2024-06-13 09:44:29 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Wed May 15 12:18:23 UTC 2024 - Emil Penchev <emil.penchev@suse.com>
|
|
|
|
|
|
|
|
|
|
|
|
- Update to version 3.1.8
|
|
|
|
|
|
* Handling integer overflow issues
|
|
|
|
|
|
* rust: Improve vector initialisation
|
|
|
|
|
|
* man: Update the corosync_overview manpage
|
|
|
|
|
|
* config: Fail to start if ping timers are invalid
|
|
|
|
|
|
* rust: Remove some pointless casts
|
|
|
|
|
|
* parser: Allow a non-breaking space as 'whitespace'
|
|
|
|
|
|
* spec: Migrate to SPDX license
|
|
|
|
|
|
* build: Fix rust make -j build dep for distcheck
|
|
|
|
|
|
* rust: Remove tests from check scripts
|
|
|
|
|
|
* Rust: Remove obsolete bindgen flag
|
|
|
|
|
|
* knet: use knet TRACE logging level if available
|
|
|
|
|
|
* Rust: 'fix' clippys for Rust 1.67
|
|
|
|
|
|
* rust: Make it work on FreeBSD
|
|
|
|
|
|
* bindings: Add Rust bindings
|
|
|
|
|
|
* totemconfig: Add support for knet_mtu
|
|
|
|
|
|
* configure: Modernize configure.ac a bit
|
|
|
|
|
|
* log: Configure knet logging to the same as corosync
|
|
|
|
|
|
* logrotate: Use copytruncate method by default
|
|
|
|
|
|
* totemconfig: Check uname return value correctly
|
|
|
|
|
|
* totempg: Fix alignment handling
|
|
|
|
|
|
* pkgconfig: Export corosysconfdir
|
|
|
|
|
|
* Remove bashism from configure script
|
|
|
|
|
|
* totemudpu: Don't block local socketpair
|
|
|
|
|
|
* build: Add explicit dependency for used libraries
|
|
|
|
|
|
* totemsrp: Switch totempg buffers at the right time
|
|
|
|
|
|
* cpghum: Allow to continue if corosync is restarted
|
|
|
|
|
|
* man: Fix consensus timeout
|
|
|
|
|
|
* logsys: Unlock config mutex on error
|
|
|
|
|
|
* totem: Add cancel_hold_on_retransmit config option
|
|
|
|
|
|
* totemconfig: Knet nodeid must be < 65536
|
|
|
|
|
|
* totemconfig: Ensure all knet hosts has a nodeid
|
|
|
|
|
|
* cfgtool: Use CS_PRI_NODE_ID for formatting nodeid
|
|
|
|
|
|
* cfgtool: Fix brief mode display of localhost
|
|
|
|
|
|
* cfgtool: Set nodeid indexes after sort
|
|
|
|
|
|
* totemconfig: Put autogenerated nodeid back to cmap
|
|
|
|
|
|
* cfgtool: Check existence of at least one of nodeid
|
|
|
|
|
|
* totemconfig: Do not process totem.nodeid
|
|
|
|
|
|
* knet: Fix node status display
|
|
|
|
|
|
* main: Add support for cgroup v2 and auto mode
|
|
|
|
|
|
* stats: fix crash when iterating over deleted keys
|
|
|
|
|
|
* man: Add note about single node configuration
|
|
|
|
|
|
* Revert "main: Add support for cgroup v2"
|
|
|
|
|
|
* Revert "man: Add info about cgroup v2 behavior"
|
|
|
|
|
|
* man: Add info about cgroup v2 behavior
|
|
|
|
|
|
* cfg: corosync_cfg_trackstop blocks forever
|
|
|
|
|
|
* main: Add support for cgroup v2
|
|
|
|
|
|
* main: Mark crypto_model key read only
|
|
|
|
|
|
* totemconfig: Ensure strncpy is always terminated
|
|
|
|
|
|
* config: Properly check crypto and compress models
|
|
|
|
|
|
* man: corosync-cfgtool.8: use proper single quotes
|
|
|
|
|
|
* knet: pass correct handle to knet_handle_compress
|
|
|
|
|
|
* totemconfig: fix integer underflow and logic bug
|
|
|
|
|
|
* totemconfig: change udp netmtu value as a constant
|
|
|
|
|
|
* totemknet: retry knet_handle_new if it fails
|
|
|
|
|
|
* main: Check memlock rlimit
|
|
|
|
|
|
* configure: drop unnecessary check and define
|
|
|
|
|
|
* configure: move exec_prefix sanitize
|
|
|
|
|
|
* configure: drop dead code
|
|
|
|
|
|
* configure: detect and init pkg-config with macro
|
|
|
|
|
|
* main: Close race condition when moving to statedir
|
|
|
|
|
|
* init: Use corosync-cfgtool for shutdown
|
|
|
|
|
|
* test: Add testcfg to exercise some cfg functions
|
|
|
|
|
|
* cfg: Reinstate cfg tracking
|
|
|
|
|
|
* cfg: Improve nodestatusget versioning
|
|
|
|
|
|
* cfg: New API to get extended node/link infomation
|
|
|
|
|
|
* totemknet: Check both cipher and hash for crypto
|
|
|
|
|
|
* The ring id file needn't be executable
|
|
|
|
|
|
* pkgconfig: export LOGDIR in corosync.pc
|
|
|
|
|
|
* spec: Add isa version of corosync-devel provides
|
|
|
|
|
|
* totemconfig: remove redundant nodeid error log
|
|
|
|
|
|
* totemsrp: More informative messages
|
|
|
|
|
|
* config: Increase default token timeout to 3000 ms
|
|
|
|
|
|
* man: votequorum.5: use proper single quotes
|
|
|
|
|
|
* man: fix typo: avaialable
|
|
|
|
|
|
* tests: Use CS_DISPATCH_BLOCKING instead of cycle
|
|
|
|
|
|
* quorum: Add support for nodelist callback
|
|
|
|
|
|
* man: reload during rolling upgrade
|
|
|
|
|
|
* totemsrp: Move token received callback
|
|
|
|
|
|
* common_lib: Remove trailing spaces in cs_strerror
|
|
|
|
|
|
* totemconfig: improve linknumber checking
|
|
|
|
|
|
* totemconfig: add interface number to the error str
|
|
|
|
|
|
* cfg: enhance message_handler_req_lib_cfg_killnode
|
|
|
|
|
|
* totemconfig: validate totem.transport value
|
|
|
|
|
|
* cmapctl: return error on no result of print prefix
|
|
|
|
|
|
* cmapctl: check NULL for key type and value for -p
|
|
|
|
|
|
* quorumtool: strict check for -o option
|
|
|
|
|
|
* quorumtool: Help shouldn't require running service
|
|
|
|
|
|
* cfgtool: Return error when -i doesn't match
|
|
|
|
|
|
* man: update output of -s and -b for cfgtool
|
|
|
|
|
|
* cmapctl: return EXIT_FAILURE on failure
|
|
|
|
|
|
* tools: use util_strtonum for options checking
|
|
|
|
|
|
* cfgtool: enhancement -a option
|
|
|
|
|
|
* cfgtool: output error messages to stderr
|
|
|
|
|
|
* configure: Use default systemd path with prefix
|
|
|
|
|
|
* build: Use git-version-gen during specfile build
|
|
|
|
|
|
* build: Update git-version-gen
|
|
|
|
|
|
* spec: Require at least knet 1.18 for crypto reload
|
|
|
|
|
|
* config: Allow reconfiguration of crypto options
|
|
|
|
|
|
* test: Fix cpgtest
|
|
|
|
|
|
* config: Fix crash when a reload fails twice
|
|
|
|
|
|
* config: Don't free pointers used by transports
|
|
|
|
|
|
* config: don't reload vquorum if reload fails
|
|
|
|
|
|
* cfg: Improve error return to cfgtool -R
|
|
|
|
|
|
* config: Reorganise the config system
|
|
|
|
|
|
* Revert "totemip: compare sin6_scope_id and interface_num"
|
|
|
|
|
|
* Revert "totemip: Add support for sin6_scope_id"
|
|
|
|
|
|
* cfgtool: Fix error code as described in MP
|
|
|
|
|
|
* icmap: icmap_init_r() leaks if trie_create() fails
|
|
|
|
|
|
* votequorum: set wfa status only on startup
|
|
|
|
|
|
* quorumtool: exit on invalid expected votes
|
|
|
|
|
|
* votequorum: Change check of expected_votes
|
|
|
|
|
|
* cfgtool: Simplify output a bit for link status
|
|
|
|
|
|
* man: Enhance link_mode priority description
|
|
|
|
|
|
* main: Add schedmiss timestamp into message
|
|
|
|
|
|
* totemip: compare sin6_scope_id and interface_num
|
|
|
|
|
|
* totemip: Really remove totemip_copy_endian_convert
|
|
|
|
|
|
* totemip: Remove unused totemip_copy_endian_convert
|
|
|
|
|
|
* totemip: Add support for sin6_scope_id
|
|
|
|
|
|
* cfgtool: Improve link status display
|
|
|
|
|
|
* totemknet: Change the initial value of the status
|
|
|
|
|
|
* stats: Use nanoseconds from epoch for schedmiss
|
|
|
|
|
|
* stats: Add stats for scheduler misses
|
|
|
|
|
|
* votequorum: Reflect runtime change of 2Node to WFA
|
|
|
|
|
|
* cpg: Change downlist log level
|
|
|
|
|
|
* man: move cmap_keys man page from section 8 to 7
|
|
|
|
|
|
* stats: Check return code of stats_map_get
|
|
|
|
|
|
* quorumtool: Assert copied string length
|
|
|
|
|
|
* notifyd: Check cmap_track_add result
|
|
|
|
|
|
* cmapctl: Free bin_value on error
|
|
|
|
|
|
* cfgtool: Remove unused callbacks
|
|
|
|
|
|
* cpghum: Remove unused time variables and functions
|
|
|
|
|
|
* votequorum: Assert copied strings length
|
|
|
|
|
|
* totemknet: Assert strcpy length
|
|
|
|
|
|
* totemknet: Check result of fcntl O_NONBLOCK call
|
|
|
|
|
|
* totemconfig: Initialize warnings variable
|
|
|
|
|
|
* sync: Assert sync_callbacks.name length
|
|
|
|
|
|
* totemknet: Don't mix corosync and knet error codes
|
|
|
|
|
|
* stats: Assert value_len when value is needed
|
|
|
|
|
|
* cmap: Assert copied string length
|
|
|
|
|
|
* totemconfig: Reuse already fetched pointer
|
|
|
|
|
|
* logconfig: Remove double free of value
|
|
|
|
|
|
* votequorum: Ignore the icmap_get_* return value
|
|
|
|
|
|
* totemconfig: Free leaks found by coverity
|
|
|
|
|
|
* icmap: fix the icmap_get_*_r functions
|
|
|
|
|
|
* pkgconfig: Add libqb dependency
|
|
|
|
|
|
* Initialize stack allocated memory
|
|
|
|
|
|
* man: Fix corosync.conf knet pong count default
|
|
|
|
|
|
* totemsrp: Reduce MTU to left room second mcast
|
|
|
|
|
|
* totempg: Check sanity (length) of received message
|
|
|
|
|
|
* build: add option for enabling sanitizer builds
|
|
|
|
|
|
* totemknet: Add locking for log call
|
|
|
|
|
|
* man: Fix link_mode priority description
|
|
|
|
|
|
* notifyd: Don't dereference NULL key_name
|
|
|
|
|
|
* totem: Increase ring_id seq after load
|
|
|
|
|
|
* init: Use cpgtool instead of cfgtool
|
|
|
|
|
|
* notifyd: Fix warning produced by 32-bit compiler
|
|
|
|
|
|
* cfgtool: Remove unused code
|
|
|
|
|
|
* logging: Add CS_PRI_NODE_ID and CS_PRI_RING_ID
|
|
|
|
|
|
* vqsim: Fix gitignore
|
|
|
|
|
|
* totemknet: Disable forwarding on shutdown
|
|
|
|
|
|
* totemconfig: Fix compiler warning
|
|
|
|
|
|
* totem: fix check if all nodes have same number of links
|
|
|
|
|
|
* totem: fix check if all nodes have name attrs in multi-link setups
|
|
|
|
|
|
* corosync-notifyd: Add option to disable DNS lookup
|
|
|
|
|
|
* totemsrp: Fix warnings produced by gcc 9.1
|
|
|
|
|
|
* cpg: Move filling of member_list to subfunction
|
|
|
|
|
|
* cpg: Add more comments to notify_lib_joinlist
|
|
|
|
|
|
* cpg: send single confchg event per group on joinlist
|
|
|
|
|
|
* cpg: notify_lib_joinlist: drop conn parameter
|
|
|
|
|
|
* vqsim: Check length of copied optarg
|
|
|
|
|
|
* vqsim: Check result of icmap_set_uint32
|
|
|
|
|
|
* vqsim: Remove unused total_nodes
|
|
|
|
|
|
* vqsim: Free allocated newvq on error
|
|
|
|
|
|
* vqsim: Check length of received message
|
|
|
|
|
|
* vqsim: Check write result
|
|
|
|
|
|
* vqsim: Do not access unitialized argv[0]
|
|
|
|
|
|
* totemknet: Initialize return value in setup_nozzle
|
|
|
|
|
|
* totemknet: macaddr_str is always set
|
|
|
|
|
|
* totemknet: Ignore icmap_get_string result
|
|
|
|
|
|
* totemknet: create_nozzle_device simplify check
|
|
|
|
|
|
* totemip: Use res in totemip_sa_equal
|
|
|
|
|
|
* totemconfig: ipaddr_equal use switch
|
|
|
|
|
|
* configure: Fix GDB_CFLAGS typo
|
|
|
|
|
|
* man: Add vqsim man page into distributed tarball
|
|
|
|
|
|
* spec: Add support for user-flags configure option
|
|
|
|
|
|
* man: Enahnce block_unlisted_ips description
|
|
|
|
|
|
* man: Enhance corosync.conf mp a bit
|
|
|
|
|
|
* cfgtool: Fix link status display
|
|
|
|
|
|
* knet: Use block_unlisted_ips
|
|
|
|
|
|
* udpu: Drop packets from unlisted IPs
|
|
|
|
|
|
* knet: Fix initialising of knet access lists.
|
|
|
|
|
|
* knet: allow corosync to use knet access lists
|
|
|
|
|
|
* man: Enhance token_retransmit description
|
|
|
|
|
|
* totemconfig: Fix minimum limit for hold timeout
|
|
|
|
|
|
* vqsim: Enhance vqsim
|
|
|
|
|
|
* knet: Fix a couple of errors when adding a new link
|
|
|
|
|
|
* totemconfig: fix autogen mcastaddr for ipv6-4
|
|
|
|
|
|
* totemconfig: Ensure nodeid is specified for IPv6
|
|
|
|
|
|
* vqsim: Fix vqsim for corosync 3.0
|
|
|
|
|
|
* vqsim: Make vqsim compile
|
|
|
|
|
|
* totemconfig: ipaddr_equal check just addr part
|
|
|
|
|
|
* cpg: Add CPG_REASON_UNDEFINED
|
|
|
|
|
|
* crypto: re-introduce secauth parameter
|
|
|
|
|
|
* totemconfig: Remove support for 3des
|
|
|
|
|
|
* keygen: Reflect change in knet
|
|
|
|
|
|
* set totem.keyfile and totem.key to RO
|
|
|
|
|
|
* Revert "init: Enable StopWhenUnneeded"
|
|
|
|
|
|
* totemsrp: Word spelling mistake
|
|
|
|
|
|
* coroparse: Fix compiler warning
|
|
|
|
|
|
* configure: Do not autodetect nozzle
|
|
|
|
|
|
* nozzle: Add support for libnozzle devices
|
|
|
|
|
|
* quorumtool: Fix exit status codes
|
|
|
|
|
|
* corosync-cfgtool: Fix -i matching
|
|
|
|
|
|
* build: Use the AWK variable provided by configure
|
|
|
|
|
|
* build: Use the SED variable provided by configure
|
|
|
|
|
|
* configure.ac: AC_PROG_SED is already present
|
|
|
|
|
|
* corosync.conf.5: typography fixes
|
|
|
|
|
|
* corosync.conf.5: fix grammar
|
|
|
|
|
|
* cfgtool: Improve link status display
|
|
|
|
|
|
* doc: Update INSTALL file
|
|
|
|
|
|
* init: Enable StopWhenUnneeded
|
|
|
|
|
|
* totemip: Use AF_UNSPEC for ipv4-6 and ipv6-4
|
|
|
|
|
|
* [totemknet] update for libknet.so.2.0.0 init API
|
|
|
|
|
|
* Config version must be specified
|
|
|
|
|
|
* Don't declare success early
|
|
|
|
|
|
* More natural error messages
|
|
|
|
|
|
* main: Rename run_dir to state_dir
|
|
|
|
|
|
* totemconfig: Enhance totem.ip_version
|
|
|
|
|
|
* totemip: Add debug information to totemip_parse
|
|
|
|
|
|
* totemconfig: Add IPs to family mismatch error
|
|
|
|
|
|
* config: Look up hostnames in a defined order
|
|
|
|
|
|
* Fix corosync.conf.5 manpage typos
|
|
|
|
|
|
* man: Add some information about address resolution
|
|
|
|
|
|
* totemconfig: Really use totemip_parse results
|
|
|
|
|
|
* man: Add instructions for adding/removing nodes
|
|
|
|
|
|
* config: Disallow corosync-cmapctl updates of nodelist
|
|
|
|
|
|
* config: Report IP addr/nodename parse errors back
|
|
|
|
|
|
* coroparse: Remove unused cs_err initialization
|
|
|
|
|
|
* cpghum: Check cpg_local_get return code
|
|
|
|
|
|
* testcpg2: Check cpg_dispatch return code
|
|
|
|
|
|
* notifyd: Delete registered tracking keys
|
|
|
|
|
|
* stats: Fix delete of track
|
|
|
|
|
|
* init: Fix init script to work with containers
|
|
|
|
|
|
* main: Remove COROSYNC_RUN_DIR
|
|
|
|
|
|
* man: Describe nodelist.node.name properly
|
|
|
|
|
|
* main: Remove COROSYNC_TOTEM_AUTHKEY_FILE
|
|
|
|
|
|
* main: Replace COROSYNC_MAIN_CONFIG_FILE
|
|
|
|
|
|
* main: Move sched paramaters to config file
|
|
|
|
|
|
* configure: move to AC_COMPILE_IFELSE
|
|
|
|
|
|
* logsys: Make hires timestamp default
|
|
|
|
|
|
* logsys: Support hires timestamp
|
|
|
|
|
|
* totemconfig: Fix logging of freed string
|
|
|
|
|
|
* config: Allow generated nodeis for UDP & UDPU
|
|
|
|
|
|
* config example: Migrate to newer syntax
|
|
|
|
|
|
* log: Implement support for reopening log files
|
|
|
|
|
|
* totemconfig: Replace strcpy by strncpy
|
|
|
|
|
|
* config: Fix crash in reload if new interfaces are added
|
|
|
|
|
|
* man: Fix default knet_pmtud_interval to match code
|
|
|
|
|
|
* build: Remove totempg shared library leftovers
|
|
|
|
|
|
* build: Do not compile totempg as a shared library
|
|
|
|
|
|
* man: Fix typo conains -> contains
|
|
|
|
|
|
* man: Fix typo connnections -> connections
|
|
|
|
|
|
* build: Remove NSS dependencies
|
|
|
|
|
|
* cts: Remove CTS
|
|
|
|
|
|
* man: Fix crypto_hash and crypto_cipher defaults
|
|
|
|
|
|
* coroparse: Fix newly introduced warning
|
|
|
|
|
|
* Add option to force cluster into GATHER state
|
|
|
|
|
|
* coroparse: Use key_name for error message
|
|
|
|
|
|
* coroparse: Add file name and line to error message
|
|
|
|
|
|
* coroparse: Be more strict in what is parsed
|
|
|
|
|
|
* coroparse: Fix remove_whitespace end condition
|
|
|
|
|
|
* coroparse: Check icmap_set results
|
|
|
|
|
|
* coroparse: Return error if config line is too long
|
|
|
|
|
|
* notifyd: Propagate error to exit code
|
|
|
|
|
|
* git-version-gen: Fail on UNKNOWN version
|
|
|
|
|
|
* build: Support for git archive stored tags
|
|
|
|
|
|
* man: fix cmap key name runtime.config.totem.token
|
|
|
|
|
|
* Remove libcgroup
|
|
|
|
|
|
* systemd: prevent redundancy in journal
|
|
|
|
|
|
* Add token_warning configuration option
|
|
|
|
|
|
* corosync-notifyd: Rename global local_nodeid
|
|
|
|
|
|
* totemsrp: Add assert into memb_lowest_in_config
|
|
|
|
|
|
* totemconfig: Enlarge error_string_response
|
|
|
|
|
|
* ipc_glue: Fix strncpy in pid_to_name function
|
|
|
|
|
|
* cmap: Fix strncpy warning in cmap_iter_next
|
|
|
|
|
|
* util: Fix strncpy in setcs_name_t function
|
|
|
|
|
|
* totemknet: Free instance on failure exit
|
|
|
|
|
|
* spec: Add explicit gcc build requirement
|
|
|
|
|
|
* Add option for quiet operation to corosync-cmapctl
|
|
|
|
|
|
* totemudpu: Pass correct paramto totemip_nosigpipe
|
|
|
|
|
|
* totemudpu: Add local loop support
|
|
|
|
|
|
* config: Fail config validation if not all nodes have all links
|
|
|
|
|
|
* config: Enforce use of 'name' node attribute in multi-link clusters
|
|
|
|
|
|
* totemconfig: Check for things that cannot be changed on the fly
|
|
|
|
|
|
* Fix snprintf warnings
|
|
|
|
|
|
* init: Use existing env variable from sysconf
|
|
|
|
|
|
* upstart: Remove notifyd upstart unit
|
|
|
|
|
|
* knet: Don't try to create loopback interface twice
|
|
|
|
|
|
* knet: Fix knet log buffer size
|
|
|
|
|
|
* cpg: Inform clients about left nodes during pause
|
|
|
|
|
|
* man: Make the manpages reproducible
|
|
|
|
|
|
* totemsrp: Fix leave message regression
|
|
|
|
|
|
* totemsrp: Log proc/fail lists in memb_join_process
|
|
|
|
|
|
* totemsrp: Fix srp_addr_compare
|
|
|
|
|
|
* tools: don't distribute what we can easily make
|
|
|
|
|
|
* Drop all references to SECURITY file
|
|
|
|
|
|
* SECURITY: Remove SECURITY file
|
|
|
|
|
|
* NSS_NoDB_Init: the parameter is reserved, must be NULL
|
|
|
|
|
|
* Fix typo: defualt -> default
|
|
|
|
|
|
* Fix typo: sucesfully -> successfully
|
|
|
|
|
|
* totemsrp: Check join and leave msg length
|
|
|
|
|
|
* totemsrp: Implement sanity checks of received msgs
|
|
|
|
|
|
* cpg: Handle fragmented message sending interrupt
|
|
|
|
|
|
* totem: Display IP of sender
|
|
|
|
|
|
* totemsrp: Add magic and version into header
|
|
|
|
|
|
* knet: Fix display of links with unconfigured link0
|
|
|
|
|
|
* main: Set errno before calling of strtol
|
|
|
|
|
|
* quorumtool: Don't set our_flags without v_handle
|
|
|
|
|
|
* sam_test_agent: Remove unused assignment
|
|
|
|
|
|
* blackbox: Quote subshell result properly
|
|
|
|
|
|
* init: Quote subshell result properly
|
|
|
|
|
|
* cfgtool: Don't assume link ID is a single char
|
|
|
|
|
|
* knet: Always use link0 for loopback
|
|
|
|
|
|
* totem: Fix debug warnings printed by knet
|
|
|
|
|
|
* config: Allow use of ring0_addr
|
|
|
|
|
|
* config: Update message when local host isn't found
|
|
|
|
|
|
* cfg: Fix cfg_get_node_addrs so that DLM works
|
|
|
|
|
|
* totem: Return interface count correctly
|
|
|
|
|
|
* totem: Use nodeid ONLY in srp_addr
|
|
|
|
|
|
* [rpm] use rpm macros to identify build distro
|
|
|
|
|
|
* [rpm] fixup corosync.spec.in to build on opensuse
|
|
|
|
|
|
* totempg: Fix corrupted messages
|
|
|
|
|
|
* totempg: use iovec[i].iov_len instead of copy_len
|
|
|
|
|
|
* totempg: Fix fragmentation segfault
|
|
|
|
|
|
* [build] fix build with non-standard knet location
|
|
|
|
|
|
* [man] fix regression introduced by 7162e75dcf81b7e475536e3060bf5e9312cd43b8
|
|
|
|
|
|
* Man: Move overview mp to sections 3 and 7 from 8
|
|
|
|
|
|
* logging: Close before and open blackbox after fork
|
|
|
|
|
|
* logging: Make blackbox configurable
|
|
|
|
|
|
* corosync-notifyd: improve error handling
|
|
|
|
|
|
* spec: Modernize spec to comply with newest Fedora
|
|
|
|
|
|
* build: Remove support for upstart
|
|
|
|
|
|
* build: Replace -lknet with autoconf generated vars
|
|
|
|
|
|
* build: Remove rdma/ibverbs
|
|
|
|
|
|
* qdevice: Remove qdevices
|
|
|
|
|
|
* config: Don't fudge port numbers
|
|
|
|
|
|
* knet: Allow ping_timers to be auto-configured
|
|
|
|
|
|
* cts: Make code compatible with Python 3
|
|
|
|
|
|
* corosync-notifyd: make SNMP work again
|
|
|
|
|
|
* build: Add the headers necessary for RPM build
|
|
|
|
|
|
* config: if local node addr is wrong, fail with a sensible message
|
|
|
|
|
|
* totemknet: Drop truncated packets on receive
|
|
|
|
|
|
* totemudp: Make use of UDP_RECEIVE_FRAME_SIZE_MAX
|
|
|
|
|
|
* totemudpu: Export and rename UDPU_FRAME_SIZE_MAX
|
|
|
|
|
|
* totemconfig: Fix UDP autogeneration of mcast addr
|
|
|
|
|
|
* totemudpu: Scale receive buffer
|
|
|
|
|
|
* config: Allow selection of crypto_model
|
|
|
|
|
|
* libcpg: Fix issue with partial big packet assembly
|
|
|
|
|
|
* qdevice: mv free(str) after port validation
|
|
|
|
|
|
* corosync.aug: Add missing options
|
|
|
|
|
|
* config: Allow links to have different ip_versions
|
|
|
|
|
|
* Fix compile errors in qdevice and vqsim on FreeBSD
|
|
|
|
|
|
* cmapctl: mention the Clear stats option in usage message
|
|
|
|
|
|
* corosync-cfgtool: refactor cli parameters handling
|
|
|
|
|
|
* wd: fix snprintf warnings
|
|
|
|
|
|
* totemsrp: Revert totemsrp_get_ifaces() changes
|
|
|
|
|
|
* man: Add note about corosync not using name option
|
|
|
|
|
|
* corosync.conf: publicize nodelist.node.name
|
|
|
|
|
|
* man: fixes for corosync.conf man page
|
|
|
|
|
|
* cmapctl: add "-m" option into help message
|
|
|
|
|
|
* totemconfig: remove duplicate aes256 test
|
|
|
|
|
|
* fix output format for corosync-cfgtool with knet (#283)
|
|
|
|
|
|
* sync: Call sync_init of all services at once
|
|
|
|
|
|
* sync: Remove unneeded determine sync code
|
|
|
|
|
|
* stats: Add some missing knet stats
|
|
|
|
|
|
* man: Add note about qdevice parallel cmds start
|
|
|
|
|
|
* man: corosync-qdevice: some more stylistics
|
|
|
|
|
|
* systemd: corosync-qdevice can not run without corosync
|
|
|
|
|
|
* man: corosync-qdevice: fix formatting vs. punctuation
|
|
|
|
|
|
* configure: kill off INITWRAPPERSDIR
|
|
|
|
|
|
* corosync-qdevice: send startup notification to systemd
|
|
|
|
|
|
* corosync-qnetd: send startup notification to systemd
|
|
|
|
|
|
* Send corosync-notifyd startup notification to systemd
|
|
|
|
|
|
* Make systemd stop corosync-notifyd if corosync is stopped
|
|
|
|
|
|
* corosync.spec: Add system-devel build requirement
|
|
|
|
|
|
* Send corosync startup notification to systemd
|
|
|
|
|
|
* quorumtool: Use full buffer size in snprintf
|
|
|
|
|
|
* cpghum: Mark print/log functions with printf attr
|
|
|
|
|
|
* cpg_test_agent: Fix snprintf compiler warnings
|
|
|
|
|
|
* sam: Fix snprintf compiler warnings
|
|
|
|
|
|
* coroparse: Do not convert empty uid, gid to 0
|
|
|
|
|
|
* cmapctl: Add option to clear the stats
|
|
|
|
|
|
* stats: Don't display errors when reading knet stat
|
|
|
|
|
|
* make the output of "corosync-cfgtool -s" more readable (#269)
|
|
|
|
|
|
* cfg: nodeid should be unsigned int
|
|
|
|
|
|
* quorumtool: remove duplicated help message
|
|
|
|
|
|
* man: fix cpg_mcast_joined.3.in
|
|
|
|
|
|
* man: Add stats.clear keys to the cmap_keys man pg
|
|
|
|
|
|
* stats: Add cmap key to clear the various stats.
|
|
|
|
|
|
* Use RuntimeDirectory instead of tmpfiles.d
|
|
|
|
|
|
* totemconfig: generate mcast icmap items for UDP
|
|
|
|
|
|
* Use static case blocks to determine distro flavor
|
|
|
|
|
|
* configure: add --with-initconfigdir option
|
|
|
|
|
|
* totemconfig: add nodeid check for knet
|
|
|
|
|
|
* man: support SOURCE_DATE_EPOCH
|
|
|
|
|
|
* man:fix in corosync-qdevice.8
|
|
|
|
|
|
* man: must set nodeid for knet in nodelist
|
|
|
|
|
|
* logsys: Avoid redundant callsite section checking
|
|
|
|
|
|
* config: Fix memory leak
|
|
|
|
|
|
* knet: Add support for knet compression
|
|
|
|
|
|
* qdevice: Add support for heuristics
|
|
|
|
|
|
* Spec: fix arch-qualified dependencies
|
|
|
|
|
|
* cmap: Remove noop highest config version check
|
|
|
|
|
|
* cmap: don't shutdown highest config_version node
|
|
|
|
|
|
* totemudp: Remove memb_join discarding
|
|
|
|
|
|
* votequorum: make atb consistent on nodelist reload
|
|
|
|
|
|
* totem: Remove unnecessary NSS headers
|
|
|
|
|
|
* config: Allow dynamic link configuration
|
|
|
|
|
|
* totemudp: Retry if bind fails
|
|
|
|
|
|
* corosync.conf.5: watchdog support is conditional
|
|
|
|
|
|
* wd: default to not using a watchdog
|
|
|
|
|
|
* wd: remove extra capitalization typo
|
|
|
|
|
|
* corosync.conf.5: add warning about slow watchdogs
|
|
|
|
|
|
* totemknet: fix debug message typo
|
|
|
|
|
|
* corosync.conf.5: Fix watchdog documentation
|
|
|
|
|
|
* wd: fix typo
|
|
|
|
|
|
* Include fcntl.h for F_* and O_* defines
|
|
|
|
|
|
* stats: add knet 'handle' stats
|
|
|
|
|
|
* main: use syslog & printf directly for early log messages
|
|
|
|
|
|
* totempg: Allow space for incoming overflow
|
|
|
|
|
|
* cpghum: Add options to change flood start/mult/end sizes (#237)
|
|
|
|
|
|
* totemknet: Use knet's LOOPBACK transport (#236)
|
|
|
|
|
|
* CFG: Remove ring-reenable code
|
|
|
|
|
|
* main: Add support for libcgroup
|
|
|
|
|
|
* stats: Add map with on-demand statistics
|
|
|
|
|
|
* ipc: Check for the libraries sending invalid message IDs
|
|
|
|
|
|
* main: Add option to set priority
|
|
|
|
|
|
* totemknet: Prevent dead-loop in log_flush_messages
|
|
|
|
|
|
* corosync-keygen: Display number of needed bits
|
|
|
|
|
|
* totemknet: Flush knet log messages
|
|
|
|
|
|
* corosync-keygen: Make less-secure default
|
|
|
|
|
|
* corosync-keygen: Adapt to knet key sizes
|
|
|
|
|
|
* totemconfig: Make crypto work again
|
|
|
|
|
|
* knet: Compile with latest knet API
|
|
|
|
|
|
* totem: Propagate totem initialization failure
|
|
|
|
|
|
* totemknet: Use new knet_link_set_config() API
|
|
|
|
|
|
* coroapi: Use size_t for private_data_size
|
|
|
|
|
|
* votequorum: Report errors from votequorum_exec_send_reconfigure
|
|
|
|
|
|
* cpghum: remove space after delimiter
|
|
|
|
|
|
* cpghum: Add interim RTT to cpghum
|
|
|
|
|
|
* configure: Enable C99 language standard
|
|
|
|
|
|
* main: Display reason why cluster cannot be formed
|
|
|
|
|
|
* notifyd: Add the community name to an SNMP trap
|
|
|
|
|
|
* cpghum: Add machine-readable output
|
|
|
|
|
|
* test: Fold cpgbench into cpghum (#205)
|
|
|
|
|
|
* knet: Allow space for encapsulated messages
|
|
|
|
|
|
* Main: Call mlockall after fork
|
|
|
|
|
|
* Fix typos in README.recovery
|
|
|
|
|
|
* coroparse: Use readdir instead of readdir_r
|
|
|
|
|
|
* totemknet: Handle logpipe creation failure
|
|
|
|
|
|
* wd: Report error when close of wd fails
|
|
|
|
|
|
* Qnetd lms: Use UTILS_PRI_RING_ID printf format str
|
|
|
|
|
|
* cpghum: Fix printf of size_t variable
|
|
|
|
|
|
* totemknet: Got back to recvmsg() from recvmmsg()
|
|
|
|
|
|
* totemconfig: Prefer nodelist over bindnetaddr
|
|
|
|
|
|
* knet: Close libknet down cleanly at shutdown
|
|
|
|
|
|
* man: Document -a option to corosync-quorumtool
|
|
|
|
|
|
* cpghum test: Improve error codes
|
|
|
|
|
|
* quorumtool: Add option to show all node addresses
|
|
|
|
|
|
* cpghum: Stop cpghum from reporting fake CRC errors
|
|
|
|
|
|
* logconfig: Do not overwrite logger_subsys priority
|
|
|
|
|
|
* totem: Fix buffer sizes
|
|
|
|
|
|
* main: Don't ask libqb to handle segv, it doesn't work
|
|
|
|
|
|
* Logsys: Change logsys syslog_priority priority
|
|
|
|
|
|
* knet: improve logging messages by adding knet subsystem
|
|
|
|
|
|
* cpghum: Add abort_on_error option
|
|
|
|
|
|
* cpghum: Add min rtt and print stats every alarm
|
|
|
|
|
|
* cpghum: Add Round Trip Time (RTT) reporting
|
|
|
|
|
|
* knet: Change nodeids to knet_node_id_t for new knet compatibility
|
|
|
|
|
|
* knet: Fix MTU sizes & allow transport config in corosync.conf
|
|
|
|
|
|
* knet: PMTUd data_mtu already accounts for IP and knet header overheads
|
|
|
|
|
|
* knet: switch from write to sendto()
|
|
|
|
|
|
* knet: Change nodeids to 8 bit for new knet compatibility
|
|
|
|
|
|
* doc: document watchdog_device parameter
|
|
|
|
|
|
* knet: Fix member_remove to shut down existing links first
|
|
|
|
|
|
* Spec: make internal dependencies arch-qualified
|
|
|
|
|
|
* Spec: drop unneeded dependency
|
|
|
|
|
|
* knet: Reduce default pong count to 2 for faster startup
|
|
|
|
|
|
* totemknet: Make it compile with kronosnet git master
|
|
|
|
|
|
* Qdevice: fix spell errors in qdevice
|
|
|
|
|
|
* Remove redundant header file inclusion
|
|
|
|
|
|
* Remove deprecated doxygen flags
|
|
|
|
|
|
* upstart: Add softdog module loading example
|
|
|
|
|
|
* Totempg: remove duplicate memcpy in mcast_msg func
|
|
|
|
|
|
* man: Modify man-page according to command usage
|
|
|
|
|
|
* init: Add doc URIs to the systemd service files
|
|
|
|
|
|
* Fix typo: Destorying -> Destroying
|
|
|
|
|
|
* man: Fix typos in man page
|
|
|
|
|
|
* totempg: totempg_groups_join return valid error
|
|
|
|
|
|
* systemd: Delete unnecessary soft_margin
|
|
|
|
|
|
* knet: Support reload of link parameters
|
|
|
|
|
|
* list: Unify the list processing with qb_list func
|
|
|
|
|
|
* knet: Allow configuration of more params
|
|
|
|
|
|
* knet: Don't lose log messages when knet gets busy (#165)
|
|
|
|
|
|
* libvotequorum: Bump version
|
|
|
|
|
|
* list: Replace for_each by safe version where need
|
|
|
|
|
|
* list: Remove list.h
|
|
|
|
|
|
* list: Replace uses of list.h with qblist.h
|
|
|
|
|
|
* [build] Fix build on RHEL7.3 latest
|
|
|
|
|
|
* Change a type of NodeID.
|
|
|
|
|
|
* vqsim: Fix Makefile.am
|
|
|
|
|
|
* configure: Remove RDMA (again)
|
|
|
|
|
|
* vqsim: Add Quorum simulator program
|
|
|
|
|
|
* Build: Fail configure if knet is not installed
|
|
|
|
|
|
* totem: add totemknet.[ch]
|
|
|
|
|
|
* cfg: Prevents use of uninitialized buffer
|
|
|
|
|
|
* totem: Add Kronosnet transport.
|
|
|
|
|
|
* coropase: Set a poll_period value for wd monitor
|
|
|
|
|
|
* votequorum: simplify reconfigure message handling
|
|
|
|
|
|
* votequorum: Don't update expected_votes display if value is too high
|
|
|
|
|
|
* Fix various typos
|
|
|
|
|
|
* init: corosync and cman aren't system facilities
|
|
|
|
|
|
* conf: be explicit about the mcast src/dst ports
|
2024-06-13 12:18:30 +02:00
|
|
|
|
|
|
|
|
|
|
Added:
|
|
|
|
|
|
corosync-3.1.8.tar.gz
|
|
|
|
|
|
Removed:
|
|
|
|
|
|
corosync-2.4.6.tar.gz
|
|
|
|
|
|
Fix-compile-warnings-with-GCC-7.2.1.patch
|
|
|
|
|
|
bug-1001164_corosync.conf-example.patch
|
|
|
|
|
|
bug-1032634_fix-ifdown-udp.patch
|
|
|
|
|
|
bug-882449_corosync-conf-example.patch
|
|
|
|
|
|
corosync-2.3.4-fix-bashisms.patch
|
|
|
|
|
|
corosync-init-lockfile-path-error.patch
|
|
|
|
|
|
corosync-start-stop-level.patch
|
|
|
|
|
|
upstream-afd97d7884940_coroapi-Use-size_t-for-private_data_size.patch
|
|
|
|
|
|
baselibs.conf
|
|
|
|
|
|
|
|
|
|
|
|
Modified:
|
|
|
|
|
|
_service
|
|
|
|
|
|
_servicedata
|
|
|
|
|
|
corosync.changes: add changelogs
|
|
|
|
|
|
corosync.spec: updates to corosync3
|
2024-06-13 09:44:29 +02:00
|
|
|
|
|
2024-03-11 14:25:26 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Mon Feb 26 10:52:30 UTC 2024 - Dominique Leuenberger <dimstar@opensuse.org>
|
|
|
|
|
|
|
|
|
|
|
|
- Use %autosetup macro. Allows to eliminate the usage of deprecated
|
|
|
|
|
|
PatchN.
|
|
|
|
|
|
|
2024-01-26 08:50:14 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Thu Jan 25 09:04:02 UTC 2024 - Dominique Leuenberger <dimstar@opensuse.org>
|
|
|
|
|
|
|
|
|
|
|
|
- Provide user(coroqnetd) and group(coroqnetd) in the -qnetd
|
|
|
|
|
|
package: user and group are generated by the pre script.
|
|
|
|
|
|
|
2022-12-07 16:06:14 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Mon Nov 21 19:56:53 UTC 2022 - Emil Penchev <emil.penchev@suse.com>
|
|
|
|
|
|
|
|
|
|
|
|
- Update to version 2.4.6:
|
|
|
|
|
|
* totemsrp: More informative messages
|
|
|
|
|
|
* icmap: fix the icmap_get_*_r functions
|
|
|
|
|
|
* stats: Add basic schedule-miss stats to needle
|
|
|
|
|
|
* icmap: icmap_init_r() leaks if trie_create() fails
|
|
|
|
|
|
* test: Fix cpgtest
|
|
|
|
|
|
* pkgconfig: Add libqb dependency
|
|
|
|
|
|
* man: votequorum.5: use proper single quotes
|
|
|
|
|
|
* cpg: Change downlist log level
|
|
|
|
|
|
* totem: Increase ring_id seq after load
|
|
|
|
|
|
* totempg: Check sanity (length) of received message
|
|
|
|
|
|
* totemsrp: Reduce MTU to left room second mcast
|
|
|
|
|
|
* qnetd: Rename qnetd-log.c to log.c
|
|
|
|
|
|
* qnetd: Fix double -d description
|
|
|
|
|
|
* qnetd: Check log initialization error
|
|
|
|
|
|
* qnetd: Add function to set log target
|
|
|
|
|
|
* qdevice: Use log instead of libqb log
|
|
|
|
|
|
* qdevice: Import log instead of qdevice-log
|
|
|
|
|
|
* qdevice: Merge msg_decode_error functions
|
|
|
|
|
|
* qnetd: Use log-common for nodelist debug dump
|
|
|
|
|
|
* qdevice: Configurable log priority bump
|
|
|
|
|
|
* tests: Add utils_parse_bool_str test
|
|
|
|
|
|
* qdevice: Free memory used by log
|
|
|
|
|
|
* qdevice: Add log test
|
|
|
|
|
|
* qdevice: Add header files to list of test sources
|
|
|
|
|
|
* qdevice: Add chk variant of vsyslog to test-log
|
|
|
|
|
|
* qdevice: Add prototype of __vsyslog_chk
|
|
|
|
|
|
* votequorum: Ignore the icmap_get_* return value
|
|
|
|
|
|
* logconfig: Remove double free of value
|
|
|
|
|
|
* cmap: Assert copied string length
|
|
|
|
|
|
* sync: Assert sync_callbacks.name length
|
|
|
|
|
|
* votequorum: Assert copied strings length
|
|
|
|
|
|
* cpghum: Remove unused time variables and functions
|
|
|
|
|
|
* cfgtool: Remove unused callbacks
|
|
|
|
|
|
* cmapctl: Free bin_value on error
|
|
|
|
|
|
* quorumtool: Assert copied string length
|
|
|
|
|
|
* votequorum: Reflect runtime change of 2Node to WFA
|
|
|
|
|
|
* main: Add schedmiss timestamp into message
|
|
|
|
|
|
* votequorum: Change check of expected_votes
|
|
|
|
|
|
* quorumtool: Fix exit status codes
|
|
|
|
|
|
* quorumtool: exit on invalid expected votes
|
|
|
|
|
|
* votequorum: set wfa status only on startup
|
|
|
|
|
|
* Revert "totemip: Add support for sin6_scope_id"
|
|
|
|
|
|
* Revert "totemip: compare sin6_scope_id and interface_num"
|
|
|
|
|
|
* main: Make schedmiss in cmap and log equal
|
|
|
|
|
|
* totemip: Add support for sin6_scope_id
|
|
|
|
|
|
* qnetd: Do not call ffsplit_do on shutdown
|
|
|
|
|
|
* qdevice: Fix connect heuristics result callback
|
|
|
|
|
|
* qdevice: Fix connect heuristics result callback
|
|
|
|
|
|
* qdevice: Log adds newline automatically
|
|
|
|
|
|
* qnetd: Fix dpd timer
|
|
|
|
|
|
* qnetd: Add support for keep active partition vote
|
|
|
|
|
|
* common_lib: Remove trailing spaces in cs_strerror
|
|
|
|
|
|
* totemsrp: Move token received callback
|
|
|
|
|
|
* tests: Use CS_DISPATCH_BLOCKING instead of cycle
|
|
|
|
|
|
* qnetd: Fix NULL dereference of client
|
|
|
|
|
|
* qnetd: Simplify KAP Tie-breaker logic
|
|
|
|
|
|
* totem: Add cancel_hold_on_retransmit config option
|
|
|
|
|
|
* logsys: Unlock config mutex on error
|
|
|
|
|
|
* totemsrp: Switch totempg buffers at the right time
|
|
|
|
|
|
* totemudpu: Don't block local socketpair
|
|
|
|
|
|
* configure.ac: fix pkgconfig issue of rdma
|
|
|
|
|
|
* totemip: Add support for sin6_scope_id
|
|
|
|
|
|
* totemip: compare sin6_scope_id and interface_num
|
|
|
|
|
|
* qdevice: Change log level to NOTICE on PASS
|
|
|
|
|
|
* cfgtool: output error messages to stderr
|
|
|
|
|
|
* tools: use util_strtonum for options checking
|
|
|
|
|
|
* cmapctl: return EXIT_FAILURE on failure
|
|
|
|
|
|
* quorumtool: Help shouldn't require running service
|
|
|
|
|
|
* quorumtool: strict check for -o option
|
|
|
|
|
|
* cmapctl: check NULL for key type and value for -p
|
|
|
|
|
|
* man: adjust description about interface section
|
|
|
|
|
|
* qnetd: sort by node_id when add new client
|
|
|
|
|
|
* man: replace votequorum_poll for actually used fn
|
|
|
|
|
|
|
2022-04-13 13:45:03 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Mon Apr 11 16:06:20 UTC 2022 - Emil Penchev <emil.penchev@suse.com>
|
|
|
|
|
|
|
|
|
|
|
|
- Update to version corosync-2.4.5+git.5d625cef:
|
|
|
|
|
|
* totemudpu: Don't block local socketpair
|
|
|
|
|
|
* totemsrp: Switch totempg buffers at the right time
|
|
|
|
|
|
* logsys: Unlock config mutex on error
|
|
|
|
|
|
|
2021-08-23 12:12:29 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Mon Aug 23 10:02:21 UTC 2021 - varkoly@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- Update to version 2.4.5+git70.64010f57:
|
|
|
|
|
|
* totem: Add cancel_hold_on_retransmit config option
|
|
|
|
|
|
|
2021-06-01 16:19:23 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Tue Jun 01 14:00:15 UTC 2021 - varkoly@suse.com
|
|
|
|
|
|
|
2021-06-01 21:51:26 +02:00
|
|
|
|
- Update to version 2.4.5+git69.6236728a:
|
2021-06-01 16:19:23 +02:00
|
|
|
|
* man: replace votequorum_poll for actually used fn
|
|
|
|
|
|
* qnetd: sort by node_id when add new client
|
|
|
|
|
|
* man: adjust description about interface section
|
|
|
|
|
|
* qnetd: Simplify KAP Tie-breaker logic
|
|
|
|
|
|
* qnetd: Fix NULL dereference of client
|
|
|
|
|
|
* man: votequorum.5: use proper single quotes
|
|
|
|
|
|
* tests: Use CS_DISPATCH_BLOCKING instead of cycle
|
|
|
|
|
|
* totemsrp: Move token received callback
|
|
|
|
|
|
* common_lib: Remove trailing spaces in cs_strerror
|
|
|
|
|
|
* totemsrp: More informative messages
|
|
|
|
|
|
- Remove patches:
|
|
|
|
|
|
bug-1166899-quorumtool-Fix-exit-status-codes.patch
|
|
|
|
|
|
bug-1163460-totemip-Add-support-for-sin6_scope_id.patch
|
|
|
|
|
|
|
2021-03-26 09:45:39 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Tue Mar 9 13:47:45 UTC 2021 - Dominique Leuenberger <dimstar@opensuse.org>
|
|
|
|
|
|
|
|
|
|
|
|
- Drop the script-dependencies on /sbin/chkconfig: deprecated
|
|
|
|
|
|
- Drop the main package's dependency on /usr/sbin/adduser: the main
|
|
|
|
|
|
package does not call this in the pre scripts.
|
|
|
|
|
|
- Change Requires(pre): shadow in corosync-qdevice to
|
|
|
|
|
|
Requires(pre): /usr/sbin/adduser (support alternartive
|
|
|
|
|
|
implementations).
|
|
|
|
|
|
- Use %systemd_ordering for the various, too strict, systemd script
|
|
|
|
|
|
dependencies.
|
|
|
|
|
|
|
2020-10-28 11:48:33 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Tue Oct 27 14:25:29 UTC 2020 - Aleksei Burlakov <aburlakov@suse.com>
|
|
|
|
|
|
|
|
|
|
|
|
- (Again) Fix bsc#1163460 Corosync does not support link-local IPv6 addresses
|
|
|
|
|
|
Added: bug-1163460-totemip-Add-support-for-sin6_scope_id.patch
|
|
|
|
|
|
|
|
|
|
|
|
Reason: This time the path will NOT cause problems when doing rolling
|
|
|
|
|
|
upgrade, see bsc#1168771
|
|
|
|
|
|
|
2020-08-27 19:29:21 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Wed Aug 19 10:18:14 UTC 2020 - Dominique Leuenberger <dimstar@opensuse.org>
|
|
|
|
|
|
|
|
|
|
|
|
- Stop mangling libexecdir: it's not needed at all.
|
|
|
|
|
|
|
2020-04-22 16:18:54 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Wed Apr 22 14:13:26 UTC 2020 - XinLiang <XLiang@suse.com>
|
|
|
|
|
|
|
|
|
|
|
|
- Revoke the patch bug-1163460-totemip-Add-support-for-sin6_scope_id.patch
|
|
|
|
|
|
Deleted: bug-1163460-totemip-Add-support-for-sin6_scope_id.patch
|
|
|
|
|
|
|
|
|
|
|
|
Reason: That path will cause problems while doing rolling upgrade, see bsc#1168771
|
|
|
|
|
|
|
2020-03-20 15:16:43 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Fri Mar 20 14:07:26 UTC 2020 - XinLiang <XLiang@suse.com>
|
|
|
|
|
|
|
|
|
|
|
|
- Fix bsc#1163460 Corosync does not support link-local IPv6 addresses
|
|
|
|
|
|
Added: bug-1163460-totemip-Add-support-for-sin6_scope_id.patch
|
|
|
|
|
|
|
2020-03-18 04:03:01 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Wed Mar 18 02:47:13 UTC 2020 - XinLiang <XLiang@suse.com>
|
|
|
|
|
|
|
|
|
|
|
|
- Fix bsc#1166899, return value of "corosync-quorumtool -s" was not correct
|
|
|
|
|
|
Added: bug-1166899-quorumtool-Fix-exit-status-codes.patch
|
|
|
|
|
|
|
2020-03-11 04:05:27 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Fri Jan 3 11:30:41 UTC 2020 - matthias.gerstner@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- Don't package sysconfig file in tmpfiles.d, it's a bug. Instead correctly
|
|
|
|
|
|
add it to /etc/sysconfig, invoking fillup accordingly.
|
|
|
|
|
|
|
2019-11-07 12:52:11 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Thu Nov 7 06:26:20 UTC 2019 - Yuan Ren <yren@suse.com>
|
|
|
|
|
|
|
|
|
|
|
|
- Packaging bug updating Corosync(bsc#1155792)
|
|
|
|
|
|
Some noisy output from Tumbleweed caused by RPM macro not fairly used
|
|
|
|
|
|
Make sure corosync sysconfig keep original configured firstly(bsc1153502)
|
2019-11-17 08:55:58 +01:00
|
|
|
|
Store the tmp file to a more security directory
|
2019-11-07 12:52:11 +01:00
|
|
|
|
|
2019-10-09 10:08:27 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Wed Oct 9 07:55:48 UTC 2019 - Yuan Ren <yren@suse.com>
|
|
|
|
|
|
|
|
|
|
|
|
- Replace corosync-2.4.5.tar.gz with a clean source.tar.gz(bsc#1144200)
|
|
|
|
|
|
The reason is some binaries left in corosync-2.4.5.tar.gz
|
|
|
|
|
|
|
2018-05-02 04:49:52 +02:00
|
|
|
|
-------------------------------------------------------------------
|
2019-08-21 05:00:36 +02:00
|
|
|
|
Fri Aug 16 09:50:28 UTC 2019 - Yuan Ren <yren@suse.com>
|
|
|
|
|
|
|
|
|
|
|
|
- corosync-2.4.5 upgrade(bsc#1144200)
|
|
|
|
|
|
block_unlisted_ips block package from ips not in nodelist
|
|
|
|
|
|
Qnetd now supports updated NSS database format
|
|
|
|
|
|
Partly fixed problem with ifdown (only for UDPU)
|
|
|
|
|
|
|
|
|
|
|
|
Added:
|
|
|
|
|
|
corosync-2.4.5.tar.gz
|
|
|
|
|
|
bug-1001164_corosync.conf-example.patch
|
|
|
|
|
|
corosync-init-lockfile-path-error.patch
|
|
|
|
|
|
Deleted:
|
|
|
|
|
|
corosync-2.4.4.tar.gz
|
|
|
|
|
|
0003-fix-tmpfiles-create.patch
|
|
|
|
|
|
0004-mark-corosync-as-a-static-service.patch
|
|
|
|
|
|
0005-do-not-convert-empty-uid-gid-to-0.patch
|
|
|
|
|
|
0007-add-config-for-corosync-qnetd.patch
|
|
|
|
|
|
0009-bsc#1088619-add-version.patch
|
|
|
|
|
|
0010-qdevice-net-instance.c-optarg-should-be-str.patch
|
|
|
|
|
|
0011-NSS_NoDB_Init-the-parameter-is-reserved-must-be-NULL.patch
|
2019-10-23 13:03:23 +02:00
|
|
|
|
0012-cpg-Inform-clients-about-left-nodes-during-pause.patch
|
2019-08-21 05:00:36 +02:00
|
|
|
|
bnc#872651-stop-cluster.patch
|
|
|
|
|
|
disable-build-html-docs.patch
|
|
|
|
|
|
Renamed:
|
|
|
|
|
|
0001-coroapi-Use-size_t-for-private_data_size.patch -> upstream-afd97d7884940_coroapi-Use-size_t-for-private_data_size.patch
|
|
|
|
|
|
0006-Fix-compile-warnings-with-GCC-7.2.1.patch -> Fix-compile-warnings-with-GCC-7.2.1.patch
|
|
|
|
|
|
0008-bsc#1083561-upgrade-from-1-x-y.patch -> bug-1083561_upgrade-from-1-x-y.patch
|
|
|
|
|
|
bnc#882449-corosync-conf-example.patch -> bug-882449_corosync-conf-example.patch
|
|
|
|
|
|
0002-fix-ifdown-udp.patch -> bug-1032634_fix-ifdown-udp.patch
|
|
|
|
|
|
bsc#1001164-corosync.conf-example.patch -> bug-1001164_corosync.conf-example.patch
|
2019-08-08 03:54:39 +02:00
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
2018-05-02 04:49:52 +02:00
|
|
|
|
Wed May 2 02:36:56 UTC 2018 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- cpg: Inform clients about left nodes during pause(bsc#1091593)
|
|
|
|
|
|
Added: 0012-cpg-Inform-clients-about-left-nodes-during-pause.patch
|
|
|
|
|
|
|
2018-04-26 08:59:57 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Thu Apr 26 06:43:54 UTC 2018 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- NSS_NoDB_Init: the parameter is reserved, must be NULL(bsc#1090996)
|
|
|
|
|
|
Added: 0011-NSS_NoDB_Init-the-parameter-is-reserved-must-be-NULL.patch
|
|
|
|
|
|
|
2018-04-19 11:12:27 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Tue Apr 17 10:19:52 UTC 2018 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- corosync-2.4.4 is available now(bsc#1089836)
|
|
|
|
|
|
man:fix in corosync-qdevice.8
|
|
|
|
|
|
quorumtool: remove duplicated help message
|
|
|
|
|
|
cfg: nodeid should be unsigned int
|
|
|
|
|
|
coroparse: Use readdir instead of readdir_r
|
|
|
|
|
|
wd: fix snprintf warnings
|
|
|
|
|
|
Fix compile errors in qdevice on FreeBSD
|
|
|
|
|
|
qdevice: mv free(str) after port validation
|
|
|
|
|
|
Fix various typos
|
|
|
|
|
|
Fix typo: recomended -> recommended
|
|
|
|
|
|
man: support SOURCE_DATE_EPOCH
|
|
|
|
|
|
configure: add --with-initconfigdir option
|
|
|
|
|
|
Use static case blocks to determine distro flavor
|
|
|
|
|
|
Use RuntimeDirectory instead of tmpfiles.d
|
|
|
|
|
|
coroparse: Do not convert empty uid, gid to 0
|
|
|
|
|
|
sam: Fix snprintf compiler warnings
|
|
|
|
|
|
quorumtool: Use full buffer size in snprintf
|
|
|
|
|
|
man: Add note about qdevice parallel cmds start
|
|
|
|
|
|
sync: Remove unneeded determine sync code
|
|
|
|
|
|
sync: Call sync_init of all services at once
|
|
|
|
|
|
corosync.conf: publicize nodelist.node.name
|
|
|
|
|
|
totemudp[u]: Drop truncated packets on receive
|
|
|
|
|
|
logging: Make blackbox configurable
|
|
|
|
|
|
logging: Close before and open blackbox after fork
|
|
|
|
|
|
init: Quote subshell result properly
|
|
|
|
|
|
blackbox: Quote subshell result properly
|
|
|
|
|
|
qdevice: quote certutils scripts properly
|
|
|
|
|
|
sam_test_agent: Remove unused assignment
|
|
|
|
|
|
qdevice: Fix NULL pointer dereference
|
|
|
|
|
|
quorumtool: Don't set our_flags without v_handle
|
|
|
|
|
|
qdevice: Nodelist is set into string not array
|
|
|
|
|
|
qdevice: Check if user_data can be dereferenced
|
|
|
|
|
|
qdevice: Add safer wrapper of strtoll
|
|
|
|
|
|
qdevice: Replace strtol by strtonum
|
|
|
|
|
|
qnetd: Replace strtol by strtonum
|
|
|
|
|
|
main: Set errno before calling of strtol
|
|
|
|
|
|
totemcrypto: Implement bad crypto header guess
|
|
|
|
|
|
cpg: Use list_del instead of qb_list_del
|
|
|
|
|
|
totemcrypto: Check length of the packet
|
|
|
|
|
|
totemsrp: Implement sanity checks of received msgs
|
|
|
|
|
|
totemsrp: Check join and leave msg length
|
|
|
|
|
|
totemudp: Check lenght of message to sent
|
|
|
|
|
|
qdevice msgio: Fix reading of msg longer than i32
|
|
|
|
|
|
logsys: Avoid redundant callsite section checking
|
|
|
|
|
|
man: corosync-qdevice: fix formatting vs. punctuation
|
|
|
|
|
|
man: corosync-qdevice: some more stylistics
|
|
|
|
|
|
man: fix cpg_mcast_joined.3.in
|
|
|
|
|
|
libcpg: Fix issue with partial big packet assembly
|
|
|
|
|
|
totempg: Fix fragmentation segfault
|
|
|
|
|
|
totempg: use iovec[i].iov_len instead of copy_len
|
|
|
|
|
|
totempg: Fix corrupted messages
|
|
|
|
|
|
cpg: Handle fragmented message sending interrupt
|
|
|
|
|
|
corosync.aug: Add missing options
|
|
|
|
|
|
systemd: Delete unnecessary soft_margin
|
|
|
|
|
|
|
|
|
|
|
|
Added:
|
|
|
|
|
|
corosync-2.4.4.tar.gz
|
|
|
|
|
|
0010-qdevice-net-instance.c-optarg-should-be-str.patch
|
|
|
|
|
|
Deleted:
|
|
|
|
|
|
0007-sync-Call-sync_init-of-all-services-at-once.patch
|
|
|
|
|
|
0008-wd-fix-snprintf-warnings.patch
|
|
|
|
|
|
0009-add-config-for-corosync-qnetd.patch
|
|
|
|
|
|
0010-qdevice-mv-free-str-after-port-validation.patch
|
|
|
|
|
|
0011-libcpg-Fix-issue-with-partial-big-packet-assembly.patch
|
|
|
|
|
|
0012-totemudp-u-Drop-truncated-packets-on-receive.patch
|
|
|
|
|
|
0013-logging-Make-blackbox-configurable.patch
|
|
|
|
|
|
0014-logging-Close-before-and-open-blackbox-after-fork.patch
|
|
|
|
|
|
0015-coverity-fixes.patch
|
|
|
|
|
|
0018-bsc#1089346-corosync-Integer-overflow-in-totemcrypto.patch
|
|
|
|
|
|
corosync-2.4.3.tar.gz
|
|
|
|
|
|
Renamed:
|
|
|
|
|
|
0009-add-config-for-corosync-qnetd.patch -> 0007-add-config-for-corosync-qnetd.patch
|
|
|
|
|
|
0016-bsc#1083561-upgrade-from-1-x-y.patch -> 0008-bsc#1083561-upgrade-from-1-x-y.patch
|
|
|
|
|
|
0017-bsc#1088619-add-version.patch -> 0009-bsc#1088619-add-version.patch
|
|
|
|
|
|
|
2018-04-13 07:19:40 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Fri Apr 13 05:17:10 UTC 2018 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- (CVE-2018-1084) VUL-0: CVE-2018-1084: corosync: Integer overflow in totemcrypto(bsc#1089346)
|
|
|
|
|
|
Added: 0018-bsc#1089346-corosync-Integer-overflow-in-totemcrypto.patch
|
|
|
|
|
|
|
2018-04-10 04:57:50 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Tue Apr 10 02:46:08 UTC 2018 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- UNKNOWN version in corosync pkg-config(bsc#1088619)
|
|
|
|
|
|
Added: 0017-bsc#1088619-add-version.patch
|
|
|
|
|
|
|
2018-03-05 09:32:16 +01:00
|
|
|
|
-------------------------------------------------------------------
|
2018-03-08 07:28:39 +01:00
|
|
|
|
Thu Mar 8 06:19:09 UTC 2018 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- [Build 489.1] Corosync is not working after upgrade from sle11sp4-ha to sle15-ha(bsc#1083561)
|
|
|
|
|
|
Added: 0016-bsc#1083561-upgrade-from-1-x-y.patch
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
2018-03-05 09:32:16 +01:00
|
|
|
|
Mon Mar 5 08:24:30 UTC 2018 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- some coverity fixes for corosync on upstream(bsc#1083895)
|
|
|
|
|
|
Added: 0015-coverity-fixes.patch
|
|
|
|
|
|
|
2018-01-31 07:32:47 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Wed Jan 31 05:59:06 UTC 2018 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- corosync exposes itself for a self-crash under rare circumstance(bsc#1078412)
|
|
|
|
|
|
Added: 0013-logging-Make-blackbox-configurable.patch
|
|
|
|
|
|
0014-logging-Close-before-and-open-blackbox-after-fork.patch
|
|
|
|
|
|
|
|
|
|
|
|
Modified: remove unncessary git commit messages
|
|
|
|
|
|
0001-coroapi-Use-size_t-for-private_data_size.patch
|
|
|
|
|
|
0002-fix-ifdown-udp.patch
|
|
|
|
|
|
0005-do-not-convert-empty-uid-gid-to-0.patch
|
|
|
|
|
|
0008-wd-fix-snprintf-warnings.patch
|
|
|
|
|
|
0010-qdevice-mv-free-str-after-port-validation.patch
|
|
|
|
|
|
0011-libcpg-Fix-issue-with-partial-big-packet-assembly.patch
|
|
|
|
|
|
0012-totemudp-u-Drop-truncated-packets-on-receive.patch
|
|
|
|
|
|
|
2018-01-10 10:59:41 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Wed Jan 10 02:36:24 UTC 2018 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- totemudp[u]: Drop truncated packets on receive(bsc#1075300)
|
|
|
|
|
|
Added: 0012-totemudp-u-Drop-truncated-packets-on-receive.patch
|
|
|
|
|
|
|
2018-01-08 03:59:01 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Thu Jan 4 04:36:41 UTC 2018 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- issue with partial packets assembly when multiple nodes are sending big packets(bsc#1074929)
|
|
|
|
|
|
Added: 0011-libcpg-Fix-issue-with-partial-big-packet-assembly.patch
|
|
|
|
|
|
|
2018-01-03 03:29:50 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Tue Jan 2 06:15:29 UTC 2018 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- qdevice failed to run(bsc#1074276)
|
|
|
|
|
|
Added: 0010-qdevice-mv-free-str-after-port-validation.patch
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Wed Dec 27 05:49:39 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- add support for corosync-qdevice in yast2-cluster and bootstrap(bsc#1070961)
|
|
|
|
|
|
Added: 0009-add-config-for-corosync-qnetd.patch
|
|
|
|
|
|
|
2017-12-05 08:39:23 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Tue Dec 5 06:13:13 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- wd: gcc shows snprintf warnings(bsc#1071187)
|
|
|
|
|
|
Added: 0008-wd-fix-snprintf-warnings.patch
|
|
|
|
|
|
|
2017-11-24 05:58:49 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Thu Nov 23 13:48:33 UTC 2017 - rbrown@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- Replace references to /var/adm/fillup-templates with new
|
|
|
|
|
|
%_fillupdir macro (boo#1069468)
|
|
|
|
|
|
|
2017-11-17 04:16:16 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Fri Nov 17 02:54:23 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- corosync race condition when node leaves immediately after joining(bsc#1067958)
|
|
|
|
|
|
Added: 0007-sync-Call-sync_init-of-all-services-at-once.patch
|
|
|
|
|
|
|
2017-11-06 10:28:09 +01:00
|
|
|
|
-------------------------------------------------------------------
|
2017-11-09 06:50:58 +01:00
|
|
|
|
Thu Nov 9 03:06:36 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- gcc: snprintf gives warning: ‘%s’ directive output may be truncated writing
|
2017-11-10 07:23:14 +01:00
|
|
|
|
8 bytes into a region of size between 1 and 255(bsc#1066090)
|
2017-11-09 06:50:58 +01:00
|
|
|
|
Added: 0006-Fix-compile-warnings-with-GCC-7.2.1.patch
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
2017-11-06 10:28:09 +01:00
|
|
|
|
Mon Nov 6 09:14:55 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- coroparse: uidgid with empty uid or gid results into add uid 0(bsc#1066585)
|
|
|
|
|
|
Added: 0005-do-not-convert-empty-uid-gid-to-0.patch
|
2017-11-21 04:17:50 +01:00
|
|
|
|
Modified: 0005-do-not-convert-empty-uid-gid-to-0.patch,
|
|
|
|
|
|
check whether the uid, gid is empty before calling strtol
|
2017-11-06 10:28:09 +01:00
|
|
|
|
|
2017-10-23 06:32:00 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Mon Oct 23 03:12:42 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- Upgrade corosync-2.4.2 to corosync-2.4.3(fate#321385)
|
|
|
|
|
|
doc: document watchdog_device parameter
|
|
|
|
|
|
Main: Call mlockall after fork
|
|
|
|
|
|
Totempg: remove duplicate memcpy in mcast_msg func
|
|
|
|
|
|
Qdevice: fix spell errors in qdevice
|
|
|
|
|
|
logconfig: Do not overwrite logger_subsys priority
|
|
|
|
|
|
totemconfig: Prefer nodelist over bindnetaddr
|
|
|
|
|
|
cpghum: Fix printf of size_t variable
|
|
|
|
|
|
Qnetd lms: Use UTILS_PRI_RING_ID printf format str
|
|
|
|
|
|
wd: Report error when close of wd fails
|
|
|
|
|
|
votequorum: Don't update expected_votes display if value is too high
|
|
|
|
|
|
votequorum: simplify reconfigure message handling
|
|
|
|
|
|
quorumtool: Add option to show all node addresses
|
|
|
|
|
|
main: Don't ask libqb to handle segv, it doesn't work
|
|
|
|
|
|
man: Document -a option to corosync-quorumtool
|
|
|
|
|
|
main: use syslog & printf directly for early log messages
|
|
|
|
|
|
votequorum: make atb consistent on nodelist reload
|
|
|
|
|
|
Fix typo: Destorying -> Destroying
|
|
|
|
|
|
init: Add doc URIs to the systemd service files
|
|
|
|
|
|
wd: fix typo
|
|
|
|
|
|
corosync.conf.5: Fix watchdog documentation
|
|
|
|
|
|
corosync.conf.5: add warning about slow watchdogs
|
|
|
|
|
|
wd: remove extra capitalization typo
|
|
|
|
|
|
corosync.conf.5: watchdog support is conditional
|
|
|
|
|
|
notifyd: Add the community name to an SNMP trap
|
|
|
|
|
|
Logsys: Change logsys syslog_priority priority
|
|
|
|
|
|
totemrrp: Fix situation when all rings are faulty
|
|
|
|
|
|
main: Display reason why cluster cannot be formed
|
|
|
|
|
|
totem: Propagate totem initialization failure
|
|
|
|
|
|
totemcrypto: Refactor symmetric key importing
|
|
|
|
|
|
totemcrypto: Use different method to import key
|
|
|
|
|
|
main: Add option to set priority
|
|
|
|
|
|
main: Add support for libcgroup
|
|
|
|
|
|
totemcrypto: Fix compiler warning
|
|
|
|
|
|
cmap: Remove noop highest config version check
|
|
|
|
|
|
qdevice: Add support for heuristics
|
|
|
|
|
|
Spec: drop unneeded dependency
|
|
|
|
|
|
Spec: make internal dependencies arch-qualified
|
|
|
|
|
|
cmap: don't shutdown highest config_version node
|
|
|
|
|
|
totemudp: Remove memb_join discarding
|
|
|
|
|
|
Spec: fix arch-qualified dependencies
|
|
|
|
|
|
Include fcntl.h for F_* and O_* defines
|
|
|
|
|
|
totemudp: Retry if bind fails
|
|
|
|
|
|
Remove deprecated doxygen flags
|
|
|
|
|
|
man: Fix typos in man page
|
|
|
|
|
|
man: Modify man-page according to command usage
|
|
|
|
|
|
Remove redundant header file inclusion
|
|
|
|
|
|
upstart: Add softdog module loading example
|
|
|
|
|
|
|
|
|
|
|
|
Added:
|
|
|
|
|
|
corosync-2.4.3.tar.gz
|
|
|
|
|
|
Removed:
|
|
|
|
|
|
corosync-2.4.2.tar.gz
|
|
|
|
|
|
bsc#1047860-add-version.patch
|
|
|
|
|
|
0001-Logsys-Change-logsys-syslog_priority-priority.patch
|
|
|
|
|
|
0001-logconfig.c-make-logging.syslog_priority-and-logging.patch
|
|
|
|
|
|
0001-totemconfig.c-Fixed-Evicted-from-CPG-membership.patch
|
|
|
|
|
|
0002-Main-call-mlock-after-fork.patch
|
|
|
|
|
|
0003-totemrrp-Fix-situation-when-all-rings-are-faulty.patch
|
|
|
|
|
|
0004-main-Display-reason-why-cluster-cannot-be-formed.patch
|
|
|
|
|
|
0005-votequorum-Report-errors-from-votequorum_exec_send_r.patch
|
|
|
|
|
|
0007-Make-corosync-work-when-FIPS-mode-is-enabled.patch
|
|
|
|
|
|
0008-main.c-add-option-to-set-priority.patch
|
|
|
|
|
|
0009-totem-Propagate-totem-initialization-failure.patch
|
|
|
|
|
|
|
|
|
|
|
|
Modified:
|
|
|
|
|
|
bsc#1047860-add-version.patch: change version to 2.4.3
|
|
|
|
|
|
corosync.changes: add changelogs
|
|
|
|
|
|
corosync.spec: remove unnecessary patches
|
|
|
|
|
|
|
|
|
|
|
|
Renamed:
|
|
|
|
|
|
0006-coroapi-Use-size_t-for-private_data_size.patch -> 0001-coroapi-Use-size_t-for-private_data_size.patch
|
|
|
|
|
|
0010-fix-ifdown-udp.patch -> 0002-fix-ifdown-udp.patch
|
|
|
|
|
|
0011-fix-tmpfiles-create.patch -> 0003-fix-tmpfiles-create.patch
|
|
|
|
|
|
0012-mark-corosync-as-a-static-service.patch -> 0004-mark-corosync-as-a-static-service.patch
|
|
|
|
|
|
|
2017-09-28 08:24:02 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Thu Sep 28 06:15:35 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- wrong "service_del_postun corosync.service"(bsc#1060767)
|
|
|
|
|
|
Modified: corosync.spec, remove service_del_postun in postun of corosync
|
|
|
|
|
|
|
2017-09-22 09:34:32 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Tue Sep 12 14:40:51 UTC 2017 - jengelh@inai.de
|
|
|
|
|
|
|
|
|
|
|
|
- Restore conformance to shared library packaging guideline.
|
|
|
|
|
|
- Remove redundant cleaning in %install and %clean.
|
|
|
|
|
|
|
2017-08-29 10:00:14 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Tue Aug 29 07:50:16 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- corosync.service should be marked as a static service(bsc#1055585)
|
|
|
|
|
|
Added: 0012-mark-corosync-as-a-static-service.patch
|
|
|
|
|
|
|
2017-08-03 05:20:08 +02:00
|
|
|
|
-------------------------------------------------------------------
|
2017-08-08 10:38:06 +02:00
|
|
|
|
Tue Aug 8 08:17:27 UTC 2017 - jengelh@inai.de
|
|
|
|
|
|
|
|
|
|
|
|
- Fix RPM groups.
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
2017-08-03 05:20:08 +02:00
|
|
|
|
Thu Aug 3 02:50:00 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- L3: corosync: assert(sender_node != NULL) fails after tearing down a network interface(bsc#1032634)
|
|
|
|
|
|
Added: 0010-fix-ifdown-udp.patch
|
|
|
|
|
|
|
2017-08-16 08:29:09 +02:00
|
|
|
|
- Fix rpmlint warnings
|
|
|
|
|
|
Added: 0011-fix-tmpfiles-create.patch
|
|
|
|
|
|
|
2017-08-03 05:20:08 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Thu Aug 3 02:49:21 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- some errors in spec file(bsc#1047862)
|
|
|
|
|
|
Modified:corosync.spec
|
|
|
|
|
|
1) as in openSUSE:factory, there are %define, but bcond_with coudld be toggled by osc command , change %define to %bcond_with and %bcond_without
|
|
|
|
|
|
2) change service_del_postun to service_del_preun, since service_del_postun is not a right macro
|
2017-08-29 11:54:18 +02:00
|
|
|
|
3) remove macro tpmfiles_create define from corosync.spec.
|
2017-08-03 05:20:08 +02:00
|
|
|
|
|
|
|
|
|
|
|
2017-07-31 05:05:03 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Mon Jul 31 02:54:49 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- make corosync.spec uniform (bsc#1051385)
|
|
|
|
|
|
Modified: corosync.spec
|
|
|
|
|
|
1. there are some lines are commented in corosync.spec, will define new macro to make these lines uncommented
|
|
|
|
|
|
2. in former, xmlconf, rdma and snmp were disabled, these features are wrongly enabled, will disable them
|
|
|
|
|
|
|
2017-07-12 07:54:18 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Wed Jul 12 05:25:45 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- some upstream fixes for corosync(bsc#1048259)
|
|
|
|
|
|
Added:
|
|
|
|
|
|
bsc#1047860-add-version.patch
|
|
|
|
|
|
0007-Make-corosync-work-when-FIPS-mode-is-enabled.patch
|
|
|
|
|
|
0008-main.c-add-option-to-set-priority.patch
|
|
|
|
|
|
0009-totem-Propagate-totem-initialization-failure.patch
|
|
|
|
|
|
|
|
|
|
|
|
Removed:
|
|
|
|
|
|
bnc#867767-add-version.patch
|
|
|
|
|
|
0007-improve-corosync-keygen.patch(since this patch is not for corosync v2.x)
|
|
|
|
|
|
|
|
|
|
|
|
Modified:
|
|
|
|
|
|
corosync.spec, add judgement whether /etc/sysconfig/corosycn* exist before remove these files
|
|
|
|
|
|
|
2017-06-07 08:33:45 +02:00
|
|
|
|
-------------------------------------------------------------------
|
2017-07-10 09:25:50 +02:00
|
|
|
|
Mon Jul 10 06:54:23 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- some errors in spec file(bsc#1047862)
|
|
|
|
|
|
Modified:
|
|
|
|
|
|
corosync.spec
|
|
|
|
|
|
|
|
|
|
|
|
- improvement for corosync-keygen(bsc#1047861)
|
|
|
|
|
|
Added:
|
|
|
|
|
|
0007-improve-corosync-keygen.patch
|
|
|
|
|
|
|
|
|
|
|
|
- 1047860corosync report wrong version number(bsc#1047860)
|
|
|
|
|
|
Modified:
|
|
|
|
|
|
bnc#867767-add-version.patch
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
2017-06-07 08:33:45 +02:00
|
|
|
|
Wed Jun 7 06:06:38 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- some Fixes from upstream(bsc#1043045)
|
|
|
|
|
|
Added:
|
|
|
|
|
|
0004-main-Display-reason-why-cluster-cannot-be-formed.patch
|
|
|
|
|
|
0005-votequorum-Report-errors-from-votequorum_exec_send_r.patch
|
|
|
|
|
|
0006-coroapi-Use-size_t-for-private_data_size.patch
|
|
|
|
|
|
|
2017-06-06 11:16:50 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Tue Jun 6 16:57:05 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
[patch-lost-in-sle] Missing issues in openSUSE:Factory/corosync(bsc#1041587)
|
|
|
|
|
|
add change log for upgrading corosync to v2.3.6 and make this change log contain all records in SLE12 SP3
|
|
|
|
|
|
make the format consistent
|
|
|
|
|
|
|
2017-05-16 05:09:05 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Tue May 16 03:05:05 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- totemrrp: Fix situation when all rings are faulty(bsc#1039215)
|
2017-06-06 11:16:50 +02:00
|
|
|
|
Added:
|
|
|
|
|
|
0003-totemrrp-Fix-situation-when-all-rings-are-faulty.patch
|
2017-05-16 05:09:05 +02:00
|
|
|
|
|
2017-05-09 06:25:45 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Tue May 9 04:17:35 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- calling mlockall before corosync_tty_detach is noop when corosync is executed as a daemon(bsc#1038147)
|
2017-06-06 11:16:50 +02:00
|
|
|
|
Added:
|
|
|
|
|
|
0002-Main-call-mlock-after-fork.patch
|
2017-05-09 06:25:45 +02:00
|
|
|
|
|
2017-04-10 08:52:22 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Mon Apr 10 06:42:51 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- [upgrade] Changing the pre-upgrade role for node failed(bsc#1030437)
|
2017-06-06 11:16:50 +02:00
|
|
|
|
Added:
|
|
|
|
|
|
0001-totemconfig.c-Fixed-Evicted-from-CPG-membership.patch
|
|
|
|
|
|
|
|
|
|
|
|
Removed:
|
|
|
|
|
|
0001-totemip.c-Fixed-Evicted-from-CPG-membership.patch
|
2017-04-10 08:52:22 +02:00
|
|
|
|
|
2017-03-01 03:46:00 +01:00
|
|
|
|
-------------------------------------------------------------------
|
2017-03-14 08:38:15 +01:00
|
|
|
|
Tue Mar 14 07:14:58 UTC 2017 - bliu@suse.com
|
2017-03-01 03:46:00 +01:00
|
|
|
|
|
|
|
|
|
|
- L3-Question: corosync logging priority takes no effect(bsc#1023959)
|
2017-06-06 11:16:50 +02:00
|
|
|
|
Added:
|
2017-03-01 03:46:00 +01:00
|
|
|
|
0001-Logsys-Change-logsys-syslog_priority-priority.patch
|
2017-03-14 08:38:15 +01:00
|
|
|
|
0001-logconfig.c-make-logging.syslog_priority-and-logging.patch
|
2017-03-01 03:46:00 +01:00
|
|
|
|
|
2016-12-06 09:55:27 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Tue Dec 6 08:19:09 UTC 2016 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- Corosync 2.4.1 still produces libvotequorum.so.7.0.0, just like Corosync 2.3.6.(bsc#1013842)
|
2017-06-06 11:16:50 +02:00
|
|
|
|
Added:
|
|
|
|
|
|
disable-build-html-docs.patch
|
|
|
|
|
|
|
|
|
|
|
|
upgrade to corosync-2.4.2:
|
2016-12-06 09:55:27 +01:00
|
|
|
|
Man: Fix corosync-qdevice-net-certutil link
|
|
|
|
|
|
man: mention qdevice incompatibilites in votequorum.5
|
|
|
|
|
|
Qnetd LMS: Fix two partition use case
|
|
|
|
|
|
cfg: Prevents use of uninitialized buffer
|
|
|
|
|
|
|
2016-11-01 10:46:52 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Mon Oct 17 08:28:33 UTC 2016 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- upgrade to corosync-2.4.1(bsc#1004967)
|
2017-06-06 11:16:50 +02:00
|
|
|
|
Added:
|
|
|
|
|
|
corosync-start-stop-level.patch
|
|
|
|
|
|
|
|
|
|
|
|
Deleted:
|
|
|
|
|
|
Config-Flag-config-uidgid-entries.patch
|
|
|
|
|
|
cfg-Prevents-use-of-uninitialized-buffer.patch
|
|
|
|
|
|
cts-Make-it-run-with-pacemaker-1.13.patch
|
|
|
|
|
|
get_cluster_mcast_addr-error-is-not-fatal.patch
|
|
|
|
|
|
totemsrp-Addition-of-the-log.patch
|
|
|
|
|
|
|
|
|
|
|
|
modified: bnc#867767-add-version.patch, change version to 2.4.1
|
|
|
|
|
|
corosync-2.4.1:
|
2016-11-01 10:46:52 +01:00
|
|
|
|
Low: totemsrp: Addition of the log.
|
|
|
|
|
|
cts: Make it run with pacemaker-1.13+
|
|
|
|
|
|
Config: Flag config uidgid entries
|
|
|
|
|
|
Spec: Qdevice require same version of corosync
|
|
|
|
|
|
|
2017-06-06 11:16:50 +02:00
|
|
|
|
corosync-2.4.0:
|
2016-11-01 10:46:52 +01:00
|
|
|
|
qdevice and qnet
|
|
|
|
|
|
config: get_cluster_mcast_addr error is not fatal
|
|
|
|
|
|
some typo fixes
|
2017-06-06 11:16:50 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Thu Oct 15 05:19:36 UTC 2016 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
upgrade corosync-v2.3.5 to corosync-v2.3.6, and backport patches from v2.4.2(FATE#322113, bsc#1020550)
|
|
|
|
|
|
Added:
|
|
|
|
|
|
Config-Flag-config-uidgid-entries.patch
|
|
|
|
|
|
cfg-Prevents-use-of-uninitialized-buffer.patch
|
|
|
|
|
|
cts-Make-it-run-with-pacemaker-1.13.patch
|
|
|
|
|
|
get_cluster_mcast_addr-error-is-not-fatal.patch
|
|
|
|
|
|
totemsrp-Addition-of-the-log.patch
|
|
|
|
|
|
|
|
|
|
|
|
Removed:
|
|
|
|
|
|
corosync-cts-api-error.patch
|
|
|
|
|
|
|
|
|
|
|
|
v2.3.6
|
|
|
|
|
|
- logconfig: Fix logging reload disabling logfiles
|
|
|
|
|
|
- wd: Warn if values are out of range
|
|
|
|
|
|
- parser: WD Read type correctly from corosync.conf
|
|
|
|
|
|
- Add some more RO keys
|
|
|
|
|
|
- Reapply config defaults corosync.conf reload
|
|
|
|
|
|
- schedwrk: Cleanup and make it work on PPC BE
|
|
|
|
|
|
- cmapctl: Handle corosync errors in print_key func
|
|
|
|
|
|
- Adds doxygen stubs to include directory
|
|
|
|
|
|
- Add clang-format configuration file
|
|
|
|
|
|
- wd: make watchdog device configurable
|
|
|
|
|
|
- logging: Use our own version of basename
|
|
|
|
|
|
- logsys: fix TOTEM logging when corosync built out of tree
|
|
|
|
|
|
- parser: Make config file parser more hierarchy
|
|
|
|
|
|
- totemconfig: Explicitly pass IP version
|
|
|
|
|
|
- cpg: Handle ipc error in cpg_zcb_alloc/free
|
|
|
|
|
|
- cpg: Memory not unmapped in cpg_zcb_free
|
|
|
|
|
|
- totempg: Fix memory leak
|
|
|
|
|
|
- Fix spelling errors
|
|
|
|
|
|
- Add section in manual title for cpg_zcb_free 3
|
|
|
|
|
|
- Add section in manual title for cpg_zcb_alloc 3
|
|
|
|
|
|
- Update corosync.spec source link
|
|
|
|
|
|
- Update gitignore files
|
|
|
|
|
|
- Remove all links to old ML
|
|
|
|
|
|
- totemsrp: Fix clang warning (tautological compare)
|
|
|
|
|
|
- configure.ac: Make location of .pc overrideable
|
|
|
|
|
|
- Remove a few unused variables and functions
|
|
|
|
|
|
- configure.ac: We don't need no C++ compiler
|
|
|
|
|
|
- configure.ac: Remove deprecated AC_PROG_LIBTOOL
|
|
|
|
|
|
- configure.ac: make foreign apply to all Makefiles
|
|
|
|
|
|
- Remove unused, obsolete check
|
|
|
|
|
|
- Fix detection of qb_log_thread_priority_set
|
|
|
|
|
|
- cpghum: Fix type of recv_crc
|
|
|
|
|
|
- Check for fdatasync
|
|
|
|
|
|
- Fix detection of warning flags for clang
|
|
|
|
|
|
- quorum: Display node id as unsigned int.
|
|
|
|
|
|
- cts: InitClusterManager is now BootCluster
|
|
|
|
|
|
- totemudp: Move udp bind() so that multicast works with IPv6
|
|
|
|
|
|
- cfgtool: Display nodeid as unsigned int
|
|
|
|
|
|
- votequorum: Don't send multiple callbacks when nodes join
|
|
|
|
|
|
- man: Add synopsis for cpg_zcb_alloc and free
|
|
|
|
|
|
- man html index: Update index
|
|
|
|
|
|
- votequorum: Make sure cs_error_t is defined
|
|
|
|
|
|
- Doxygen fix for cmap_iter_next()
|
|
|
|
|
|
- configure: Correct help entry for logdir
|
|
|
|
|
|
- totmesrp: Fix typo in log message
|
|
|
|
|
|
- configure: typo in include
|
|
|
|
|
|
- man page: Correct option letter for DBus
|
|
|
|
|
|
- wd: fix setting of watchdog timeouts
|
|
|
|
|
|
- CFG: Prevent CFG orignating messages during SYNC
|
2016-11-01 10:46:52 +01:00
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Tue Sep 27 07:33:09 UTC 2016 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- Default token timeout was 5000 ms in SLE 11 SP4, but is 1000 ms in SLE 12(bsc#1001164)
|
|
|
|
|
|
Added: bsc#1001164-corosync.conf-example.patch
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Wed Sep 7 07:35:12 UTC 2016 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- Fix: [s390]Upgrade from SP1-GM + HA to SP2-RC2 +: Failed to start Corosync Cluster engine(bsc#996230)
|
|
|
|
|
|
- modify corosync.spec to remove "chkconfig --add"
|
|
|
|
|
|
- remove corosync-devel and require lines from baselibs.conf
|
|
|
|
|
|
|
2016-07-14 10:06:36 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Thu Jul 14 07:59:03 UTC 2016 - bliu@suse.com
|
|
|
|
|
|
- corosync process still exists when stop pacemaker service(bnc#988683)
|
|
|
|
|
|
|
2015-07-28 02:52:54 +02:00
|
|
|
|
-------------------------------------------------------------------
|
2016-11-01 10:46:52 +01:00
|
|
|
|
Mon Aug 17 15:09:13 UTC 2015 - bliu@suse.com
|
|
|
|
|
|
- remove git files from tarball(bnc#941910)
|
2015-08-17 09:11:36 +02:00
|
|
|
|
- modify corosync.spec to delete logrotate.d
|
2015-07-28 02:52:54 +02:00
|
|
|
|
|
2015-07-27 04:51:30 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Wed Jul 21 15:12:26 UTC 2015 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
update from v2.3.3 to v2.3.5 (bnc#939328)
|
|
|
|
|
|
v2.3.5
|
|
|
|
|
|
- Log: Add logrotate configuration file
|
|
|
|
|
|
- totemsrp: Improve logging of left/down nodes
|
|
|
|
|
|
- totemconfig: Check for duplicate nodeids
|
|
|
|
|
|
- Really add cpghum
|
|
|
|
|
|
- cpg: Add support for messages larger than 1Mb
|
|
|
|
|
|
- Handle adding and removing UDPU members atomically
|
|
|
|
|
|
|
2015-07-27 04:59:12 +02:00
|
|
|
|
- add patches:
|
|
|
|
|
|
* corosync-cts-api-error.patch
|
|
|
|
|
|
* bnc#867767-add-version.patch
|
|
|
|
|
|
|
2015-07-27 04:51:30 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Wed Jul 1 17:30:22 UTC 2015 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- mv the place of corosync.conf.example*(fate#318190)
|
|
|
|
|
|
|
2014-11-21 03:59:30 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Wed Nov 19 22:24:13 UTC 2014 - dimstar@opensuse.org
|
|
|
|
|
|
|
|
|
|
|
|
- Replace systemd BuildRequires with pkgconfig(systemd): we do not
|
|
|
|
|
|
require the full installation / dep chain of systemd.
|
|
|
|
|
|
|
2014-11-21 03:58:32 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Mon Nov 17 04:01:00 UTC 2014 - Led <ledest@gmail.com>
|
|
|
|
|
|
|
|
|
|
|
|
- fix bashisms in mem_leak_test.sh script
|
|
|
|
|
|
- add patches:
|
|
|
|
|
|
* corosync-2.3.4-fix-bashisms.patch
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Mon Nov 17 04:00:00 UTC 2014 - Led <ledest@gmail.com>
|
|
|
|
|
|
|
|
|
|
|
|
- fix bashism in preun script
|
|
|
|
|
|
|
2014-09-09 16:53:12 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Mon Sep 1 08:01:50 UTC 2014 - xli@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- Update to corosync 2.3.4
|
|
|
|
|
|
- Drop the obsoleted patches
|
|
|
|
|
|
- corosync-cts-api-error.patch
|
|
|
|
|
|
- bnc#867767-add-version.patch
|
|
|
|
|
|
- bnc#881142-fix-shm-leak.patch
|
|
|
|
|
|
- quorumtool: Sort output by nodeid
|
|
|
|
|
|
- YKD: Fix loading of YKD quorum module
|
|
|
|
|
|
- corosync-quorumtool: add sort options
|
|
|
|
|
|
- cleanup after test-driver
|
|
|
|
|
|
- be consistent in using CPPFLAGS vs CFLAGS
|
|
|
|
|
|
- totemsrp: Fix typo with cont gather
|
|
|
|
|
|
- cpg: Refactor mh_req_exec_cpg_procleave
|
|
|
|
|
|
- cpg: Make sure nodid is always logged as hex num
|
|
|
|
|
|
- cpg: Make sure left nodes are really removed
|
|
|
|
|
|
- mon: Make mon compilable with libstatgrab ver 0.9
|
|
|
|
|
|
- mon: Fix comparsion typo
|
|
|
|
|
|
- mon: Pass correct pointer to inst
|
|
|
|
|
|
- mon: Make monitoring work
|
|
|
|
|
|
- config: Handle totem_set_volatile_defaults errors
|
|
|
|
|
|
- config: Allow dynamic change of token_coefficient
|
|
|
|
|
|
- Log: Make reload of logging work
|
|
|
|
|
|
- Really clear totemconfig nodes on reload
|
|
|
|
|
|
- Add token_coefficient option
|
|
|
|
|
|
- init: Make init script configurable
|
|
|
|
|
|
- totemiba: Fix incorrect failed log message
|
|
|
|
|
|
- logsys: Log error if blackbox cannot be created
|
|
|
|
|
|
- logsys: Log warning if flightrecorder init fails
|
|
|
|
|
|
- Introduce get_run_dir function
|
|
|
|
|
|
- Move ringid store and load from totem library
|
|
|
|
|
|
- coroparse: More strict numbers parsing
|
|
|
|
|
|
- Doc: Enhance INSTALL file a bit
|
|
|
|
|
|
- Make config.reload_in_progress key read only
|
|
|
|
|
|
- Fix compiler warning introduced by previous patch
|
|
|
|
|
|
- totemconfig: Free ifaddrs list
|
|
|
|
|
|
- totemconfig: Make sure join timeout is less than consensus
|
|
|
|
|
|
- totemconfig: Key change process dependencies
|
|
|
|
|
|
- totemconfig: Log errors on key change and reload
|
|
|
|
|
|
- totemconfig: totem_config_get_ip_version
|
|
|
|
|
|
- totemconfig: refactor nodelist_to_interface func
|
|
|
|
|
|
- corosync-keygen: Replace printf/exit call with err
|
|
|
|
|
|
- votequorum: Add cmap key to reset wait_for_all
|
|
|
|
|
|
- votequorum: Return current ring id in callback
|
|
|
|
|
|
- votequorum: Add ring id to poll call
|
|
|
|
|
|
- votequorum: Do not process events during reload
|
|
|
|
|
|
- votequorum: Block sync until qdevice poll
|
|
|
|
|
|
- votequorum: Make qdev timeout in sync configurable
|
|
|
|
|
|
- votequorum: Properly initialize atb and atb_string
|
|
|
|
|
|
- ipc: Process votequorum messages during sync
|
|
|
|
|
|
- testvotequorum2: Opt for polling with old ringid
|
|
|
|
|
|
- TODO: Remove TODO file
|
|
|
|
|
|
- Makefile: Do not install TODO file
|
|
|
|
|
|
- totem: Inform RRP about membership changes
|
|
|
|
|
|
- totemnet: Add totemnet_member_set_active
|
|
|
|
|
|
- totemrrp: Implement *_membership_changed
|
|
|
|
|
|
- totemudpu: Implement member_set_active
|
|
|
|
|
|
- totemudpu: Send msgs to all members occasionally
|
|
|
|
|
|
- Cancel token holding while in retransmition
|
|
|
|
|
|
- upstart: Make job conf file configurable
|
|
|
|
|
|
- systemd: Config example for corosync wd service
|
|
|
|
|
|
- Install doc: Correct a typo
|
|
|
|
|
|
- init: change return value when starting corosync
|
|
|
|
|
|
- Free object allocated at quorum_register_callback
|
|
|
|
|
|
- corosync-cmapctl: Allow -p option to delete keys
|
|
|
|
|
|
- Implement config file testing mode
|
|
|
|
|
|
- Slightly rework corosync-keygen.
|
|
|
|
|
|
- totemiba: Add multicast recovery
|
|
|
|
|
|
- Indent: Remove space in negation of expression
|
|
|
|
|
|
- Indent: Remove newline before else branch start
|
|
|
|
|
|
- fix memory leak produced by 'corosync -v'
|
|
|
|
|
|
- Handle SIGSEGV and SIGABRT signals
|
|
|
|
|
|
|
2014-07-03 07:28:11 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Thu Jul 3 05:07:13 UTC 2014 - lzhong@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- comment out line: to_logfile:no (bnc#882449)
|
2014-09-09 16:53:12 +02:00
|
|
|
|
work on patch bnc#882449-corosync-conf-example.patch
|
2014-07-03 07:28:11 +02:00
|
|
|
|
|
2014-07-02 08:19:34 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Wed Jul 2 05:48:47 UTC 2014 - yzou@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- Fixed shared memory leak.
|
2014-09-09 16:53:12 +02:00
|
|
|
|
+ bnc#881142-fix-shm-leak.patch
|
2014-07-02 08:19:34 +02:00
|
|
|
|
|
2014-07-02 07:27:10 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Fri Jun 13 03:13:13 UTC 2014 - lzhong@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- Update corosync.conf.example and corosync.conf.example.udpu(bnc#882449)
|
2014-09-09 16:53:12 +02:00
|
|
|
|
- remove corosync-conf-example.patch
|
|
|
|
|
|
+ add bnc#882449-corosync-conf-example.patch
|
2014-07-02 07:27:10 +02:00
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
2014-04-11 10:27:04 +02:00
|
|
|
|
Fri Apr 11 06:50:17 UTC 2014 - lzhong@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- Fix `systemctl stop pacemaker` leaves corosync running
|
2014-09-09 16:53:12 +02:00
|
|
|
|
+ bnc#872651-stop-cluster.patch
|
2014-04-11 10:27:04 +02:00
|
|
|
|
- Ensure that libopenais3 is removed on update of corosync(bnc#872122)
|
|
|
|
|
|
|
2014-03-13 03:03:45 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Wed Mar 12 08:41:21 UTC 2014 - lzhong@suse.com
|
|
|
|
|
|
|
2014-03-17 03:42:29 +01:00
|
|
|
|
- Modify spec file:add symlink rccorosync to /usr/sbin/service (bnc#866057)
|
2014-03-13 03:03:45 +01:00
|
|
|
|
- Fix corosync -v show UNKNOW (bnc#867767)
|
2014-09-09 16:53:12 +02:00
|
|
|
|
+ bnc#867767-add-version.patch
|
2014-03-13 03:03:45 +01:00
|
|
|
|
|
2014-01-24 03:56:45 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Tue Jan 21 07:48:22 UTC 2014 - xli@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- Update to corosync 2.3.3
|
|
|
|
|
|
- Properly check result of symlink
|
|
|
|
|
|
- Fix cppchecks warning
|
|
|
|
|
|
- Close devnull file handler
|
|
|
|
|
|
- votequorum: Add missing man pages
|
|
|
|
|
|
- totem: Drop invalid join msg in operational state
|
|
|
|
|
|
- systemd unit: Make sure network is really up
|
|
|
|
|
|
- votequorum: Improve/add documentation for quorum device API
|
|
|
|
|
|
- votequorum: Add persistent expected_votes tracking.
|
|
|
|
|
|
- Upstream version cs: 45dd9861ff78362068d214cf520006a1b26376cd
|
|
|
|
|
|
|
2014-01-17 09:11:20 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Thu Jan 9 09:14:50 UTC 2014 - xli@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- Add patch to fix cts api wrong issue
|
|
|
|
|
|
+ corosync-cts-api-error.patch
|
|
|
|
|
|
- Add patch to change default settings of conf.example
|
|
|
|
|
|
+ corosync-conf-example.patch
|
|
|
|
|
|
|
2014-01-02 09:00:47 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Thu Dec 12 06:35:17 UTC 2013 - xli@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- Update to corosync 2.3.2
|
|
|
|
|
|
- cfgtool: return error on reload failure
|
|
|
|
|
|
- man pages: Note that votequorum's allow_downscale is unsupported
|
|
|
|
|
|
- logsys: Make logging of totem work again
|
|
|
|
|
|
- totemsrp: Show English message when memb_state_gather_enter is called
|
|
|
|
|
|
- totemiba: Check if configured MTU is allowed by HW
|
|
|
|
|
|
- totemiba: Fix parameters position for poll_add
|
|
|
|
|
|
- totemiba: Del channel fd from poll before destroy
|
|
|
|
|
|
- totemiba: Properly allocate RDMA buffers
|
2014-01-24 03:56:45 +01:00
|
|
|
|
- Upstream version cs: 7014f10123a634cf026491edc9a09d6044106116
|
2014-01-02 09:00:47 +01:00
|
|
|
|
|
2013-11-29 22:49:40 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Fri Nov 29 21:49:07 UTC 2013 - lmb@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- Obsolete openais so that updates work automatically and uninstall the
|
|
|
|
|
|
openais package.
|
|
|
|
|
|
|
2013-09-13 08:59:26 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Fri Sep 13 03:26:31 UTC 2013 - xli@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- Upstream version cs: c6688c6e11a35d13293f9b610faca5c7beb7e5cb
|
|
|
|
|
|
- Reload: document config.reload_in_progress in man page
|
|
|
|
|
|
- Reload: Add atomic reload to log config
|
|
|
|
|
|
- Reload: Add atomic reload to totemconfig
|
|
|
|
|
|
- Reload: Add reload code to cfg
|
|
|
|
|
|
- Reload: Make coroparse use a designated icmap hash table
|
|
|
|
|
|
- icmap: Add func to test equality of two key values
|
|
|
|
|
|
- [PATCH] Replace freopen with open/dup2 when daemonizing
|
|
|
|
|
|
- Add log message to exit signal handler
|
|
|
|
|
|
- icmap: Add map copy function
|
|
|
|
|
|
- icmap: Add function to return item data pointer
|
|
|
|
|
|
- icmap: Fix value len checking for strings
|
|
|
|
|
|
- icmap: Add function to return global icmap
|
|
|
|
|
|
- icmap: Allow multiple icmap instances
|
|
|
|
|
|
- Fix scheduler pause-detection timeout
|
|
|
|
|
|
|
2013-09-09 04:35:28 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Fri Sep 6 05:47:16 UTC 2013 - xli@suse.com
|
|
|
|
|
|
|
2013-09-13 08:59:26 +02:00
|
|
|
|
- Update corosync-2.3.1.tar.gz for cts file missing
|
2013-09-09 04:35:28 +02:00
|
|
|
|
|
2013-07-30 08:50:18 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Thu Jul 25 02:17:50 UTC 2013 - xli@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- Fix corosync start failed issue
|
2013-09-17 08:12:28 +02:00
|
|
|
|
+ corosync-init-lockfile-path-error.patch
|
2013-07-30 08:50:18 +02:00
|
|
|
|
|
2013-07-24 04:04:48 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Tue Jul 23 09:44:07 UTC 2013 - xli@suse.com
|
|
|
|
|
|
|
2013-09-17 08:12:28 +02:00
|
|
|
|
- Update to corosync 2.3.1 stable release
|
|
|
|
|
|
- Remove patches for all merged in the upstream or obsoleted
|
|
|
|
|
|
- corosync-confexample-timestamp.patch
|
|
|
|
|
|
- corosync-cpg-procdown.patch
|
|
|
|
|
|
- corosync-revert-cs2429.patch
|
|
|
|
|
|
- corosync.conf.example.patch
|
|
|
|
|
|
- corosync_reduce_RR_priority.patch
|
|
|
|
|
|
- fix-nodeid-conflicting.patch
|
2013-07-24 04:04:48 +02:00
|
|
|
|
|
2013-05-10 15:18:10 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Fri May 10 13:18:25 UTC 2013 - tserong@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- Update to corosync 1.4.5 stable release (bnc#799031)
|
|
|
|
|
|
- coroipc: Handle pfd.revents as bit-field
|
|
|
|
|
|
- Check socket_recv error code in ipc_dispatch_get
|
|
|
|
|
|
- On places with POLLERR check also POLLNVAL
|
|
|
|
|
|
- coroipc: Don't spin when waiting on semaphore
|
|
|
|
|
|
- log: Handle race in printf_to_logs and format_set
|
|
|
|
|
|
- objdb: Don't read uninitialized memory in inc/dec
|
|
|
|
|
|
- Add waiting_trans_ack also to fragmentation layer
|
|
|
|
|
|
- Handle segfault in backlog_get
|
|
|
|
|
|
- Fix problem with sync operations under very rare circumstances
|
|
|
|
|
|
- manpages: Add confdb_key_get man page
|
|
|
|
|
|
- manpages: Add links for referenced confdb calls
|
|
|
|
|
|
- manpages: Fix typo in evs* manpages
|
|
|
|
|
|
- If failed_to_recv is set, consensus can be empty
|
|
|
|
|
|
- Ignore sync barrier msgs if sync doesn't started
|
|
|
|
|
|
- Make service_build contain correct number of msgs
|
|
|
|
|
|
- Handle sync and service unload correctly
|
|
|
|
|
|
- Don't call sync_* funcs for unloaded services
|
|
|
|
|
|
- Return back "Totem is unable to form..." message
|
|
|
|
|
|
- Move "Totem is unable to form..." message to main
|
|
|
|
|
|
- Use unix socket for local multicast loop
|
|
|
|
|
|
- cpg: Enhance downlist selection algorithm
|
|
|
|
|
|
- cpg: Process join list after downlists
|
|
|
|
|
|
- cpg: Never choose downlist with localnode
|
|
|
|
|
|
- Fix cpg_membership_get()
|
|
|
|
|
|
- Don't access invalid mem in totemconfig
|
|
|
|
|
|
- Move some totem and cpg messages to trace level
|
|
|
|
|
|
- flatiron: Free outq items list on conn exit
|
|
|
|
|
|
- Fix nodeid conflicting issue (bnc#806634)
|
|
|
|
|
|
+ Added fix-nodeid-conflicting.patch
|
|
|
|
|
|
- change the default priority to RR(1) same as pacemaker(bnc#804707)
|
|
|
|
|
|
+ Added corosync_reduce_RR_priority.patch
|
|
|
|
|
|
|
2012-02-14 04:04:29 +01:00
|
|
|
|
-------------------------------------------------------------------
|
2013-04-26 12:07:01 +02:00
|
|
|
|
Thu Mar 21 11:59:58 UTC 2013 - mmeister@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- Added url as source.
|
|
|
|
|
|
Please see http://en.opensuse.org/SourceUrls
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
2012-06-15 12:07:43 +02:00
|
|
|
|
Fri Jun 8 07:46:10 UTC 2012 - tserong@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- Update to corosync 1.4.3 stable release.
|
|
|
|
|
|
- Add calls to missing object_find_destroy() to fix mem leaks
|
|
|
|
|
|
- Free mem allocated by getaddrinfo
|
|
|
|
|
|
- corosync.conf.example: change bindnetaddr, mcastaddr, add comments
|
|
|
|
|
|
- Store error str if can't open logfile
|
|
|
|
|
|
- Wait for corosync-notifyd exit in init script
|
|
|
|
|
|
- iba: Use configured node id
|
|
|
|
|
|
- Unlink shm buffers if init fails
|
|
|
|
|
|
- Fix memory leaks when nss fails
|
|
|
|
|
|
- Madvise NOSYNC flag only if available
|
|
|
|
|
|
- Include net/if_var.h header only when needed
|
|
|
|
|
|
- Include stdint.h because funcs uses int16_t
|
|
|
|
|
|
- Use install instead of cp
|
|
|
|
|
|
- Don't unlock mutex in different threads
|
|
|
|
|
|
- Revert "Use install instead of cp"
|
|
|
|
|
|
- Add support for per OS CP flags
|
|
|
|
|
|
- Remove cloned lines in main of main.c
|
|
|
|
|
|
- Fixed bug when corosync receive JoinMSG in OPERATIONAL state
|
|
|
|
|
|
- Correct nodeid of token when we retransmit it
|
|
|
|
|
|
- Correct nodeid in memb_state_commit_token_send function
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
2012-02-14 04:04:29 +01:00
|
|
|
|
Sun Feb 5 11:44:40 UTC 2012 - jjzhang@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- Send CPG_REASON_PROCDOWN when really needed (bnc#740343)
|
|
|
|
|
|
|
2011-09-20 15:51:29 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Tue Sep 20 13:15:22 UTC 2011 - tserong@suse.com
|
|
|
|
|
|
|
|
|
|
|
|
- Changes since corosync 1.4.1 stable release:
|
|
|
|
|
|
* Resolve a deadlock between the timer and serialize locks.
|
|
|
|
|
|
* totemconfig: change minimum RRP threshold
|
|
|
|
|
|
* Ignore memb_join messages during flush operations
|
|
|
|
|
|
* rrp: Higher threshold in passive mode for mcast (bnc#712037)
|
|
|
|
|
|
* rrp: Handle endless loop if all ifaces are faulty (bnc#712037)
|
|
|
|
|
|
* A CPG client can sometimes lockup if the local node is in the downlist
|
|
|
|
|
|
* Handle errors from totem_mcast
|
|
|
|
|
|
* coroipcc: use malloc for path in service_connect
|
|
|
|
|
|
* Version cs: 23112099e1c2b620e6976ca099d2b9afc80721aa
|
|
|
|
|
|
- corosync 1.4.1 stable release:
|
|
|
|
|
|
* main: let poll really stop before totempg_finalize
|
|
|
|
|
|
* totemsrp: fix buffer overflows for large clusters (> 100 nodes)
|
|
|
|
|
|
* rrp: Handle rollower in passive rrp properly
|
|
|
|
|
|
* rrp: handle rollover in active rrp properly
|
|
|
|
|
|
* totemconfig: Change default FAIL_TO_RECV_CONST
|
|
|
|
|
|
* Fix problem where corosync will segfault if there are gaps in recovery
|
|
|
|
|
|
queue
|
|
|
|
|
|
* cpgtool/cfgtool: print list of IP with space between items
|
|
|
|
|
|
* RRP: redundant ring automatic recovery (fate#310284)
|
|
|
|
|
|
* fix typos in cpg_mcast_joined.3 and cpg_zcb_mcast_joined.3
|
|
|
|
|
|
* Remove spinlocks
|
|
|
|
|
|
* confdb: Resolve dispatch deadlock
|
|
|
|
|
|
* RRP: Fix ring initialization issue for UDPU mode
|
|
|
|
|
|
* crypto: rng_make_prng prevent buf overflow
|
|
|
|
|
|
* cpg: do_proc_join change list_slice to list_add
|
|
|
|
|
|
* totemudp: memset of proper size
|
|
|
|
|
|
* coroipcs: init buf in coroipcs_handler_dispatch
|
|
|
|
|
|
* iazc: Reduce number of mem alloc and memcpy
|
|
|
|
|
|
* coroipcc: Fix unhandled BSD EOF in coroipcc_dispatch_get()
|
|
|
|
|
|
* cpg: fix sync master selection when one node paused
|
|
|
|
|
|
* totemsrp: Enhance mcast failure detection
|
|
|
|
|
|
* coroipcs: Deny connect to service without initfn
|
|
|
|
|
|
* Add ipc_refcnt to message_handler_req_{exec, lib}_cfg_ringreenable()
|
|
|
|
|
|
- corosync 1.3.1 release:
|
|
|
|
|
|
* corosync crashing when a network becomes disrupted and then restored
|
|
|
|
|
|
(bnc#685241)
|
|
|
|
|
|
* Align IPC on 8 byte boundaries for performance and avoid bus errors.
|
|
|
|
|
|
* Provide better checking of the message type.
|
|
|
|
|
|
* totemsrp: free messages originated in recovery rather then rely on
|
|
|
|
|
|
messages_free
|
|
|
|
|
|
* Resolve abort during simulatenous stopping of at least 4 nodes.
|
|
|
|
|
|
* Don't assert when ring id file is less then 8 bytes (possibly after
|
|
|
|
|
|
local fs problems).
|
|
|
|
|
|
* Handle delayed multicast packets that occur with switches.
|
|
|
|
|
|
* CPG: make sure coroipcc_service_disconnect() is always called.
|
|
|
|
|
|
* Fix abort when token is lost in RECOVERY state (bnc#677779)
|
|
|
|
|
|
|
2011-09-20 11:39:43 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Sat Sep 17 23:53:47 UTC 2011 - jengelh@medozas.de
|
|
|
|
|
|
|
|
|
|
|
|
- Remove redundant tags/sections from specfile
|
|
|
|
|
|
- Add baselibs configuration
|
|
|
|
|
|
|
2011-02-08 14:42:25 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Tue Feb 8 13:03:11 UTC 2011 - tserong@novell.com
|
|
|
|
|
|
|
|
|
|
|
|
- Update to corosync 1.3.0
|
|
|
|
|
|
- Set the max buffer size for sockets to reduce message dropping
|
|
|
|
|
|
- diags: add a mechanism to trigger the writing the flight data
|
|
|
|
|
|
- Add the UDPU transport (UDP transport for corosync)
|
|
|
|
|
|
- Remove delay in library on corosync shutdown
|
|
|
|
|
|
- Check for a properly configured multicast address.
|
|
|
|
|
|
- cpg: fix sync'ing the downlist.
|
|
|
|
|
|
- POLL: gracefully handle running out of file descriptors.
|
|
|
|
|
|
- Return CS_ERR_NO_RESOURCES when the server is low on available file
|
|
|
|
|
|
descriptors.
|
|
|
|
|
|
- Remove checking of subparameters in service.d files.
|
|
|
|
|
|
- Only allow corosync to run one copy via a lock file.
|
|
|
|
|
|
- When used with the openais ckpt service, don't disconnect an ipc
|
|
|
|
|
|
connection during configuration change that takes longer then 2
|
|
|
|
|
|
seconds.
|
|
|
|
|
|
- Remove the token cancel retransmit timeout on receipt of a multicast
|
|
|
|
|
|
message.
|
|
|
|
|
|
|
2010-12-02 16:10:16 +01:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Thu Aug 5 04:55:08 UTC 2010 - tserong@novell.com
|
|
|
|
|
|
|
|
|
|
|
|
- Update to corosync 1.2.7
|
|
|
|
|
|
- Remove consensus check for two node cluster cases which can have smaller
|
|
|
|
|
|
consensus values. Document in man page the behavior of consensus.
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Tue Jul 27 11:48:21 UTC 2010 - tserong@novell.com
|
|
|
|
|
|
|
|
|
|
|
|
- Fix problem where flow control could lock up ipc under very heavy load in
|
|
|
|
|
|
very rare circumstances (upstream cs 3003)
|
|
|
|
|
|
- SYNC: always call sync_aborted() in sync_confchg_fn() (upstream cs 3000)
|
|
|
|
|
|
- SYNCV2: reset the my_memb_determine_ring_id in sync_v2_memb_list_abort()
|
|
|
|
|
|
(upstream cs 2999)
|
|
|
|
|
|
- Fix logging_daemon config parser code (rhbz#615203) (upstream cs 2998)
|
|
|
|
|
|
- Remove reset of token timeout on retransmitted token reception. Fixes
|
|
|
|
|
|
membership problems with certain timing parametrs (upstream cs 2989)
|
|
|
|
|
|
- Speed up IPC connection process (upstream cs 2987)
|
|
|
|
|
|
- Fix fail list fault that occurs in very rare circumstances (upstream cs 2985)
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Thu Jul 22 03:31:59 UTC 2010 - tserong@novell.com
|
|
|
|
|
|
|
|
|
|
|
|
- Update to corosync 1.2.6
|
|
|
|
|
|
- 80% packet loss networks were resulting in problems with totem.
|
|
|
|
|
|
- Fixed ~40 scanning errors found with coverity.
|
|
|
|
|
|
- cpg_membership_get now functional.
|
|
|
|
|
|
- errors logged prior to the start of the daemon were not flushed.
|
|
|
|
|
|
- Fixes defects in logsys which are crashing pacemaker installations.
|
|
|
|
|
|
- Adds man pages for all binaries
|
|
|
|
|
|
- Fixes several defects found in high packet loss field environments.
|
|
|
|
|
|
- Send proper notification code of CPG_REASON_LEAVE in cpg service.
|
|
|
|
|
|
- Fix segfault when pacemaker forks new processes
|
|
|
|
|
|
- Unlock global serializer lock during shutdown to prevent spinning on
|
|
|
|
|
|
single cpu systems or high cpu use on mulitple cpu systems
|
|
|
|
|
|
- Stop totem statistics updater timer during shutdown to prevent a
|
|
|
|
|
|
segfault during shutdown.
|
|
|
|
|
|
- Fix problem where glibc's fork() implementation may cause segfaults in
|
|
|
|
|
|
Pacemaker's use of the fork() system call.
|
|
|
|
|
|
- Fix problem where a full /dev/shm would result in client segfault -
|
|
|
|
|
|
instead an error is returned in this situation.
|
|
|
|
|
|
- Fix problem where flight recorder leaks files in shared memory
|
|
|
|
|
|
filesystem. Also clean up the error handling of the shared memory
|
|
|
|
|
|
allocation code of the flight recorder.
|
|
|
|
|
|
- Fix problem where a failure in glibc's pathconf API would result in
|
|
|
|
|
|
segfault.
|
|
|
|
|
|
- Add corosync and corosync-blackbox man pages.
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Fri Jul 9 08:53:55 UTC 2010 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
|
|
- prevent corosync-cfgtool from hanging (bnc#616183)
|
|
|
|
|
|
|
2010-06-29 18:10:39 +02:00
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Wed Jun 2 11:53:28 UTC 2010 - tserong@novell.com
|
|
|
|
|
|
|
|
|
|
|
|
- Set sensible defaults for Pacemaker in corosync.conf.example (bnc#610663)
|
|
|
|
|
|
- Clarify bindnetaddr option in corosync.conf.5 manpage (upstream cs 2856)
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Mon May 10 14:59:13 UTC 2010 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
|
|
- Handle POLLNVAL in coroipcc
|
|
|
|
|
|
- Save the ring id and restore it properly when the recovery operation fails
|
|
|
|
|
|
- increase maximum entries in the retransmit queue when recovery takes place.
|
|
|
|
|
|
- fix one-off error in memove
|
|
|
|
|
|
- discard and report unknown messages
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Mon Apr 26 14:40:44 UTC 2010 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
|
|
- fix valgrind reported problems (upstream cs 2787)
|
|
|
|
|
|
- Memset for res_setup variable in coroipcs:req_setup_send
|
|
|
|
|
|
- Two memset in logsys for buffers
|
|
|
|
|
|
- Problem in corosync_totem_stats_updater where
|
|
|
|
|
|
avg_token_holdtime has size of avg_backlog_calc
|
|
|
|
|
|
- corosync_totem_stats_init where avg_backlog_calc is 32 bits (not 64)
|
|
|
|
|
|
- objdb problem if new_valie_len != object->value_len. In
|
|
|
|
|
|
such case newly allocated memory is not initialized and in some
|
|
|
|
|
|
situations, value_len is not updated.
|
|
|
|
|
|
- select a new sync member if the node with the lowest nodeid has
|
|
|
|
|
|
left (upstream cs 2785)
|
|
|
|
|
|
- fix a crash in YKD
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Fri Apr 9 15:09:11 UTC 2010 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
|
|
- clear the ring id on sync abort (bnc#590666)
|
|
|
|
|
|
- fix unloading of evs
|
|
|
|
|
|
- change sign of all exit codes (normal error exit is now 1)
|
|
|
|
|
|
- objdb: fix key change notifications (don't notify if the key
|
|
|
|
|
|
wasn't changed; notify on key inc/dec)
|
|
|
|
|
|
- fix possible lockup when a dispatch handler function is NULL
|
|
|
|
|
|
- upstream version cs 2756
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Mon Mar 29 14:15:43 UTC 2010 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
|
|
- fix lockup that occurs sometimes before exiting
|
|
|
|
|
|
- fix problem where retransmissions don't occur resulting in failure
|
|
|
|
|
|
to receive condition
|
|
|
|
|
|
- add a reload callback to libconfdb
|
|
|
|
|
|
- support for lib_cpg_finalize
|
|
|
|
|
|
- cpg join with undelivered leave message (fixes problems with nodes
|
|
|
|
|
|
joining cpg twice in quick succession)
|
|
|
|
|
|
- fix error handling to avoid segfaults/leaks on error
|
|
|
|
|
|
in coroipcc_service_connect
|
|
|
|
|
|
- upstream release 1.2.1
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Thu Mar 4 18:43:07 UTC 2010 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
|
|
- retain nodeid compatibility with openais (revert patch from cs 2429)
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Wed Mar 3 16:41:12 CST 2010 - jjzhang@novell.com
|
|
|
|
|
|
|
|
|
|
|
|
- minor enhancement to corosync.conf man page (bnc#580180)
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Tue Mar 2 22:01:26 UTC 2010 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
|
|
- upstream version cs 2667
|
|
|
|
|
|
- allow empty (default) consensus timeout
|
|
|
|
|
|
- fix freeze of IPC library connection on sem_wait
|
|
|
|
|
|
- fix malloc deadlock in signal handler (rhbz#547511)
|
|
|
|
|
|
- fix coroipcs message corruption that occurs when a message fills the
|
|
|
|
|
|
remainder of the dispatch buffer with a full message
|
|
|
|
|
|
- totemsrp: fix transitional configuration changes with long token timeouts
|
|
|
|
|
|
- remove a double list_del() when a tracking CFG client shuts down without
|
|
|
|
|
|
calling cfg_track_stop (it caused corosync to crash)
|
|
|
|
|
|
- use nodeid instead of localhost ip for the case when binding to a loalhost
|
|
|
|
|
|
interface
|
|
|
|
|
|
- fix corosync shutdown process
|
|
|
|
|
|
- add augeas lense for corosync.conf
|
|
|
|
|
|
- patch to set unset value in token hold cancel structure as to not crash
|
|
|
|
|
|
wireshark
|
|
|
|
|
|
- convert unsafe function to thread-safe reentrant equivalents
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Mon Feb 22 15:53:00 UTC 2010 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
|
|
- SP1 beta5 (no code changes)
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Mon Feb 8 14:53:31 UTC 2010 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
|
|
- turn timestamp off in corosync.conf.example (there was a problem
|
|
|
|
|
|
reported in connection with not thread-safe glibc functions used
|
|
|
|
|
|
in concert with this option, which hasn't yet been resolved)
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Wed Jan 27 13:44:58 UTC 2010 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
|
|
- add cs2646 patch from upstream, fixes cs2642
|
|
|
|
|
|
- add patch to accept on/off for the various log directives (bnc#573451)
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Thu Jan 21 14:21:44 UTC 2010 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
|
|
- %pre script moved to openais
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Mon Jan 18 16:36:24 UTC 2010 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
|
|
- remove init script
|
|
|
|
|
|
- add %pre script to copy openais.conf and authkey to /etc/corosync
|
|
|
|
|
|
- add patch 2642 (parser fix)
|
|
|
|
|
|
- fix some obsoletes/requires
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Mon Jan 11 16:08:35 UTC 2010 - lmb@novell.com
|
|
|
|
|
|
|
|
|
|
|
|
- Update to corosync 1.2.0.
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Tue Dec 29 10:23:21 UTC 2009 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
|
|
- init script changes:
|
|
|
|
|
|
+ replace killall with checkproc, otherwise corosync can't stop
|
|
|
|
|
|
+ test if sbd/lrmadmin exist, because corosync has no dependency
|
|
|
|
|
|
on cluster-glue
|
|
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
|
Tue Dec 15 15:27:37 UTC 2009 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
|
|
- update to the corosync upstream release 1.2.0
|
|
|
|
|
|
- add suse init script
|
|
|
|
|
|
- don't create rccorosync, because users should be using
|
|
|
|
|
|
rcopenais to start a cluster
|
|
|
|
|
|
- rename corosynclib to libcorosync4 (similar for the devel package)
|
|
|
|
|
|
(http://en.opensuse.org/Shared_Library_Packaging_Policy)
|
|
|
|
|
|
- Autotools generated version from the released upstream version 1.2.0
|
|
|
|
|
|
- some specfile changes (initddir -> initrddir, header)
|
