2017-08-03 05:20:08 +02:00
|
|
|
-------------------------------------------------------------------
|
2017-08-08 10:38:06 +02:00
|
|
|
Tue Aug 8 08:17:27 UTC 2017 - jengelh@inai.de
|
|
|
|
|
|
|
|
|
|
- Fix RPM groups.
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
2017-08-03 05:20:08 +02:00
|
|
|
Thu Aug 3 02:50:00 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
- L3: corosync: assert(sender_node != NULL) fails after tearing down a network interface(bsc#1032634)
|
|
|
|
|
Added: 0010-fix-ifdown-udp.patch
|
|
|
|
|
|
2017-08-16 08:29:09 +02:00
|
|
|
- Fix rpmlint warnings
|
|
|
|
|
Added: 0011-fix-tmpfiles-create.patch
|
|
|
|
|
|
2017-08-03 05:20:08 +02:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Thu Aug 3 02:49:21 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
- some errors in spec file(bsc#1047862)
|
|
|
|
|
Modified:corosync.spec
|
|
|
|
|
1) as in openSUSE:factory, there are %define, but bcond_with coudld be toggled by osc command , change %define to %bcond_with and %bcond_without
|
|
|
|
|
2) change service_del_postun to service_del_preun, since service_del_postun is not a right macro
|
|
|
|
|
|
|
|
|
|
|
2017-07-31 05:05:03 +02:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Mon Jul 31 02:54:49 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
- make corosync.spec uniform (bsc#1051385)
|
|
|
|
|
Modified: corosync.spec
|
|
|
|
|
1. there are some lines are commented in corosync.spec, will define new macro to make these lines uncommented
|
|
|
|
|
2. in former, xmlconf, rdma and snmp were disabled, these features are wrongly enabled, will disable them
|
|
|
|
|
|
2017-07-12 07:54:18 +02:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Wed Jul 12 05:25:45 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
- some upstream fixes for corosync(bsc#1048259)
|
|
|
|
|
Added:
|
|
|
|
|
bsc#1047860-add-version.patch
|
|
|
|
|
0007-Make-corosync-work-when-FIPS-mode-is-enabled.patch
|
|
|
|
|
0008-main.c-add-option-to-set-priority.patch
|
|
|
|
|
0009-totem-Propagate-totem-initialization-failure.patch
|
|
|
|
|
|
|
|
|
|
Removed:
|
|
|
|
|
bnc#867767-add-version.patch
|
|
|
|
|
0007-improve-corosync-keygen.patch(since this patch is not for corosync v2.x)
|
|
|
|
|
|
|
|
|
|
Modified:
|
|
|
|
|
corosync.spec, add judgement whether /etc/sysconfig/corosycn* exist before remove these files
|
|
|
|
|
|
2017-06-07 08:33:45 +02:00
|
|
|
-------------------------------------------------------------------
|
2017-07-10 09:25:50 +02:00
|
|
|
Mon Jul 10 06:54:23 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
- some errors in spec file(bsc#1047862)
|
|
|
|
|
Modified:
|
|
|
|
|
corosync.spec
|
|
|
|
|
|
|
|
|
|
- improvement for corosync-keygen(bsc#1047861)
|
|
|
|
|
Added:
|
|
|
|
|
0007-improve-corosync-keygen.patch
|
|
|
|
|
|
|
|
|
|
- 1047860corosync report wrong version number(bsc#1047860)
|
|
|
|
|
Modified:
|
|
|
|
|
bnc#867767-add-version.patch
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
2017-06-07 08:33:45 +02:00
|
|
|
Wed Jun 7 06:06:38 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
- some Fixes from upstream(bsc#1043045)
|
|
|
|
|
Added:
|
|
|
|
|
0004-main-Display-reason-why-cluster-cannot-be-formed.patch
|
|
|
|
|
0005-votequorum-Report-errors-from-votequorum_exec_send_r.patch
|
|
|
|
|
0006-coroapi-Use-size_t-for-private_data_size.patch
|
|
|
|
|
|
2017-06-06 11:16:50 +02:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Tue Jun 6 16:57:05 UTC 2017 - bliu@suse.com
|
|
|
|
|
[patch-lost-in-sle] Missing issues in openSUSE:Factory/corosync(bsc#1041587)
|
|
|
|
|
add change log for upgrading corosync to v2.3.6 and make this change log contain all records in SLE12 SP3
|
|
|
|
|
make the format consistent
|
|
|
|
|
|
2017-05-16 05:09:05 +02:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Tue May 16 03:05:05 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
- totemrrp: Fix situation when all rings are faulty(bsc#1039215)
|
2017-06-06 11:16:50 +02:00
|
|
|
Added:
|
|
|
|
|
0003-totemrrp-Fix-situation-when-all-rings-are-faulty.patch
|
2017-05-16 05:09:05 +02:00
|
|
|
|
2017-05-09 06:25:45 +02:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Tue May 9 04:17:35 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
- calling mlockall before corosync_tty_detach is noop when corosync is executed as a daemon(bsc#1038147)
|
2017-06-06 11:16:50 +02:00
|
|
|
Added:
|
|
|
|
|
0002-Main-call-mlock-after-fork.patch
|
2017-05-09 06:25:45 +02:00
|
|
|
|
2017-04-10 08:52:22 +02:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Mon Apr 10 06:42:51 UTC 2017 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
- [upgrade] Changing the pre-upgrade role for node failed(bsc#1030437)
|
2017-06-06 11:16:50 +02:00
|
|
|
Added:
|
|
|
|
|
0001-totemconfig.c-Fixed-Evicted-from-CPG-membership.patch
|
|
|
|
|
|
|
|
|
|
Removed:
|
|
|
|
|
0001-totemip.c-Fixed-Evicted-from-CPG-membership.patch
|
2017-04-10 08:52:22 +02:00
|
|
|
|
2017-03-01 03:46:00 +01:00
|
|
|
-------------------------------------------------------------------
|
2017-03-14 08:38:15 +01:00
|
|
|
Tue Mar 14 07:14:58 UTC 2017 - bliu@suse.com
|
2017-03-01 03:46:00 +01:00
|
|
|
|
|
|
|
|
- L3-Question: corosync logging priority takes no effect(bsc#1023959)
|
2017-06-06 11:16:50 +02:00
|
|
|
Added:
|
2017-03-01 03:46:00 +01:00
|
|
|
0001-Logsys-Change-logsys-syslog_priority-priority.patch
|
2017-03-14 08:38:15 +01:00
|
|
|
0001-logconfig.c-make-logging.syslog_priority-and-logging.patch
|
2017-03-01 03:46:00 +01:00
|
|
|
|
2016-12-06 09:55:27 +01:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Tue Dec 6 08:19:09 UTC 2016 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
- Corosync 2.4.1 still produces libvotequorum.so.7.0.0, just like Corosync 2.3.6.(bsc#1013842)
|
2017-06-06 11:16:50 +02:00
|
|
|
Added:
|
|
|
|
|
disable-build-html-docs.patch
|
|
|
|
|
|
|
|
|
|
upgrade to corosync-2.4.2:
|
2016-12-06 09:55:27 +01:00
|
|
|
Man: Fix corosync-qdevice-net-certutil link
|
|
|
|
|
man: mention qdevice incompatibilites in votequorum.5
|
|
|
|
|
Qnetd LMS: Fix two partition use case
|
|
|
|
|
cfg: Prevents use of uninitialized buffer
|
|
|
|
|
|
2016-11-01 10:46:52 +01:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Mon Oct 17 08:28:33 UTC 2016 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
- upgrade to corosync-2.4.1(bsc#1004967)
|
2017-06-06 11:16:50 +02:00
|
|
|
Added:
|
|
|
|
|
corosync-start-stop-level.patch
|
|
|
|
|
|
|
|
|
|
Deleted:
|
|
|
|
|
Config-Flag-config-uidgid-entries.patch
|
|
|
|
|
cfg-Prevents-use-of-uninitialized-buffer.patch
|
|
|
|
|
cts-Make-it-run-with-pacemaker-1.13.patch
|
|
|
|
|
get_cluster_mcast_addr-error-is-not-fatal.patch
|
|
|
|
|
totemsrp-Addition-of-the-log.patch
|
|
|
|
|
|
|
|
|
|
modified: bnc#867767-add-version.patch, change version to 2.4.1
|
|
|
|
|
corosync-2.4.1:
|
2016-11-01 10:46:52 +01:00
|
|
|
Low: totemsrp: Addition of the log.
|
|
|
|
|
cts: Make it run with pacemaker-1.13+
|
|
|
|
|
Config: Flag config uidgid entries
|
|
|
|
|
Spec: Qdevice require same version of corosync
|
|
|
|
|
|
2017-06-06 11:16:50 +02:00
|
|
|
corosync-2.4.0:
|
2016-11-01 10:46:52 +01:00
|
|
|
qdevice and qnet
|
|
|
|
|
config: get_cluster_mcast_addr error is not fatal
|
|
|
|
|
some typo fixes
|
2017-06-06 11:16:50 +02:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Thu Oct 15 05:19:36 UTC 2016 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
upgrade corosync-v2.3.5 to corosync-v2.3.6, and backport patches from v2.4.2(FATE#322113, bsc#1020550)
|
|
|
|
|
Added:
|
|
|
|
|
Config-Flag-config-uidgid-entries.patch
|
|
|
|
|
cfg-Prevents-use-of-uninitialized-buffer.patch
|
|
|
|
|
cts-Make-it-run-with-pacemaker-1.13.patch
|
|
|
|
|
get_cluster_mcast_addr-error-is-not-fatal.patch
|
|
|
|
|
totemsrp-Addition-of-the-log.patch
|
|
|
|
|
|
|
|
|
|
Removed:
|
|
|
|
|
corosync-cts-api-error.patch
|
|
|
|
|
|
|
|
|
|
v2.3.6
|
|
|
|
|
- logconfig: Fix logging reload disabling logfiles
|
|
|
|
|
- wd: Warn if values are out of range
|
|
|
|
|
- parser: WD Read type correctly from corosync.conf
|
|
|
|
|
- Add some more RO keys
|
|
|
|
|
- Reapply config defaults corosync.conf reload
|
|
|
|
|
- schedwrk: Cleanup and make it work on PPC BE
|
|
|
|
|
- cmapctl: Handle corosync errors in print_key func
|
|
|
|
|
- Adds doxygen stubs to include directory
|
|
|
|
|
- Add clang-format configuration file
|
|
|
|
|
- wd: make watchdog device configurable
|
|
|
|
|
- logging: Use our own version of basename
|
|
|
|
|
- logsys: fix TOTEM logging when corosync built out of tree
|
|
|
|
|
- parser: Make config file parser more hierarchy
|
|
|
|
|
- totemconfig: Explicitly pass IP version
|
|
|
|
|
- cpg: Handle ipc error in cpg_zcb_alloc/free
|
|
|
|
|
- cpg: Memory not unmapped in cpg_zcb_free
|
|
|
|
|
- totempg: Fix memory leak
|
|
|
|
|
- Fix spelling errors
|
|
|
|
|
- Add section in manual title for cpg_zcb_free 3
|
|
|
|
|
- Add section in manual title for cpg_zcb_alloc 3
|
|
|
|
|
- Update corosync.spec source link
|
|
|
|
|
- Update gitignore files
|
|
|
|
|
- Remove all links to old ML
|
|
|
|
|
- totemsrp: Fix clang warning (tautological compare)
|
|
|
|
|
- configure.ac: Make location of .pc overrideable
|
|
|
|
|
- Remove a few unused variables and functions
|
|
|
|
|
- configure.ac: We don't need no C++ compiler
|
|
|
|
|
- configure.ac: Remove deprecated AC_PROG_LIBTOOL
|
|
|
|
|
- configure.ac: make foreign apply to all Makefiles
|
|
|
|
|
- Remove unused, obsolete check
|
|
|
|
|
- Fix detection of qb_log_thread_priority_set
|
|
|
|
|
- cpghum: Fix type of recv_crc
|
|
|
|
|
- Check for fdatasync
|
|
|
|
|
- Fix detection of warning flags for clang
|
|
|
|
|
- quorum: Display node id as unsigned int.
|
|
|
|
|
- cts: InitClusterManager is now BootCluster
|
|
|
|
|
- totemudp: Move udp bind() so that multicast works with IPv6
|
|
|
|
|
- cfgtool: Display nodeid as unsigned int
|
|
|
|
|
- votequorum: Don't send multiple callbacks when nodes join
|
|
|
|
|
- man: Add synopsis for cpg_zcb_alloc and free
|
|
|
|
|
- man html index: Update index
|
|
|
|
|
- votequorum: Make sure cs_error_t is defined
|
|
|
|
|
- Doxygen fix for cmap_iter_next()
|
|
|
|
|
- configure: Correct help entry for logdir
|
|
|
|
|
- totmesrp: Fix typo in log message
|
|
|
|
|
- configure: typo in include
|
|
|
|
|
- man page: Correct option letter for DBus
|
|
|
|
|
- wd: fix setting of watchdog timeouts
|
|
|
|
|
- CFG: Prevent CFG orignating messages during SYNC
|
2016-11-01 10:46:52 +01:00
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Tue Sep 27 07:33:09 UTC 2016 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
- Default token timeout was 5000 ms in SLE 11 SP4, but is 1000 ms in SLE 12(bsc#1001164)
|
|
|
|
|
Added: bsc#1001164-corosync.conf-example.patch
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Wed Sep 7 07:35:12 UTC 2016 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
- Fix: [s390]Upgrade from SP1-GM + HA to SP2-RC2 +: Failed to start Corosync Cluster engine(bsc#996230)
|
|
|
|
|
- modify corosync.spec to remove "chkconfig --add"
|
|
|
|
|
- remove corosync-devel and require lines from baselibs.conf
|
|
|
|
|
|
2016-07-14 10:06:36 +02:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Thu Jul 14 07:59:03 UTC 2016 - bliu@suse.com
|
|
|
|
|
- corosync process still exists when stop pacemaker service(bnc#988683)
|
|
|
|
|
|
2015-07-28 02:52:54 +02:00
|
|
|
-------------------------------------------------------------------
|
2016-11-01 10:46:52 +01:00
|
|
|
Mon Aug 17 15:09:13 UTC 2015 - bliu@suse.com
|
|
|
|
|
- remove git files from tarball(bnc#941910)
|
2015-08-17 09:11:36 +02:00
|
|
|
- modify corosync.spec to delete logrotate.d
|
2015-07-28 02:52:54 +02:00
|
|
|
|
2015-07-27 04:51:30 +02:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Wed Jul 21 15:12:26 UTC 2015 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
update from v2.3.3 to v2.3.5 (bnc#939328)
|
|
|
|
|
v2.3.5
|
|
|
|
|
- Log: Add logrotate configuration file
|
|
|
|
|
- totemsrp: Improve logging of left/down nodes
|
|
|
|
|
- totemconfig: Check for duplicate nodeids
|
|
|
|
|
- Really add cpghum
|
|
|
|
|
- cpg: Add support for messages larger than 1Mb
|
|
|
|
|
- Handle adding and removing UDPU members atomically
|
|
|
|
|
|
2015-07-27 04:59:12 +02:00
|
|
|
- add patches:
|
|
|
|
|
* corosync-cts-api-error.patch
|
|
|
|
|
* bnc#867767-add-version.patch
|
|
|
|
|
|
2015-07-27 04:51:30 +02:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Wed Jul 1 17:30:22 UTC 2015 - bliu@suse.com
|
|
|
|
|
|
|
|
|
|
- mv the place of corosync.conf.example*(fate#318190)
|
|
|
|
|
|
2014-11-21 03:59:30 +01:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Wed Nov 19 22:24:13 UTC 2014 - dimstar@opensuse.org
|
|
|
|
|
|
|
|
|
|
- Replace systemd BuildRequires with pkgconfig(systemd): we do not
|
|
|
|
|
require the full installation / dep chain of systemd.
|
|
|
|
|
|
2014-11-21 03:58:32 +01:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Mon Nov 17 04:01:00 UTC 2014 - Led <ledest@gmail.com>
|
|
|
|
|
|
|
|
|
|
- fix bashisms in mem_leak_test.sh script
|
|
|
|
|
- add patches:
|
|
|
|
|
* corosync-2.3.4-fix-bashisms.patch
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Mon Nov 17 04:00:00 UTC 2014 - Led <ledest@gmail.com>
|
|
|
|
|
|
|
|
|
|
- fix bashism in preun script
|
|
|
|
|
|
2014-09-09 16:53:12 +02:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Mon Sep 1 08:01:50 UTC 2014 - xli@suse.com
|
|
|
|
|
|
|
|
|
|
- Update to corosync 2.3.4
|
|
|
|
|
- Drop the obsoleted patches
|
|
|
|
|
- corosync-cts-api-error.patch
|
|
|
|
|
- bnc#867767-add-version.patch
|
|
|
|
|
- bnc#881142-fix-shm-leak.patch
|
|
|
|
|
- quorumtool: Sort output by nodeid
|
|
|
|
|
- YKD: Fix loading of YKD quorum module
|
|
|
|
|
- corosync-quorumtool: add sort options
|
|
|
|
|
- cleanup after test-driver
|
|
|
|
|
- be consistent in using CPPFLAGS vs CFLAGS
|
|
|
|
|
- totemsrp: Fix typo with cont gather
|
|
|
|
|
- cpg: Refactor mh_req_exec_cpg_procleave
|
|
|
|
|
- cpg: Make sure nodid is always logged as hex num
|
|
|
|
|
- cpg: Make sure left nodes are really removed
|
|
|
|
|
- mon: Make mon compilable with libstatgrab ver 0.9
|
|
|
|
|
- mon: Fix comparsion typo
|
|
|
|
|
- mon: Pass correct pointer to inst
|
|
|
|
|
- mon: Make monitoring work
|
|
|
|
|
- config: Handle totem_set_volatile_defaults errors
|
|
|
|
|
- config: Allow dynamic change of token_coefficient
|
|
|
|
|
- Log: Make reload of logging work
|
|
|
|
|
- Really clear totemconfig nodes on reload
|
|
|
|
|
- Add token_coefficient option
|
|
|
|
|
- init: Make init script configurable
|
|
|
|
|
- totemiba: Fix incorrect failed log message
|
|
|
|
|
- logsys: Log error if blackbox cannot be created
|
|
|
|
|
- logsys: Log warning if flightrecorder init fails
|
|
|
|
|
- Introduce get_run_dir function
|
|
|
|
|
- Move ringid store and load from totem library
|
|
|
|
|
- coroparse: More strict numbers parsing
|
|
|
|
|
- Doc: Enhance INSTALL file a bit
|
|
|
|
|
- Make config.reload_in_progress key read only
|
|
|
|
|
- Fix compiler warning introduced by previous patch
|
|
|
|
|
- totemconfig: Free ifaddrs list
|
|
|
|
|
- totemconfig: Make sure join timeout is less than consensus
|
|
|
|
|
- totemconfig: Key change process dependencies
|
|
|
|
|
- totemconfig: Log errors on key change and reload
|
|
|
|
|
- totemconfig: totem_config_get_ip_version
|
|
|
|
|
- totemconfig: refactor nodelist_to_interface func
|
|
|
|
|
- corosync-keygen: Replace printf/exit call with err
|
|
|
|
|
- votequorum: Add cmap key to reset wait_for_all
|
|
|
|
|
- votequorum: Return current ring id in callback
|
|
|
|
|
- votequorum: Add ring id to poll call
|
|
|
|
|
- votequorum: Do not process events during reload
|
|
|
|
|
- votequorum: Block sync until qdevice poll
|
|
|
|
|
- votequorum: Make qdev timeout in sync configurable
|
|
|
|
|
- votequorum: Properly initialize atb and atb_string
|
|
|
|
|
- ipc: Process votequorum messages during sync
|
|
|
|
|
- testvotequorum2: Opt for polling with old ringid
|
|
|
|
|
- TODO: Remove TODO file
|
|
|
|
|
- Makefile: Do not install TODO file
|
|
|
|
|
- totem: Inform RRP about membership changes
|
|
|
|
|
- totemnet: Add totemnet_member_set_active
|
|
|
|
|
- totemrrp: Implement *_membership_changed
|
|
|
|
|
- totemudpu: Implement member_set_active
|
|
|
|
|
- totemudpu: Send msgs to all members occasionally
|
|
|
|
|
- Cancel token holding while in retransmition
|
|
|
|
|
- upstart: Make job conf file configurable
|
|
|
|
|
- systemd: Config example for corosync wd service
|
|
|
|
|
- Install doc: Correct a typo
|
|
|
|
|
- init: change return value when starting corosync
|
|
|
|
|
- Free object allocated at quorum_register_callback
|
|
|
|
|
- corosync-cmapctl: Allow -p option to delete keys
|
|
|
|
|
- Implement config file testing mode
|
|
|
|
|
- Slightly rework corosync-keygen.
|
|
|
|
|
- totemiba: Add multicast recovery
|
|
|
|
|
- Indent: Remove space in negation of expression
|
|
|
|
|
- Indent: Remove newline before else branch start
|
|
|
|
|
- fix memory leak produced by 'corosync -v'
|
|
|
|
|
- Handle SIGSEGV and SIGABRT signals
|
|
|
|
|
|
2014-07-03 07:28:11 +02:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Thu Jul 3 05:07:13 UTC 2014 - lzhong@suse.com
|
|
|
|
|
|
|
|
|
|
- comment out line: to_logfile:no (bnc#882449)
|
2014-09-09 16:53:12 +02:00
|
|
|
work on patch bnc#882449-corosync-conf-example.patch
|
2014-07-03 07:28:11 +02:00
|
|
|
|
2014-07-02 08:19:34 +02:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Wed Jul 2 05:48:47 UTC 2014 - yzou@suse.com
|
|
|
|
|
|
|
|
|
|
- Fixed shared memory leak.
|
2014-09-09 16:53:12 +02:00
|
|
|
+ bnc#881142-fix-shm-leak.patch
|
2014-07-02 08:19:34 +02:00
|
|
|
|
2014-07-02 07:27:10 +02:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Fri Jun 13 03:13:13 UTC 2014 - lzhong@suse.com
|
|
|
|
|
|
|
|
|
|
- Update corosync.conf.example and corosync.conf.example.udpu(bnc#882449)
|
2014-09-09 16:53:12 +02:00
|
|
|
- remove corosync-conf-example.patch
|
|
|
|
|
+ add bnc#882449-corosync-conf-example.patch
|
2014-07-02 07:27:10 +02:00
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
2014-04-11 10:27:04 +02:00
|
|
|
Fri Apr 11 06:50:17 UTC 2014 - lzhong@suse.com
|
|
|
|
|
|
|
|
|
|
- Fix `systemctl stop pacemaker` leaves corosync running
|
2014-09-09 16:53:12 +02:00
|
|
|
+ bnc#872651-stop-cluster.patch
|
2014-04-11 10:27:04 +02:00
|
|
|
- Ensure that libopenais3 is removed on update of corosync(bnc#872122)
|
|
|
|
|
|
2014-03-13 03:03:45 +01:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Wed Mar 12 08:41:21 UTC 2014 - lzhong@suse.com
|
|
|
|
|
|
2014-03-17 03:42:29 +01:00
|
|
|
- Modify spec file:add symlink rccorosync to /usr/sbin/service (bnc#866057)
|
2014-03-13 03:03:45 +01:00
|
|
|
- Fix corosync -v show UNKNOW (bnc#867767)
|
2014-09-09 16:53:12 +02:00
|
|
|
+ bnc#867767-add-version.patch
|
2014-03-13 03:03:45 +01:00
|
|
|
|
2014-01-24 03:56:45 +01:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Tue Jan 21 07:48:22 UTC 2014 - xli@suse.com
|
|
|
|
|
|
|
|
|
|
- Update to corosync 2.3.3
|
|
|
|
|
- Properly check result of symlink
|
|
|
|
|
- Fix cppchecks warning
|
|
|
|
|
- Close devnull file handler
|
|
|
|
|
- votequorum: Add missing man pages
|
|
|
|
|
- totem: Drop invalid join msg in operational state
|
|
|
|
|
- systemd unit: Make sure network is really up
|
|
|
|
|
- votequorum: Improve/add documentation for quorum device API
|
|
|
|
|
- votequorum: Add persistent expected_votes tracking.
|
|
|
|
|
- Upstream version cs: 45dd9861ff78362068d214cf520006a1b26376cd
|
|
|
|
|
|
2014-01-17 09:11:20 +01:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Thu Jan 9 09:14:50 UTC 2014 - xli@suse.com
|
|
|
|
|
|
|
|
|
|
- Add patch to fix cts api wrong issue
|
|
|
|
|
+ corosync-cts-api-error.patch
|
|
|
|
|
- Add patch to change default settings of conf.example
|
|
|
|
|
+ corosync-conf-example.patch
|
|
|
|
|
|
2014-01-02 09:00:47 +01:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Thu Dec 12 06:35:17 UTC 2013 - xli@suse.com
|
|
|
|
|
|
|
|
|
|
- Update to corosync 2.3.2
|
|
|
|
|
- cfgtool: return error on reload failure
|
|
|
|
|
- man pages: Note that votequorum's allow_downscale is unsupported
|
|
|
|
|
- logsys: Make logging of totem work again
|
|
|
|
|
- totemsrp: Show English message when memb_state_gather_enter is called
|
|
|
|
|
- totemiba: Check if configured MTU is allowed by HW
|
|
|
|
|
- totemiba: Fix parameters position for poll_add
|
|
|
|
|
- totemiba: Del channel fd from poll before destroy
|
|
|
|
|
- totemiba: Properly allocate RDMA buffers
|
2014-01-24 03:56:45 +01:00
|
|
|
- Upstream version cs: 7014f10123a634cf026491edc9a09d6044106116
|
2014-01-02 09:00:47 +01:00
|
|
|
|
2013-11-29 22:49:40 +01:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Fri Nov 29 21:49:07 UTC 2013 - lmb@suse.com
|
|
|
|
|
|
|
|
|
|
- Obsolete openais so that updates work automatically and uninstall the
|
|
|
|
|
openais package.
|
|
|
|
|
|
2013-09-13 08:59:26 +02:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Fri Sep 13 03:26:31 UTC 2013 - xli@suse.com
|
|
|
|
|
|
|
|
|
|
- Upstream version cs: c6688c6e11a35d13293f9b610faca5c7beb7e5cb
|
|
|
|
|
- Reload: document config.reload_in_progress in man page
|
|
|
|
|
- Reload: Add atomic reload to log config
|
|
|
|
|
- Reload: Add atomic reload to totemconfig
|
|
|
|
|
- Reload: Add reload code to cfg
|
|
|
|
|
- Reload: Make coroparse use a designated icmap hash table
|
|
|
|
|
- icmap: Add func to test equality of two key values
|
|
|
|
|
- [PATCH] Replace freopen with open/dup2 when daemonizing
|
|
|
|
|
- Add log message to exit signal handler
|
|
|
|
|
- icmap: Add map copy function
|
|
|
|
|
- icmap: Add function to return item data pointer
|
|
|
|
|
- icmap: Fix value len checking for strings
|
|
|
|
|
- icmap: Add function to return global icmap
|
|
|
|
|
- icmap: Allow multiple icmap instances
|
|
|
|
|
- Fix scheduler pause-detection timeout
|
|
|
|
|
|
2013-09-09 04:35:28 +02:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Fri Sep 6 05:47:16 UTC 2013 - xli@suse.com
|
|
|
|
|
|
2013-09-13 08:59:26 +02:00
|
|
|
- Update corosync-2.3.1.tar.gz for cts file missing
|
2013-09-09 04:35:28 +02:00
|
|
|
|
2013-07-30 08:50:18 +02:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Thu Jul 25 02:17:50 UTC 2013 - xli@suse.com
|
|
|
|
|
|
|
|
|
|
- Fix corosync start failed issue
|
2013-09-17 08:12:28 +02:00
|
|
|
+ corosync-init-lockfile-path-error.patch
|
2013-07-30 08:50:18 +02:00
|
|
|
|
2013-07-24 04:04:48 +02:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Tue Jul 23 09:44:07 UTC 2013 - xli@suse.com
|
|
|
|
|
|
2013-09-17 08:12:28 +02:00
|
|
|
- Update to corosync 2.3.1 stable release
|
|
|
|
|
- Remove patches for all merged in the upstream or obsoleted
|
|
|
|
|
- corosync-confexample-timestamp.patch
|
|
|
|
|
- corosync-cpg-procdown.patch
|
|
|
|
|
- corosync-revert-cs2429.patch
|
|
|
|
|
- corosync.conf.example.patch
|
|
|
|
|
- corosync_reduce_RR_priority.patch
|
|
|
|
|
- fix-nodeid-conflicting.patch
|
2013-07-24 04:04:48 +02:00
|
|
|
|
2013-05-10 15:18:10 +02:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Fri May 10 13:18:25 UTC 2013 - tserong@suse.com
|
|
|
|
|
|
|
|
|
|
- Update to corosync 1.4.5 stable release (bnc#799031)
|
|
|
|
|
- coroipc: Handle pfd.revents as bit-field
|
|
|
|
|
- Check socket_recv error code in ipc_dispatch_get
|
|
|
|
|
- On places with POLLERR check also POLLNVAL
|
|
|
|
|
- coroipc: Don't spin when waiting on semaphore
|
|
|
|
|
- log: Handle race in printf_to_logs and format_set
|
|
|
|
|
- objdb: Don't read uninitialized memory in inc/dec
|
|
|
|
|
- Add waiting_trans_ack also to fragmentation layer
|
|
|
|
|
- Handle segfault in backlog_get
|
|
|
|
|
- Fix problem with sync operations under very rare circumstances
|
|
|
|
|
- manpages: Add confdb_key_get man page
|
|
|
|
|
- manpages: Add links for referenced confdb calls
|
|
|
|
|
- manpages: Fix typo in evs* manpages
|
|
|
|
|
- If failed_to_recv is set, consensus can be empty
|
|
|
|
|
- Ignore sync barrier msgs if sync doesn't started
|
|
|
|
|
- Make service_build contain correct number of msgs
|
|
|
|
|
- Handle sync and service unload correctly
|
|
|
|
|
- Don't call sync_* funcs for unloaded services
|
|
|
|
|
- Return back "Totem is unable to form..." message
|
|
|
|
|
- Move "Totem is unable to form..." message to main
|
|
|
|
|
- Use unix socket for local multicast loop
|
|
|
|
|
- cpg: Enhance downlist selection algorithm
|
|
|
|
|
- cpg: Process join list after downlists
|
|
|
|
|
- cpg: Never choose downlist with localnode
|
|
|
|
|
- Fix cpg_membership_get()
|
|
|
|
|
- Don't access invalid mem in totemconfig
|
|
|
|
|
- Move some totem and cpg messages to trace level
|
|
|
|
|
- flatiron: Free outq items list on conn exit
|
|
|
|
|
- Fix nodeid conflicting issue (bnc#806634)
|
|
|
|
|
+ Added fix-nodeid-conflicting.patch
|
|
|
|
|
- change the default priority to RR(1) same as pacemaker(bnc#804707)
|
|
|
|
|
+ Added corosync_reduce_RR_priority.patch
|
|
|
|
|
|
2012-02-14 04:04:29 +01:00
|
|
|
-------------------------------------------------------------------
|
2013-04-26 12:07:01 +02:00
|
|
|
Thu Mar 21 11:59:58 UTC 2013 - mmeister@suse.com
|
|
|
|
|
|
|
|
|
|
- Added url as source.
|
|
|
|
|
Please see http://en.opensuse.org/SourceUrls
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
2012-06-15 12:07:43 +02:00
|
|
|
Fri Jun 8 07:46:10 UTC 2012 - tserong@suse.com
|
|
|
|
|
|
|
|
|
|
- Update to corosync 1.4.3 stable release.
|
|
|
|
|
- Add calls to missing object_find_destroy() to fix mem leaks
|
|
|
|
|
- Free mem allocated by getaddrinfo
|
|
|
|
|
- corosync.conf.example: change bindnetaddr, mcastaddr, add comments
|
|
|
|
|
- Store error str if can't open logfile
|
|
|
|
|
- Wait for corosync-notifyd exit in init script
|
|
|
|
|
- iba: Use configured node id
|
|
|
|
|
- Unlink shm buffers if init fails
|
|
|
|
|
- Fix memory leaks when nss fails
|
|
|
|
|
- Madvise NOSYNC flag only if available
|
|
|
|
|
- Include net/if_var.h header only when needed
|
|
|
|
|
- Include stdint.h because funcs uses int16_t
|
|
|
|
|
- Use install instead of cp
|
|
|
|
|
- Don't unlock mutex in different threads
|
|
|
|
|
- Revert "Use install instead of cp"
|
|
|
|
|
- Add support for per OS CP flags
|
|
|
|
|
- Remove cloned lines in main of main.c
|
|
|
|
|
- Fixed bug when corosync receive JoinMSG in OPERATIONAL state
|
|
|
|
|
- Correct nodeid of token when we retransmit it
|
|
|
|
|
- Correct nodeid in memb_state_commit_token_send function
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
2012-02-14 04:04:29 +01:00
|
|
|
Sun Feb 5 11:44:40 UTC 2012 - jjzhang@suse.com
|
|
|
|
|
|
|
|
|
|
- Send CPG_REASON_PROCDOWN when really needed (bnc#740343)
|
|
|
|
|
|
2011-09-20 15:51:29 +02:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Tue Sep 20 13:15:22 UTC 2011 - tserong@suse.com
|
|
|
|
|
|
|
|
|
|
- Changes since corosync 1.4.1 stable release:
|
|
|
|
|
* Resolve a deadlock between the timer and serialize locks.
|
|
|
|
|
* totemconfig: change minimum RRP threshold
|
|
|
|
|
* Ignore memb_join messages during flush operations
|
|
|
|
|
* rrp: Higher threshold in passive mode for mcast (bnc#712037)
|
|
|
|
|
* rrp: Handle endless loop if all ifaces are faulty (bnc#712037)
|
|
|
|
|
* A CPG client can sometimes lockup if the local node is in the downlist
|
|
|
|
|
* Handle errors from totem_mcast
|
|
|
|
|
* coroipcc: use malloc for path in service_connect
|
|
|
|
|
* Version cs: 23112099e1c2b620e6976ca099d2b9afc80721aa
|
|
|
|
|
- corosync 1.4.1 stable release:
|
|
|
|
|
* main: let poll really stop before totempg_finalize
|
|
|
|
|
* totemsrp: fix buffer overflows for large clusters (> 100 nodes)
|
|
|
|
|
* rrp: Handle rollower in passive rrp properly
|
|
|
|
|
* rrp: handle rollover in active rrp properly
|
|
|
|
|
* totemconfig: Change default FAIL_TO_RECV_CONST
|
|
|
|
|
* Fix problem where corosync will segfault if there are gaps in recovery
|
|
|
|
|
queue
|
|
|
|
|
* cpgtool/cfgtool: print list of IP with space between items
|
|
|
|
|
* RRP: redundant ring automatic recovery (fate#310284)
|
|
|
|
|
* fix typos in cpg_mcast_joined.3 and cpg_zcb_mcast_joined.3
|
|
|
|
|
* Remove spinlocks
|
|
|
|
|
* confdb: Resolve dispatch deadlock
|
|
|
|
|
* RRP: Fix ring initialization issue for UDPU mode
|
|
|
|
|
* crypto: rng_make_prng prevent buf overflow
|
|
|
|
|
* cpg: do_proc_join change list_slice to list_add
|
|
|
|
|
* totemudp: memset of proper size
|
|
|
|
|
* coroipcs: init buf in coroipcs_handler_dispatch
|
|
|
|
|
* iazc: Reduce number of mem alloc and memcpy
|
|
|
|
|
* coroipcc: Fix unhandled BSD EOF in coroipcc_dispatch_get()
|
|
|
|
|
* cpg: fix sync master selection when one node paused
|
|
|
|
|
* totemsrp: Enhance mcast failure detection
|
|
|
|
|
* coroipcs: Deny connect to service without initfn
|
|
|
|
|
* Add ipc_refcnt to message_handler_req_{exec, lib}_cfg_ringreenable()
|
|
|
|
|
- corosync 1.3.1 release:
|
|
|
|
|
* corosync crashing when a network becomes disrupted and then restored
|
|
|
|
|
(bnc#685241)
|
|
|
|
|
* Align IPC on 8 byte boundaries for performance and avoid bus errors.
|
|
|
|
|
* Provide better checking of the message type.
|
|
|
|
|
* totemsrp: free messages originated in recovery rather then rely on
|
|
|
|
|
messages_free
|
|
|
|
|
* Resolve abort during simulatenous stopping of at least 4 nodes.
|
|
|
|
|
* Don't assert when ring id file is less then 8 bytes (possibly after
|
|
|
|
|
local fs problems).
|
|
|
|
|
* Handle delayed multicast packets that occur with switches.
|
|
|
|
|
* CPG: make sure coroipcc_service_disconnect() is always called.
|
|
|
|
|
* Fix abort when token is lost in RECOVERY state (bnc#677779)
|
|
|
|
|
|
2011-09-20 11:39:43 +02:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Sat Sep 17 23:53:47 UTC 2011 - jengelh@medozas.de
|
|
|
|
|
|
|
|
|
|
- Remove redundant tags/sections from specfile
|
|
|
|
|
- Add baselibs configuration
|
|
|
|
|
|
2011-02-08 14:42:25 +01:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Tue Feb 8 13:03:11 UTC 2011 - tserong@novell.com
|
|
|
|
|
|
|
|
|
|
- Update to corosync 1.3.0
|
|
|
|
|
- Set the max buffer size for sockets to reduce message dropping
|
|
|
|
|
- diags: add a mechanism to trigger the writing the flight data
|
|
|
|
|
- Add the UDPU transport (UDP transport for corosync)
|
|
|
|
|
- Remove delay in library on corosync shutdown
|
|
|
|
|
- Check for a properly configured multicast address.
|
|
|
|
|
- cpg: fix sync'ing the downlist.
|
|
|
|
|
- POLL: gracefully handle running out of file descriptors.
|
|
|
|
|
- Return CS_ERR_NO_RESOURCES when the server is low on available file
|
|
|
|
|
descriptors.
|
|
|
|
|
- Remove checking of subparameters in service.d files.
|
|
|
|
|
- Only allow corosync to run one copy via a lock file.
|
|
|
|
|
- When used with the openais ckpt service, don't disconnect an ipc
|
|
|
|
|
connection during configuration change that takes longer then 2
|
|
|
|
|
seconds.
|
|
|
|
|
- Remove the token cancel retransmit timeout on receipt of a multicast
|
|
|
|
|
message.
|
|
|
|
|
|
2010-12-02 16:10:16 +01:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Thu Aug 5 04:55:08 UTC 2010 - tserong@novell.com
|
|
|
|
|
|
|
|
|
|
- Update to corosync 1.2.7
|
|
|
|
|
- Remove consensus check for two node cluster cases which can have smaller
|
|
|
|
|
consensus values. Document in man page the behavior of consensus.
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Tue Jul 27 11:48:21 UTC 2010 - tserong@novell.com
|
|
|
|
|
|
|
|
|
|
- Fix problem where flow control could lock up ipc under very heavy load in
|
|
|
|
|
very rare circumstances (upstream cs 3003)
|
|
|
|
|
- SYNC: always call sync_aborted() in sync_confchg_fn() (upstream cs 3000)
|
|
|
|
|
- SYNCV2: reset the my_memb_determine_ring_id in sync_v2_memb_list_abort()
|
|
|
|
|
(upstream cs 2999)
|
|
|
|
|
- Fix logging_daemon config parser code (rhbz#615203) (upstream cs 2998)
|
|
|
|
|
- Remove reset of token timeout on retransmitted token reception. Fixes
|
|
|
|
|
membership problems with certain timing parametrs (upstream cs 2989)
|
|
|
|
|
- Speed up IPC connection process (upstream cs 2987)
|
|
|
|
|
- Fix fail list fault that occurs in very rare circumstances (upstream cs 2985)
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Thu Jul 22 03:31:59 UTC 2010 - tserong@novell.com
|
|
|
|
|
|
|
|
|
|
- Update to corosync 1.2.6
|
|
|
|
|
- 80% packet loss networks were resulting in problems with totem.
|
|
|
|
|
- Fixed ~40 scanning errors found with coverity.
|
|
|
|
|
- cpg_membership_get now functional.
|
|
|
|
|
- errors logged prior to the start of the daemon were not flushed.
|
|
|
|
|
- Fixes defects in logsys which are crashing pacemaker installations.
|
|
|
|
|
- Adds man pages for all binaries
|
|
|
|
|
- Fixes several defects found in high packet loss field environments.
|
|
|
|
|
- Send proper notification code of CPG_REASON_LEAVE in cpg service.
|
|
|
|
|
- Fix segfault when pacemaker forks new processes
|
|
|
|
|
- Unlock global serializer lock during shutdown to prevent spinning on
|
|
|
|
|
single cpu systems or high cpu use on mulitple cpu systems
|
|
|
|
|
- Stop totem statistics updater timer during shutdown to prevent a
|
|
|
|
|
segfault during shutdown.
|
|
|
|
|
- Fix problem where glibc's fork() implementation may cause segfaults in
|
|
|
|
|
Pacemaker's use of the fork() system call.
|
|
|
|
|
- Fix problem where a full /dev/shm would result in client segfault -
|
|
|
|
|
instead an error is returned in this situation.
|
|
|
|
|
- Fix problem where flight recorder leaks files in shared memory
|
|
|
|
|
filesystem. Also clean up the error handling of the shared memory
|
|
|
|
|
allocation code of the flight recorder.
|
|
|
|
|
- Fix problem where a failure in glibc's pathconf API would result in
|
|
|
|
|
segfault.
|
|
|
|
|
- Add corosync and corosync-blackbox man pages.
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Fri Jul 9 08:53:55 UTC 2010 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
- prevent corosync-cfgtool from hanging (bnc#616183)
|
|
|
|
|
|
2010-06-29 18:10:39 +02:00
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Wed Jun 2 11:53:28 UTC 2010 - tserong@novell.com
|
|
|
|
|
|
|
|
|
|
- Set sensible defaults for Pacemaker in corosync.conf.example (bnc#610663)
|
|
|
|
|
- Clarify bindnetaddr option in corosync.conf.5 manpage (upstream cs 2856)
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Mon May 10 14:59:13 UTC 2010 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
- Handle POLLNVAL in coroipcc
|
|
|
|
|
- Save the ring id and restore it properly when the recovery operation fails
|
|
|
|
|
- increase maximum entries in the retransmit queue when recovery takes place.
|
|
|
|
|
- fix one-off error in memove
|
|
|
|
|
- discard and report unknown messages
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Mon Apr 26 14:40:44 UTC 2010 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
- fix valgrind reported problems (upstream cs 2787)
|
|
|
|
|
- Memset for res_setup variable in coroipcs:req_setup_send
|
|
|
|
|
- Two memset in logsys for buffers
|
|
|
|
|
- Problem in corosync_totem_stats_updater where
|
|
|
|
|
avg_token_holdtime has size of avg_backlog_calc
|
|
|
|
|
- corosync_totem_stats_init where avg_backlog_calc is 32 bits (not 64)
|
|
|
|
|
- objdb problem if new_valie_len != object->value_len. In
|
|
|
|
|
such case newly allocated memory is not initialized and in some
|
|
|
|
|
situations, value_len is not updated.
|
|
|
|
|
- select a new sync member if the node with the lowest nodeid has
|
|
|
|
|
left (upstream cs 2785)
|
|
|
|
|
- fix a crash in YKD
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Fri Apr 9 15:09:11 UTC 2010 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
- clear the ring id on sync abort (bnc#590666)
|
|
|
|
|
- fix unloading of evs
|
|
|
|
|
- change sign of all exit codes (normal error exit is now 1)
|
|
|
|
|
- objdb: fix key change notifications (don't notify if the key
|
|
|
|
|
wasn't changed; notify on key inc/dec)
|
|
|
|
|
- fix possible lockup when a dispatch handler function is NULL
|
|
|
|
|
- upstream version cs 2756
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Mon Mar 29 14:15:43 UTC 2010 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
- fix lockup that occurs sometimes before exiting
|
|
|
|
|
- fix problem where retransmissions don't occur resulting in failure
|
|
|
|
|
to receive condition
|
|
|
|
|
- add a reload callback to libconfdb
|
|
|
|
|
- support for lib_cpg_finalize
|
|
|
|
|
- cpg join with undelivered leave message (fixes problems with nodes
|
|
|
|
|
joining cpg twice in quick succession)
|
|
|
|
|
- fix error handling to avoid segfaults/leaks on error
|
|
|
|
|
in coroipcc_service_connect
|
|
|
|
|
- upstream release 1.2.1
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Thu Mar 4 18:43:07 UTC 2010 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
- retain nodeid compatibility with openais (revert patch from cs 2429)
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Wed Mar 3 16:41:12 CST 2010 - jjzhang@novell.com
|
|
|
|
|
|
|
|
|
|
- minor enhancement to corosync.conf man page (bnc#580180)
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Tue Mar 2 22:01:26 UTC 2010 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
- upstream version cs 2667
|
|
|
|
|
- allow empty (default) consensus timeout
|
|
|
|
|
- fix freeze of IPC library connection on sem_wait
|
|
|
|
|
- fix malloc deadlock in signal handler (rhbz#547511)
|
|
|
|
|
- fix coroipcs message corruption that occurs when a message fills the
|
|
|
|
|
remainder of the dispatch buffer with a full message
|
|
|
|
|
- totemsrp: fix transitional configuration changes with long token timeouts
|
|
|
|
|
- remove a double list_del() when a tracking CFG client shuts down without
|
|
|
|
|
calling cfg_track_stop (it caused corosync to crash)
|
|
|
|
|
- use nodeid instead of localhost ip for the case when binding to a loalhost
|
|
|
|
|
interface
|
|
|
|
|
- fix corosync shutdown process
|
|
|
|
|
- add augeas lense for corosync.conf
|
|
|
|
|
- patch to set unset value in token hold cancel structure as to not crash
|
|
|
|
|
wireshark
|
|
|
|
|
- convert unsafe function to thread-safe reentrant equivalents
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Mon Feb 22 15:53:00 UTC 2010 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
- SP1 beta5 (no code changes)
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Mon Feb 8 14:53:31 UTC 2010 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
- turn timestamp off in corosync.conf.example (there was a problem
|
|
|
|
|
reported in connection with not thread-safe glibc functions used
|
|
|
|
|
in concert with this option, which hasn't yet been resolved)
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Wed Jan 27 13:44:58 UTC 2010 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
- add cs2646 patch from upstream, fixes cs2642
|
|
|
|
|
- add patch to accept on/off for the various log directives (bnc#573451)
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Thu Jan 21 14:21:44 UTC 2010 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
- %pre script moved to openais
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Mon Jan 18 16:36:24 UTC 2010 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
- remove init script
|
|
|
|
|
- add %pre script to copy openais.conf and authkey to /etc/corosync
|
|
|
|
|
- add patch 2642 (parser fix)
|
|
|
|
|
- fix some obsoletes/requires
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Mon Jan 11 16:08:35 UTC 2010 - lmb@novell.com
|
|
|
|
|
|
|
|
|
|
- Update to corosync 1.2.0.
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Tue Dec 29 10:23:21 UTC 2009 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
- init script changes:
|
|
|
|
|
+ replace killall with checkproc, otherwise corosync can't stop
|
|
|
|
|
+ test if sbd/lrmadmin exist, because corosync has no dependency
|
|
|
|
|
on cluster-glue
|
|
|
|
|
|
|
|
|
|
-------------------------------------------------------------------
|
|
|
|
|
Tue Dec 15 15:27:37 UTC 2009 - dmuhamedagic@novell.com
|
|
|
|
|
|
|
|
|
|
- update to the corosync upstream release 1.2.0
|
|
|
|
|
- add suse init script
|
|
|
|
|
- don't create rccorosync, because users should be using
|
|
|
|
|
rcopenais to start a cluster
|
|
|
|
|
- rename corosynclib to libcorosync4 (similar for the devel package)
|
|
|
|
|
(http://en.opensuse.org/Shared_Library_Packaging_Policy)
|
|
|
|
|
- Autotools generated version from the released upstream version 1.2.0
|
|
|
|
|
- some specfile changes (initddir -> initrddir, header)
|
