamp interface{}, value float64, options *TSOptions) *IntCmd
TSCreate(ctx context.Context, key string) *StatusCmd
TSCreateWithArgs(ctx context.Context, key string, options *TSOptions) *StatusCmd
TSAlter(ctx context.Context, key string, options *TSAlterOptions) *StatusCmd
TSCreateRule(ctx context.Context, sourceKey string, destKey string, aggregator Aggregator, bucketDuration int) *StatusCmd
TSCreateRuleWithArgs(ctx context.Context, sourceKey string, destKey string, aggregator Aggregator, bucketDuration int, options *TSCreateRuleOptions) *StatusCmd
TSIncrBy(ctx context.Context, Key string, timestamp float64) *IntCmd
TSIncrByWithArgs(ctx context.Context, key string, timestamp float64, options *TSIncrDecrOptions) *IntCmd
TSDecrBy(ctx context.Context, Key string, timestamp float64) *IntCmd
TSDecrByWithArgs(ctx context.Context, key string, timestamp float64, options *TSIncrDecrOptions) *IntCmd
TSDel(ctx context.Context, Key string, fromTimestamp int, toTimestamp int) *IntCmd
TSDeleteRule(ctx context.Context, sourceKey string, destKey string) *StatusCmd
TSGet(ctx context.Context, key string) *TSTimestampValueCmd
TSGetWithArgs(ctx context.Context, key string, options *TSGetOptions) *TSTimestampValueCmd
TSInfo(ctx context.Context, key string) *MapStringInterfaceCmd
TSInfoWithArgs(ctx context.Context, key string, options *TSInfoOptions) *MapStringInterfaceCmd
TSMAdd(ctx context.Context, ktvSlices [][]interface{}) *IntSliceCmd
TSQueryIndex(ctx context.Context, filterExpr []string) *StringSliceCmd
TSRevRange(ctx context.Context, key string, fromTimestamp int, toTimestamp int) *TSTimestampValueSliceCmd
TSRevRangeWithArgs(ctx context.Context, key string, fromTimestamp int, toTimestamp int, options *TSRevRangeOptions) *TSTimestampValueSliceCmd
TSRange(ctx context.Context, key string, fromTimestamp int, toTimestamp int) *TSTimestampValueSliceCmd
TSRangeWithArgs(ctx context.Context, key string, fromTimestamp int, toTimestamp int, options *TSRangeOptions) *TSTimestampValueSliceCmd
TSMRange(ctx context.Context, fromTimestamp int, toTimestamp int, filterExpr []string) *MapStringSliceInterfaceCmd
TSMRangeWithArgs(ctx context.Context, fromTimestamp int, toTimestamp int, filterExpr []string, options *TSMRangeOptions) *MapStringSliceInterfaceCmd
TSMRevRange(ctx context.Context, fromTimestamp int, toTimestamp int, filterExpr []string) *MapStringSliceInterfaceCmd
TSMRevRangeWithArgs(ctx context.Context, fromTimestamp int, toTimestamp int, filterExpr []string, options *TSMRevRangeOptions) *MapStringSliceInterfaceCmd
TSMGet(ctx context.Context, filters []string) *MapStringSliceInterfaceCmd
TSMGetWithArgs(ctx context.Context, filters []string, options *TSMGetOptions) *MapStringSliceInterfaceCmd
}
type TSOptions struct {
Retention int
ChunkSize int
Encoding string
DuplicatePolicy string
Labels map[string]string
IgnoreMaxTimeDiff int64
IgnoreMaxValDiff float64
}
type TSIncrDecrOptions struct {
Timestamp int64
Retention int
ChunkSize int
Uncompressed bool
DuplicatePolicy string
Labels map[string]string
IgnoreMaxTimeDiff int64
IgnoreMaxValDiff float64
}
type TSAlterOptions struct {
Retention int
ChunkSize int
DuplicatePolicy string
Labels map[string]string
IgnoreMaxTimeDiff int64
IgnoreMaxValDiff float64
}
type TSCreateRuleOptions struct {
alignTimestamp int64
}
type TSGetOptions struct {
Latest bool
}
type TSInfoOptions struct {
Debug bool
}
type Aggregator int
const (
Invalid = Aggregator(iota)
Avg
Sum
Min
Max
Range
Count
First
Last
StdP
StdS
VarP
VarS
Twa
)
func (a Aggregator) String() string {
switch a {
case Invalid:
return ""
case Avg:
return "AVG"
case Sum:
return "SUM"
case Min:
return "MIN"
case Max:
return "MAX"
case Range:
return "RANGE"
case Count:
return "COUNT"
case First:
return "FIRST"
case Last:
return "LAST"
case StdP:
return "STD.P"
case StdS:
return "STD.S"
case VarP:
return "VAR.P"
case VarS:
return "VAR.S"
case Twa:
return "TWA"
default:
return ""
}
}
type TSRangeOptions struct {
Latest bool
FilterByTS []int
FilterByValue []int
Count int
Align interface{}
Aggregator Aggregator
BucketDuration int
BucketTimestamp interface{}
Empty bool
}
type TSRevRangeOptions struct {
Latest bool
FilterByTS []int
FilterByValue []int
Count int
Align interface{}
Aggregator Aggregator
BucketDuration int
BucketTimestamp interface{}
Empty bool
}
type TSMRangeOptions struct {
Latest bool
FilterByTS []int
FilterByValue []int
WithLabels bool
SelectedLabels []interface{}
Count int
Align interface{}
Aggregator Aggregator
BucketDuration int
BucketTimestamp interface{}
Empty bool
GroupByLabel interface{}
Reducer interface{}
}
type TSMRevRangeOptions struct {
Latest bool
FilterByTS []int
FilterByValue []int
WithLabels bool
SelectedLabels []interface{}
Count int
Align interface{}
Aggregator Aggregator
BucketDuration int
BucketTimestamp interface{}
Empty bool
GroupByLabel interface{}
Reducer interface{}
}
type TSMGetOptions struct {
Latest bool
WithLabels bool
SelectedLabels []interface{}
}
// TSAdd - Adds one or more observations to a t-digest sketch.
// For more information - https://redis.io/commands/ts.add/
func (c cmdable) TSAdd(ctx context.Context, key string, timestamp interface{}, value float64) *IntCmd {
args := []interface{}{"TS.ADD", key, timestamp, value}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSAddWithArgs - Adds one or more observations to a t-digest sketch.
// This function also allows for specifying additional options such as:
// Retention, ChunkSize, Encoding, DuplicatePolicy and Labels.
// For more information - https://redis.io/commands/ts.add/
func (c cmdable) TSAddWithArgs(ctx context.Context, key string, timestamp interface{}, value float64, options *TSOptions) *IntCmd {
args := []interface{}{"TS.ADD", key, timestamp, value}
if options != nil {
if options.Retention != 0 {
args = append(args, "RETENTION", options.Retention)
}
if options.ChunkSize != 0 {
args = append(args, "CHUNK_SIZE", options.ChunkSize)
}
if options.Encoding != "" {
args = append(args, "ENCODING", options.Encoding)
}
if options.DuplicatePolicy != "" {
args = append(args, "DUPLICATE_POLICY", options.DuplicatePolicy)
}
if options.Labels != nil {
args = append(args, "LABELS")
for label, value := range options.Labels {
args = append(args, label, value)
}
}
if options.IgnoreMaxTimeDiff != 0 || options.IgnoreMaxValDiff != 0 {
args = append(args, "IGNORE", options.IgnoreMaxTimeDiff, options.IgnoreMaxValDiff)
}
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSCreate - Creates a new time-series key.
// For more information - https://redis.io/commands/ts.create/
func (c cmdable) TSCreate(ctx context.Context, key string) *StatusCmd {
args := []interface{}{"TS.CREATE", key}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSCreateWithArgs - Creates a new time-series key with additional options.
// This function allows for specifying additional options such as:
// Retention, ChunkSize, Encoding, DuplicatePolicy and Labels.
// For more information - https://redis.io/commands/ts.create/
func (c cmdable) TSCreateWithArgs(ctx context.Context, key string, options *TSOptions) *StatusCmd {
args := []interface{}{"TS.CREATE", key}
if options != nil {
if options.Retention != 0 {
args = append(args, "RETENTION", options.Retention)
}
if options.ChunkSize != 0 {
args = append(args, "CHUNK_SIZE", options.ChunkSize)
}
if options.Encoding != "" {
args = append(args, "ENCODING", options.Encoding)
}
if options.DuplicatePolicy != "" {
args = append(args, "DUPLICATE_POLICY", options.DuplicatePolicy)
}
if options.Labels != nil {
args = append(args, "LABELS")
for label, value := range options.Labels {
args = append(args, label, value)
}
}
if options.IgnoreMaxTimeDiff != 0 || options.IgnoreMaxValDiff != 0 {
args = append(args, "IGNORE", options.IgnoreMaxTimeDiff, options.IgnoreMaxValDiff)
}
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSAlter - Alters an existing time-series key with additional options.
// This function allows for specifying additional options such as:
// Retention, ChunkSize and DuplicatePolicy.
// For more information - https://redis.io/commands/ts.alter/
func (c cmdable) TSAlter(ctx context.Context, key string, options *TSAlterOptions) *StatusCmd {
args := []interface{}{"TS.ALTER", key}
if options != nil {
if options.Retention != 0 {
args = append(args, "RETENTION", options.Retention)
}
if options.ChunkSize != 0 {
args = append(args, "CHUNK_SIZE", options.ChunkSize)
}
if options.DuplicatePolicy != "" {
args = append(args, "DUPLICATE_POLICY", options.DuplicatePolicy)
}
if options.Labels != nil {
args = append(args, "LABELS")
for label, value := range options.Labels {
args = append(args, label, value)
}
}
if options.IgnoreMaxTimeDiff != 0 || options.IgnoreMaxValDiff != 0 {
args = append(args, "IGNORE", options.IgnoreMaxTimeDiff, options.IgnoreMaxValDiff)
}
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSCreateRule - Creates a compaction rule from sourceKey to destKey.
// For more information - https://redis.io/commands/ts.createrule/
func (c cmdable) TSCreateRule(ctx context.Context, sourceKey string, destKey string, aggregator Aggregator, bucketDuration int) *StatusCmd {
args := []interface{}{"TS.CREATERULE", sourceKey, destKey, "AGGREGATION", aggregator.String(), bucketDuration}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSCreateRuleWithArgs - Creates a compaction rule from sourceKey to destKey with additional option.
// This function allows for specifying additional option such as:
// alignTimestamp.
// For more information - https://redis.io/commands/ts.createrule/
func (c cmdable) TSCreateRuleWithArgs(ctx context.Context, sourceKey string, destKey string, aggregator Aggregator, bucketDuration int, options *TSCreateRuleOptions) *StatusCmd {
args := []interface{}{"TS.CREATERULE", sourceKey, destKey, "AGGREGATION", aggregator.String(), bucketDuration}
if options != nil {
if options.alignTimestamp != 0 {
args = append(args, options.alignTimestamp)
}
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSIncrBy - Increments the value of a time-series key by the specified timestamp.
// For more information - https://redis.io/commands/ts.incrby/
func (c cmdable) TSIncrBy(ctx context.Context, Key string, timestamp float64) *IntCmd {
args := []interface{}{"TS.INCRBY", Key, timestamp}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSIncrByWithArgs - Increments the value of a time-series key by the specified timestamp with additional options.
// This function allows for specifying additional options such as:
// Timestamp, Retention, ChunkSize, Uncompressed and Labels.
// For more information - https://redis.io/commands/ts.incrby/
func (c cmdable) TSIncrByWithArgs(ctx context.Context, key string, timestamp float64, options *TSIncrDecrOptions) *IntCmd {
args := []interface{}{"TS.INCRBY", key, timestamp}
if options != nil {
if options.Timestamp != 0 {
args = append(args, "TIMESTAMP", options.Timestamp)
}
if options.Retention != 0 {
args = append(args, "RETENTION", options.Retention)
}
if options.ChunkSize != 0 {
args = append(args, "CHUNK_SIZE", options.ChunkSize)
}
if options.Uncompressed {
args = append(args, "UNCOMPRESSED")
}
if options.DuplicatePolicy != "" {
args = append(args, "DUPLICATE_POLICY", options.DuplicatePolicy)
}
if options.Labels != nil {
args = append(args, "LABELS")
for label, value := range options.Labels {
args = append(args, label, value)
}
}
if options.IgnoreMaxTimeDiff != 0 || options.IgnoreMaxValDiff != 0 {
args = append(args, "IGNORE", options.IgnoreMaxTimeDiff, options.IgnoreMaxValDiff)
}
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSDecrBy - Decrements the value of a time-series key by the specified timestamp.
// For more information - https://redis.io/commands/ts.decrby/
func (c cmdable) TSDecrBy(ctx context.Context, Key string, timestamp float64) *IntCmd {
args := []interface{}{"TS.DECRBY", Key, timestamp}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSDecrByWithArgs - Decrements the value of a time-series key by the specified timestamp with additional options.
// This function allows for specifying additional options such as:
// Timestamp, Retention, ChunkSize, Uncompressed and Labels.
// For more information - https://redis.io/commands/ts.decrby/
func (c cmdable) TSDecrByWithArgs(ctx context.Context, key string, timestamp float64, options *TSIncrDecrOptions) *IntCmd {
args := []interface{}{"TS.DECRBY", key, timestamp}
if options != nil {
if options.Timestamp != 0 {
args = append(args, "TIMESTAMP", options.Timestamp)
}
if options.Retention != 0 {
args = append(args, "RETENTION", options.Retention)
}
if options.ChunkSize != 0 {
args = append(args, "CHUNK_SIZE", options.ChunkSize)
}
if options.Uncompressed {
args = append(args, "UNCOMPRESSED")
}
if options.DuplicatePolicy != "" {
args = append(args, "DUPLICATE_POLICY", options.DuplicatePolicy)
}
if options.Labels != nil {
args = append(args, "LABELS")
for label, value := range options.Labels {
args = append(args, label, value)
}
}
if options.IgnoreMaxTimeDiff != 0 || options.IgnoreMaxValDiff != 0 {
args = append(args, "IGNORE", options.IgnoreMaxTimeDiff, options.IgnoreMaxValDiff)
}
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSDel - Deletes a range of samples from a time-series key.
// For more information - https://redis.io/commands/ts.del/
func (c cmdable) TSDel(ctx context.Context, Key string, fromTimestamp int, toTimestamp int) *IntCmd {
args := []interface{}{"TS.DEL", Key, fromTimestamp, toTimestamp}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSDeleteRule - Deletes a compaction rule from sourceKey to destKey.
// For more information - https://redis.io/commands/ts.deleterule/
func (c cmdable) TSDeleteRule(ctx context.Context, sourceKey string, destKey string) *StatusCmd {
args := []interface{}{"TS.DELETERULE", sourceKey, destKey}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSGetWithArgs - Gets the last sample of a time-series key with additional option.
// This function allows for specifying additional option such as:
// Latest.
// For more information - https://redis.io/commands/ts.get/
func (c cmdable) TSGetWithArgs(ctx context.Context, key string, options *TSGetOptions) *TSTimestampValueCmd {
args := []interface{}{"TS.GET", key}
if options != nil {
if options.Latest {
args = append(args, "LATEST")
}
}
cmd := newTSTimestampValueCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSGet - Gets the last sample of a time-series key.
// For more information - https://redis.io/commands/ts.get/
func (c cmdable) TSGet(ctx context.Context, key string) *TSTimestampValueCmd {
args := []interface{}{"TS.GET", key}
cmd := newTSTimestampValueCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
type TSTimestampValue struct {
Timestamp int64
Value float64
}
type TSTimestampValueCmd struct {
baseCmd
val TSTimestampValue
}
func newTSTimestampValueCmd(ctx context.Context, args ...interface{}) *TSTimestampValueCmd {
return &TSTimestampValueCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
},
}
}
func (cmd *TSTimestampValueCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *TSTimestampValueCmd) SetVal(val TSTimestampValue) {
cmd.val = val
}
func (cmd *TSTimestampValueCmd) Result() (TSTimestampValue, error) {
return cmd.val, cmd.err
}
func (cmd *TSTimestampValueCmd) Val() TSTimestampValue {
return cmd.val
}
func (cmd *TSTimestampValueCmd) readReply(rd *proto.Reader) (err error) {
n, err := rd.ReadMapLen()
if err != nil {
return err
}
cmd.val = TSTimestampValue{}
for i := 0; i < n; i++ {
timestamp, err := rd.ReadInt()
if err != nil {
return err
}
value, err := rd.ReadString()
if err != nil {
return err
}
cmd.val.Timestamp = timestamp
cmd.val.Value, err = strconv.ParseFloat(value, 64)
if err != nil {
return err
}
}
return nil
}
// TSInfo - Returns information about a time-series key.
// For more information - https://redis.io/commands/ts.info/
func (c cmdable) TSInfo(ctx context.Context, key string) *MapStringInterfaceCmd {
args := []interface{}{"TS.INFO", key}
cmd := NewMapStringInterfaceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSInfoWithArgs - Returns information about a time-series key with additional option.
// This function allows for specifying additional option such as:
// Debug.
// For more information - https://redis.io/commands/ts.info/
func (c cmdable) TSInfoWithArgs(ctx context.Context, key string, options *TSInfoOptions) *MapStringInterfaceCmd {
args := []interface{}{"TS.INFO", key}
if options != nil {
if options.Debug {
args = append(args, "DEBUG")
}
}
cmd := NewMapStringInterfaceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSMAdd - Adds multiple samples to multiple time-series keys.
// It accepts a slice of 'ktv' slices, each containing exactly three elements: key, timestamp, and value.
// This struct must be provided for this command to work.
// For more information - https://redis.io/commands/ts.madd/
func (c cmdable) TSMAdd(ctx context.Context, ktvSlices [][]interface{}) *IntSliceCmd {
args := []interface{}{"TS.MADD"}
for _, ktv := range ktvSlices {
args = append(args, ktv...)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSQueryIndex - Returns all the keys matching the filter expression.
// For more information - https://redis.io/commands/ts.queryindex/
func (c cmdable) TSQueryIndex(ctx context.Context, filterExpr []string) *StringSliceCmd {
args := []interface{}{"TS.QUERYINDEX"}
for _, f := range filterExpr {
args = append(args, f)
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSRevRange - Returns a range of samples from a time-series key in reverse order.
// For more information - https://redis.io/commands/ts.revrange/
func (c cmdable) TSRevRange(ctx context.Context, key string, fromTimestamp int, toTimestamp int) *TSTimestampValueSliceCmd {
args := []interface{}{"TS.REVRANGE", key, fromTimestamp, toTimestamp}
cmd := newTSTimestampValueSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSRevRangeWithArgs - Returns a range of samples from a time-series key in reverse order with additional options.
// This function allows for specifying additional options such as:
// Latest, FilterByTS, FilterByValue, Count, Align, Aggregator,
// BucketDuration, BucketTimestamp and Empty.
// For more information - https://redis.io/commands/ts.revrange/
func (c cmdable) TSRevRangeWithArgs(ctx context.Context, key string, fromTimestamp int, toTimestamp int, options *TSRevRangeOptions) *TSTimestampValueSliceCmd {
args := []interface{}{"TS.REVRANGE", key, fromTimestamp, toTimestamp}
if options != nil {
if options.Latest {
args = append(args, "LATEST")
}
if options.FilterByTS != nil {
args = append(args, "FILTER_BY_TS")
for _, f := range options.FilterByTS {
args = append(args, f)
}
}
if options.FilterByValue != nil {
args = append(args, "FILTER_BY_VALUE")
for _, f := range options.FilterByValue {
args = append(args, f)
}
}
if options.Count != 0 {
args = append(args, "COUNT", options.Count)
}
if options.Align != nil {
args = append(args, "ALIGN", options.Align)
}
if options.Aggregator != 0 {
args = append(args, "AGGREGATION", options.Aggregator.String())
}
if options.BucketDuration != 0 {
args = append(args, options.BucketDuration)
}
if options.BucketTimestamp != nil {
args = append(args, "BUCKETTIMESTAMP", options.BucketTimestamp)
}
if options.Empty {
args = append(args, "EMPTY")
}
}
cmd := newTSTimestampValueSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSRange - Returns a range of samples from a time-series key.
// For more information - https://redis.io/commands/ts.range/
func (c cmdable) TSRange(ctx context.Context, key string, fromTimestamp int, toTimestamp int) *TSTimestampValueSliceCmd {
args := []interface{}{"TS.RANGE", key, fromTimestamp, toTimestamp}
cmd := newTSTimestampValueSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSRangeWithArgs - Returns a range of samples from a time-series key with additional options.
// This function allows for specifying additional options such as:
// Latest, FilterByTS, FilterByValue, Count, Align, Aggregator,
// BucketDuration, BucketTimestamp and Empty.
// For more information - https://redis.io/commands/ts.range/
func (c cmdable) TSRangeWithArgs(ctx context.Context, key string, fromTimestamp int, toTimestamp int, options *TSRangeOptions) *TSTimestampValueSliceCmd {
args := []interface{}{"TS.RANGE", key, fromTimestamp, toTimestamp}
if options != nil {
if options.Latest {
args = append(args, "LATEST")
}
if options.FilterByTS != nil {
args = append(args, "FILTER_BY_TS")
for _, f := range options.FilterByTS {
args = append(args, f)
}
}
if options.FilterByValue != nil {
args = append(args, "FILTER_BY_VALUE")
for _, f := range options.FilterByValue {
args = append(args, f)
}
}
if options.Count != 0 {
args = append(args, "COUNT", options.Count)
}
if options.Align != nil {
args = append(args, "ALIGN", options.Align)
}
if options.Aggregator != 0 {
args = append(args, "AGGREGATION", options.Aggregator.String())
}
if options.BucketDuration != 0 {
args = append(args, options.BucketDuration)
}
if options.BucketTimestamp != nil {
args = append(args, "BUCKETTIMESTAMP", options.BucketTimestamp)
}
if options.Empty {
args = append(args, "EMPTY")
}
}
cmd := newTSTimestampValueSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
type TSTimestampValueSliceCmd struct {
baseCmd
val []TSTimestampValue
}
func newTSTimestampValueSliceCmd(ctx context.Context, args ...interface{}) *TSTimestampValueSliceCmd {
return &TSTimestampValueSliceCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
},
}
}
func (cmd *TSTimestampValueSliceCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *TSTimestampValueSliceCmd) SetVal(val []TSTimestampValue) {
cmd.val = val
}
func (cmd *TSTimestampValueSliceCmd) Result() ([]TSTimestampValue, error) {
return cmd.val, cmd.err
}
func (cmd *TSTimestampValueSliceCmd) Val() []TSTimestampValue {
return cmd.val
}
func (cmd *TSTimestampValueSliceCmd) readReply(rd *proto.Reader) (err error) {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]TSTimestampValue, n)
for i := 0; i < n; i++ {
_, _ = rd.ReadArrayLen()
timestamp, err := rd.ReadInt()
if err != nil {
return err
}
value, err := rd.ReadString()
if err != nil {
return err
}
cmd.val[i].Timestamp = timestamp
cmd.val[i].Value, err = strconv.ParseFloat(value, 64)
if err != nil {
return err
}
}
return nil
}
// TSMRange - Returns a range of samples from multiple time-series keys.
// For more information - https://redis.io/commands/ts.mrange/
func (c cmdable) TSMRange(ctx context.Context, fromTimestamp int, toTimestamp int, filterExpr []string) *MapStringSliceInterfaceCmd {
args := []interface{}{"TS.MRANGE", fromTimestamp, toTimestamp, "FILTER"}
for _, f := range filterExpr {
args = append(args, f)
}
cmd := NewMapStringSliceInterfaceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSMRangeWithArgs - Returns a range of samples from multiple time-series keys with additional options.
// This function allows for specifying additional options such as:
// Latest, FilterByTS, FilterByValue, WithLabels, SelectedLabels,
// Count, Align, Aggregator, BucketDuration, BucketTimestamp,
// Empty, GroupByLabel and Reducer.
// For more information - https://redis.io/commands/ts.mrange/
func (c cmdable) TSMRangeWithArgs(ctx context.Context, fromTimestamp int, toTimestamp int, filterExpr []string, options *TSMRangeOptions) *MapStringSliceInterfaceCmd {
args := []interface{}{"TS.MRANGE", fromTimestamp, toTimestamp}
if options != nil {
if options.Latest {
args = append(args, "LATEST")
}
if options.FilterByTS != nil {
args = append(args, "FILTER_BY_TS")
for _, f := range options.FilterByTS {
args = append(args, f)
}
}
if options.FilterByValue != nil {
args = append(args, "FILTER_BY_VALUE")
for _, f := range options.FilterByValue {
args = append(args, f)
}
}
if options.WithLabels {
args = append(args, "WITHLABELS")
}
if options.SelectedLabels != nil {
args = append(args, "SELECTED_LABELS")
args = append(args, options.SelectedLabels...)
}
if options.Count != 0 {
args = append(args, "COUNT", options.Count)
}
if options.Align != nil {
args = append(args, "ALIGN", options.Align)
}
if options.Aggregator != 0 {
args = append(args, "AGGREGATION", options.Aggregator.String())
}
if options.BucketDuration != 0 {
args = append(args, options.BucketDuration)
}
if options.BucketTimestamp != nil {
args = append(args, "BUCKETTIMESTAMP", options.BucketTimestamp)
}
if options.Empty {
args = append(args, "EMPTY")
}
}
args = append(args, "FILTER")
for _, f := range filterExpr {
args = append(args, f)
}
if options != nil {
if options.GroupByLabel != nil {
args = append(args, "GROUPBY", options.GroupByLabel)
}
if options.Reducer != nil {
args = append(args, "REDUCE", options.Reducer)
}
}
cmd := NewMapStringSliceInterfaceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSMRevRange - Returns a range of samples from multiple time-series keys in reverse order.
// For more information - https://redis.io/commands/ts.mrevrange/
func (c cmdable) TSMRevRange(ctx context.Context, fromTimestamp int, toTimestamp int, filterExpr []string) *MapStringSliceInterfaceCmd {
args := []interface{}{"TS.MREVRANGE", fromTimestamp, toTimestamp, "FILTER"}
for _, f := range filterExpr {
args = append(args, f)
}
cmd := NewMapStringSliceInterfaceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSMRevRangeWithArgs - Returns a range of samples from multiple time-series keys in reverse order with additional options.
// This function allows for specifying additional options such as:
// Latest, FilterByTS, FilterByValue, WithLabels, SelectedLabels,
// Count, Align, Aggregator, BucketDuration, BucketTimestamp,
// Empty, GroupByLabel and Reducer.
// For more information - https://redis.io/commands/ts.mrevrange/
func (c cmdable) TSMRevRangeWithArgs(ctx context.Context, fromTimestamp int, toTimestamp int, filterExpr []string, options *TSMRevRangeOptions) *MapStringSliceInterfaceCmd {
args := []interface{}{"TS.MREVRANGE", fromTimestamp, toTimestamp}
if options != nil {
if options.Latest {
args = append(args, "LATEST")
}
if options.FilterByTS != nil {
args = append(args, "FILTER_BY_TS")
for _, f := range options.FilterByTS {
args = append(args, f)
}
}
if options.FilterByValue != nil {
args = append(args, "FILTER_BY_VALUE")
for _, f := range options.FilterByValue {
args = append(args, f)
}
}
if options.WithLabels {
args = append(args, "WITHLABELS")
}
if options.SelectedLabels != nil {
args = append(args, "SELECTED_LABELS")
args = append(args, options.SelectedLabels...)
}
if options.Count != 0 {
args = append(args, "COUNT", options.Count)
}
if options.Align != nil {
args = append(args, "ALIGN", options.Align)
}
if options.Aggregator != 0 {
args = append(args, "AGGREGATION", options.Aggregator.String())
}
if options.BucketDuration != 0 {
args = append(args, options.BucketDuration)
}
if options.BucketTimestamp != nil {
args = append(args, "BUCKETTIMESTAMP", options.BucketTimestamp)
}
if options.Empty {
args = append(args, "EMPTY")
}
}
args = append(args, "FILTER")
for _, f := range filterExpr {
args = append(args, f)
}
if options != nil {
if options.GroupByLabel != nil {
args = append(args, "GROUPBY", options.GroupByLabel)
}
if options.Reducer != nil {
args = append(args, "REDUCE", options.Reducer)
}
}
cmd := NewMapStringSliceInterfaceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSMGet - Returns the last sample of multiple time-series keys.
// For more information - https://redis.io/commands/ts.mget/
func (c cmdable) TSMGet(ctx context.Context, filters []string) *MapStringSliceInterfaceCmd {
args := []interface{}{"TS.MGET", "FILTER"}
for _, f := range filters {
args = append(args, f)
}
cmd := NewMapStringSliceInterfaceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSMGetWithArgs - Returns the last sample of multiple time-series keys with additional options.
// This function allows for specifying additional options such as:
// Latest, WithLabels and SelectedLabels.
// For more information - https://redis.io/commands/ts.mget/
func (c cmdable) TSMGetWithArgs(ctx context.Context, filters []string, options *TSMGetOptions) *MapStringSliceInterfaceCmd {
args := []interface{}{"TS.MGET"}
if options != nil {
if options.Latest {
args = append(args, "LATEST")
}
if options.WithLabels {
args = append(args, "WITHLABELS")
}
if options.SelectedLabels != nil {
args = append(args, "SELECTED_LABELS")
args = append(args, options.SelectedLabels...)
}
}
args = append(args, "FILTER")
for _, f := range filters {
args = append(args, f)
}
cmd := NewMapStringSliceInterfaceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}

150
vendor/github.com/redis/go-redis/v9/tx.go generated vendored Normal file
View File

@@ -0,0 +1,150 @@
package redis
import (
"context"
"github.com/redis/go-redis/v9/internal/pool"
"github.com/redis/go-redis/v9/internal/proto"
)
// TxFailedErr transaction redis failed.
const TxFailedErr = proto.RedisError("redis: transaction failed")
// Tx implements Redis transactions as described in
// http://redis.io/topics/transactions. It's NOT safe for concurrent use
// by multiple goroutines, because Exec resets list of watched keys.
//
// If you don't need WATCH, use Pipeline instead.
type Tx struct {
baseClient
cmdable
statefulCmdable
}
func (c *Client) newTx() *Tx {
tx := Tx{
baseClient: baseClient{
opt: c.opt,
connPool: pool.NewStickyConnPool(c.connPool),
hooksMixin: c.hooksMixin.clone(),
},
}
tx.init()
return &tx
}
func (c *Tx) init() {
c.cmdable = c.Process
c.statefulCmdable = c.Process
c.initHooks(hooks{
dial: c.baseClient.dial,
process: c.baseClient.process,
pipeline: c.baseClient.processPipeline,
txPipeline: c.baseClient.processTxPipeline,
})
}
func (c *Tx) Process(ctx context.Context, cmd Cmder) error {
err := c.processHook(ctx, cmd)
cmd.SetErr(err)
return err
}
// Watch prepares a transaction and marks the keys to be watched
// for conditional execution if there are any keys.
//
// The transaction is automatically closed when fn exits.
func (c *Client) Watch(ctx context.Context, fn func(*Tx) error, keys ...string) error {
tx := c.newTx()
defer tx.Close(ctx)
if len(keys) > 0 {
if err := tx.Watch(ctx, keys...).Err(); err != nil {
return err
}
}
return fn(tx)
}
// Close closes the transaction, releasing any open resources.
func (c *Tx) Close(ctx context.Context) error {
_ = c.Unwatch(ctx).Err()
return c.baseClient.Close()
}
// Watch marks the keys to be watched for conditional execution
// of a transaction.
func (c *Tx) Watch(ctx context.Context, keys ...string) *StatusCmd {
args := make([]interface{}, 1+len(keys))
args[0] = "watch"
for i, key := range keys {
args[1+i] = key
}
cmd := NewStatusCmd(ctx, args...)
_ = c.Process(ctx, cmd)
return cmd
}
// Unwatch flushes all the previously watched keys for a transaction.
func (c *Tx) Unwatch(ctx context.Context, keys ...string) *StatusCmd {
args := make([]interface{}, 1+len(keys))
args[0] = "unwatch"
for i, key := range keys {
args[1+i] = key
}
cmd := NewStatusCmd(ctx, args...)
_ = c.Process(ctx, cmd)
return cmd
}
// Pipeline creates a pipeline. Usually it is more convenient to use Pipelined.
func (c *Tx) Pipeline() Pipeliner {
pipe := Pipeline{
exec: func(ctx context.Context, cmds []Cmder) error {
return c.processPipelineHook(ctx, cmds)
},
}
pipe.init()
return &pipe
}
// Pipelined executes commands queued in the fn outside of the transaction.
// Use TxPipelined if you need transactional behavior.
func (c *Tx) Pipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error) {
return c.Pipeline().Pipelined(ctx, fn)
}
// TxPipelined executes commands queued in the fn in the transaction.
//
// When using WATCH, EXEC will execute commands only if the watched keys
// were not modified, allowing for a check-and-set mechanism.
//
// Exec always returns list of commands. If transaction fails
// TxFailedErr is returned. Otherwise Exec returns an error of the first
// failed command or nil.
func (c *Tx) TxPipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error) {
return c.TxPipeline().Pipelined(ctx, fn)
}
// TxPipeline creates a pipeline. Usually it is more convenient to use TxPipelined.
func (c *Tx) TxPipeline() Pipeliner {
pipe := Pipeline{
exec: func(ctx context.Context, cmds []Cmder) error {
cmds = wrapMultiExec(ctx, cmds)
return c.processTxPipelineHook(ctx, cmds)
},
}
pipe.init()
return &pipe
}
func wrapMultiExec(ctx context.Context, cmds []Cmder) []Cmder {
if len(cmds) == 0 {
panic("not reached")
}
cmdsCopy := make([]Cmder, len(cmds)+2)
cmdsCopy[0] = NewStatusCmd(ctx, "multi")
copy(cmdsCopy[1:], cmds)
cmdsCopy[len(cmdsCopy)-1] = NewSliceCmd(ctx, "exec")
return cmdsCopy
}

314
vendor/github.com/redis/go-redis/v9/universal.go generated vendored Normal file
View File

@@ -0,0 +1,314 @@
package redis
import (
"context"
"crypto/tls"
"net"
"time"
"github.com/redis/go-redis/v9/auth"
)
// UniversalOptions information is required by UniversalClient to establish
// connections.
type UniversalOptions struct {
// Either a single address or a seed list of host:port addresses
// of cluster/sentinel nodes.
Addrs []string
// ClientName will execute the `CLIENT SETNAME ClientName` command for each conn.
ClientName string
// Database to be selected after connecting to the server.
// Only single-node and failover clients.
DB int
// Common options.
Dialer func(ctx context.Context, network, addr string) (net.Conn, error)
OnConnect func(ctx context.Context, cn *Conn) error
Protocol int
Username string
Password string
// CredentialsProvider allows the username and password to be updated
// before reconnecting. It should return the current username and password.
CredentialsProvider func() (username string, password string)
// CredentialsProviderContext is an enhanced parameter of CredentialsProvider,
// done to maintain API compatibility. In the future,
// there might be a merge between CredentialsProviderContext and CredentialsProvider.
// There will be a conflict between them; if CredentialsProviderContext exists, we will ignore CredentialsProvider.
CredentialsProviderContext func(ctx context.Context) (username string, password string, err error)
// StreamingCredentialsProvider is used to retrieve the credentials
// for the connection from an external source. Those credentials may change
// during the connection lifetime. This is useful for managed identity
// scenarios where the credentials are retrieved from an external source.
//
// Currently, this is a placeholder for the future implementation.
StreamingCredentialsProvider auth.StreamingCredentialsProvider
SentinelUsername string
SentinelPassword string
MaxRetries int
MinRetryBackoff time.Duration
MaxRetryBackoff time.Duration
DialTimeout time.Duration
ReadTimeout time.Duration
WriteTimeout time.Duration
ContextTimeoutEnabled bool
// PoolFIFO uses FIFO mode for each node connection pool GET/PUT (default LIFO).
PoolFIFO bool
PoolSize int
PoolTimeout time.Duration
MinIdleConns int
MaxIdleConns int
MaxActiveConns int
ConnMaxIdleTime time.Duration
ConnMaxLifetime time.Duration
TLSConfig *tls.Config
// Only cluster clients.
MaxRedirects int
ReadOnly bool
RouteByLatency bool
RouteRandomly bool
// MasterName is the sentinel master name.
// Only for failover clients.
MasterName string
// DisableIndentity - Disable set-lib on connect.
//
// default: false
//
// Deprecated: Use DisableIdentity instead.
DisableIndentity bool
// DisableIdentity is used to disable CLIENT SETINFO command on connect.
//
// default: false
DisableIdentity bool
IdentitySuffix string
UnstableResp3 bool
// IsClusterMode can be used when only one Addrs is provided (e.g. Elasticache supports setting up cluster mode with configuration endpoint).
IsClusterMode bool
}
// Cluster returns cluster options created from the universal options.
func (o *UniversalOptions) Cluster() *ClusterOptions {
if len(o.Addrs) == 0 {
o.Addrs = []string{"127.0.0.1:6379"}
}
return &ClusterOptions{
Addrs: o.Addrs,
ClientName: o.ClientName,
Dialer: o.Dialer,
OnConnect: o.OnConnect,
Protocol: o.Protocol,
Username: o.Username,
Password: o.Password,
CredentialsProvider: o.CredentialsProvider,
CredentialsProviderContext: o.CredentialsProviderContext,
StreamingCredentialsProvider: o.StreamingCredentialsProvider,
MaxRedirects: o.MaxRedirects,
ReadOnly: o.ReadOnly,
RouteByLatency: o.RouteByLatency,
RouteRandomly: o.RouteRandomly,
MaxRetries: o.MaxRetries,
MinRetryBackoff: o.MinRetryBackoff,
MaxRetryBackoff: o.MaxRetryBackoff,
DialTimeout: o.DialTimeout,
ReadTimeout: o.ReadTimeout,
WriteTimeout: o.WriteTimeout,
ContextTimeoutEnabled: o.ContextTimeoutEnabled,
PoolFIFO: o.PoolFIFO,
PoolSize: o.PoolSize,
PoolTimeout: o.PoolTimeout,
MinIdleConns: o.MinIdleConns,
MaxIdleConns: o.MaxIdleConns,
MaxActiveConns: o.MaxActiveConns,
ConnMaxIdleTime: o.ConnMaxIdleTime,
ConnMaxLifetime: o.ConnMaxLifetime,
TLSConfig: o.TLSConfig,
DisableIdentity: o.DisableIdentity,
DisableIndentity: o.DisableIndentity,
IdentitySuffix: o.IdentitySuffix,
UnstableResp3: o.UnstableResp3,
}
}
// Failover returns failover options created from the universal options.
func (o *UniversalOptions) Failover() *FailoverOptions {
if len(o.Addrs) == 0 {
o.Addrs = []string{"127.0.0.1:26379"}
}
return &FailoverOptions{
SentinelAddrs: o.Addrs,
MasterName: o.MasterName,
ClientName: o.ClientName,
Dialer: o.Dialer,
OnConnect: o.OnConnect,
DB: o.DB,
Protocol: o.Protocol,
Username: o.Username,
Password: o.Password,
CredentialsProvider: o.CredentialsProvider,
CredentialsProviderContext: o.CredentialsProviderContext,
StreamingCredentialsProvider: o.StreamingCredentialsProvider,
SentinelUsername: o.SentinelUsername,
SentinelPassword: o.SentinelPassword,
RouteByLatency: o.RouteByLatency,
RouteRandomly: o.RouteRandomly,
MaxRetries: o.MaxRetries,
MinRetryBackoff: o.MinRetryBackoff,
MaxRetryBackoff: o.MaxRetryBackoff,
DialTimeout: o.DialTimeout,
ReadTimeout: o.ReadTimeout,
WriteTimeout: o.WriteTimeout,
ContextTimeoutEnabled: o.ContextTimeoutEnabled,
PoolFIFO: o.PoolFIFO,
PoolSize: o.PoolSize,
PoolTimeout: o.PoolTimeout,
MinIdleConns: o.MinIdleConns,
MaxIdleConns: o.MaxIdleConns,
MaxActiveConns: o.MaxActiveConns,
ConnMaxIdleTime: o.ConnMaxIdleTime,
ConnMaxLifetime: o.ConnMaxLifetime,
TLSConfig: o.TLSConfig,
ReplicaOnly: o.ReadOnly,
DisableIdentity: o.DisableIdentity,
DisableIndentity: o.DisableIndentity,
IdentitySuffix: o.IdentitySuffix,
UnstableResp3: o.UnstableResp3,
}
}
// Simple returns basic options created from the universal options.
func (o *UniversalOptions) Simple() *Options {
addr := "127.0.0.1:6379"
if len(o.Addrs) > 0 {
addr = o.Addrs[0]
}
return &Options{
Addr: addr,
ClientName: o.ClientName,
Dialer: o.Dialer,
OnConnect: o.OnConnect,
DB: o.DB,
Protocol: o.Protocol,
Username: o.Username,
Password: o.Password,
CredentialsProvider: o.CredentialsProvider,
CredentialsProviderContext: o.CredentialsProviderContext,
StreamingCredentialsProvider: o.StreamingCredentialsProvider,
MaxRetries: o.MaxRetries,
MinRetryBackoff: o.MinRetryBackoff,
MaxRetryBackoff: o.MaxRetryBackoff,
DialTimeout: o.DialTimeout,
ReadTimeout: o.ReadTimeout,
WriteTimeout: o.WriteTimeout,
ContextTimeoutEnabled: o.ContextTimeoutEnabled,
PoolFIFO: o.PoolFIFO,
PoolSize: o.PoolSize,
PoolTimeout: o.PoolTimeout,
MinIdleConns: o.MinIdleConns,
MaxIdleConns: o.MaxIdleConns,
MaxActiveConns: o.MaxActiveConns,
ConnMaxIdleTime: o.ConnMaxIdleTime,
ConnMaxLifetime: o.ConnMaxLifetime,
TLSConfig: o.TLSConfig,
DisableIdentity: o.DisableIdentity,
DisableIndentity: o.DisableIndentity,
IdentitySuffix: o.IdentitySuffix,
UnstableResp3: o.UnstableResp3,
}
}
// --------------------------------------------------------------------
// UniversalClient is an abstract client which - based on the provided options -
// represents either a ClusterClient, a FailoverClient, or a single-node Client.
// This can be useful for testing cluster-specific applications locally or having different
// clients in different environments.
type UniversalClient interface {
Cmdable
AddHook(Hook)
Watch(ctx context.Context, fn func(*Tx) error, keys ...string) error
Do(ctx context.Context, args ...interface{}) *Cmd
Process(ctx context.Context, cmd Cmder) error
Subscribe(ctx context.Context, channels ...string) *PubSub
PSubscribe(ctx context.Context, channels ...string) *PubSub
SSubscribe(ctx context.Context, channels ...string) *PubSub
Close() error
PoolStats() *PoolStats
}
var (
_ UniversalClient = (*Client)(nil)
_ UniversalClient = (*ClusterClient)(nil)
_ UniversalClient = (*Ring)(nil)
)
// NewUniversalClient returns a new multi client. The type of the returned client depends
// on the following conditions:
//
// 1. If the MasterName option is specified with RouteByLatency, RouteRandomly or IsClusterMode,
// a FailoverClusterClient is returned.
// 2. If the MasterName option is specified without RouteByLatency, RouteRandomly or IsClusterMode,
// a sentinel-backed FailoverClient is returned.
// 3. If the number of Addrs is two or more, or IsClusterMode option is specified,
// a ClusterClient is returned.
// 4. Otherwise, a single-node Client is returned.
func NewUniversalClient(opts *UniversalOptions) UniversalClient {
if opts == nil {
panic("redis: NewUniversalClient nil options")
}
switch {
case opts.MasterName != "" && (opts.RouteByLatency || opts.RouteRandomly || opts.IsClusterMode):
return NewFailoverClusterClient(opts.Failover())
case opts.MasterName != "":
return NewFailoverClient(opts.Failover())
case len(opts.Addrs) > 1 || opts.IsClusterMode:
return NewClusterClient(opts.Cluster())
default:
return NewClient(opts.Simple())
}
}

348
vendor/github.com/redis/go-redis/v9/vectorset_commands.go generated vendored Normal file
View File

@@ -0,0 +1,348 @@
package redis
import (
"context"
"encoding/json"
"strconv"
)
// note: the APIs is experimental and may be subject to change.
type VectorSetCmdable interface {
VAdd(ctx context.Context, key, element string, val Vector) *BoolCmd
VAddWithArgs(ctx context.Context, key, element string, val Vector, addArgs *VAddArgs) *BoolCmd
VCard(ctx context.Context, key string) *IntCmd
VDim(ctx context.Context, key string) *IntCmd
VEmb(ctx context.Context, key, element string, raw bool) *SliceCmd
VGetAttr(ctx context.Context, key, element string) *StringCmd
VInfo(ctx context.Context, key string) *MapStringInterfaceCmd
VLinks(ctx context.Context, key, element string) *StringSliceCmd
VLinksWithScores(ctx context.Context, key, element string) *VectorScoreSliceCmd
VRandMember(ctx context.Context, key string) *StringCmd
VRandMemberCount(ctx context.Context, key string, count int) *StringSliceCmd
VRem(ctx context.Context, key, element string) *BoolCmd
VSetAttr(ctx context.Context, key, element string, attr interface{}) *BoolCmd
VClearAttributes(ctx context.Context, key, element string) *BoolCmd
VSim(ctx context.Context, key string, val Vector) *StringSliceCmd
VSimWithScores(ctx context.Context, key string, val Vector) *VectorScoreSliceCmd
VSimWithArgs(ctx context.Context, key string, val Vector, args *VSimArgs) *StringSliceCmd
VSimWithArgsWithScores(ctx context.Context, key string, val Vector, args *VSimArgs) *VectorScoreSliceCmd
}
type Vector interface {
Value() []any
}
const (
vectorFormatFP32 string = "FP32"
vectorFormatValues string = "Values"
)
type VectorFP32 struct {
Val []byte
}
func (v *VectorFP32) Value() []any {
return []any{vectorFormatFP32, v.Val}
}
var _ Vector = (*VectorFP32)(nil)
type VectorValues struct {
Val []float64
}
func (v *VectorValues) Value() []any {
res := make([]any, 2+len(v.Val))
res[0] = vectorFormatValues
res[1] = len(v.Val)
for i, v := range v.Val {
res[2+i] = v
}
return res
}
var _ Vector = (*VectorValues)(nil)
type VectorRef struct {
Name string // the name of the referent vector
}
func (v *VectorRef) Value() []any {
return []any{"ele", v.Name}
}
var _ Vector = (*VectorRef)(nil)
type VectorScore struct {
Name string
Score float64
}
// `VADD key (FP32 | VALUES num) vector element`
// note: the API is experimental and may be subject to change.
func (c cmdable) VAdd(ctx context.Context, key, element string, val Vector) *BoolCmd {
return c.VAddWithArgs(ctx, key, element, val, &VAddArgs{})
}
type VAddArgs struct {
// the REDUCE option must be passed immediately after the key
Reduce int64
Cas bool
// The NoQuant, Q8 and Bin options are mutually exclusive.
NoQuant bool
Q8 bool
Bin bool
EF int64
SetAttr string
M int64
}
func (v VAddArgs) reduce() int64 {
return v.Reduce
}
func (v VAddArgs) appendArgs(args []any) []any {
if v.Cas {
args = append(args, "cas")
}
if v.NoQuant {
args = append(args, "noquant")
} else if v.Q8 {
args = append(args, "q8")
} else if v.Bin {
args = append(args, "bin")
}
if v.EF > 0 {
args = append(args, "ef", strconv.FormatInt(v.EF, 10))
}
if len(v.SetAttr) > 0 {
args = append(args, "setattr", v.SetAttr)
}
if v.M > 0 {
args = append(args, "m", strconv.FormatInt(v.M, 10))
}
return args
}
// `VADD key [REDUCE dim] (FP32 | VALUES num) vector element [CAS] [NOQUANT | Q8 | BIN] [EF build-exploration-factor] [SETATTR attributes] [M numlinks]`
// note: the API is experimental and may be subject to change.
func (c cmdable) VAddWithArgs(ctx context.Context, key, element string, val Vector, addArgs *VAddArgs) *BoolCmd {
if addArgs == nil {
addArgs = &VAddArgs{}
}
args := []any{"vadd", key}
if addArgs.reduce() > 0 {
args = append(args, "reduce", addArgs.reduce())
}
args = append(args, val.Value()...)
args = append(args, element)
args = addArgs.appendArgs(args)
cmd := NewBoolCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// `VCARD key`
// note: the API is experimental and may be subject to change.
func (c cmdable) VCard(ctx context.Context, key string) *IntCmd {
cmd := NewIntCmd(ctx, "vcard", key)
_ = c(ctx, cmd)
return cmd
}
// `VDIM key`
// note: the API is experimental and may be subject to change.
func (c cmdable) VDim(ctx context.Context, key string) *IntCmd {
cmd := NewIntCmd(ctx, "vdim", key)
_ = c(ctx, cmd)
return cmd
}
// `VEMB key element [RAW]`
// note: the API is experimental and may be subject to change.
func (c cmdable) VEmb(ctx context.Context, key, element string, raw bool) *SliceCmd {
args := []any{"vemb", key, element}
if raw {
args = append(args, "raw")
}
cmd := NewSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// `VGETATTR key element`
// note: the API is experimental and may be subject to change.
func (c cmdable) VGetAttr(ctx context.Context, key, element string) *StringCmd {
cmd := NewStringCmd(ctx, "vgetattr", key, element)
_ = c(ctx, cmd)
return cmd
}
// `VINFO key`
// note: the API is experimental and may be subject to change.
func (c cmdable) VInfo(ctx context.Context, key string) *MapStringInterfaceCmd {
cmd := NewMapStringInterfaceCmd(ctx, "vinfo", key)
_ = c(ctx, cmd)
return cmd
}
// `VLINKS key element`
// note: the API is experimental and may be subject to change.
func (c cmdable) VLinks(ctx context.Context, key, element string) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "vlinks", key, element)
_ = c(ctx, cmd)
return cmd
}
// `VLINKS key element WITHSCORES`
// note: the API is experimental and may be subject to change.
func (c cmdable) VLinksWithScores(ctx context.Context, key, element string) *VectorScoreSliceCmd {
cmd := NewVectorInfoSliceCmd(ctx, "vlinks", key, element, "withscores")
_ = c(ctx, cmd)
return cmd
}
// `VRANDMEMBER key`
// note: the API is experimental and may be subject to change.
func (c cmdable) VRandMember(ctx context.Context, key string) *StringCmd {
cmd := NewStringCmd(ctx, "vrandmember", key)
_ = c(ctx, cmd)
return cmd
}
// `VRANDMEMBER key [count]`
// note: the API is experimental and may be subject to change.
func (c cmdable) VRandMemberCount(ctx context.Context, key string, count int) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "vrandmember", key, count)
_ = c(ctx, cmd)
return cmd
}
// `VREM key element`
// note: the API is experimental and may be subject to change.
func (c cmdable) VRem(ctx context.Context, key, element string) *BoolCmd {
cmd := NewBoolCmd(ctx, "vrem", key, element)
_ = c(ctx, cmd)
return cmd
}
// `VSETATTR key element "{ JSON obj }"`
// The `attr` must be something that can be marshaled to JSON (using encoding/JSON) unless
// the argument is a string or []byte when we assume that it can be passed directly as JSON.
//
// note: the API is experimental and may be subject to change.
func (c cmdable) VSetAttr(ctx context.Context, key, element string, attr interface{}) *BoolCmd {
var attrStr string
var err error
switch v := attr.(type) {
case string:
attrStr = v
case []byte:
attrStr = string(v)
default:
var bytes []byte
bytes, err = json.Marshal(v)
if err != nil {
// If marshalling fails, create the command and set the error; this command won't be executed.
cmd := NewBoolCmd(ctx, "vsetattr", key, element, "")
cmd.SetErr(err)
return cmd
}
attrStr = string(bytes)
}
cmd := NewBoolCmd(ctx, "vsetattr", key, element, attrStr)
_ = c(ctx, cmd)
return cmd
}
// `VClearAttributes` clear attributes on a vector set element.
// The implementation of `VClearAttributes` is execute command `VSETATTR key element ""`.
// note: the API is experimental and may be subject to change.
func (c cmdable) VClearAttributes(ctx context.Context, key, element string) *BoolCmd {
cmd := NewBoolCmd(ctx, "vsetattr", key, element, "")
_ = c(ctx, cmd)
return cmd
}
// `VSIM key (ELE | FP32 | VALUES num) (vector | element)`
// note: the API is experimental and may be subject to change.
func (c cmdable) VSim(ctx context.Context, key string, val Vector) *StringSliceCmd {
return c.VSimWithArgs(ctx, key, val, &VSimArgs{})
}
// `VSIM key (ELE | FP32 | VALUES num) (vector | element) WITHSCORES`
// note: the API is experimental and may be subject to change.
func (c cmdable) VSimWithScores(ctx context.Context, key string, val Vector) *VectorScoreSliceCmd {
return c.VSimWithArgsWithScores(ctx, key, val, &VSimArgs{})
}
type VSimArgs struct {
Count int64
EF int64
Filter string
FilterEF int64
Truth bool
NoThread bool
// The `VSim` command in Redis has the option, by the doc in Redis.io don't have.
// Epsilon float64
}
func (v VSimArgs) appendArgs(args []any) []any {
if v.Count > 0 {
args = append(args, "count", v.Count)
}
if v.EF > 0 {
args = append(args, "ef", v.EF)
}
if len(v.Filter) > 0 {
args = append(args, "filter", v.Filter)
}
if v.FilterEF > 0 {
args = append(args, "filter-ef", v.FilterEF)
}
if v.Truth {
args = append(args, "truth")
}
if v.NoThread {
args = append(args, "nothread")
}
// if v.Epsilon > 0 {
// args = append(args, "Epsilon", v.Epsilon)
// }
return args
}
// `VSIM key (ELE | FP32 | VALUES num) (vector | element) [COUNT num]
// [EF search-exploration-factor] [FILTER expression] [FILTER-EF max-filtering-effort] [TRUTH] [NOTHREAD]`
// note: the API is experimental and may be subject to change.
func (c cmdable) VSimWithArgs(ctx context.Context, key string, val Vector, simArgs *VSimArgs) *StringSliceCmd {
if simArgs == nil {
simArgs = &VSimArgs{}
}
args := []any{"vsim", key}
args = append(args, val.Value()...)
args = simArgs.appendArgs(args)
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// `VSIM key (ELE | FP32 | VALUES num) (vector | element) [WITHSCORES] [COUNT num]
// [EF search-exploration-factor] [FILTER expression] [FILTER-EF max-filtering-effort] [TRUTH] [NOTHREAD]`
// note: the API is experimental and may be subject to change.
func (c cmdable) VSimWithArgsWithScores(ctx context.Context, key string, val Vector, simArgs *VSimArgs) *VectorScoreSliceCmd {
if simArgs == nil {
simArgs = &VSimArgs{}
}
args := []any{"vsim", key}
args = append(args, val.Value()...)
args = append(args, "withscores")
args = simArgs.appendArgs(args)
cmd := NewVectorInfoSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}

6
vendor/github.com/redis/go-redis/v9/version.go generated vendored Normal file
View File

@@ -0,0 +1,6 @@
package redis
// Version is the current release version.
func Version() string {
return "9.11.0"
}